Merge branch 'master' into portals
Conflicts: src/Blocks/WorldInterface.h src/ClientHandle.cpp src/ClientHandle.h src/Entities/Player.cpp src/Entities/Player.h src/Generating/FinishGen.cpp src/Protocol/Protocol.h src/Protocol/Protocol125.cpp src/Protocol/Protocol125.h src/Protocol/Protocol16x.cpp src/Protocol/Protocol16x.h src/Protocol/Protocol17x.cpp src/Protocol/Protocol17x.h src/Protocol/ProtocolRecognizer.cpp src/Protocol/ProtocolRecognizer.h src/Root.h src/World.cpp
This commit is contained in:
commit
37140ae578
1
.gitignore
vendored
1
.gitignore
vendored
|
@ -26,6 +26,7 @@ cloc.xsl
|
||||||
## Eclipse
|
## Eclipse
|
||||||
.cproject
|
.cproject
|
||||||
.project
|
.project
|
||||||
|
*.cbp
|
||||||
|
|
||||||
# world inside source
|
# world inside source
|
||||||
ChunkWorx.ini
|
ChunkWorx.ini
|
||||||
|
|
|
@ -62,7 +62,10 @@ add_subdirectory(lib/tolua++/)
|
||||||
add_subdirectory(lib/sqlite/)
|
add_subdirectory(lib/sqlite/)
|
||||||
add_subdirectory(lib/expat/)
|
add_subdirectory(lib/expat/)
|
||||||
add_subdirectory(lib/luaexpat/)
|
add_subdirectory(lib/luaexpat/)
|
||||||
add_subdirectory(lib/md5/)
|
|
||||||
|
if (WIN32)
|
||||||
|
add_subdirectory(lib/luaproxy/)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
|
||||||
# We use EXCLUDE_FROM_ALL so that only the explicit dependencies are used
|
# We use EXCLUDE_FROM_ALL so that only the explicit dependencies are used
|
||||||
|
|
|
@ -28,5 +28,6 @@ UltraCoderRU
|
||||||
worktycho
|
worktycho
|
||||||
xoft
|
xoft
|
||||||
Yeeeeezus (Donated AlchemistVillage prefabs)
|
Yeeeeezus (Donated AlchemistVillage prefabs)
|
||||||
|
Howaner
|
||||||
|
|
||||||
Please add yourself to this list if you contribute to MCServer.
|
Please add yourself to this list if you contribute to MCServer.
|
||||||
|
|
|
@ -1691,6 +1691,9 @@ a_Player:OpenWindow(Window);
|
||||||
TakeDamage = { Return = "" },
|
TakeDamage = { Return = "" },
|
||||||
KilledBy = { Return = "" },
|
KilledBy = { Return = "" },
|
||||||
GetHealth = { Return = "number" },
|
GetHealth = { Return = "number" },
|
||||||
|
AddEntityEffect = { Params = "EffectType, {{cEntityEffect}}", Return = "", Notes = "Applies an entity effect" },
|
||||||
|
RemoveEntityEffect = { Params = "EffectType", Return = "", Notes = "Removes a currently applied entity effect" },
|
||||||
|
ClearEntityEffects = { Return = "", Notes = "Removes all currently applied entity effects" },
|
||||||
},
|
},
|
||||||
Inherits = "cEntity",
|
Inherits = "cEntity",
|
||||||
}, -- cPawn
|
}, -- cPawn
|
||||||
|
@ -1875,9 +1878,9 @@ cPluginManager.AddHook(cPluginManager.HOOK_CHAT, OnChatMessage);
|
||||||
},
|
},
|
||||||
CallPlugin = { Params = "PluginName, FunctionName, [FunctionArgs...]", Return = "[FunctionRets]", Notes = "(STATIC) Calls the specified function in the specified plugin, passing all the given arguments to it. If it succeeds, it returns all the values returned by that function. If it fails, returns no value at all. Note that only strings, numbers, bools, nils and classes can be used for parameters and return values; tables and functions cannot be copied across plugins." },
|
CallPlugin = { Params = "PluginName, FunctionName, [FunctionArgs...]", Return = "[FunctionRets]", Notes = "(STATIC) Calls the specified function in the specified plugin, passing all the given arguments to it. If it succeeds, it returns all the values returned by that function. If it fails, returns no value at all. Note that only strings, numbers, bools, nils and classes can be used for parameters and return values; tables and functions cannot be copied across plugins." },
|
||||||
DisablePlugin = { Params = "PluginName", Return = "bool", Notes = "Disables a plugin specified by its name. Returns true if the plugin was disabled, false if it wasn't found or wasn't active." },
|
DisablePlugin = { Params = "PluginName", Return = "bool", Notes = "Disables a plugin specified by its name. Returns true if the plugin was disabled, false if it wasn't found or wasn't active." },
|
||||||
ExecuteCommand = { Params = "{{cPlayer|Player}}, CommandStr", Return = "bool", Notes = "Executes the command as if given by the specified Player. Checks permissions. Returns true if executed." },
|
ExecuteCommand = { Params = "{{cPlayer|Player}}, CommandStr", Return = "{{cPluginManager#CommandResult|CommandResult}}", Notes = "Executes the command as if given by the specified Player. Checks permissions." },
|
||||||
FindPlugins = { Params = "", Return = "", Notes = "Refreshes the list of plugins to include all folders inside the Plugins folder (potentially new disabled plugins)" },
|
FindPlugins = { Params = "", Return = "", Notes = "Refreshes the list of plugins to include all folders inside the Plugins folder (potentially new disabled plugins)" },
|
||||||
ForceExecuteCommand = { Params = "{{cPlayer|Player}}, CommandStr", Return = "bool", Notes = "Same as ExecuteCommand, but doesn't check permissions" },
|
ForceExecuteCommand = { Params = "{{cPlayer|Player}}, CommandStr", Return = "{{cPluginManager#CommandResult|CommandResult}}", Notes = "Same as ExecuteCommand, but doesn't check permissions" },
|
||||||
ForEachCommand = { Params = "CallbackFn", Return = "bool", Notes = "Calls the CallbackFn function for each command that has been bound using BindCommand(). The CallbackFn has the following signature: <pre class=\"prettyprint lang-lua\">function(Command, Permission, HelpString)</pre>. If the callback returns true, the enumeration is aborted and this API function returns false; if it returns false or no value, the enumeration continues with the next command, and the API function returns true." },
|
ForEachCommand = { Params = "CallbackFn", Return = "bool", Notes = "Calls the CallbackFn function for each command that has been bound using BindCommand(). The CallbackFn has the following signature: <pre class=\"prettyprint lang-lua\">function(Command, Permission, HelpString)</pre>. If the callback returns true, the enumeration is aborted and this API function returns false; if it returns false or no value, the enumeration continues with the next command, and the API function returns true." },
|
||||||
ForEachConsoleCommand = { Params = "CallbackFn", Return = "bool", Notes = "Calls the CallbackFn function for each command that has been bound using BindConsoleCommand(). The CallbackFn has the following signature: <pre class=\"prettyprint lang-lua\">function (Command, HelpString)</pre>. If the callback returns true, the enumeration is aborted and this API function returns false; if it returns false or no value, the enumeration continues with the next command, and the API function returns true." },
|
ForEachConsoleCommand = { Params = "CallbackFn", Return = "bool", Notes = "Calls the CallbackFn function for each command that has been bound using BindConsoleCommand(). The CallbackFn has the following signature: <pre class=\"prettyprint lang-lua\">function (Command, HelpString)</pre>. If the callback returns true, the enumeration is aborted and this API function returns false; if it returns false or no value, the enumeration continues with the next command, and the API function returns true." },
|
||||||
Get = { Params = "", Return = "cPluginManager", Notes = "(STATIC) Returns the single instance of the plugin manager" },
|
Get = { Params = "", Return = "cPluginManager", Notes = "(STATIC) Returns the single instance of the plugin manager" },
|
||||||
|
@ -1893,8 +1896,23 @@ cPluginManager.AddHook(cPluginManager.HOOK_CHAT, OnChatMessage);
|
||||||
LogStackTrace = { Params = "", Return = "", Notes = "(STATIC) Logs a current stack trace of the Lua engine to the server console log. Same format as is used when the plugin fails." },
|
LogStackTrace = { Params = "", Return = "", Notes = "(STATIC) Logs a current stack trace of the Lua engine to the server console log. Same format as is used when the plugin fails." },
|
||||||
ReloadPlugins = { Params = "", Return = "", Notes = "Reloads all active plugins" },
|
ReloadPlugins = { Params = "", Return = "", Notes = "Reloads all active plugins" },
|
||||||
},
|
},
|
||||||
|
ConstantGroups=
|
||||||
|
{
|
||||||
|
CommandResult =
|
||||||
|
{
|
||||||
|
Include = "^cr.*",
|
||||||
|
TextBefore = [[
|
||||||
|
Results that the (Force)ExecuteCommand return. This gives information if the command is executed or not and the reason.
|
||||||
|
]],
|
||||||
|
},
|
||||||
|
},
|
||||||
Constants =
|
Constants =
|
||||||
{
|
{
|
||||||
|
crBlocked = { Notes = "When a plugin stopped the command using the OnExecuteCommand hook" },
|
||||||
|
crError = { Notes = "When the command handler for the given command results in an error" },
|
||||||
|
crExecuted = { Notes = "When the command is successfully executed." },
|
||||||
|
crNoPermission = { Notes = "When the player doesn't have permission to execute the given command." },
|
||||||
|
crUnknownCommand = { Notes = "When the given command doesn't exist." },
|
||||||
HOOK_BLOCK_SPREAD = { Notes = "Called when a block spreads based on world conditions" },
|
HOOK_BLOCK_SPREAD = { Notes = "Called when a block spreads based on world conditions" },
|
||||||
HOOK_BLOCK_TO_PICKUPS = { Notes = "Called when a block has been dug and is being converted to pickups. The server has provided the default pickups and the plugins may modify them." },
|
HOOK_BLOCK_TO_PICKUPS = { Notes = "Called when a block has been dug and is being converted to pickups. The server has provided the default pickups and the plugins may modify them." },
|
||||||
HOOK_CHAT = { Notes = "Called when a client sends a chat message that is not a command. The plugin may modify the chat message" },
|
HOOK_CHAT = { Notes = "Called when a client sends a chat message that is not a command. The plugin may modify the chat message" },
|
||||||
|
@ -2325,6 +2343,7 @@ end
|
||||||
{ Params = "BlockX, BlockY, BlockZ, BlockMeta", Return = "", Notes = "Sets the meta for the block at the specified coords." },
|
{ Params = "BlockX, BlockY, BlockZ, BlockMeta", Return = "", Notes = "Sets the meta for the block at the specified coords." },
|
||||||
{ Params = "{{Vector3i|BlockCoords}}, BlockMeta", Return = "", Notes = "Sets the meta for the block at the specified coords." },
|
{ Params = "{{Vector3i|BlockCoords}}, BlockMeta", Return = "", Notes = "Sets the meta for the block at the specified coords." },
|
||||||
},
|
},
|
||||||
|
SetChunkAlwaysTicked = { Params = "ChunkX, ChunkZ, IsAlwaysTicked", Return = "", Notes = "Sets the chunk to always be ticked even when it doesn't contain any clients. IsAlwaysTicked set to true turns forced ticking on, set to false turns it off. Every call with 'true' should be paired with a later call with 'false', otherwise the ticking won't stop. Multiple actions can request ticking independently, the ticking will continue until the last call with 'false'. Note that when the chunk unloads, it loses the value of this flag." },
|
||||||
SetNextBlockTick = { Params = "BlockX, BlockY, BlockZ", Return = "", Notes = "Sets the blockticking to start at the specified block in the next tick." },
|
SetNextBlockTick = { Params = "BlockX, BlockY, BlockZ", Return = "", Notes = "Sets the blockticking to start at the specified block in the next tick." },
|
||||||
SetCommandBlockCommand = { Params = "BlockX, BlockY, BlockZ, Command", Return = "bool", Notes = "Sets the command to be executed in a command block at the specified coordinates. Returns if command was changed." },
|
SetCommandBlockCommand = { Params = "BlockX, BlockY, BlockZ, Command", Return = "bool", Notes = "Sets the command to be executed in a command block at the specified coordinates. Returns if command was changed." },
|
||||||
SetCommandBlocksEnabled = { Params = "IsEnabled (bool)", Return = "", Notes = "Sets whether command blocks should be enabled on the (entire) server." },
|
SetCommandBlocksEnabled = { Params = "IsEnabled (bool)", Return = "", Notes = "Sets whether command blocks should be enabled on the (entire) server." },
|
||||||
|
|
33
MCServer/Plugins/APIDump/Hooks/OnEntityAddEffect.lua
Normal file
33
MCServer/Plugins/APIDump/Hooks/OnEntityAddEffect.lua
Normal file
|
@ -0,0 +1,33 @@
|
||||||
|
return
|
||||||
|
{
|
||||||
|
HOOK_ENTITY_ADD_EFFECT =
|
||||||
|
{
|
||||||
|
CalledWhen = "An entity effect is about to get added to an entity.",
|
||||||
|
DefaultFnName = "OnEntityAddEffect", -- also used as pagename
|
||||||
|
Desc = [[
|
||||||
|
This hook is called whenever an entity effect is about to be added to an entity. The plugin may
|
||||||
|
disallow the addition by returning true.</p>
|
||||||
|
<p>Note that this hook only fires for adding the effect, but not for the actual effect application. See
|
||||||
|
also the {{OnEntityRemoveEffect|HOOK_ENTITY_REMOVE_EFFECT}} for notification about effects expiring /
|
||||||
|
removing, and {{OnEntityApplyEffect|HOOK_ENTITY_APPLY_EFFECT}} for the actual effect application to the
|
||||||
|
entity.
|
||||||
|
]],
|
||||||
|
Params =
|
||||||
|
{
|
||||||
|
{ Name = "Entity", Type = "{{cEntity}}", Notes = "The entity to which the effect is about to be added" },
|
||||||
|
{ Name = "EffectType", Type = "number", Notes = "The type of the effect to be added. One of the effXXX constants." },
|
||||||
|
{ Name = "EffectDuration", Type = "number", Notes = "The duration of the effect to be added, in ticks." },
|
||||||
|
{ Name = "EffectIntensity", Type = "number", Notes = "The intensity (level) of the effect to be added. " },
|
||||||
|
{ Name = "DistanceModifier", Type = "number", Notes = "The modifier for the effect intensity, based on distance. Used mainly for splash potions." },
|
||||||
|
},
|
||||||
|
Returns = [[
|
||||||
|
If the plugin returns true, the effect will not be added and none of the remaining hook handlers will
|
||||||
|
be called. If the plugin returns false, MCServer calls all the remaining hook handlers and finally
|
||||||
|
the effect is added to the entity.
|
||||||
|
]],
|
||||||
|
}, -- HOOK_EXECUTE_COMMAND
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
27
MCServer/Plugins/APIDump/Hooks/OnPlayerFoodLevelChange.lua
Normal file
27
MCServer/Plugins/APIDump/Hooks/OnPlayerFoodLevelChange.lua
Normal file
|
@ -0,0 +1,27 @@
|
||||||
|
return
|
||||||
|
{
|
||||||
|
HOOK_PLAYER_FOOD_LEVEL_CHANGE =
|
||||||
|
{
|
||||||
|
CalledWhen = "Called before the player food level changed. Plugin may override",
|
||||||
|
DefaultFnName = "OnPlayerFoodLevelChange", -- also used as pagename
|
||||||
|
Desc = [[
|
||||||
|
This hook is called before the food level changes.
|
||||||
|
The food level is not changed yet, plugins may choose
|
||||||
|
to refuse the change.
|
||||||
|
]],
|
||||||
|
Params =
|
||||||
|
{
|
||||||
|
{ Name = "Player", Type = "{{cPlayer}}", Notes = "The player who changes the food level." },
|
||||||
|
{ Name = "NewFoodLevel", Type = "number", Notes = "The new food level." },
|
||||||
|
},
|
||||||
|
Returns = [[
|
||||||
|
If the function returns false or no value, the next plugin's callback is called. Afterwards, the
|
||||||
|
server changes the food level of the player. If the function returns true, no
|
||||||
|
other callback is called for this event and the player's food level doesn't change.
|
||||||
|
]],
|
||||||
|
}, -- HOOK_PLAYER_FOOD_LEVEL_CHANGE
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -2,7 +2,7 @@ return
|
||||||
{
|
{
|
||||||
HOOK_PLAYER_USED_BLOCK =
|
HOOK_PLAYER_USED_BLOCK =
|
||||||
{
|
{
|
||||||
CalledWhen = "A player has just used a block (chest, furnace…). Notification only.",
|
CalledWhen = "A player has just used a block (chest, furnace...). Notification only.",
|
||||||
DefaultFnName = "OnPlayerUsedBlock", -- also used as pagename
|
DefaultFnName = "OnPlayerUsedBlock", -- also used as pagename
|
||||||
Desc = [[
|
Desc = [[
|
||||||
This hook is called after a {{cPlayer|player}} has right-clicked a block that can be used, such as a
|
This hook is called after a {{cPlayer|player}} has right-clicked a block that can be used, such as a
|
||||||
|
|
|
@ -6,7 +6,7 @@ return
|
||||||
DefaultFnName = "OnWeatherChanging", -- also used as pagename
|
DefaultFnName = "OnWeatherChanging", -- also used as pagename
|
||||||
Desc = [[
|
Desc = [[
|
||||||
This hook is called when the current weather has expired and a new weather is selected. Plugins may
|
This hook is called when the current weather has expired and a new weather is selected. Plugins may
|
||||||
override the new weather setting.</p>
|
override the new weather being set.</p>
|
||||||
<p>
|
<p>
|
||||||
The new weather setting is sent to the clients only after this hook has been processed.</p>
|
The new weather setting is sent to the clients only after this hook has been processed.</p>
|
||||||
<p>
|
<p>
|
||||||
|
@ -19,9 +19,12 @@ return
|
||||||
{ Name = "Weather", Type = "number", Notes = "The newly selected weather. One of wSunny, wRain, wStorm" },
|
{ Name = "Weather", Type = "number", Notes = "The newly selected weather. One of wSunny, wRain, wStorm" },
|
||||||
},
|
},
|
||||||
Returns = [[
|
Returns = [[
|
||||||
If the function returns false or no value, the server calls other plugins' callbacks and finally
|
The hook handler can return up to two values. If the first value is false or not present, the server
|
||||||
sets the weather. If the function returns true, the server takes the second returned value (wSunny
|
calls other plugins' callbacks and finally sets the weather. If it is true, the server doesn't call any
|
||||||
by default) and sets it as the new weather. No other plugins' callbacks are called in this case.
|
more callbacks for this hook. The second value returned is used as the new weather. If no value is
|
||||||
|
given, the weather from the parameters is used as the weather. Returning false as the first value and a
|
||||||
|
specific weather constant as the second value makes the server call the rest of the hook handlers with
|
||||||
|
the new weather value.
|
||||||
]],
|
]],
|
||||||
}, -- HOOK_WEATHER_CHANGING
|
}, -- HOOK_WEATHER_CHANGING
|
||||||
}
|
}
|
||||||
|
|
|
@ -31,6 +31,8 @@ function Initialize(Plugin)
|
||||||
PM:AddHook(cPluginManager.HOOK_PLUGIN_MESSAGE, OnPluginMessage);
|
PM:AddHook(cPluginManager.HOOK_PLUGIN_MESSAGE, OnPluginMessage);
|
||||||
PM:AddHook(cPluginManager.HOOK_PLAYER_JOINED, OnPlayerJoined);
|
PM:AddHook(cPluginManager.HOOK_PLAYER_JOINED, OnPlayerJoined);
|
||||||
PM:AddHook(cPluginManager.HOOK_PROJECTILE_HIT_BLOCK, OnProjectileHitBlock);
|
PM:AddHook(cPluginManager.HOOK_PROJECTILE_HIT_BLOCK, OnProjectileHitBlock);
|
||||||
|
PM:AddHook(cPluginManager.HOOK_CHUNK_UNLOADING, OnChunkUnloading);
|
||||||
|
PM:AddHook(cPluginManager.HOOK_WORLD_STARTED, OnWorldStarted);
|
||||||
|
|
||||||
-- _X: Disabled so that the normal operation doesn't interfere with anything
|
-- _X: Disabled so that the normal operation doesn't interfere with anything
|
||||||
-- PM:AddHook(cPluginManager.HOOK_CHUNK_GENERATED, OnChunkGenerated);
|
-- PM:AddHook(cPluginManager.HOOK_CHUNK_GENERATED, OnChunkGenerated);
|
||||||
|
@ -1382,6 +1384,7 @@ end
|
||||||
|
|
||||||
|
|
||||||
function OnProjectileHitBlock(a_Projectile, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_BlockHitPos)
|
function OnProjectileHitBlock(a_Projectile, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_BlockHitPos)
|
||||||
|
-- Test projectile hooks by setting the blocks they hit on fire:
|
||||||
local BlockX, BlockY, BlockZ = AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace)
|
local BlockX, BlockY, BlockZ = AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace)
|
||||||
local World = a_Projectile:GetWorld()
|
local World = a_Projectile:GetWorld()
|
||||||
|
|
||||||
|
@ -1391,3 +1394,28 @@ end
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
function OnChunkUnloading(a_World, a_ChunkX, a_ChunkZ)
|
||||||
|
-- Do not let chunk [0, 0] unload, so that it continues ticking [cWorld:SetChunkAlwaysTicked() test]
|
||||||
|
if ((a_ChunkX == 0) and (a_ChunkZ == 0)) then
|
||||||
|
return true
|
||||||
|
end
|
||||||
|
end
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
function OnWorldStarted(a_World)
|
||||||
|
-- Make the chunk [0, 0] in every world keep ticking [cWorld:SetChunkAlwaysTicked() test]
|
||||||
|
a_World:ChunkStay({{0, 0}}, nil,
|
||||||
|
function()
|
||||||
|
-- The chunk is loaded, make it always tick:
|
||||||
|
a_World:SetChunkAlwaysTicked(0, 0, true)
|
||||||
|
end
|
||||||
|
)
|
||||||
|
end
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -22,6 +22,8 @@ function Initialize(Plugin)
|
||||||
Plugin:SetVersion(1);
|
Plugin:SetVersion(1);
|
||||||
|
|
||||||
cPluginManager.AddHook(cPluginManager.HOOK_PLAYER_USED_ITEM, OnPlayerUsedItem);
|
cPluginManager.AddHook(cPluginManager.HOOK_PLAYER_USED_ITEM, OnPlayerUsedItem);
|
||||||
|
|
||||||
|
LOG("Initialized " .. Plugin:GetName() .. " v." .. Plugin:GetVersion());
|
||||||
return true;
|
return true;
|
||||||
end
|
end
|
||||||
|
|
||||||
|
@ -36,8 +38,8 @@ function OnPlayerUsedItem(Player, BlockX, BlockY, BlockZ, BlockFace, CursorX, Cu
|
||||||
return false;
|
return false;
|
||||||
end;
|
end;
|
||||||
|
|
||||||
if (Player:HasPermission("diamondmover.move") == false) then
|
if (not Player:HasPermission("diamondmover.move")) then
|
||||||
return true;
|
return false;
|
||||||
end;
|
end;
|
||||||
|
|
||||||
-- Rclk with a diamond to push in the direction the player is facing
|
-- Rclk with a diamond to push in the direction the player is facing
|
||||||
|
@ -56,7 +58,7 @@ function OnPlayerUsedItem(Player, BlockX, BlockY, BlockZ, BlockFace, CursorX, Cu
|
||||||
if (PlayerPitch > 70) then -- looking down
|
if (PlayerPitch > 70) then -- looking down
|
||||||
BlockY = BlockY - 1;
|
BlockY = BlockY - 1;
|
||||||
else
|
else
|
||||||
local PlayerRot = Player:GetRotation() + 180; -- Convert [-180, 180] into [0, 360] for simpler conditions
|
local PlayerRot = Player:GetYaw() + 180; -- Convert [-180, 180] into [0, 360] for simpler conditions
|
||||||
if ((PlayerRot < 45) or (PlayerRot > 315)) then
|
if ((PlayerRot < 45) or (PlayerRot > 315)) then
|
||||||
BlockZ = BlockZ - 1;
|
BlockZ = BlockZ - 1;
|
||||||
else
|
else
|
||||||
|
|
Binary file not shown.
|
@ -5,7 +5,7 @@ MCServer is a Minecraft server that is written in C++ and designed to be efficie
|
||||||
|
|
||||||
MCServer can run on PCs, Macs, and *nix. This includes android phones and tablets as well as Raspberry Pis.
|
MCServer can run on PCs, Macs, and *nix. This includes android phones and tablets as well as Raspberry Pis.
|
||||||
|
|
||||||
We currently support the protocol from Minecraft 1.2 all the way up to Minecraft 1.7.9.
|
We currently support the protocol from Minecraft 1.2 all the way up to Minecraft 1.7.10.
|
||||||
|
|
||||||
Installation
|
Installation
|
||||||
------------
|
------------
|
||||||
|
|
|
@ -26,10 +26,18 @@ endmacro()
|
||||||
|
|
||||||
|
|
||||||
macro(set_flags)
|
macro(set_flags)
|
||||||
# Add the preprocessor macros used for distinguishing between debug and release builds (CMake does this automatically for MSVC):
|
# Add coverage processing, if requested:
|
||||||
if (NOT MSVC)
|
if (NOT MSVC)
|
||||||
|
|
||||||
|
if (CMAKE_BUILD_TYPE STREQUAL "COVERAGE")
|
||||||
|
message("Including CodeCoverage")
|
||||||
set(CMAKE_MODULE_PATH ${CMAKE_MODULE_PATH} "${CMAKE_SOURCE_DIR}/lib/cmake-coverage/")
|
set(CMAKE_MODULE_PATH ${CMAKE_MODULE_PATH} "${CMAKE_SOURCE_DIR}/lib/cmake-coverage/")
|
||||||
include(CodeCoverage)
|
include(CodeCoverage)
|
||||||
|
endif()
|
||||||
|
endif()
|
||||||
|
|
||||||
|
# Add the preprocessor macros used for distinguishing between debug and release builds (CMake does this automatically for MSVC):
|
||||||
|
if (NOT MSVC)
|
||||||
set(CMAKE_CXX_FLAGS_DEBUG "${CMAKE_CXX_FLAGS_DEBUG} -D_DEBUG")
|
set(CMAKE_CXX_FLAGS_DEBUG "${CMAKE_CXX_FLAGS_DEBUG} -D_DEBUG")
|
||||||
set(CMAKE_C_FLAGS_DEBUG "${CMAKE_C_FLAGS_DEBUG} -D_DEBUG")
|
set(CMAKE_C_FLAGS_DEBUG "${CMAKE_C_FLAGS_DEBUG} -D_DEBUG")
|
||||||
set(CMAKE_CXX_FLAGS_COVERAGE "${CMAKE_CXX_FLAGS_COVERAGE} -D_DEBUG")
|
set(CMAKE_CXX_FLAGS_COVERAGE "${CMAKE_CXX_FLAGS_COVERAGE} -D_DEBUG")
|
||||||
|
@ -63,7 +71,11 @@ macro(set_flags)
|
||||||
|
|
||||||
else()
|
else()
|
||||||
# Let gcc / clang know that we're compiling a multi-threaded app:
|
# Let gcc / clang know that we're compiling a multi-threaded app:
|
||||||
|
if (UNIX)
|
||||||
add_flags_cxx("-pthread")
|
add_flags_cxx("-pthread")
|
||||||
|
endif()
|
||||||
|
|
||||||
|
# Make CLang use C++11, otherwise MSVC2008-supported extensions don't work ("override" keyword etc.):
|
||||||
if ("${CMAKE_CXX_COMPILER_ID}" STREQUAL "Clang")
|
if ("${CMAKE_CXX_COMPILER_ID}" STREQUAL "Clang")
|
||||||
set(CMAKE_CXX_FLAGS "${CMAKE_CXX_FLAGS} -std=c++11")
|
set(CMAKE_CXX_FLAGS "${CMAKE_CXX_FLAGS} -std=c++11")
|
||||||
set(CMAKE_CXX_FLAGS_DEBUG "${CMAKE_CXX_FLAGS_DEBUG} -std=c++11")
|
set(CMAKE_CXX_FLAGS_DEBUG "${CMAKE_CXX_FLAGS_DEBUG} -std=c++11")
|
||||||
|
|
|
@ -11,21 +11,16 @@ file(GLOB SOURCE
|
||||||
list(REMOVE_ITEM SOURCE "${PROJECT_SOURCE_DIR}/src/lua.c" "${PROJECT_SOURCE_DIR}/src/luac.c")
|
list(REMOVE_ITEM SOURCE "${PROJECT_SOURCE_DIR}/src/lua.c" "${PROJECT_SOURCE_DIR}/src/luac.c")
|
||||||
|
|
||||||
# add headers to MSVC project files:
|
# add headers to MSVC project files:
|
||||||
if (WIN32)
|
if (MSVC)
|
||||||
file(GLOB HEADERS "src/*.h")
|
file(GLOB HEADERS "src/*.h")
|
||||||
list(REMOVE_ITEM SOURCE "${PROJECT_SOURCE_DIR}/src/lua.h" "${PROJECT_SOURCE_DIR}/src/luac.h")
|
list(REMOVE_ITEM SOURCE "${PROJECT_SOURCE_DIR}/src/lua.h" "${PROJECT_SOURCE_DIR}/src/luac.h")
|
||||||
set(SOURCE ${SOURCE} ${HEADERS})
|
set(SOURCE ${SOURCE} ${HEADERS})
|
||||||
source_group("Sources" FILES ${SOURCE})
|
source_group("Sources" FILES ${SOURCE})
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
|
|
||||||
# Lua needs to be linked dynamically on Windows and statically on *nix, so that LuaRocks work
|
# Lua needs to be linked dynamically on Windows and statically on *nix, so that LuaRocks work
|
||||||
if (WIN32)
|
if (WIN32)
|
||||||
|
|
||||||
#for compiliers other than msvc we need to tell lua that its building as a dll
|
|
||||||
if (NOT MSVC)
|
|
||||||
add_flags_cxx(-DLUA_BUILD_AS_DLL=1)
|
|
||||||
endif()
|
|
||||||
|
|
||||||
add_library(lua SHARED ${SOURCE})
|
add_library(lua SHARED ${SOURCE})
|
||||||
set(LIBRARY_OUTPUT_PATH ${CMAKE_SOURCE_DIR}/MCServer)
|
set(LIBRARY_OUTPUT_PATH ${CMAKE_SOURCE_DIR}/MCServer)
|
||||||
|
|
||||||
|
@ -53,7 +48,7 @@ if (WIN32)
|
||||||
)
|
)
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
set_target_properties(lua PROPERTIES OUTPUT_NAME "lua51")
|
set_target_properties(lua PROPERTIES OUTPUT_NAME "lua51" PREFIX "")
|
||||||
|
|
||||||
# NOTE: The DLL for each configuration is stored at the same place, thus overwriting each other.
|
# NOTE: The DLL for each configuration is stored at the same place, thus overwriting each other.
|
||||||
# This is known, however such behavior is needed for LuaRocks - they always load "lua5.1.dll" or "lua51.dll"
|
# This is known, however such behavior is needed for LuaRocks - they always load "lua5.1.dll" or "lua51.dll"
|
||||||
|
@ -63,6 +58,7 @@ else()
|
||||||
add_library(lua ${SOURCE})
|
add_library(lua ${SOURCE})
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
|
|
||||||
# Tell Lua what dynamic loader to use (for LuaRocks):
|
# Tell Lua what dynamic loader to use (for LuaRocks):
|
||||||
if (UNIX)
|
if (UNIX)
|
||||||
add_definitions(-DLUA_USE_DLOPEN)
|
add_definitions(-DLUA_USE_DLOPEN)
|
||||||
|
|
61
lib/luaproxy/CMakeLists.txt
Normal file
61
lib/luaproxy/CMakeLists.txt
Normal file
|
@ -0,0 +1,61 @@
|
||||||
|
|
||||||
|
# This project adds a Lua Proxy DLL on Windows
|
||||||
|
# By an unfortunate choice in the popular LuaBinaries distribution, there are two names for the Lua DLL on Windows: lua51.dll and lua5.1.dll.
|
||||||
|
# Some binary Lua packages are built for one, the others for the other. Messy!
|
||||||
|
# In order to support both package flavors, we create a "proxy DLL":
|
||||||
|
# Basically the lua5.1.dll has its PE Exports section manipulated so that it points each exported function to its lua51.dll implementation.
|
||||||
|
# Effectively, this forwards all calls from lua5.1.dll to lua51.dll without any performance costs (the forwarding is done in the Windows PE loader on app start).
|
||||||
|
|
||||||
|
# This project creates the proxy DLL by using a specially crafted .DEF file that is used to link the Proxy DLL.
|
||||||
|
# Note that it has been tested only on MSVC, it might not work with other compilers.
|
||||||
|
# The initial implementation was taken from http://lua-users.org/wiki/LuaProxyDllFour , but adapted to MSVC
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
if (WIN32)
|
||||||
|
|
||||||
|
if (MSVC)
|
||||||
|
# Tell the linker to use the DEF file to generate the proxy:
|
||||||
|
set(CMAKE_EXE_LINKER_FLAGS_RELEASE "${CMAKE_EXE_LINKER_FLAGS_RELEASE} /NOENTRY /DEF:lua5.1.def /MANIFEST:NO")
|
||||||
|
set(CMAKE_SHARED_LINKER_FLAGS_RELEASE "${CMAKE_SHARED_LINKER_FLAGS_RELEASE} /NOENTRY /DEF:lua5.1.def /MANIFEST:NO")
|
||||||
|
set(CMAKE_MODULE_LINKER_FLAGS_RELEASE "${CMAKE_MODULE_LINKER_FLAGS_RELEASE} /NOENTRY /DEF:lua5.1.def /MANIFEST:NO")
|
||||||
|
set(CMAKE_EXE_LINKER_FLAGS_DEBUG "${CMAKE_EXE_LINKER_FLAGS_DEBUG} /NOENTRY /DEF:lua5.1.def /MANIFEST:NO")
|
||||||
|
set(CMAKE_SHARED_LINKER_FLAGS_DEBUG "${CMAKE_SHARED_LINKER_FLAGS_DEBUG} /NOENTRY /DEF:lua5.1.def /MANIFEST:NO")
|
||||||
|
set(CMAKE_MODULE_LINKER_FLAGS_DEBUG "${CMAKE_MODULE_LINKER_FLAGS_DEBUG} /NOENTRY /DEF:lua5.1.def /MANIFEST:NO")
|
||||||
|
elseif (MINGW)
|
||||||
|
# MinGW requires no further flags and has been tested
|
||||||
|
else()
|
||||||
|
message ("LuaProxy: This cmake code has not been tested on your compiler. Please report your success or failure in the forum.")
|
||||||
|
endif()
|
||||||
|
|
||||||
|
add_library(luaproxy SHARED "lua5.1.def" "Dummy.c")
|
||||||
|
set(LIBRARY_OUTPUT_PATH ${CMAKE_SOURCE_DIR}/MCServer)
|
||||||
|
set_target_properties(luaproxy PROPERTIES
|
||||||
|
OUTPUT_NAME "lua5.1"
|
||||||
|
PREFIX ""
|
||||||
|
)
|
||||||
|
target_link_libraries(luaproxy lua)
|
||||||
|
|
||||||
|
# Output the executable into the $/MCServer folder, so that MCServer can find it:
|
||||||
|
set(EXECUTABLE_OUTPUT_PATH ${CMAKE_SOURCE_DIR}/MCServer)
|
||||||
|
SET_TARGET_PROPERTIES(luaproxy PROPERTIES
|
||||||
|
ARCHIVE_OUTPUT_DIRECTORY_DEBUG ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
ARCHIVE_OUTPUT_DIRECTORY_RELEASE ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
ARCHIVE_OUTPUT_DIRECTORY_DEBUGPROFILE ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
ARCHIVE_OUTPUT_DIRECTORY_RELEASEPROFILE ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
LIBRARY_OUTPUT_DIRECTORY_DEBUG ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
LIBRARY_OUTPUT_DIRECTORY_RELEASE ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
LIBRARY_OUTPUT_DIRECTORY_DEBUGPROFILE ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
LIBRARY_OUTPUT_DIRECTORY_RELEASEPROFILE ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
RUNTIME_OUTPUT_DIRECTORY_DEBUG ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
RUNTIME_OUTPUT_DIRECTORY_RELEASE ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
RUNTIME_OUTPUT_DIRECTORY_DEBUGPROFILE ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
RUNTIME_OUTPUT_DIRECTORY_RELEASEPROFILE ${CMAKE_SOURCE_DIR}/MCServer
|
||||||
|
)
|
||||||
|
|
||||||
|
else()
|
||||||
|
|
||||||
|
message (FATAL_ERROR "This project is needed only for Windows, modify your cmake file not to include it on Linux")
|
||||||
|
|
||||||
|
endif()
|
4
lib/luaproxy/Dummy.c
Normal file
4
lib/luaproxy/Dummy.c
Normal file
|
@ -0,0 +1,4 @@
|
||||||
|
|
||||||
|
// Dummy.c
|
||||||
|
|
||||||
|
// Because the MSVC compiler needs at least one C file to compile the project
|
115
lib/luaproxy/lua5.1.def
Normal file
115
lib/luaproxy/lua5.1.def
Normal file
|
@ -0,0 +1,115 @@
|
||||||
|
EXPORTS
|
||||||
|
luaL_addlstring=lua51.luaL_addlstring
|
||||||
|
luaL_addstring=lua51.luaL_addstring
|
||||||
|
luaL_addvalue=lua51.luaL_addvalue
|
||||||
|
luaL_argerror=lua51.luaL_argerror
|
||||||
|
luaL_buffinit=lua51.luaL_buffinit
|
||||||
|
luaL_callmeta=lua51.luaL_callmeta
|
||||||
|
luaL_checkany=lua51.luaL_checkany
|
||||||
|
luaL_checkinteger=lua51.luaL_checkinteger
|
||||||
|
luaL_checklstring=lua51.luaL_checklstring
|
||||||
|
luaL_checknumber=lua51.luaL_checknumber
|
||||||
|
luaL_checkoption=lua51.luaL_checkoption
|
||||||
|
luaL_checkstack=lua51.luaL_checkstack
|
||||||
|
luaL_checktype=lua51.luaL_checktype
|
||||||
|
luaL_checkudata=lua51.luaL_checkudata
|
||||||
|
luaL_error=lua51.luaL_error
|
||||||
|
luaL_findtable=lua51.luaL_findtable
|
||||||
|
luaL_getmetafield=lua51.luaL_getmetafield
|
||||||
|
luaL_gsub=lua51.luaL_gsub
|
||||||
|
luaL_loadbuffer=lua51.luaL_loadbuffer
|
||||||
|
luaL_loadfile=lua51.luaL_loadfile
|
||||||
|
luaL_loadstring=lua51.luaL_loadstring
|
||||||
|
luaL_newmetatable=lua51.luaL_newmetatable
|
||||||
|
luaL_newstate=lua51.luaL_newstate
|
||||||
|
luaL_openlib=lua51.luaL_openlib
|
||||||
|
luaL_openlibs=lua51.luaL_openlibs
|
||||||
|
luaL_optinteger=lua51.luaL_optinteger
|
||||||
|
luaL_optlstring=lua51.luaL_optlstring
|
||||||
|
luaL_optnumber=lua51.luaL_optnumber
|
||||||
|
luaL_prepbuffer=lua51.luaL_prepbuffer
|
||||||
|
luaL_pushresult=lua51.luaL_pushresult
|
||||||
|
luaL_ref=lua51.luaL_ref
|
||||||
|
luaL_register=lua51.luaL_register
|
||||||
|
luaL_typerror=lua51.luaL_typerror
|
||||||
|
luaL_unref=lua51.luaL_unref
|
||||||
|
luaL_where=lua51.luaL_where
|
||||||
|
lua_atpanic=lua51.lua_atpanic
|
||||||
|
lua_call=lua51.lua_call
|
||||||
|
lua_checkstack=lua51.lua_checkstack
|
||||||
|
lua_close=lua51.lua_close
|
||||||
|
lua_concat=lua51.lua_concat
|
||||||
|
lua_cpcall=lua51.lua_cpcall
|
||||||
|
lua_createtable=lua51.lua_createtable
|
||||||
|
lua_dump=lua51.lua_dump
|
||||||
|
lua_equal=lua51.lua_equal
|
||||||
|
lua_error=lua51.lua_error
|
||||||
|
lua_gc=lua51.lua_gc
|
||||||
|
lua_getallocf=lua51.lua_getallocf
|
||||||
|
lua_getfenv=lua51.lua_getfenv
|
||||||
|
lua_getfield=lua51.lua_getfield
|
||||||
|
lua_gethook=lua51.lua_gethook
|
||||||
|
lua_gethookcount=lua51.lua_gethookcount
|
||||||
|
lua_gethookmask=lua51.lua_gethookmask
|
||||||
|
lua_getinfo=lua51.lua_getinfo
|
||||||
|
lua_getlocal=lua51.lua_getlocal
|
||||||
|
lua_getmetatable=lua51.lua_getmetatable
|
||||||
|
lua_getstack=lua51.lua_getstack
|
||||||
|
lua_gettable=lua51.lua_gettable
|
||||||
|
lua_gettop=lua51.lua_gettop
|
||||||
|
lua_getupvalue=lua51.lua_getupvalue
|
||||||
|
lua_insert=lua51.lua_insert
|
||||||
|
lua_iscfunction=lua51.lua_iscfunction
|
||||||
|
lua_isnumber=lua51.lua_isnumber
|
||||||
|
lua_isstring=lua51.lua_isstring
|
||||||
|
lua_isuserdata=lua51.lua_isuserdata
|
||||||
|
lua_lessthan=lua51.lua_lessthan
|
||||||
|
lua_load=lua51.lua_load
|
||||||
|
lua_newstate=lua51.lua_newstate
|
||||||
|
lua_newthread=lua51.lua_newthread
|
||||||
|
lua_newuserdata=lua51.lua_newuserdata
|
||||||
|
lua_next=lua51.lua_next
|
||||||
|
lua_objlen=lua51.lua_objlen
|
||||||
|
lua_pcall=lua51.lua_pcall
|
||||||
|
lua_pushboolean=lua51.lua_pushboolean
|
||||||
|
lua_pushcclosure=lua51.lua_pushcclosure
|
||||||
|
lua_pushfstring=lua51.lua_pushfstring
|
||||||
|
lua_pushinteger=lua51.lua_pushinteger
|
||||||
|
lua_pushlightuserdata=lua51.lua_pushlightuserdata
|
||||||
|
lua_pushlstring=lua51.lua_pushlstring
|
||||||
|
lua_pushnil=lua51.lua_pushnil
|
||||||
|
lua_pushnumber=lua51.lua_pushnumber
|
||||||
|
lua_pushstring=lua51.lua_pushstring
|
||||||
|
lua_pushthread=lua51.lua_pushthread
|
||||||
|
lua_pushvalue=lua51.lua_pushvalue
|
||||||
|
lua_pushvfstring=lua51.lua_pushvfstring
|
||||||
|
lua_rawequal=lua51.lua_rawequal
|
||||||
|
lua_rawget=lua51.lua_rawget
|
||||||
|
lua_rawgeti=lua51.lua_rawgeti
|
||||||
|
lua_rawset=lua51.lua_rawset
|
||||||
|
lua_rawseti=lua51.lua_rawseti
|
||||||
|
lua_remove=lua51.lua_remove
|
||||||
|
lua_replace=lua51.lua_replace
|
||||||
|
lua_resume=lua51.lua_resume
|
||||||
|
lua_setallocf=lua51.lua_setallocf
|
||||||
|
lua_setfenv=lua51.lua_setfenv
|
||||||
|
lua_setfield=lua51.lua_setfield
|
||||||
|
lua_sethook=lua51.lua_sethook
|
||||||
|
lua_setlocal=lua51.lua_setlocal
|
||||||
|
lua_setmetatable=lua51.lua_setmetatable
|
||||||
|
lua_settable=lua51.lua_settable
|
||||||
|
lua_settop=lua51.lua_settop
|
||||||
|
lua_setupvalue=lua51.lua_setupvalue
|
||||||
|
lua_status=lua51.lua_status
|
||||||
|
lua_toboolean=lua51.lua_toboolean
|
||||||
|
lua_tocfunction=lua51.lua_tocfunction
|
||||||
|
lua_tointeger=lua51.lua_tointeger
|
||||||
|
lua_tolstring=lua51.lua_tolstring
|
||||||
|
lua_tonumber=lua51.lua_tonumber
|
||||||
|
lua_topointer=lua51.lua_topointer
|
||||||
|
lua_tothread=lua51.lua_tothread
|
||||||
|
lua_touserdata=lua51.lua_touserdata
|
||||||
|
lua_type=lua51.lua_type
|
||||||
|
lua_typename=lua51.lua_typename
|
||||||
|
lua_xmove=lua51.lua_xmove
|
||||||
|
lua_yield=lua51.lua_yield
|
140
lib/luaproxy/lua5.1.lua
Normal file
140
lib/luaproxy/lua5.1.lua
Normal file
|
@ -0,0 +1,140 @@
|
||||||
|
|
||||||
|
-- lua5.1.lua
|
||||||
|
-- Generates the lua5.1.def file from the list of Lua symbols below
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
local symbols =
|
||||||
|
{
|
||||||
|
"luaL_addlstring",
|
||||||
|
"luaL_addstring",
|
||||||
|
"luaL_addvalue",
|
||||||
|
"luaL_argerror",
|
||||||
|
"luaL_buffinit",
|
||||||
|
"luaL_callmeta",
|
||||||
|
"luaL_checkany",
|
||||||
|
"luaL_checkinteger",
|
||||||
|
"luaL_checklstring",
|
||||||
|
"luaL_checknumber",
|
||||||
|
"luaL_checkoption",
|
||||||
|
"luaL_checkstack",
|
||||||
|
"luaL_checktype",
|
||||||
|
"luaL_checkudata",
|
||||||
|
"luaL_error",
|
||||||
|
"luaL_findtable",
|
||||||
|
"luaL_getmetafield",
|
||||||
|
"luaL_gsub",
|
||||||
|
"luaL_loadbuffer",
|
||||||
|
"luaL_loadfile",
|
||||||
|
"luaL_loadstring",
|
||||||
|
"luaL_newmetatable",
|
||||||
|
"luaL_newstate",
|
||||||
|
"luaL_openlib",
|
||||||
|
"luaL_openlibs",
|
||||||
|
"luaL_optinteger",
|
||||||
|
"luaL_optlstring",
|
||||||
|
"luaL_optnumber",
|
||||||
|
"luaL_prepbuffer",
|
||||||
|
"luaL_pushresult",
|
||||||
|
"luaL_ref",
|
||||||
|
"luaL_register",
|
||||||
|
"luaL_typerror",
|
||||||
|
"luaL_unref",
|
||||||
|
"luaL_where",
|
||||||
|
"lua_atpanic",
|
||||||
|
"lua_call",
|
||||||
|
"lua_checkstack",
|
||||||
|
"lua_close",
|
||||||
|
"lua_concat",
|
||||||
|
"lua_cpcall",
|
||||||
|
"lua_createtable",
|
||||||
|
"lua_dump",
|
||||||
|
"lua_equal",
|
||||||
|
"lua_error",
|
||||||
|
"lua_gc",
|
||||||
|
"lua_getallocf",
|
||||||
|
"lua_getfenv",
|
||||||
|
"lua_getfield",
|
||||||
|
"lua_gethook",
|
||||||
|
"lua_gethookcount",
|
||||||
|
"lua_gethookmask",
|
||||||
|
"lua_getinfo",
|
||||||
|
"lua_getlocal",
|
||||||
|
"lua_getmetatable",
|
||||||
|
"lua_getstack",
|
||||||
|
"lua_gettable",
|
||||||
|
"lua_gettop",
|
||||||
|
"lua_getupvalue",
|
||||||
|
"lua_insert",
|
||||||
|
"lua_iscfunction",
|
||||||
|
"lua_isnumber",
|
||||||
|
"lua_isstring",
|
||||||
|
"lua_isuserdata",
|
||||||
|
"lua_lessthan",
|
||||||
|
"lua_load",
|
||||||
|
"lua_newstate",
|
||||||
|
"lua_newthread",
|
||||||
|
"lua_newuserdata",
|
||||||
|
"lua_next",
|
||||||
|
"lua_objlen",
|
||||||
|
"lua_pcall",
|
||||||
|
"lua_pushboolean",
|
||||||
|
"lua_pushcclosure",
|
||||||
|
"lua_pushfstring",
|
||||||
|
"lua_pushinteger",
|
||||||
|
"lua_pushlightuserdata",
|
||||||
|
"lua_pushlstring",
|
||||||
|
"lua_pushnil",
|
||||||
|
"lua_pushnumber",
|
||||||
|
"lua_pushstring",
|
||||||
|
"lua_pushthread",
|
||||||
|
"lua_pushvalue",
|
||||||
|
"lua_pushvfstring",
|
||||||
|
"lua_rawequal",
|
||||||
|
"lua_rawget",
|
||||||
|
"lua_rawgeti",
|
||||||
|
"lua_rawset",
|
||||||
|
"lua_rawseti",
|
||||||
|
"lua_remove",
|
||||||
|
"lua_replace",
|
||||||
|
"lua_resume",
|
||||||
|
"lua_setallocf",
|
||||||
|
"lua_setfenv",
|
||||||
|
"lua_setfield",
|
||||||
|
"lua_sethook",
|
||||||
|
"lua_setlocal",
|
||||||
|
"lua_setmetatable",
|
||||||
|
"lua_settable",
|
||||||
|
"lua_settop",
|
||||||
|
"lua_setupvalue",
|
||||||
|
"lua_status",
|
||||||
|
"lua_toboolean",
|
||||||
|
"lua_tocfunction",
|
||||||
|
"lua_tointeger",
|
||||||
|
"lua_tolstring",
|
||||||
|
"lua_tonumber",
|
||||||
|
"lua_topointer",
|
||||||
|
"lua_tothread",
|
||||||
|
"lua_touserdata",
|
||||||
|
"lua_type",
|
||||||
|
"lua_typename",
|
||||||
|
"lua_xmove",
|
||||||
|
"lua_yield",
|
||||||
|
-- "luaopen_base",
|
||||||
|
-- "luaopen_debug",
|
||||||
|
-- "luaopen_io",
|
||||||
|
-- "luaopen_math",
|
||||||
|
-- "luaopen_os",
|
||||||
|
-- "luaopen_package",
|
||||||
|
-- "luaopen_string",
|
||||||
|
-- "luaopen_table",
|
||||||
|
}
|
||||||
|
|
||||||
|
local def = io.open("lua5.1.def", "w")
|
||||||
|
def:write("EXPORTS\n")
|
||||||
|
for _,symbol in ipairs(symbols) do
|
||||||
|
def:write("\t" .. symbol .. "=lua51." .. symbol .. "\n")
|
||||||
|
end
|
||||||
|
def:close()
|
|
@ -1,12 +0,0 @@
|
||||||
|
|
||||||
cmake_minimum_required (VERSION 2.6)
|
|
||||||
project (md5)
|
|
||||||
|
|
||||||
include_directories ("${PROJECT_SOURCE_DIR}/../../src/")
|
|
||||||
|
|
||||||
file(GLOB SOURCE
|
|
||||||
"*.cpp"
|
|
||||||
"*.h"
|
|
||||||
)
|
|
||||||
|
|
||||||
add_library(md5 ${SOURCE})
|
|
369
lib/md5/md5.cpp
369
lib/md5/md5.cpp
|
@ -1,369 +0,0 @@
|
||||||
/* MD5
|
|
||||||
converted to C++ class by Frank Thilo (thilo@unix-ag.org)
|
|
||||||
for bzflag (http://www.bzflag.org)
|
|
||||||
|
|
||||||
based on:
|
|
||||||
|
|
||||||
md5.h and md5.c
|
|
||||||
reference implemantion of RFC 1321
|
|
||||||
|
|
||||||
Copyright (C) 1991-2, RSA Data Security, Inc. Created 1991. All
|
|
||||||
rights reserved.
|
|
||||||
|
|
||||||
License to copy and use this software is granted provided that it
|
|
||||||
is identified as the "RSA Data Security, Inc. MD5 Message-Digest
|
|
||||||
Algorithm" in all material mentioning or referencing this software
|
|
||||||
or this function.
|
|
||||||
|
|
||||||
License is also granted to make and use derivative works provided
|
|
||||||
that such works are identified as "derived from the RSA Data
|
|
||||||
Security, Inc. MD5 Message-Digest Algorithm" in all material
|
|
||||||
mentioning or referencing the derived work.
|
|
||||||
|
|
||||||
RSA Data Security, Inc. makes no representations concerning either
|
|
||||||
the merchantability of this software or the suitability of this
|
|
||||||
software for any particular purpose. It is provided "as is"
|
|
||||||
without express or implied warranty of any kind.
|
|
||||||
|
|
||||||
These notices must be retained in any copies of any part of this
|
|
||||||
documentation and/or software.
|
|
||||||
|
|
||||||
*/
|
|
||||||
|
|
||||||
/* interface header */
|
|
||||||
#include "md5.h"
|
|
||||||
|
|
||||||
/* system implementation headers */
|
|
||||||
#include <stdio.h>
|
|
||||||
|
|
||||||
#ifndef _WIN32
|
|
||||||
#include <cstring>
|
|
||||||
#endif
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
// Constants for MD5Transform routine.
|
|
||||||
#define S11 7
|
|
||||||
#define S12 12
|
|
||||||
#define S13 17
|
|
||||||
#define S14 22
|
|
||||||
#define S21 5
|
|
||||||
#define S22 9
|
|
||||||
#define S23 14
|
|
||||||
#define S24 20
|
|
||||||
#define S31 4
|
|
||||||
#define S32 11
|
|
||||||
#define S33 16
|
|
||||||
#define S34 23
|
|
||||||
#define S41 6
|
|
||||||
#define S42 10
|
|
||||||
#define S43 15
|
|
||||||
#define S44 21
|
|
||||||
|
|
||||||
///////////////////////////////////////////////
|
|
||||||
|
|
||||||
// F, G, H and I are basic MD5 functions.
|
|
||||||
inline MD5::uint4 MD5::F(uint4 x, uint4 y, uint4 z) {
|
|
||||||
return x&y | ~x&z;
|
|
||||||
}
|
|
||||||
|
|
||||||
inline MD5::uint4 MD5::G(uint4 x, uint4 y, uint4 z) {
|
|
||||||
return x&z | y&~z;
|
|
||||||
}
|
|
||||||
|
|
||||||
inline MD5::uint4 MD5::H(uint4 x, uint4 y, uint4 z) {
|
|
||||||
return x^y^z;
|
|
||||||
}
|
|
||||||
|
|
||||||
inline MD5::uint4 MD5::I(uint4 x, uint4 y, uint4 z) {
|
|
||||||
return y ^ (x | ~z);
|
|
||||||
}
|
|
||||||
|
|
||||||
// rotate_left rotates x left n bits.
|
|
||||||
inline MD5::uint4 MD5::rotate_left(uint4 x, int n) {
|
|
||||||
return (x << n) | (x >> (32-n));
|
|
||||||
}
|
|
||||||
|
|
||||||
// FF, GG, HH, and II transformations for rounds 1, 2, 3, and 4.
|
|
||||||
// Rotation is separate from addition to prevent recomputation.
|
|
||||||
inline void MD5::FF(uint4 &a, uint4 b, uint4 c, uint4 d, uint4 x, uint4 s, uint4 ac) {
|
|
||||||
a = rotate_left(a+ F(b,c,d) + x + ac, s) + b;
|
|
||||||
}
|
|
||||||
|
|
||||||
inline void MD5::GG(uint4 &a, uint4 b, uint4 c, uint4 d, uint4 x, uint4 s, uint4 ac) {
|
|
||||||
a = rotate_left(a + G(b,c,d) + x + ac, s) + b;
|
|
||||||
}
|
|
||||||
|
|
||||||
inline void MD5::HH(uint4 &a, uint4 b, uint4 c, uint4 d, uint4 x, uint4 s, uint4 ac) {
|
|
||||||
a = rotate_left(a + H(b,c,d) + x + ac, s) + b;
|
|
||||||
}
|
|
||||||
|
|
||||||
inline void MD5::II(uint4 &a, uint4 b, uint4 c, uint4 d, uint4 x, uint4 s, uint4 ac) {
|
|
||||||
a = rotate_left(a + I(b,c,d) + x + ac, s) + b;
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////////////////////
|
|
||||||
|
|
||||||
// default ctor, just initailize
|
|
||||||
MD5::MD5()
|
|
||||||
{
|
|
||||||
init();
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////////////////////
|
|
||||||
|
|
||||||
// nifty shortcut ctor, compute MD5 for string and finalize it right away
|
|
||||||
MD5::MD5(const std::string &text)
|
|
||||||
{
|
|
||||||
init();
|
|
||||||
update(text.c_str(), text.length());
|
|
||||||
finalize();
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////
|
|
||||||
|
|
||||||
void MD5::init()
|
|
||||||
{
|
|
||||||
finalized=false;
|
|
||||||
|
|
||||||
count[0] = 0;
|
|
||||||
count[1] = 0;
|
|
||||||
|
|
||||||
// load magic initialization constants.
|
|
||||||
state[0] = 0x67452301;
|
|
||||||
state[1] = 0xefcdab89;
|
|
||||||
state[2] = 0x98badcfe;
|
|
||||||
state[3] = 0x10325476;
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////
|
|
||||||
|
|
||||||
// decodes input (unsigned char) into output (uint4). Assumes len is a multiple of 4.
|
|
||||||
void MD5::decode(uint4 output[], const uint1 input[], size_type len)
|
|
||||||
{
|
|
||||||
for (unsigned int i = 0, j = 0; j < len; i++, j += 4)
|
|
||||||
output[i] = ((uint4)input[j]) | (((uint4)input[j+1]) << 8) |
|
|
||||||
(((uint4)input[j+2]) << 16) | (((uint4)input[j+3]) << 24);
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////
|
|
||||||
|
|
||||||
// encodes input (uint4) into output (unsigned char). Assumes len is
|
|
||||||
// a multiple of 4.
|
|
||||||
void MD5::encode(uint1 output[], const uint4 input[], size_type len)
|
|
||||||
{
|
|
||||||
for (size_type i = 0, j = 0; j < len; i++, j += 4) {
|
|
||||||
output[j] = input[i] & 0xff;
|
|
||||||
output[j+1] = (input[i] >> 8) & 0xff;
|
|
||||||
output[j+2] = (input[i] >> 16) & 0xff;
|
|
||||||
output[j+3] = (input[i] >> 24) & 0xff;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////
|
|
||||||
|
|
||||||
// apply MD5 algo on a block
|
|
||||||
void MD5::transform(const uint1 block[blocksize])
|
|
||||||
{
|
|
||||||
uint4 a = state[0], b = state[1], c = state[2], d = state[3], x[16];
|
|
||||||
decode (x, block, blocksize);
|
|
||||||
|
|
||||||
/* Round 1 */
|
|
||||||
FF (a, b, c, d, x[ 0], S11, 0xd76aa478); /* 1 */
|
|
||||||
FF (d, a, b, c, x[ 1], S12, 0xe8c7b756); /* 2 */
|
|
||||||
FF (c, d, a, b, x[ 2], S13, 0x242070db); /* 3 */
|
|
||||||
FF (b, c, d, a, x[ 3], S14, 0xc1bdceee); /* 4 */
|
|
||||||
FF (a, b, c, d, x[ 4], S11, 0xf57c0faf); /* 5 */
|
|
||||||
FF (d, a, b, c, x[ 5], S12, 0x4787c62a); /* 6 */
|
|
||||||
FF (c, d, a, b, x[ 6], S13, 0xa8304613); /* 7 */
|
|
||||||
FF (b, c, d, a, x[ 7], S14, 0xfd469501); /* 8 */
|
|
||||||
FF (a, b, c, d, x[ 8], S11, 0x698098d8); /* 9 */
|
|
||||||
FF (d, a, b, c, x[ 9], S12, 0x8b44f7af); /* 10 */
|
|
||||||
FF (c, d, a, b, x[10], S13, 0xffff5bb1); /* 11 */
|
|
||||||
FF (b, c, d, a, x[11], S14, 0x895cd7be); /* 12 */
|
|
||||||
FF (a, b, c, d, x[12], S11, 0x6b901122); /* 13 */
|
|
||||||
FF (d, a, b, c, x[13], S12, 0xfd987193); /* 14 */
|
|
||||||
FF (c, d, a, b, x[14], S13, 0xa679438e); /* 15 */
|
|
||||||
FF (b, c, d, a, x[15], S14, 0x49b40821); /* 16 */
|
|
||||||
|
|
||||||
/* Round 2 */
|
|
||||||
GG (a, b, c, d, x[ 1], S21, 0xf61e2562); /* 17 */
|
|
||||||
GG (d, a, b, c, x[ 6], S22, 0xc040b340); /* 18 */
|
|
||||||
GG (c, d, a, b, x[11], S23, 0x265e5a51); /* 19 */
|
|
||||||
GG (b, c, d, a, x[ 0], S24, 0xe9b6c7aa); /* 20 */
|
|
||||||
GG (a, b, c, d, x[ 5], S21, 0xd62f105d); /* 21 */
|
|
||||||
GG (d, a, b, c, x[10], S22, 0x2441453); /* 22 */
|
|
||||||
GG (c, d, a, b, x[15], S23, 0xd8a1e681); /* 23 */
|
|
||||||
GG (b, c, d, a, x[ 4], S24, 0xe7d3fbc8); /* 24 */
|
|
||||||
GG (a, b, c, d, x[ 9], S21, 0x21e1cde6); /* 25 */
|
|
||||||
GG (d, a, b, c, x[14], S22, 0xc33707d6); /* 26 */
|
|
||||||
GG (c, d, a, b, x[ 3], S23, 0xf4d50d87); /* 27 */
|
|
||||||
GG (b, c, d, a, x[ 8], S24, 0x455a14ed); /* 28 */
|
|
||||||
GG (a, b, c, d, x[13], S21, 0xa9e3e905); /* 29 */
|
|
||||||
GG (d, a, b, c, x[ 2], S22, 0xfcefa3f8); /* 30 */
|
|
||||||
GG (c, d, a, b, x[ 7], S23, 0x676f02d9); /* 31 */
|
|
||||||
GG (b, c, d, a, x[12], S24, 0x8d2a4c8a); /* 32 */
|
|
||||||
|
|
||||||
/* Round 3 */
|
|
||||||
HH (a, b, c, d, x[ 5], S31, 0xfffa3942); /* 33 */
|
|
||||||
HH (d, a, b, c, x[ 8], S32, 0x8771f681); /* 34 */
|
|
||||||
HH (c, d, a, b, x[11], S33, 0x6d9d6122); /* 35 */
|
|
||||||
HH (b, c, d, a, x[14], S34, 0xfde5380c); /* 36 */
|
|
||||||
HH (a, b, c, d, x[ 1], S31, 0xa4beea44); /* 37 */
|
|
||||||
HH (d, a, b, c, x[ 4], S32, 0x4bdecfa9); /* 38 */
|
|
||||||
HH (c, d, a, b, x[ 7], S33, 0xf6bb4b60); /* 39 */
|
|
||||||
HH (b, c, d, a, x[10], S34, 0xbebfbc70); /* 40 */
|
|
||||||
HH (a, b, c, d, x[13], S31, 0x289b7ec6); /* 41 */
|
|
||||||
HH (d, a, b, c, x[ 0], S32, 0xeaa127fa); /* 42 */
|
|
||||||
HH (c, d, a, b, x[ 3], S33, 0xd4ef3085); /* 43 */
|
|
||||||
HH (b, c, d, a, x[ 6], S34, 0x4881d05); /* 44 */
|
|
||||||
HH (a, b, c, d, x[ 9], S31, 0xd9d4d039); /* 45 */
|
|
||||||
HH (d, a, b, c, x[12], S32, 0xe6db99e5); /* 46 */
|
|
||||||
HH (c, d, a, b, x[15], S33, 0x1fa27cf8); /* 47 */
|
|
||||||
HH (b, c, d, a, x[ 2], S34, 0xc4ac5665); /* 48 */
|
|
||||||
|
|
||||||
/* Round 4 */
|
|
||||||
II (a, b, c, d, x[ 0], S41, 0xf4292244); /* 49 */
|
|
||||||
II (d, a, b, c, x[ 7], S42, 0x432aff97); /* 50 */
|
|
||||||
II (c, d, a, b, x[14], S43, 0xab9423a7); /* 51 */
|
|
||||||
II (b, c, d, a, x[ 5], S44, 0xfc93a039); /* 52 */
|
|
||||||
II (a, b, c, d, x[12], S41, 0x655b59c3); /* 53 */
|
|
||||||
II (d, a, b, c, x[ 3], S42, 0x8f0ccc92); /* 54 */
|
|
||||||
II (c, d, a, b, x[10], S43, 0xffeff47d); /* 55 */
|
|
||||||
II (b, c, d, a, x[ 1], S44, 0x85845dd1); /* 56 */
|
|
||||||
II (a, b, c, d, x[ 8], S41, 0x6fa87e4f); /* 57 */
|
|
||||||
II (d, a, b, c, x[15], S42, 0xfe2ce6e0); /* 58 */
|
|
||||||
II (c, d, a, b, x[ 6], S43, 0xa3014314); /* 59 */
|
|
||||||
II (b, c, d, a, x[13], S44, 0x4e0811a1); /* 60 */
|
|
||||||
II (a, b, c, d, x[ 4], S41, 0xf7537e82); /* 61 */
|
|
||||||
II (d, a, b, c, x[11], S42, 0xbd3af235); /* 62 */
|
|
||||||
II (c, d, a, b, x[ 2], S43, 0x2ad7d2bb); /* 63 */
|
|
||||||
II (b, c, d, a, x[ 9], S44, 0xeb86d391); /* 64 */
|
|
||||||
|
|
||||||
state[0] += a;
|
|
||||||
state[1] += b;
|
|
||||||
state[2] += c;
|
|
||||||
state[3] += d;
|
|
||||||
|
|
||||||
// Zeroize sensitive information.
|
|
||||||
memset(x, 0, sizeof x);
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////
|
|
||||||
|
|
||||||
// MD5 block update operation. Continues an MD5 message-digest
|
|
||||||
// operation, processing another message block
|
|
||||||
void MD5::update(const unsigned char input[], size_type length)
|
|
||||||
{
|
|
||||||
// compute number of bytes mod 64
|
|
||||||
size_type index = count[0] / 8 % blocksize;
|
|
||||||
|
|
||||||
// Update number of bits
|
|
||||||
if ((count[0] += (length << 3)) < (length << 3))
|
|
||||||
count[1]++;
|
|
||||||
count[1] += (length >> 29);
|
|
||||||
|
|
||||||
// number of bytes we need to fill in buffer
|
|
||||||
size_type firstpart = 64 - index;
|
|
||||||
|
|
||||||
size_type i;
|
|
||||||
|
|
||||||
// transform as many times as possible.
|
|
||||||
if (length >= firstpart)
|
|
||||||
{
|
|
||||||
// fill buffer first, transform
|
|
||||||
memcpy(&buffer[index], input, firstpart);
|
|
||||||
transform(buffer);
|
|
||||||
|
|
||||||
// transform chunks of blocksize (64 bytes)
|
|
||||||
for (i = firstpart; i + blocksize <= length; i += blocksize)
|
|
||||||
transform(&input[i]);
|
|
||||||
|
|
||||||
index = 0;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
i = 0;
|
|
||||||
|
|
||||||
// buffer remaining input
|
|
||||||
memcpy(&buffer[index], &input[i], length-i);
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////
|
|
||||||
|
|
||||||
// for convenience provide a verson with signed char
|
|
||||||
void MD5::update(const char input[], size_type length)
|
|
||||||
{
|
|
||||||
update((const unsigned char*)input, length);
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////
|
|
||||||
|
|
||||||
// MD5 finalization. Ends an MD5 message-digest operation, writing the
|
|
||||||
// the message digest and zeroizing the context.
|
|
||||||
MD5& MD5::finalize()
|
|
||||||
{
|
|
||||||
static unsigned char padding[64] = {
|
|
||||||
0x80, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
|
||||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
|
||||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
|
|
||||||
};
|
|
||||||
|
|
||||||
if (!finalized) {
|
|
||||||
// Save number of bits
|
|
||||||
unsigned char bits[8];
|
|
||||||
encode(bits, count, 8);
|
|
||||||
|
|
||||||
// pad out to 56 mod 64.
|
|
||||||
size_type index = count[0] / 8 % 64;
|
|
||||||
size_type padLen = (index < 56) ? (56 - index) : (120 - index);
|
|
||||||
update(padding, padLen);
|
|
||||||
|
|
||||||
// Append length (before padding)
|
|
||||||
update(bits, 8);
|
|
||||||
|
|
||||||
// Store state in digest
|
|
||||||
encode(digest, state, 16);
|
|
||||||
|
|
||||||
// Zeroize sensitive information.
|
|
||||||
memset(buffer, 0, sizeof buffer);
|
|
||||||
memset(count, 0, sizeof count);
|
|
||||||
|
|
||||||
finalized=true;
|
|
||||||
}
|
|
||||||
|
|
||||||
return *this;
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////
|
|
||||||
|
|
||||||
// return hex representation of digest as string
|
|
||||||
std::string MD5::hexdigest() const
|
|
||||||
{
|
|
||||||
if (!finalized)
|
|
||||||
return "";
|
|
||||||
|
|
||||||
char buf[33];
|
|
||||||
for (int i=0; i<16; i++)
|
|
||||||
sprintf(buf+i*2, "%02x", digest[i]);
|
|
||||||
buf[32]=0;
|
|
||||||
|
|
||||||
return std::string(buf);
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////
|
|
||||||
|
|
||||||
std::ostream& operator<<(std::ostream& out, MD5 md5)
|
|
||||||
{
|
|
||||||
return out << md5.hexdigest();
|
|
||||||
}
|
|
||||||
|
|
||||||
//////////////////////////////
|
|
||||||
|
|
||||||
std::string md5(const std::string & str)
|
|
||||||
{
|
|
||||||
MD5 md5 = MD5(str);
|
|
||||||
|
|
||||||
return md5.hexdigest();
|
|
||||||
}
|
|
|
@ -1,93 +0,0 @@
|
||||||
/* MD5
|
|
||||||
converted to C++ class by Frank Thilo (thilo@unix-ag.org)
|
|
||||||
for bzflag (http://www.bzflag.org)
|
|
||||||
|
|
||||||
based on:
|
|
||||||
|
|
||||||
md5.h and md5.c
|
|
||||||
reference implementation of RFC 1321
|
|
||||||
|
|
||||||
Copyright (C) 1991-2, RSA Data Security, Inc. Created 1991. All
|
|
||||||
rights reserved.
|
|
||||||
|
|
||||||
License to copy and use this software is granted provided that it
|
|
||||||
is identified as the "RSA Data Security, Inc. MD5 Message-Digest
|
|
||||||
Algorithm" in all material mentioning or referencing this software
|
|
||||||
or this function.
|
|
||||||
|
|
||||||
License is also granted to make and use derivative works provided
|
|
||||||
that such works are identified as "derived from the RSA Data
|
|
||||||
Security, Inc. MD5 Message-Digest Algorithm" in all material
|
|
||||||
mentioning or referencing the derived work.
|
|
||||||
|
|
||||||
RSA Data Security, Inc. makes no representations concerning either
|
|
||||||
the merchantability of this software or the suitability of this
|
|
||||||
software for any particular purpose. It is provided "as is"
|
|
||||||
without express or implied warranty of any kind.
|
|
||||||
|
|
||||||
These notices must be retained in any copies of any part of this
|
|
||||||
documentation and/or software.
|
|
||||||
|
|
||||||
*/
|
|
||||||
|
|
||||||
#ifndef BZF_MD5_H
|
|
||||||
#define BZF_MD5_H
|
|
||||||
|
|
||||||
#include <string>
|
|
||||||
#include <iostream>
|
|
||||||
|
|
||||||
|
|
||||||
// a small class for calculating MD5 hashes of strings or byte arrays
|
|
||||||
// it is not meant to be fast or secure
|
|
||||||
//
|
|
||||||
// usage: 1) feed it blocks of uchars with update()
|
|
||||||
// 2) finalize()
|
|
||||||
// 3) get hexdigest() string
|
|
||||||
// or
|
|
||||||
// MD5(std::string).hexdigest()
|
|
||||||
//
|
|
||||||
// assumes that char is 8 bit and int is 32 bit
|
|
||||||
class MD5
|
|
||||||
{
|
|
||||||
public:
|
|
||||||
typedef unsigned int size_type; // must be 32bit
|
|
||||||
|
|
||||||
MD5();
|
|
||||||
MD5(const std::string& text);
|
|
||||||
void update(const unsigned char *buf, size_type length);
|
|
||||||
void update(const char *buf, size_type length);
|
|
||||||
MD5& finalize();
|
|
||||||
std::string hexdigest() const;
|
|
||||||
friend std::ostream& operator<<(std::ostream&, MD5 md5);
|
|
||||||
|
|
||||||
private:
|
|
||||||
void init();
|
|
||||||
typedef unsigned char uint1; // 8bit
|
|
||||||
typedef unsigned int uint4; // 32bit
|
|
||||||
enum {blocksize = 64}; // VC6 won't eat a const static int here
|
|
||||||
|
|
||||||
void transform(const uint1 block[blocksize]);
|
|
||||||
static void decode(uint4 output[], const uint1 input[], size_type len);
|
|
||||||
static void encode(uint1 output[], const uint4 input[], size_type len);
|
|
||||||
|
|
||||||
bool finalized;
|
|
||||||
uint1 buffer[blocksize]; // bytes that didn't fit in last 64 byte chunk
|
|
||||||
uint4 count[2]; // 64bit counter for number of bits (lo, hi)
|
|
||||||
uint4 state[4]; // digest so far
|
|
||||||
uint1 digest[16]; // the result
|
|
||||||
|
|
||||||
// low level logic operations
|
|
||||||
static inline uint4 F(uint4 x, uint4 y, uint4 z);
|
|
||||||
static inline uint4 G(uint4 x, uint4 y, uint4 z);
|
|
||||||
static inline uint4 H(uint4 x, uint4 y, uint4 z);
|
|
||||||
static inline uint4 I(uint4 x, uint4 y, uint4 z);
|
|
||||||
static inline uint4 rotate_left(uint4 x, int n);
|
|
||||||
static inline void FF(uint4 &a, uint4 b, uint4 c, uint4 d, uint4 x, uint4 s, uint4 ac);
|
|
||||||
static inline void GG(uint4 &a, uint4 b, uint4 c, uint4 d, uint4 x, uint4 s, uint4 ac);
|
|
||||||
static inline void HH(uint4 &a, uint4 b, uint4 c, uint4 d, uint4 x, uint4 s, uint4 ac);
|
|
||||||
static inline void II(uint4 &a, uint4 b, uint4 c, uint4 d, uint4 x, uint4 s, uint4 ac);
|
|
||||||
};
|
|
||||||
|
|
||||||
std::string md5(const std::string & str);
|
|
||||||
|
|
||||||
#endif
|
|
|
@ -1,9 +1,9 @@
|
||||||
|
|
||||||
if(NOT TARGET polarssl)
|
if(NOT TARGET polarssl)
|
||||||
message("including polarssl")
|
message("including polarssl")
|
||||||
if (SELF_TEST)
|
|
||||||
set(ENABLE_TESTING OFF CACHE BOOL "Disable tests")
|
set(ENABLE_TESTING OFF CACHE BOOL "Disable tests")
|
||||||
set(ENABLE_PROGRAMS OFF CACHE BOOL "Disable programs")
|
set(ENABLE_PROGRAMS OFF CACHE BOOL "Disable programs")
|
||||||
|
if (SELF_TEST)
|
||||||
add_subdirectory(${CMAKE_CURRENT_LIST_DIR}/polarssl/ ${CMAKE_CURRENT_BINARY_DIR}/lib/polarssl)
|
add_subdirectory(${CMAKE_CURRENT_LIST_DIR}/polarssl/ ${CMAKE_CURRENT_BINARY_DIR}/lib/polarssl)
|
||||||
else()
|
else()
|
||||||
add_subdirectory(${CMAKE_CURRENT_LIST_DIR}/polarssl/ ${CMAKE_CURRENT_BINARY_DIR}/lib/polarssl EXCLUDE_FROM_ALL)
|
add_subdirectory(${CMAKE_CURRENT_LIST_DIR}/polarssl/ ${CMAKE_CURRENT_BINARY_DIR}/lib/polarssl EXCLUDE_FROM_ALL)
|
||||||
|
|
|
@ -9,8 +9,14 @@ file(GLOB SOURCE
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
# add headers to MSVC project files:
|
# Lua is required as a DLL for LuaSQLite:
|
||||||
if (WIN32)
|
if (WIN32)
|
||||||
|
add_definitions(-DLUA_BUILD_AS_DLL)
|
||||||
|
endif()
|
||||||
|
|
||||||
|
|
||||||
|
# add headers to MSVC project files:
|
||||||
|
if (MSVC)
|
||||||
file(GLOB HEADERS "src/*.h")
|
file(GLOB HEADERS "src/*.h")
|
||||||
list(REMOVE_ITEM SOURCE "${PROJECT_SOURCE_DIR}/src/lua.h" "${PROJECT_SOURCE_DIR}/src/luac.h")
|
list(REMOVE_ITEM SOURCE "${PROJECT_SOURCE_DIR}/src/lua.h" "${PROJECT_SOURCE_DIR}/src/luac.h")
|
||||||
set(SOURCE ${SOURCE} ${HEADERS})
|
set(SOURCE ${SOURCE} ${HEADERS})
|
||||||
|
@ -23,6 +29,7 @@ if (${CMAKE_SYSTEM_NAME} STREQUAL "FreeBSD")
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
add_library(sqlite ${SOURCE})
|
add_library(sqlite ${SOURCE})
|
||||||
|
target_link_libraries(sqlite lua)
|
||||||
|
|
||||||
if (UNIX)
|
if (UNIX)
|
||||||
target_link_libraries(sqlite ${DYNAMIC_LOADER})
|
target_link_libraries(sqlite ${DYNAMIC_LOADER})
|
||||||
|
|
|
@ -44,14 +44,13 @@ file(GLOB BIN_SOURCE
|
||||||
"src/bin/*.c"
|
"src/bin/*.c"
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
add_executable(tolua ${BIN_SOURCE})
|
add_executable(tolua ${BIN_SOURCE})
|
||||||
add_library(tolualib ${LIB_SOURCE})
|
add_library(tolualib ${LIB_SOURCE})
|
||||||
|
target_link_libraries(tolualib lua)
|
||||||
|
|
||||||
#m is the standard math librarys
|
#m is the standard math librarys
|
||||||
if(UNIX)
|
if(UNIX)
|
||||||
target_link_libraries(tolua m ${DYNAMIC_LOADER})
|
target_link_libraries(tolua m ${DYNAMIC_LOADER})
|
||||||
endif()
|
endif()
|
||||||
|
|
||||||
target_link_libraries(tolua lua tolualib)
|
target_link_libraries(tolua tolualib lua)
|
||||||
|
|
|
@ -107,3 +107,7 @@ class cListAllocationPool : public cAllocationPool<T>
|
||||||
std::list<void *> m_FreeList;
|
std::list<void *> m_FreeList;
|
||||||
std::auto_ptr<typename cAllocationPool<T>::cStarvationCallbacks> m_Callbacks;
|
std::auto_ptr<typename cAllocationPool<T>::cStarvationCallbacks> m_Callbacks;
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
1
src/Bindings/.gitignore
vendored
1
src/Bindings/.gitignore
vendored
|
@ -1 +1,2 @@
|
||||||
lua51.dll
|
lua51.dll
|
||||||
|
LuaState_Call.inc
|
||||||
|
|
|
@ -40,7 +40,7 @@ $cfile "../Entities/Painting.h"
|
||||||
$cfile "../Entities/Pickup.h"
|
$cfile "../Entities/Pickup.h"
|
||||||
$cfile "../Entities/ProjectileEntity.h"
|
$cfile "../Entities/ProjectileEntity.h"
|
||||||
$cfile "../Entities/TNTEntity.h"
|
$cfile "../Entities/TNTEntity.h"
|
||||||
$cfile "../Entities/Effects.h"
|
$cfile "../Entities/EntityEffect.h"
|
||||||
$cfile "../Server.h"
|
$cfile "../Server.h"
|
||||||
$cfile "../World.h"
|
$cfile "../World.h"
|
||||||
$cfile "../Inventory.h"
|
$cfile "../Inventory.h"
|
||||||
|
|
|
@ -39,7 +39,7 @@ static int tolua_get_AllToLua_g_BlockLightValue(lua_State* tolua_S)
|
||||||
tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetLightValue((BLOCKTYPE)BlockType));
|
tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetLightValue((BLOCKTYPE)BlockType));
|
||||||
return 1;
|
return 1;
|
||||||
}
|
}
|
||||||
#endif //#ifndef TOLUA_DISABLE
|
#endif // #ifndef TOLUA_DISABLE
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -65,7 +65,7 @@ static int tolua_get_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S)
|
||||||
tolua_pushnumber(tolua_S, (lua_Number)cBlockInfo::GetSpreadLightFalloff((BLOCKTYPE)BlockType));
|
tolua_pushnumber(tolua_S, (lua_Number)cBlockInfo::GetSpreadLightFalloff((BLOCKTYPE)BlockType));
|
||||||
return 1;
|
return 1;
|
||||||
}
|
}
|
||||||
#endif //#ifndef TOLUA_DISABLE
|
#endif // #ifndef TOLUA_DISABLE
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -91,7 +91,7 @@ static int tolua_get_AllToLua_g_BlockTransparent(lua_State* tolua_S)
|
||||||
tolua_pushboolean(tolua_S, cBlockInfo::IsTransparent((BLOCKTYPE)BlockType));
|
tolua_pushboolean(tolua_S, cBlockInfo::IsTransparent((BLOCKTYPE)BlockType));
|
||||||
return 1;
|
return 1;
|
||||||
}
|
}
|
||||||
#endif //#ifndef TOLUA_DISABLE
|
#endif // #ifndef TOLUA_DISABLE
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -117,7 +117,7 @@ static int tolua_get_AllToLua_g_BlockOneHitDig(lua_State* tolua_S)
|
||||||
tolua_pushboolean(tolua_S, cBlockInfo::IsOneHitDig((BLOCKTYPE)BlockType));
|
tolua_pushboolean(tolua_S, cBlockInfo::IsOneHitDig((BLOCKTYPE)BlockType));
|
||||||
return 1;
|
return 1;
|
||||||
}
|
}
|
||||||
#endif //#ifndef TOLUA_DISABLE
|
#endif // #ifndef TOLUA_DISABLE
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -143,7 +143,7 @@ static int tolua_get_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S)
|
||||||
tolua_pushboolean(tolua_S, cBlockInfo::IsPistonBreakable((BLOCKTYPE)BlockType));
|
tolua_pushboolean(tolua_S, cBlockInfo::IsPistonBreakable((BLOCKTYPE)BlockType));
|
||||||
return 1;
|
return 1;
|
||||||
}
|
}
|
||||||
#endif //#ifndef TOLUA_DISABLE
|
#endif // #ifndef TOLUA_DISABLE
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -169,7 +169,7 @@ static int tolua_get_AllToLua_g_BlockIsSnowable(lua_State* tolua_S)
|
||||||
tolua_pushboolean(tolua_S, cBlockInfo::IsSnowable((BLOCKTYPE)BlockType));
|
tolua_pushboolean(tolua_S, cBlockInfo::IsSnowable((BLOCKTYPE)BlockType));
|
||||||
return 1;
|
return 1;
|
||||||
}
|
}
|
||||||
#endif //#ifndef TOLUA_DISABLE
|
#endif // #ifndef TOLUA_DISABLE
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -195,7 +195,7 @@ static int tolua_get_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S)
|
||||||
tolua_pushboolean(tolua_S, cBlockInfo::RequiresSpecialTool((BLOCKTYPE)BlockType));
|
tolua_pushboolean(tolua_S, cBlockInfo::RequiresSpecialTool((BLOCKTYPE)BlockType));
|
||||||
return 1;
|
return 1;
|
||||||
}
|
}
|
||||||
#endif //#ifndef TOLUA_DISABLE
|
#endif // #ifndef TOLUA_DISABLE
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -221,7 +221,7 @@ static int tolua_get_AllToLua_g_BlockIsSolid(lua_State* tolua_S)
|
||||||
tolua_pushboolean(tolua_S, (bool)cBlockInfo::IsSolid((BLOCKTYPE)BlockType));
|
tolua_pushboolean(tolua_S, (bool)cBlockInfo::IsSolid((BLOCKTYPE)BlockType));
|
||||||
return 1;
|
return 1;
|
||||||
}
|
}
|
||||||
#endif //#ifndef TOLUA_DISABLE
|
#endif // #ifndef TOLUA_DISABLE
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -247,7 +247,7 @@ static int tolua_get_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S)
|
||||||
tolua_pushboolean(tolua_S, (bool)cBlockInfo::FullyOccupiesVoxel((BLOCKTYPE)BlockType));
|
tolua_pushboolean(tolua_S, (bool)cBlockInfo::FullyOccupiesVoxel((BLOCKTYPE)BlockType));
|
||||||
return 1;
|
return 1;
|
||||||
}
|
}
|
||||||
#endif //#ifndef TOLUA_DISABLE
|
#endif // #ifndef TOLUA_DISABLE
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -40,7 +40,7 @@ const cLuaState::cRet cLuaState::Return = {};
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cLuaState:
|
// cLuaState:
|
||||||
|
|
||||||
cLuaState::cLuaState(const AString & a_SubsystemName) :
|
cLuaState::cLuaState(const AString & a_SubsystemName) :
|
||||||
|
@ -811,6 +811,18 @@ void cLuaState::GetStackValue(int a_StackPos, double & a_ReturnedVal)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
void cLuaState::GetStackValue(int a_StackPos, eWeather & a_ReturnedVal)
|
||||||
|
{
|
||||||
|
if (lua_isnumber(m_LuaState, a_StackPos))
|
||||||
|
{
|
||||||
|
a_ReturnedVal = (eWeather)Clamp((int)tolua_tonumber(m_LuaState, a_StackPos, a_ReturnedVal), (int)wSunny, (int)wThunderstorm);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cLuaState::CallFunction(int a_NumResults)
|
bool cLuaState::CallFunction(int a_NumResults)
|
||||||
{
|
{
|
||||||
ASSERT (m_NumCurrentFunctionArgs >= 0); // A function must be pushed to stack first
|
ASSERT (m_NumCurrentFunctionArgs >= 0); // A function must be pushed to stack first
|
||||||
|
@ -1359,7 +1371,7 @@ int cLuaState::ReportFnCallErrors(lua_State * a_LuaState)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cLuaState::cRef:
|
// cLuaState::cRef:
|
||||||
|
|
||||||
cLuaState::cRef::cRef(void) :
|
cLuaState::cRef::cRef(void) :
|
||||||
|
|
|
@ -9,10 +9,11 @@ Owned lua_State is created by calling Create() and the cLuaState automatically c
|
||||||
Or, lua_State can be attached by calling Attach(), the cLuaState doesn't close such a state
|
Or, lua_State can be attached by calling Attach(), the cLuaState doesn't close such a state
|
||||||
Attaching a state will automatically close an owned state.
|
Attaching a state will automatically close an owned state.
|
||||||
|
|
||||||
Calling a Lua function is done by pushing the function, either by PushFunction() or PushFunctionFromRegistry(),
|
Calling a Lua function is done internally by pushing the function using PushFunction(), then pushing the
|
||||||
then pushing the arguments (PushString(), PushNumber(), PushUserData() etc.) and finally
|
arguments and finally executing CallFunction(). cLuaState automatically keeps track of the number of
|
||||||
executing CallFunction(). cLuaState automatically keeps track of the number of arguments and the name of the
|
arguments and the name of the function (for logging purposes). After the call the return values are read from
|
||||||
function (for logging purposes), which makes the call less error-prone.
|
the stack using GetStackValue(). All of this is wrapped in a templated function overloads cLuaState::Call(),
|
||||||
|
which is generated automatically by gen_LuaState_Call.lua script file into the LuaState_Call.inc file.
|
||||||
|
|
||||||
Reference management is provided by the cLuaState::cRef class. This is used when you need to hold a reference to
|
Reference management is provided by the cLuaState::cRef class. This is used when you need to hold a reference to
|
||||||
any Lua object across several function calls; usually this is used for callbacks. The class is RAII-like, with
|
any Lua object across several function calls; usually this is used for callbacks. The class is RAII-like, with
|
||||||
|
@ -30,6 +31,7 @@ extern "C"
|
||||||
}
|
}
|
||||||
|
|
||||||
#include "../Vector3.h"
|
#include "../Vector3.h"
|
||||||
|
#include "../Defines.h"
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -222,625 +224,13 @@ public:
|
||||||
/** Retrieve value at a_StackPos, if it is a valid number. If not, a_Value is unchanged */
|
/** Retrieve value at a_StackPos, if it is a valid number. If not, a_Value is unchanged */
|
||||||
void GetStackValue(int a_StackPos, double & a_Value);
|
void GetStackValue(int a_StackPos, double & a_Value);
|
||||||
|
|
||||||
|
/** Retrieve value at a_StackPos, if it is a valid number, converting and clamping it to eWeather.
|
||||||
|
If not, a_Value is unchanged. */
|
||||||
|
void GetStackValue(int a_StackPos, eWeather & a_Value);
|
||||||
|
|
||||||
/** Call any 0-param 0-return Lua function in a single line: */
|
|
||||||
template <typename FnT>
|
|
||||||
bool Call(FnT a_FnName)
|
|
||||||
{
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
return CallFunction(0);
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 1-param 0-return Lua function in a single line: */
|
// Include the cLuaState::Call() overload implementation that is generated by the gen_LuaState_Call.lua script:
|
||||||
template<
|
#include "LuaState_Call.inc"
|
||||||
typename FnT,
|
|
||||||
typename ArgT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1)
|
|
||||||
{
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
return CallFunction(0);
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 2-param 0-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2)
|
|
||||||
{
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
return CallFunction(0);
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 3-param 0-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3)
|
|
||||||
{
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
return CallFunction(0);
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 0-param 1-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename RetT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, const cRet & a_Mark, RetT1 & a_Ret1)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
if (!CallFunction(1))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-1, a_Ret1);
|
|
||||||
lua_pop(m_LuaState, 1);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 1-param 1-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename RetT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, const cRet & a_Mark, RetT1 & a_Ret1)
|
|
||||||
{
|
|
||||||
int InitialTop = lua_gettop(m_LuaState);
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
if (!CallFunction(1))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-1, a_Ret1);
|
|
||||||
lua_pop(m_LuaState, 1);
|
|
||||||
ASSERT(InitialTop == lua_gettop(m_LuaState));
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 2-param 1-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename RetT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, const cRet & a_Mark, RetT1 & a_Ret1)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
if (!CallFunction(1))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-1, a_Ret1);
|
|
||||||
lua_pop(m_LuaState, 1);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 3-param 1-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename RetT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, const cRet & a_Mark, RetT1 & a_Ret1)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
if (!CallFunction(1))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-1, a_Ret1);
|
|
||||||
lua_pop(m_LuaState, 1);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 4-param 1-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename RetT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, const cRet & a_Mark, RetT1 & a_Ret1)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
if (!CallFunction(1))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-1, a_Ret1);
|
|
||||||
lua_pop(m_LuaState, 1);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 5-param 1-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5, typename RetT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, const cRet & a_Mark, RetT1 & a_Ret1)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
if (!CallFunction(1))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-1, a_Ret1);
|
|
||||||
lua_pop(m_LuaState, 1);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 6-param 1-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5, typename ArgT6,
|
|
||||||
typename RetT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, ArgT6 a_Arg6, const cRet & a_Mark, RetT1 & a_Ret1)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
Push(a_Arg6);
|
|
||||||
if (!CallFunction(1))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-1, a_Ret1);
|
|
||||||
lua_pop(m_LuaState, 1);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 7-param 1-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5, typename ArgT6,
|
|
||||||
typename ArgT7, typename RetT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, ArgT6 a_Arg6, ArgT7 a_Arg7, const cRet & a_Mark, RetT1 & a_Ret1)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
Push(a_Arg6);
|
|
||||||
Push(a_Arg7);
|
|
||||||
if (!CallFunction(1))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-1, a_Ret1);
|
|
||||||
lua_pop(m_LuaState, 1);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 8-param 1-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5, typename ArgT6,
|
|
||||||
typename ArgT7, typename ArgT8, typename RetT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, ArgT6 a_Arg6, ArgT7 a_Arg7, ArgT8 a_Arg8, const cRet & a_Mark, RetT1 & a_Ret1)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
Push(a_Arg6);
|
|
||||||
Push(a_Arg7);
|
|
||||||
Push(a_Arg8);
|
|
||||||
if (!CallFunction(1))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-1, a_Ret1);
|
|
||||||
lua_pop(m_LuaState, 1);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 9-param 1-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5, typename ArgT6,
|
|
||||||
typename ArgT7, typename ArgT8, typename ArgT9, typename RetT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, ArgT6 a_Arg6, ArgT7 a_Arg7, ArgT8 a_Arg8, ArgT9 a_Arg9, const cRet & a_Mark, RetT1 & a_Ret1)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
Push(a_Arg6);
|
|
||||||
Push(a_Arg7);
|
|
||||||
Push(a_Arg8);
|
|
||||||
Push(a_Arg9);
|
|
||||||
if (!CallFunction(1))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-1, a_Ret1);
|
|
||||||
lua_pop(m_LuaState, 1);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 10-param 1-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5, typename ArgT6,
|
|
||||||
typename ArgT7, typename ArgT8, typename ArgT9, typename ArgT10, typename RetT1
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, ArgT6 a_Arg6, ArgT7 a_Arg7, ArgT8 a_Arg8, ArgT9 a_Arg9, ArgT10 a_Arg10, const cRet & a_Mark, RetT1 & a_Ret1)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
Push(a_Arg6);
|
|
||||||
Push(a_Arg7);
|
|
||||||
Push(a_Arg8);
|
|
||||||
Push(a_Arg9);
|
|
||||||
Push(a_Arg10);
|
|
||||||
if (!CallFunction(1))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-1, a_Ret1);
|
|
||||||
lua_pop(m_LuaState, 1);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 1-param 2-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename RetT1, typename RetT2
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, const cRet & a_Mark, RetT1 & a_Ret1, RetT2 & a_Ret2)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
if (!CallFunction(2))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-2, a_Ret1);
|
|
||||||
GetStackValue(-1, a_Ret2);
|
|
||||||
lua_pop(m_LuaState, 2);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 2-param 2-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename RetT1, typename RetT2
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, const cRet & a_Mark, RetT1 & a_Ret1, RetT2 & a_Ret2)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
if (!CallFunction(2))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-2, a_Ret1);
|
|
||||||
GetStackValue(-1, a_Ret2);
|
|
||||||
lua_pop(m_LuaState, 2);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 3-param 2-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3,
|
|
||||||
typename RetT1, typename RetT2
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, const cRet & a_Mark, RetT1 & a_Ret1, RetT2 & a_Ret2)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
if (!CallFunction(2))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-2, a_Ret1);
|
|
||||||
GetStackValue(-1, a_Ret2);
|
|
||||||
lua_pop(m_LuaState, 2);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 4-param 2-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4,
|
|
||||||
typename RetT1, typename RetT2
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, const cRet & a_Mark, RetT1 & a_Ret1, RetT2 & a_Ret2)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
if (!CallFunction(2))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-2, a_Ret1);
|
|
||||||
GetStackValue(-1, a_Ret2);
|
|
||||||
lua_pop(m_LuaState, 2);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 5-param 2-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5,
|
|
||||||
typename RetT1, typename RetT2
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, const cRet & a_Mark, RetT1 & a_Ret1, RetT2 & a_Ret2)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
if (!CallFunction(2))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-2, a_Ret1);
|
|
||||||
GetStackValue(-1, a_Ret2);
|
|
||||||
lua_pop(m_LuaState, 2);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 6-param 2-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5,
|
|
||||||
typename ArgT6,
|
|
||||||
typename RetT1, typename RetT2
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, ArgT6 a_Arg6, const cRet & a_Mark, RetT1 & a_Ret1, RetT2 & a_Ret2)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
Push(a_Arg6);
|
|
||||||
if (!CallFunction(2))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-2, a_Ret1);
|
|
||||||
GetStackValue(-1, a_Ret2);
|
|
||||||
lua_pop(m_LuaState, 2);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 7-param 2-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5,
|
|
||||||
typename ArgT6, typename ArgT7,
|
|
||||||
typename RetT1, typename RetT2
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, ArgT6 a_Arg6, ArgT7 a_Arg7, const cRet & a_Mark, RetT1 & a_Ret1, RetT2 & a_Ret2)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
Push(a_Arg6);
|
|
||||||
Push(a_Arg7);
|
|
||||||
if (!CallFunction(2))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-2, a_Ret1);
|
|
||||||
GetStackValue(-1, a_Ret2);
|
|
||||||
lua_pop(m_LuaState, 2);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 7-param 3-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5,
|
|
||||||
typename ArgT6, typename ArgT7,
|
|
||||||
typename RetT1, typename RetT2, typename RetT3
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, ArgT6 a_Arg6, ArgT7 a_Arg7, const cRet & a_Mark, RetT1 & a_Ret1, RetT2 & a_Ret2, RetT3 & a_Ret3)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
Push(a_Arg6);
|
|
||||||
Push(a_Arg7);
|
|
||||||
if (!CallFunction(3))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-3, a_Ret1);
|
|
||||||
GetStackValue(-2, a_Ret2);
|
|
||||||
GetStackValue(-1, a_Ret3);
|
|
||||||
lua_pop(m_LuaState, 3);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 8-param 3-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5,
|
|
||||||
typename ArgT6, typename ArgT7, typename ArgT8,
|
|
||||||
typename RetT1, typename RetT2, typename RetT3
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, ArgT6 a_Arg6, ArgT7 a_Arg7, ArgT8 a_Arg8, const cRet & a_Mark, RetT1 & a_Ret1, RetT2 & a_Ret2, RetT3 & a_Ret3)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
Push(a_Arg6);
|
|
||||||
Push(a_Arg7);
|
|
||||||
Push(a_Arg8);
|
|
||||||
if (!CallFunction(3))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-3, a_Ret1);
|
|
||||||
GetStackValue(-2, a_Ret2);
|
|
||||||
GetStackValue(-1, a_Ret3);
|
|
||||||
lua_pop(m_LuaState, 3);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
/** Call any 9-param 5-return Lua function in a single line: */
|
|
||||||
template<
|
|
||||||
typename FnT, typename ArgT1, typename ArgT2, typename ArgT3, typename ArgT4, typename ArgT5,
|
|
||||||
typename ArgT6, typename ArgT7, typename ArgT8, typename ArgT9,
|
|
||||||
typename RetT1, typename RetT2, typename RetT3, typename RetT4, typename RetT5
|
|
||||||
>
|
|
||||||
bool Call(FnT a_FnName, ArgT1 a_Arg1, ArgT2 a_Arg2, ArgT3 a_Arg3, ArgT4 a_Arg4, ArgT5 a_Arg5, ArgT6 a_Arg6, ArgT7 a_Arg7, ArgT8 a_Arg8, ArgT9 a_Arg9, const cRet & a_Mark, RetT1 & a_Ret1, RetT2 & a_Ret2, RetT3 & a_Ret3, RetT4 & a_Ret4, RetT5 & a_Ret5)
|
|
||||||
{
|
|
||||||
UNUSED(a_Mark);
|
|
||||||
if (!PushFunction(a_FnName))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
Push(a_Arg1);
|
|
||||||
Push(a_Arg2);
|
|
||||||
Push(a_Arg3);
|
|
||||||
Push(a_Arg4);
|
|
||||||
Push(a_Arg5);
|
|
||||||
Push(a_Arg6);
|
|
||||||
Push(a_Arg7);
|
|
||||||
Push(a_Arg8);
|
|
||||||
Push(a_Arg9);
|
|
||||||
if (!CallFunction(5))
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
GetStackValue(-5, a_Ret1);
|
|
||||||
GetStackValue(-4, a_Ret2);
|
|
||||||
GetStackValue(-3, a_Ret3);
|
|
||||||
GetStackValue(-2, a_Ret4);
|
|
||||||
GetStackValue(-1, a_Ret5);
|
|
||||||
lua_pop(m_LuaState, 5);
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/** Returns true if the specified parameters on the stack are of the specified usertable type; also logs warning if not. Used for static functions */
|
/** Returns true if the specified parameters on the stack are of the specified usertable type; also logs warning if not. Used for static functions */
|
||||||
|
|
|
@ -13,7 +13,7 @@
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cLuaWindow:
|
// cLuaWindow:
|
||||||
|
|
||||||
cLuaWindow::cLuaWindow(cWindow::WindowType a_WindowType, int a_SlotsX, int a_SlotsY, const AString & a_Title) :
|
cLuaWindow::cLuaWindow(cWindow::WindowType a_WindowType, int a_SlotsX, int a_SlotsY, const AString & a_Title) :
|
||||||
|
|
|
@ -4,7 +4,7 @@
|
||||||
#include "ManualBindings.h"
|
#include "ManualBindings.h"
|
||||||
#undef TOLUA_TEMPLATE_BIND
|
#undef TOLUA_TEMPLATE_BIND
|
||||||
#include "tolua++/include/tolua++.h"
|
#include "tolua++/include/tolua++.h"
|
||||||
|
#include "polarssl/md5.h"
|
||||||
#include "Plugin.h"
|
#include "Plugin.h"
|
||||||
#include "PluginLua.h"
|
#include "PluginLua.h"
|
||||||
#include "PluginManager.h"
|
#include "PluginManager.h"
|
||||||
|
@ -25,7 +25,6 @@
|
||||||
#include "../BlockEntities/NoteEntity.h"
|
#include "../BlockEntities/NoteEntity.h"
|
||||||
#include "../BlockEntities/MobHeadEntity.h"
|
#include "../BlockEntities/MobHeadEntity.h"
|
||||||
#include "../BlockEntities/FlowerPotEntity.h"
|
#include "../BlockEntities/FlowerPotEntity.h"
|
||||||
#include "md5/md5.h"
|
|
||||||
#include "../LineBlockTracer.h"
|
#include "../LineBlockTracer.h"
|
||||||
#include "../WorldStorage/SchematicFileSerializer.h"
|
#include "../WorldStorage/SchematicFileSerializer.h"
|
||||||
#include "../CompositeChat.h"
|
#include "../CompositeChat.h"
|
||||||
|
@ -34,9 +33,7 @@
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
/****************************
|
// Better error reporting for Lua
|
||||||
* Better error reporting for Lua
|
|
||||||
**/
|
|
||||||
static int tolua_do_error(lua_State* L, const char * a_pMsg, tolua_Error * a_pToLuaError)
|
static int tolua_do_error(lua_State* L, const char * a_pMsg, tolua_Error * a_pToLuaError)
|
||||||
{
|
{
|
||||||
// Retrieve current function name
|
// Retrieve current function name
|
||||||
|
@ -82,10 +79,7 @@ static int lua_do_error(lua_State* L, const char * a_pFormat, ...)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
/****************************
|
// Lua bound functions with special return types
|
||||||
* Lua bound functions with special return types
|
|
||||||
**/
|
|
||||||
|
|
||||||
static int tolua_StringSplit(lua_State * tolua_S)
|
static int tolua_StringSplit(lua_State * tolua_S)
|
||||||
{
|
{
|
||||||
cLuaState LuaState(tolua_S);
|
cLuaState LuaState(tolua_S);
|
||||||
|
@ -558,10 +552,12 @@ static int tolua_DoWithXYZ(lua_State* tolua_S)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
template< class Ty1,
|
template<
|
||||||
|
class Ty1,
|
||||||
class Ty2,
|
class Ty2,
|
||||||
bool (Ty1::*Func1)(int, int, cItemCallback<Ty2> &) >
|
bool (Ty1::*Func1)(int, int, cItemCallback<Ty2> &)
|
||||||
static int tolua_ForEachInChunk(lua_State* tolua_S)
|
>
|
||||||
|
static int tolua_ForEachInChunk(lua_State * tolua_S)
|
||||||
{
|
{
|
||||||
int NumArgs = lua_gettop(tolua_S) - 1; /* This includes 'self' */
|
int NumArgs = lua_gettop(tolua_S) - 1; /* This includes 'self' */
|
||||||
if ((NumArgs != 3) && (NumArgs != 4))
|
if ((NumArgs != 3) && (NumArgs != 4))
|
||||||
|
@ -652,9 +648,11 @@ static int tolua_ForEachInChunk(lua_State* tolua_S)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
template< class Ty1,
|
template<
|
||||||
|
class Ty1,
|
||||||
class Ty2,
|
class Ty2,
|
||||||
bool (Ty1::*Func1)(cItemCallback<Ty2> &) >
|
bool (Ty1::*Func1)(cItemCallback<Ty2> &)
|
||||||
|
>
|
||||||
static int tolua_ForEach(lua_State * tolua_S)
|
static int tolua_ForEach(lua_State * tolua_S)
|
||||||
{
|
{
|
||||||
int NumArgs = lua_gettop(tolua_S) - 1; /* This includes 'self' */
|
int NumArgs = lua_gettop(tolua_S) - 1; /* This includes 'self' */
|
||||||
|
@ -2001,9 +1999,11 @@ static int tolua_cPlugin_Call(lua_State * tolua_S)
|
||||||
|
|
||||||
static int tolua_md5(lua_State* tolua_S)
|
static int tolua_md5(lua_State* tolua_S)
|
||||||
{
|
{
|
||||||
std::string SourceString = tolua_tostring(tolua_S, 1, 0);
|
unsigned char Output[16];
|
||||||
std::string CryptedString = md5( SourceString );
|
size_t len = 0;
|
||||||
tolua_pushstring( tolua_S, CryptedString.c_str() );
|
const unsigned char * SourceString = (const unsigned char *)lua_tolstring(tolua_S, 1, &len);
|
||||||
|
md5(SourceString, len, Output);
|
||||||
|
lua_pushlstring(tolua_S, (const char *)Output, ARRAYCOUNT(Output));
|
||||||
return 1;
|
return 1;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -2064,7 +2064,7 @@ static int tolua_get_HTTPRequest_FormData(lua_State* tolua_S)
|
||||||
{
|
{
|
||||||
lua_pushstring(tolua_S, it->first.c_str() );
|
lua_pushstring(tolua_S, it->first.c_str() );
|
||||||
tolua_pushusertype(tolua_S, &(it->second), "HTTPFormData" );
|
tolua_pushusertype(tolua_S, &(it->second), "HTTPFormData" );
|
||||||
//lua_pushlstring(tolua_S, it->second.Value.c_str(), it->second.Value.size() ); // Might contain binary data
|
// lua_pushlstring(tolua_S, it->second.Value.c_str(), it->second.Value.size() ); // Might contain binary data
|
||||||
lua_settable(tolua_S, top);
|
lua_settable(tolua_S, top);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -42,10 +42,7 @@ public:
|
||||||
// Called each tick
|
// Called each tick
|
||||||
virtual void Tick(float a_Dt) = 0;
|
virtual void Tick(float a_Dt) = 0;
|
||||||
|
|
||||||
/**
|
/** Calls the specified hook with the params given. Returns the bool that the hook callback returns.*/
|
||||||
* On all these functions, return true if you want to override default behavior and not call other plugins on that callback.
|
|
||||||
* You can also return false, so default behavior is used.
|
|
||||||
**/
|
|
||||||
virtual bool OnBlockSpread (cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source) = 0;
|
virtual bool OnBlockSpread (cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source) = 0;
|
||||||
virtual bool OnBlockToPickups (cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) = 0;
|
virtual bool OnBlockToPickups (cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) = 0;
|
||||||
virtual bool OnChat (cPlayer * a_Player, AString & a_Message) = 0;
|
virtual bool OnChat (cPlayer * a_Player, AString & a_Message) = 0;
|
||||||
|
@ -57,13 +54,14 @@ public:
|
||||||
virtual bool OnCollectingPickup (cPlayer * a_Player, cPickup * a_Pickup) = 0;
|
virtual bool OnCollectingPickup (cPlayer * a_Player, cPickup * a_Pickup) = 0;
|
||||||
virtual bool OnCraftingNoRecipe (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0;
|
virtual bool OnCraftingNoRecipe (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0;
|
||||||
virtual bool OnDisconnect (cClientHandle & a_Client, const AString & a_Reason) = 0;
|
virtual bool OnDisconnect (cClientHandle & a_Client, const AString & a_Reason) = 0;
|
||||||
|
virtual bool OnEntityAddEffect (cEntity & a_Entity, int a_EffectType, int a_EffectDurationTicks, int a_EffectIntensity, double a_DistanceModifier) = 0;
|
||||||
virtual bool OnExecuteCommand (cPlayer * a_Player, const AStringVector & a_Split) = 0;
|
virtual bool OnExecuteCommand (cPlayer * a_Player, const AStringVector & a_Split) = 0;
|
||||||
virtual bool OnExploded (cWorld & a_World, double a_ExplosionSize, bool a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData) = 0;
|
virtual bool OnExploded (cWorld & a_World, double a_ExplosionSize, bool a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData) = 0;
|
||||||
virtual bool OnExploding (cWorld & a_World, double & a_ExplosionSize, bool & a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData) = 0;
|
virtual bool OnExploding (cWorld & a_World, double & a_ExplosionSize, bool & a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData) = 0;
|
||||||
virtual bool OnHandshake (cClientHandle * a_Client, const AString & a_Username) = 0;
|
virtual bool OnHandshake (cClientHandle * a_Client, const AString & a_Username) = 0;
|
||||||
virtual bool OnHopperPullingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_DstSlotNum, cBlockEntityWithItems & a_SrcEntity, int a_SrcSlotNum) = 0;
|
virtual bool OnHopperPullingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_DstSlotNum, cBlockEntityWithItems & a_SrcEntity, int a_SrcSlotNum) = 0;
|
||||||
virtual bool OnHopperPushingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_SrcSlotNum, cBlockEntityWithItems & a_DstEntity, int a_DstSlotNum) = 0;
|
virtual bool OnHopperPushingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_SrcSlotNum, cBlockEntityWithItems & a_DstEntity, int a_DstSlotNum) = 0;
|
||||||
virtual bool OnKilling (cEntity & a_Victim, cEntity * a_Killer) = 0;
|
virtual bool OnKilling (cEntity & a_Victim, cEntity * a_Killer, TakeDamageInfo & a_TDI) = 0;
|
||||||
virtual bool OnLogin (cClientHandle * a_Client, int a_ProtocolVersion, const AString & a_Username) = 0;
|
virtual bool OnLogin (cClientHandle * a_Client, int a_ProtocolVersion, const AString & a_Username) = 0;
|
||||||
virtual bool OnPlayerAnimation (cPlayer & a_Player, int a_Animation) = 0;
|
virtual bool OnPlayerAnimation (cPlayer & a_Player, int a_Animation) = 0;
|
||||||
virtual bool OnPlayerBreakingBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) = 0;
|
virtual bool OnPlayerBreakingBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) = 0;
|
||||||
|
@ -72,6 +70,7 @@ public:
|
||||||
virtual bool OnPlayerEating (cPlayer & a_Player) = 0;
|
virtual bool OnPlayerEating (cPlayer & a_Player) = 0;
|
||||||
virtual bool OnPlayerFished (cPlayer & a_Player, const cItems & a_Reward) = 0;
|
virtual bool OnPlayerFished (cPlayer & a_Player, const cItems & a_Reward) = 0;
|
||||||
virtual bool OnPlayerFishing (cPlayer & a_Player, cItems & a_Reward) = 0;
|
virtual bool OnPlayerFishing (cPlayer & a_Player, cItems & a_Reward) = 0;
|
||||||
|
virtual bool OnPlayerFoodLevelChange (cPlayer & a_Player, int a_NewFoodLevel) = 0;
|
||||||
virtual bool OnPlayerJoined (cPlayer & a_Player) = 0;
|
virtual bool OnPlayerJoined (cPlayer & a_Player) = 0;
|
||||||
virtual bool OnPlayerLeftClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, char a_Status) = 0;
|
virtual bool OnPlayerLeftClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, char a_Status) = 0;
|
||||||
virtual bool OnPlayerMoved (cPlayer & a_Player) = 0;
|
virtual bool OnPlayerMoved (cPlayer & a_Player) = 0;
|
||||||
|
|
|
@ -25,7 +25,7 @@ extern "C"
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cPluginLua:
|
// cPluginLua:
|
||||||
|
|
||||||
cPluginLua::cPluginLua(const AString & a_PluginDirectory) :
|
cPluginLua::cPluginLua(const AString & a_PluginDirectory) :
|
||||||
|
@ -420,6 +420,26 @@ bool cPluginLua::OnDisconnect(cClientHandle & a_Client, const AString & a_Reason
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
bool cPluginLua::OnEntityAddEffect(cEntity & a_Entity, int a_EffectType, int a_EffectDurationTicks, int a_EffectIntensity, double a_DistanceModifier)
|
||||||
|
{
|
||||||
|
cCSLock Lock(m_CriticalSection);
|
||||||
|
bool res = false;
|
||||||
|
cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_ENTITY_ADD_EFFECT];
|
||||||
|
for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
|
||||||
|
{
|
||||||
|
m_LuaState.Call((int)(**itr), &a_Entity, a_EffectType, a_EffectDurationTicks, a_EffectIntensity, a_DistanceModifier, cLuaState::Return, res);
|
||||||
|
if (res)
|
||||||
|
{
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cPluginLua::OnExecuteCommand(cPlayer * a_Player, const AStringVector & a_Split)
|
bool cPluginLua::OnExecuteCommand(cPlayer * a_Player, const AStringVector & a_Split)
|
||||||
{
|
{
|
||||||
cCSLock Lock(m_CriticalSection);
|
cCSLock Lock(m_CriticalSection);
|
||||||
|
@ -575,14 +595,14 @@ bool cPluginLua::OnHopperPushingItem(cWorld & a_World, cHopperEntity & a_Hopper,
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cPluginLua::OnKilling(cEntity & a_Victim, cEntity * a_Killer)
|
bool cPluginLua::OnKilling(cEntity & a_Victim, cEntity * a_Killer, TakeDamageInfo & a_TDI)
|
||||||
{
|
{
|
||||||
cCSLock Lock(m_CriticalSection);
|
cCSLock Lock(m_CriticalSection);
|
||||||
bool res = false;
|
bool res = false;
|
||||||
cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_KILLING];
|
cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_KILLING];
|
||||||
for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
|
for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
|
||||||
{
|
{
|
||||||
m_LuaState.Call((int)(**itr), &a_Victim, a_Killer, cLuaState::Return, res);
|
m_LuaState.Call((int)(**itr), &a_Victim, a_Killer, &a_TDI, cLuaState::Return, res);
|
||||||
if (res)
|
if (res)
|
||||||
{
|
{
|
||||||
return true;
|
return true;
|
||||||
|
@ -715,6 +735,26 @@ bool cPluginLua::OnPlayerEating(cPlayer & a_Player)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
bool cPluginLua::OnPlayerFoodLevelChange(cPlayer & a_Player, int a_NewFoodLevel)
|
||||||
|
{
|
||||||
|
cCSLock Lock(m_CriticalSection);
|
||||||
|
bool res = false;
|
||||||
|
cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PLAYER_FOOD_LEVEL_CHANGE];
|
||||||
|
for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
|
||||||
|
{
|
||||||
|
m_LuaState.Call((int)(**itr), &a_Player, a_NewFoodLevel, cLuaState::Return, res);
|
||||||
|
if (res)
|
||||||
|
{
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cPluginLua::OnPlayerFished(cPlayer & a_Player, const cItems & a_Reward)
|
bool cPluginLua::OnPlayerFished(cPlayer & a_Player, const cItems & a_Reward)
|
||||||
{
|
{
|
||||||
cCSLock Lock(m_CriticalSection);
|
cCSLock Lock(m_CriticalSection);
|
||||||
|
@ -1327,18 +1367,15 @@ bool cPluginLua::OnWeatherChanging(cWorld & a_World, eWeather & a_NewWeather)
|
||||||
{
|
{
|
||||||
cCSLock Lock(m_CriticalSection);
|
cCSLock Lock(m_CriticalSection);
|
||||||
bool res = false;
|
bool res = false;
|
||||||
int NewWeather = a_NewWeather;
|
|
||||||
cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_WEATHER_CHANGING];
|
cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_WEATHER_CHANGING];
|
||||||
for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
|
for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
|
||||||
{
|
{
|
||||||
m_LuaState.Call((int)(**itr), &a_World, NewWeather, cLuaState::Return, res, NewWeather);
|
m_LuaState.Call((int)(**itr), &a_World, a_NewWeather, cLuaState::Return, res, a_NewWeather);
|
||||||
if (res)
|
if (res)
|
||||||
{
|
{
|
||||||
a_NewWeather = (eWeather)NewWeather;
|
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
a_NewWeather = (eWeather)NewWeather;
|
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -1507,6 +1544,7 @@ const char * cPluginLua::GetHookFnName(int a_HookType)
|
||||||
case cPluginManager::HOOK_CRAFTING_NO_RECIPE: return "OnCraftingNoRecipe";
|
case cPluginManager::HOOK_CRAFTING_NO_RECIPE: return "OnCraftingNoRecipe";
|
||||||
case cPluginManager::HOOK_DISCONNECT: return "OnDisconnect";
|
case cPluginManager::HOOK_DISCONNECT: return "OnDisconnect";
|
||||||
case cPluginManager::HOOK_PLAYER_ANIMATION: return "OnPlayerAnimation";
|
case cPluginManager::HOOK_PLAYER_ANIMATION: return "OnPlayerAnimation";
|
||||||
|
case cPluginManager::HOOK_ENTITY_ADD_EFFECT: return "OnEntityAddEffect";
|
||||||
case cPluginManager::HOOK_EXECUTE_COMMAND: return "OnExecuteCommand";
|
case cPluginManager::HOOK_EXECUTE_COMMAND: return "OnExecuteCommand";
|
||||||
case cPluginManager::HOOK_HANDSHAKE: return "OnHandshake";
|
case cPluginManager::HOOK_HANDSHAKE: return "OnHandshake";
|
||||||
case cPluginManager::HOOK_KILLING: return "OnKilling";
|
case cPluginManager::HOOK_KILLING: return "OnKilling";
|
||||||
|
@ -1714,7 +1752,7 @@ bool cPluginLua::CallbackWindowClosing(int a_FnRef, cWindow & a_Window, cPlayer
|
||||||
ASSERT(a_FnRef != LUA_REFNIL);
|
ASSERT(a_FnRef != LUA_REFNIL);
|
||||||
|
|
||||||
cCSLock Lock(m_CriticalSection);
|
cCSLock Lock(m_CriticalSection);
|
||||||
bool res;
|
bool res = false;
|
||||||
m_LuaState.Call(a_FnRef, &a_Window, &a_Player, a_CanRefuse, cLuaState::Return, res);
|
m_LuaState.Call(a_FnRef, &a_Window, &a_Player, a_CanRefuse, cLuaState::Return, res);
|
||||||
return res;
|
return res;
|
||||||
}
|
}
|
||||||
|
|
|
@ -80,13 +80,14 @@ public:
|
||||||
virtual bool OnCollectingPickup (cPlayer * a_Player, cPickup * a_Pickup) override;
|
virtual bool OnCollectingPickup (cPlayer * a_Player, cPickup * a_Pickup) override;
|
||||||
virtual bool OnCraftingNoRecipe (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override;
|
virtual bool OnCraftingNoRecipe (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override;
|
||||||
virtual bool OnDisconnect (cClientHandle & a_Client, const AString & a_Reason) override;
|
virtual bool OnDisconnect (cClientHandle & a_Client, const AString & a_Reason) override;
|
||||||
|
virtual bool OnEntityAddEffect (cEntity & a_Entity, int a_EffectType, int a_EffectDurationTicks, int a_EffectIntensity, double a_DistanceModifier) override;
|
||||||
virtual bool OnExecuteCommand (cPlayer * a_Player, const AStringVector & a_Split) override;
|
virtual bool OnExecuteCommand (cPlayer * a_Player, const AStringVector & a_Split) override;
|
||||||
virtual bool OnExploded (cWorld & a_World, double a_ExplosionSize, bool a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData) override;
|
virtual bool OnExploded (cWorld & a_World, double a_ExplosionSize, bool a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData) override;
|
||||||
virtual bool OnExploding (cWorld & a_World, double & a_ExplosionSize, bool & a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData) override;
|
virtual bool OnExploding (cWorld & a_World, double & a_ExplosionSize, bool & a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData) override;
|
||||||
virtual bool OnHandshake (cClientHandle * a_Client, const AString & a_Username) override;
|
virtual bool OnHandshake (cClientHandle * a_Client, const AString & a_Username) override;
|
||||||
virtual bool OnHopperPullingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_DstSlotNum, cBlockEntityWithItems & a_SrcEntity, int a_SrcSlotNum) override;
|
virtual bool OnHopperPullingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_DstSlotNum, cBlockEntityWithItems & a_SrcEntity, int a_SrcSlotNum) override;
|
||||||
virtual bool OnHopperPushingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_SrcSlotNum, cBlockEntityWithItems & a_DstEntity, int a_DstSlotNum) override;
|
virtual bool OnHopperPushingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_SrcSlotNum, cBlockEntityWithItems & a_DstEntity, int a_DstSlotNum) override;
|
||||||
virtual bool OnKilling (cEntity & a_Victim, cEntity * a_Killer) override;
|
virtual bool OnKilling (cEntity & a_Victim, cEntity * a_Killer, TakeDamageInfo & a_TDI) override;
|
||||||
virtual bool OnLogin (cClientHandle * a_Client, int a_ProtocolVersion, const AString & a_Username) override;
|
virtual bool OnLogin (cClientHandle * a_Client, int a_ProtocolVersion, const AString & a_Username) override;
|
||||||
virtual bool OnPlayerAnimation (cPlayer & a_Player, int a_Animation) override;
|
virtual bool OnPlayerAnimation (cPlayer & a_Player, int a_Animation) override;
|
||||||
virtual bool OnPlayerBreakingBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override;
|
virtual bool OnPlayerBreakingBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override;
|
||||||
|
@ -95,6 +96,7 @@ public:
|
||||||
virtual bool OnPlayerEating (cPlayer & a_Player) override;
|
virtual bool OnPlayerEating (cPlayer & a_Player) override;
|
||||||
virtual bool OnPlayerFished (cPlayer & a_Player, const cItems & a_Reward) override;
|
virtual bool OnPlayerFished (cPlayer & a_Player, const cItems & a_Reward) override;
|
||||||
virtual bool OnPlayerFishing (cPlayer & a_Player, cItems & a_Reward) override;
|
virtual bool OnPlayerFishing (cPlayer & a_Player, cItems & a_Reward) override;
|
||||||
|
virtual bool OnPlayerFoodLevelChange (cPlayer & a_Player, int a_NewFoodLevel) override;
|
||||||
virtual bool OnPlayerJoined (cPlayer & a_Player) override;
|
virtual bool OnPlayerJoined (cPlayer & a_Player) override;
|
||||||
virtual bool OnPlayerMoved (cPlayer & a_Player) override;
|
virtual bool OnPlayerMoved (cPlayer & a_Player) override;
|
||||||
virtual bool OnPlayerLeftClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, char a_Status) override;
|
virtual bool OnPlayerLeftClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, char a_Status) override;
|
||||||
|
|
|
@ -257,18 +257,44 @@ bool cPluginManager::CallHookBlockToPickups(
|
||||||
|
|
||||||
bool cPluginManager::CallHookChat(cPlayer * a_Player, AString & a_Message)
|
bool cPluginManager::CallHookChat(cPlayer * a_Player, AString & a_Message)
|
||||||
{
|
{
|
||||||
bool WasCommandForbidden = false;
|
// Check if the message contains a command, execute it:
|
||||||
if (HandleCommand(a_Player, a_Message, true, WasCommandForbidden)) // We use HandleCommand as opposed to ExecuteCommand to accomodate the need to the WasCommandForbidden bool
|
switch (HandleCommand(a_Player, a_Message, true))
|
||||||
{
|
{
|
||||||
return true; // Chat message was handled as command
|
case crExecuted:
|
||||||
}
|
|
||||||
else if (WasCommandForbidden) // Couldn't be handled as command, was it because of insufficient permissions?
|
|
||||||
{
|
{
|
||||||
return true; // Yes - message was sent in HandleCommand, abort
|
// The command has executed successfully
|
||||||
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
// Check if it was a standard command (starts with a slash)
|
case crBlocked:
|
||||||
// If it was, we know that it was completely unrecognised (WasCommandForbidden == false)
|
{
|
||||||
|
// The command was blocked by a plugin using HOOK_EXECUTE_COMMAND
|
||||||
|
// The plugin has most likely sent a message to the player already
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
case crError:
|
||||||
|
{
|
||||||
|
// An error in the plugin has prevented the command from executing. Report the error to the player:
|
||||||
|
a_Player->SendMessageFailure(Printf("Something went wrong while executing command \"%s\"", a_Message.c_str()));
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
case crNoPermission:
|
||||||
|
{
|
||||||
|
// The player is not allowed to execute this command
|
||||||
|
a_Player->SendMessageFailure(Printf("Forbidden command; insufficient privileges: \"%s\"", a_Message.c_str()));
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
case crUnknownCommand:
|
||||||
|
{
|
||||||
|
// This was not a known command, keep processing as a message
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check if the message is a command (starts with a slash). If it is, we know that it wasn't recognised:
|
||||||
if (!a_Message.empty() && (a_Message[0] == '/'))
|
if (!a_Message.empty() && (a_Message[0] == '/'))
|
||||||
{
|
{
|
||||||
AStringVector Split(StringSplit(a_Message, " "));
|
AStringVector Split(StringSplit(a_Message, " "));
|
||||||
|
@ -448,6 +474,27 @@ bool cPluginManager::CallHookDisconnect(cClientHandle & a_Client, const AString
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
bool cPluginManager::CallHookEntityAddEffect(cEntity & a_Entity, int a_EffectType, int a_EffectDurationTicks, int a_EffectIntensity, double a_DistanceModifier)
|
||||||
|
{
|
||||||
|
HookMap::iterator Plugins = m_Hooks.find(HOOK_ENTITY_ADD_EFFECT);
|
||||||
|
if (Plugins == m_Hooks.end())
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
|
||||||
|
{
|
||||||
|
if ((*itr)->OnEntityAddEffect(a_Entity, a_EffectType, a_EffectDurationTicks, a_EffectIntensity, a_DistanceModifier))
|
||||||
|
{
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cPluginManager::CallHookExecuteCommand(cPlayer * a_Player, const AStringVector & a_Split)
|
bool cPluginManager::CallHookExecuteCommand(cPlayer * a_Player, const AStringVector & a_Split)
|
||||||
{
|
{
|
||||||
FIND_HOOK(HOOK_EXECUTE_COMMAND);
|
FIND_HOOK(HOOK_EXECUTE_COMMAND);
|
||||||
|
@ -562,14 +609,14 @@ bool cPluginManager::CallHookHopperPushingItem(cWorld & a_World, cHopperEntity &
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cPluginManager::CallHookKilling(cEntity & a_Victim, cEntity * a_Killer)
|
bool cPluginManager::CallHookKilling(cEntity & a_Victim, cEntity * a_Killer, TakeDamageInfo & a_TDI)
|
||||||
{
|
{
|
||||||
FIND_HOOK(HOOK_KILLING);
|
FIND_HOOK(HOOK_KILLING);
|
||||||
VERIFY_HOOK;
|
VERIFY_HOOK;
|
||||||
|
|
||||||
for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
|
for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
|
||||||
{
|
{
|
||||||
if ((*itr)->OnKilling(a_Victim, a_Killer))
|
if ((*itr)->OnKilling(a_Victim, a_Killer, a_TDI))
|
||||||
{
|
{
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
@ -695,6 +742,25 @@ bool cPluginManager::CallHookPlayerEating(cPlayer & a_Player)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
bool cPluginManager::CallHookPlayerFoodLevelChange(cPlayer & a_Player, int a_NewFoodLevel)
|
||||||
|
{
|
||||||
|
FIND_HOOK(HOOK_PLAYER_FOOD_LEVEL_CHANGE);
|
||||||
|
VERIFY_HOOK;
|
||||||
|
|
||||||
|
for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
|
||||||
|
{
|
||||||
|
if ((*itr)->OnPlayerFoodLevelChange(a_Player, a_NewFoodLevel))
|
||||||
|
{
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cPluginManager::CallHookPlayerFished(cPlayer & a_Player, const cItems a_Reward)
|
bool cPluginManager::CallHookPlayerFished(cPlayer & a_Player, const cItems a_Reward)
|
||||||
{
|
{
|
||||||
FIND_HOOK(HOOK_PLAYER_FISHED);
|
FIND_HOOK(HOOK_PLAYER_FISHED);
|
||||||
|
@ -1318,28 +1384,28 @@ bool cPluginManager::CallHookWorldTick(cWorld & a_World, float a_Dt, int a_LastT
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cPluginManager::HandleCommand(cPlayer * a_Player, const AString & a_Command, bool a_ShouldCheckPermissions, bool & a_WasCommandForbidden)
|
cPluginManager::CommandResult cPluginManager::HandleCommand(cPlayer * a_Player, const AString & a_Command, bool a_ShouldCheckPermissions)
|
||||||
{
|
{
|
||||||
ASSERT(a_Player != NULL);
|
ASSERT(a_Player != NULL);
|
||||||
|
|
||||||
AStringVector Split(StringSplit(a_Command, " "));
|
AStringVector Split(StringSplit(a_Command, " "));
|
||||||
if (Split.empty())
|
if (Split.empty())
|
||||||
{
|
{
|
||||||
return false;
|
return crUnknownCommand;
|
||||||
}
|
}
|
||||||
|
|
||||||
CommandMap::iterator cmd = m_Commands.find(Split[0]);
|
CommandMap::iterator cmd = m_Commands.find(Split[0]);
|
||||||
if (cmd == m_Commands.end())
|
if (cmd == m_Commands.end())
|
||||||
{
|
{
|
||||||
// Command not found
|
// Command not found
|
||||||
return false;
|
return crUnknownCommand;
|
||||||
}
|
}
|
||||||
|
|
||||||
// Ask plugins first if a command is okay to execute the command:
|
// Ask plugins first if a command is okay to execute the command:
|
||||||
if (CallHookExecuteCommand(a_Player, Split))
|
if (CallHookExecuteCommand(a_Player, Split))
|
||||||
{
|
{
|
||||||
LOGINFO("Player %s tried executing command \"%s\" that was stopped by the HOOK_EXECUTE_COMMAND hook", a_Player->GetName().c_str(), Split[0].c_str());
|
LOGINFO("Player %s tried executing command \"%s\" that was stopped by the HOOK_EXECUTE_COMMAND hook", a_Player->GetName().c_str(), Split[0].c_str());
|
||||||
return false;
|
return crBlocked;
|
||||||
}
|
}
|
||||||
|
|
||||||
if (
|
if (
|
||||||
|
@ -1348,15 +1414,18 @@ bool cPluginManager::HandleCommand(cPlayer * a_Player, const AString & a_Command
|
||||||
!a_Player->HasPermission(cmd->second.m_Permission)
|
!a_Player->HasPermission(cmd->second.m_Permission)
|
||||||
)
|
)
|
||||||
{
|
{
|
||||||
a_Player->SendMessageFailure(Printf("Forbidden command; insufficient privileges: \"%s\"", Split[0].c_str()));
|
|
||||||
LOGINFO("Player %s tried to execute forbidden command: \"%s\"", a_Player->GetName().c_str(), Split[0].c_str());
|
LOGINFO("Player %s tried to execute forbidden command: \"%s\"", a_Player->GetName().c_str(), Split[0].c_str());
|
||||||
a_WasCommandForbidden = true;
|
return crNoPermission;
|
||||||
return false;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
ASSERT(cmd->second.m_Plugin != NULL);
|
ASSERT(cmd->second.m_Plugin != NULL);
|
||||||
|
|
||||||
return cmd->second.m_Plugin->HandleCommand(Split, a_Player);
|
if (!cmd->second.m_Plugin->HandleCommand(Split, a_Player))
|
||||||
|
{
|
||||||
|
return crError;
|
||||||
|
}
|
||||||
|
|
||||||
|
return crExecuted;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -1554,7 +1623,7 @@ AString cPluginManager::GetCommandPermission(const AString & a_Command)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cPluginManager::ExecuteCommand(cPlayer * a_Player, const AString & a_Command)
|
cPluginManager::CommandResult cPluginManager::ExecuteCommand(cPlayer * a_Player, const AString & a_Command)
|
||||||
{
|
{
|
||||||
return HandleCommand(a_Player, a_Command, true);
|
return HandleCommand(a_Player, a_Command, true);
|
||||||
}
|
}
|
||||||
|
@ -1563,7 +1632,7 @@ bool cPluginManager::ExecuteCommand(cPlayer * a_Player, const AString & a_Comman
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cPluginManager::ForceExecuteCommand(cPlayer * a_Player, const AString & a_Command)
|
cPluginManager::CommandResult cPluginManager::ForceExecuteCommand(cPlayer * a_Player, const AString & a_Command)
|
||||||
{
|
{
|
||||||
return HandleCommand(a_Player, a_Command, false);
|
return HandleCommand(a_Player, a_Command, false);
|
||||||
}
|
}
|
||||||
|
|
|
@ -51,14 +51,25 @@ class cBlockEntityWithItems;
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
class cPluginManager // tolua_export
|
// tolua_begin
|
||||||
{ // tolua_export
|
class cPluginManager
|
||||||
public: // tolua_export
|
{
|
||||||
|
public:
|
||||||
|
// tolua_end
|
||||||
|
|
||||||
// Called each tick
|
// Called each tick
|
||||||
virtual void Tick(float a_Dt);
|
virtual void Tick(float a_Dt);
|
||||||
|
|
||||||
// tolua_begin
|
// tolua_begin
|
||||||
|
enum CommandResult
|
||||||
|
{
|
||||||
|
crExecuted,
|
||||||
|
crUnknownCommand,
|
||||||
|
crError,
|
||||||
|
crBlocked,
|
||||||
|
crNoPermission,
|
||||||
|
} ;
|
||||||
|
|
||||||
enum PluginHook
|
enum PluginHook
|
||||||
{
|
{
|
||||||
HOOK_BLOCK_SPREAD,
|
HOOK_BLOCK_SPREAD,
|
||||||
|
@ -73,6 +84,7 @@ public: // tolua_export
|
||||||
HOOK_CRAFTING_NO_RECIPE,
|
HOOK_CRAFTING_NO_RECIPE,
|
||||||
HOOK_DISCONNECT,
|
HOOK_DISCONNECT,
|
||||||
HOOK_PLAYER_ANIMATION,
|
HOOK_PLAYER_ANIMATION,
|
||||||
|
HOOK_ENTITY_ADD_EFFECT,
|
||||||
HOOK_EXECUTE_COMMAND,
|
HOOK_EXECUTE_COMMAND,
|
||||||
HOOK_EXPLODED,
|
HOOK_EXPLODED,
|
||||||
HOOK_EXPLODING,
|
HOOK_EXPLODING,
|
||||||
|
@ -87,6 +99,7 @@ public: // tolua_export
|
||||||
HOOK_PLAYER_EATING,
|
HOOK_PLAYER_EATING,
|
||||||
HOOK_PLAYER_FISHED,
|
HOOK_PLAYER_FISHED,
|
||||||
HOOK_PLAYER_FISHING,
|
HOOK_PLAYER_FISHING,
|
||||||
|
HOOK_PLAYER_FOOD_LEVEL_CHANGE,
|
||||||
HOOK_PLAYER_JOINED,
|
HOOK_PLAYER_JOINED,
|
||||||
HOOK_PLAYER_LEFT_CLICK,
|
HOOK_PLAYER_LEFT_CLICK,
|
||||||
HOOK_PLAYER_MOVING,
|
HOOK_PLAYER_MOVING,
|
||||||
|
@ -153,8 +166,10 @@ public: // tolua_export
|
||||||
cPlugin * GetPlugin( const AString & a_Plugin ) const; // tolua_export
|
cPlugin * GetPlugin( const AString & a_Plugin ) const; // tolua_export
|
||||||
const PluginMap & GetAllPlugins() const; // >> EXPORTED IN MANUALBINDINGS <<
|
const PluginMap & GetAllPlugins() const; // >> EXPORTED IN MANUALBINDINGS <<
|
||||||
|
|
||||||
void FindPlugins(); // tolua_export
|
// tolua_begin
|
||||||
void ReloadPlugins(); // tolua_export
|
void FindPlugins();
|
||||||
|
void ReloadPlugins();
|
||||||
|
// tolua_end
|
||||||
|
|
||||||
/** Adds the plugin to the list of plugins called for the specified hook type. Handles multiple adds as a single add */
|
/** Adds the plugin to the list of plugins called for the specified hook type. Handles multiple adds as a single add */
|
||||||
void AddHook(cPlugin * a_Plugin, int a_HookType);
|
void AddHook(cPlugin * a_Plugin, int a_HookType);
|
||||||
|
@ -173,13 +188,14 @@ public: // tolua_export
|
||||||
bool CallHookCollectingPickup (cPlayer * a_Player, cPickup & a_Pickup);
|
bool CallHookCollectingPickup (cPlayer * a_Player, cPickup & a_Pickup);
|
||||||
bool CallHookCraftingNoRecipe (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe);
|
bool CallHookCraftingNoRecipe (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe);
|
||||||
bool CallHookDisconnect (cClientHandle & a_Client, const AString & a_Reason);
|
bool CallHookDisconnect (cClientHandle & a_Client, const AString & a_Reason);
|
||||||
|
bool CallHookEntityAddEffect (cEntity & a_Entity, int a_EffectType, int a_EffectDurationTicks, int a_EffectIntensity, double a_DistanceModifier);
|
||||||
bool CallHookExecuteCommand (cPlayer * a_Player, const AStringVector & a_Split); // If a_Player == NULL, it is a console cmd
|
bool CallHookExecuteCommand (cPlayer * a_Player, const AStringVector & a_Split); // If a_Player == NULL, it is a console cmd
|
||||||
bool CallHookExploded (cWorld & a_World, double a_ExplosionSize, bool a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData);
|
bool CallHookExploded (cWorld & a_World, double a_ExplosionSize, bool a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData);
|
||||||
bool CallHookExploding (cWorld & a_World, double & a_ExplosionSize, bool & a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData);
|
bool CallHookExploding (cWorld & a_World, double & a_ExplosionSize, bool & a_CanCauseFire, double a_X, double a_Y, double a_Z, eExplosionSource a_Source, void * a_SourceData);
|
||||||
bool CallHookHandshake (cClientHandle * a_ClientHandle, const AString & a_Username);
|
bool CallHookHandshake (cClientHandle * a_ClientHandle, const AString & a_Username);
|
||||||
bool CallHookHopperPullingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_DstSlotNum, cBlockEntityWithItems & a_SrcEntity, int a_SrcSlotNum);
|
bool CallHookHopperPullingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_DstSlotNum, cBlockEntityWithItems & a_SrcEntity, int a_SrcSlotNum);
|
||||||
bool CallHookHopperPushingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_SrcSlotNum, cBlockEntityWithItems & a_DstEntity, int a_DstSlotNum);
|
bool CallHookHopperPushingItem (cWorld & a_World, cHopperEntity & a_Hopper, int a_SrcSlotNum, cBlockEntityWithItems & a_DstEntity, int a_DstSlotNum);
|
||||||
bool CallHookKilling (cEntity & a_Victim, cEntity * a_Killer);
|
bool CallHookKilling (cEntity & a_Victim, cEntity * a_Killer, TakeDamageInfo & a_TDI);
|
||||||
bool CallHookLogin (cClientHandle * a_Client, int a_ProtocolVersion, const AString & a_Username);
|
bool CallHookLogin (cClientHandle * a_Client, int a_ProtocolVersion, const AString & a_Username);
|
||||||
bool CallHookPlayerAnimation (cPlayer & a_Player, int a_Animation);
|
bool CallHookPlayerAnimation (cPlayer & a_Player, int a_Animation);
|
||||||
bool CallHookPlayerBreakingBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta);
|
bool CallHookPlayerBreakingBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta);
|
||||||
|
@ -188,6 +204,7 @@ public: // tolua_export
|
||||||
bool CallHookPlayerEating (cPlayer & a_Player);
|
bool CallHookPlayerEating (cPlayer & a_Player);
|
||||||
bool CallHookPlayerFished (cPlayer & a_Player, const cItems a_Reward);
|
bool CallHookPlayerFished (cPlayer & a_Player, const cItems a_Reward);
|
||||||
bool CallHookPlayerFishing (cPlayer & a_Player, cItems a_Reward);
|
bool CallHookPlayerFishing (cPlayer & a_Player, cItems a_Reward);
|
||||||
|
bool CallHookPlayerFoodLevelChange (cPlayer & a_Player, int a_NewFoodLevel);
|
||||||
bool CallHookPlayerJoined (cPlayer & a_Player);
|
bool CallHookPlayerJoined (cPlayer & a_Player);
|
||||||
bool CallHookPlayerMoving (cPlayer & a_Player);
|
bool CallHookPlayerMoving (cPlayer & a_Player);
|
||||||
bool CallHookPlayerLeftClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, char a_Status);
|
bool CallHookPlayerLeftClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, char a_Status);
|
||||||
|
@ -244,11 +261,11 @@ public: // tolua_export
|
||||||
/** Returns the permission needed for the specified command; empty string if command not found */
|
/** Returns the permission needed for the specified command; empty string if command not found */
|
||||||
AString GetCommandPermission(const AString & a_Command); // tolua_export
|
AString GetCommandPermission(const AString & a_Command); // tolua_export
|
||||||
|
|
||||||
/** Executes the command, as if it was requested by a_Player. Checks permissions first. Returns true if executed. */
|
/** Executes the command, as if it was requested by a_Player. Checks permissions first. Returns crExecuted if executed. */
|
||||||
bool ExecuteCommand(cPlayer * a_Player, const AString & a_Command); // tolua_export
|
CommandResult ExecuteCommand(cPlayer * a_Player, const AString & a_Command); // tolua_export
|
||||||
|
|
||||||
/** Executes the command, as if it was requested by a_Player. Permisssions are not checked. Returns true if executed (false if not found) */
|
/** Executes the command, as if it was requested by a_Player. Permisssions are not checked. Returns crExecuted if executed. */
|
||||||
bool ForceExecuteCommand(cPlayer * a_Player, const AString & a_Command); // tolua_export
|
CommandResult ForceExecuteCommand(cPlayer * a_Player, const AString & a_Command); // tolua_export
|
||||||
|
|
||||||
/** Removes all console command bindings that the specified plugin has made */
|
/** Removes all console command bindings that the specified plugin has made */
|
||||||
void RemovePluginConsoleCommands(cPlugin * a_Plugin);
|
void RemovePluginConsoleCommands(cPlugin * a_Plugin);
|
||||||
|
@ -321,13 +338,8 @@ private:
|
||||||
/** Adds the plugin into the internal list of plugins and initializes it. If initialization fails, the plugin is removed again. */
|
/** Adds the plugin into the internal list of plugins and initializes it. If initialization fails, the plugin is removed again. */
|
||||||
bool AddPlugin(cPlugin * a_Plugin);
|
bool AddPlugin(cPlugin * a_Plugin);
|
||||||
|
|
||||||
/** Tries to match a_Command to the internal table of commands, if a match is found, the corresponding plugin is called. Returns true if the command is handled. */
|
/** Tries to match a_Command to the internal table of commands, if a match is found, the corresponding plugin is called. Returns crExecuted if the command is executed. */
|
||||||
bool HandleCommand(cPlayer * a_Player, const AString & a_Command, bool a_ShouldCheckPermissions, bool & a_WasCommandForbidden);
|
cPluginManager::CommandResult HandleCommand(cPlayer * a_Player, const AString & a_Command, bool a_ShouldCheckPermissions);
|
||||||
bool HandleCommand(cPlayer * a_Player, const AString & a_Command, bool a_ShouldCheckPermissions)
|
|
||||||
{
|
|
||||||
bool DummyBoolean = false;
|
|
||||||
return HandleCommand(a_Player, a_Command, a_ShouldCheckPermissions, DummyBoolean);
|
|
||||||
}
|
|
||||||
} ; // tolua_export
|
} ; // tolua_export
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -64,14 +64,14 @@ std::pair< AString, AString > cWebPlugin::GetTabNameForRequest(const HTTPRequest
|
||||||
std::pair< AString, AString > Names;
|
std::pair< AString, AString > Names;
|
||||||
AStringVector Split = StringSplit(a_Request->Path, "/");
|
AStringVector Split = StringSplit(a_Request->Path, "/");
|
||||||
|
|
||||||
if( Split.size() > 1 )
|
if (Split.size() > 1)
|
||||||
{
|
{
|
||||||
sWebPluginTab* Tab = 0;
|
sWebPluginTab * Tab = NULL;
|
||||||
if( Split.size() > 2 ) // If we got the tab name, show that page
|
if (Split.size() > 2) // If we got the tab name, show that page
|
||||||
{
|
{
|
||||||
for( TabList::iterator itr = GetTabs().begin(); itr != GetTabs().end(); ++itr )
|
for( TabList::iterator itr = GetTabs().begin(); itr != GetTabs().end(); ++itr )
|
||||||
{
|
{
|
||||||
if( (*itr)->SafeTitle.compare( Split[2] ) == 0 ) // This is the one! Rawr
|
if ((*itr)->SafeTitle.compare(Split[2]) == 0) // This is the one!
|
||||||
{
|
{
|
||||||
Tab = *itr;
|
Tab = *itr;
|
||||||
break;
|
break;
|
||||||
|
@ -84,7 +84,7 @@ std::pair< AString, AString > cWebPlugin::GetTabNameForRequest(const HTTPRequest
|
||||||
Tab = *GetTabs().begin();
|
Tab = *GetTabs().begin();
|
||||||
}
|
}
|
||||||
|
|
||||||
if( Tab )
|
if (Tab != NULL)
|
||||||
{
|
{
|
||||||
Names.first = Tab->Title;
|
Names.first = Tab->Title;
|
||||||
Names.second = Tab->SafeTitle;
|
Names.second = Tab->SafeTitle;
|
||||||
|
@ -97,7 +97,7 @@ std::pair< AString, AString > cWebPlugin::GetTabNameForRequest(const HTTPRequest
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
AString cWebPlugin::SafeString( const AString & a_String )
|
AString cWebPlugin::SafeString(const AString & a_String)
|
||||||
{
|
{
|
||||||
AString RetVal;
|
AString RetVal;
|
||||||
for( unsigned int i = 0; i < a_String.size(); ++i )
|
for( unsigned int i = 0; i < a_String.size(); ++i )
|
||||||
|
@ -111,3 +111,7 @@ AString cWebPlugin::SafeString( const AString & a_String )
|
||||||
}
|
}
|
||||||
return RetVal;
|
return RetVal;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
196
src/Bindings/gen_LuaState_Call.lua
Normal file
196
src/Bindings/gen_LuaState_Call.lua
Normal file
|
@ -0,0 +1,196 @@
|
||||||
|
|
||||||
|
-- gen_LuaState_Call.lua
|
||||||
|
|
||||||
|
-- Generates the cLuaState::Call() function templates that are included from LuaState.h
|
||||||
|
|
||||||
|
--[[
|
||||||
|
The cLuaState::Call() family of functions provides a template-based system for calling any Lua function
|
||||||
|
either by name or by reference with almost any number of parameters and return values. This is done by
|
||||||
|
providing a number of overloads of the same name with variable number of template-type parameters. To
|
||||||
|
separate the arguments from the return values, a special type of cLuaState::cRet is used.
|
||||||
|
--]]
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
print("Generating LuaState_Call.inc...")
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
-- List of combinations (# params, # returns) to generate:
|
||||||
|
local Combinations =
|
||||||
|
{
|
||||||
|
-- no return values:
|
||||||
|
{0, 0},
|
||||||
|
{1, 0},
|
||||||
|
{2, 0},
|
||||||
|
{3, 0},
|
||||||
|
{4, 0},
|
||||||
|
|
||||||
|
-- 1 return value:
|
||||||
|
{0, 1},
|
||||||
|
{1, 1},
|
||||||
|
{2, 1},
|
||||||
|
{3, 1},
|
||||||
|
{4, 1},
|
||||||
|
{5, 1},
|
||||||
|
{6, 1},
|
||||||
|
{7, 1},
|
||||||
|
{8, 1},
|
||||||
|
{9, 1},
|
||||||
|
{10, 1},
|
||||||
|
|
||||||
|
-- 2 return values:
|
||||||
|
{0, 2},
|
||||||
|
{1, 2},
|
||||||
|
{2, 2},
|
||||||
|
{3, 2},
|
||||||
|
{4, 2},
|
||||||
|
{5, 2},
|
||||||
|
{6, 2},
|
||||||
|
{7, 2},
|
||||||
|
{8, 2},
|
||||||
|
{9, 2},
|
||||||
|
|
||||||
|
-- Special combinations:
|
||||||
|
{7, 3},
|
||||||
|
{8, 3},
|
||||||
|
{9, 5},
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
--- Writes a single overloaded function definition for the specified number of params and returns into f
|
||||||
|
--[[
|
||||||
|
The format for the generated function is this:
|
||||||
|
/** Call the specified 3-param 2-return Lua function:
|
||||||
|
Returns true if call succeeded, false if there was an error. */
|
||||||
|
template <typename FnT, typename ParamT1, typename ParamT2, typename ParamT3, typename RetT1, typename RetT2>
|
||||||
|
bool Call(FnT a_Function, ParamT1 a_Param1, ParamT2 a_Param2, ParamT3 a_Param3, const cLuaState::cRet & a_RetMark, RetT1 & a_Ret1, RetT2 & a_Ret2)
|
||||||
|
{
|
||||||
|
UNUSED(a_RetMark);
|
||||||
|
if (!PushFunction(a_Function))
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
Push(a_Param1);
|
||||||
|
Push(a_Param2);
|
||||||
|
Push(a_Param3);
|
||||||
|
if (!CallFunction(2))
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
GetStackValue(-2, a_Ret1);
|
||||||
|
GetStackValue(-1, a_Ret2);
|
||||||
|
lua_pop(m_LuaState, 2);
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
Note especially the negative numbers in GetStackValue() calls.
|
||||||
|
--]]
|
||||||
|
local function WriteOverload(f, a_NumParams, a_NumReturns)
|
||||||
|
-- Write the function doxy-comments:
|
||||||
|
f:write("/** Call the specified ", a_NumParams, "-param ", a_NumReturns, "-return Lua function:\n")
|
||||||
|
f:write("Returns true if call succeeded, false if there was an error. */\n")
|
||||||
|
|
||||||
|
-- Write the template <...> line:
|
||||||
|
f:write("template <typename FnT")
|
||||||
|
for i = 1, a_NumParams do
|
||||||
|
f:write(", typename ParamT", i)
|
||||||
|
end
|
||||||
|
if (a_NumReturns > 0) then
|
||||||
|
for i = 1, a_NumReturns do
|
||||||
|
f:write(", typename RetT", i)
|
||||||
|
end
|
||||||
|
end
|
||||||
|
f:write(">\n")
|
||||||
|
|
||||||
|
-- Write the function signature:
|
||||||
|
f:write("bool Call(")
|
||||||
|
f:write("FnT a_Function")
|
||||||
|
for i = 1, a_NumParams do
|
||||||
|
f:write(", ParamT", i, " a_Param", i)
|
||||||
|
end
|
||||||
|
if (a_NumReturns > 0) then
|
||||||
|
f:write(", const cLuaState::cRet & a_RetMark")
|
||||||
|
for i = 1, a_NumReturns do
|
||||||
|
f:write(", RetT", i, " & a_Ret", i)
|
||||||
|
end
|
||||||
|
end
|
||||||
|
f:write(")\n")
|
||||||
|
|
||||||
|
-- Common code:
|
||||||
|
f:write("{\n")
|
||||||
|
if (a_NumReturns > 0) then
|
||||||
|
f:write("\tUNUSED(a_RetMark);\n")
|
||||||
|
end
|
||||||
|
f:write("\tif (!PushFunction(a_Function))\n")
|
||||||
|
f:write("\t{\n")
|
||||||
|
f:write("\t\treturn false;\n")
|
||||||
|
f:write("\t}\n")
|
||||||
|
|
||||||
|
-- Push the params:
|
||||||
|
for i = 1, a_NumParams do
|
||||||
|
f:write("\tPush(a_Param", i, ");\n")
|
||||||
|
end
|
||||||
|
|
||||||
|
-- Call the function:
|
||||||
|
f:write("\tif (!CallFunction(", a_NumReturns, "))\n")
|
||||||
|
f:write("\t{\n")
|
||||||
|
f:write("\t\treturn false;\n")
|
||||||
|
f:write("\t}\n")
|
||||||
|
|
||||||
|
-- Get the return values:
|
||||||
|
for i = 1, a_NumReturns do
|
||||||
|
f:write("\tGetStackValue(", -1 - a_NumReturns + i, ", a_Ret", i, ");\n")
|
||||||
|
end
|
||||||
|
|
||||||
|
-- Pop the returns off the stack, if needed:
|
||||||
|
if (a_NumReturns > 0) then
|
||||||
|
f:write("\tlua_pop(m_LuaState, ", a_NumReturns, ");\n")
|
||||||
|
end
|
||||||
|
|
||||||
|
-- Everything ok:
|
||||||
|
f:write("\treturn true;\n")
|
||||||
|
f:write("}\n")
|
||||||
|
|
||||||
|
-- Separate from the next function:
|
||||||
|
f:write("\n\n\n\n\n")
|
||||||
|
end
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
local f = assert(io.open("LuaState_Call.inc", "w"))
|
||||||
|
|
||||||
|
-- Write file header:
|
||||||
|
f:write([[
|
||||||
|
// LuaState_Call.inc
|
||||||
|
|
||||||
|
// This file is auto-generated by gen_LuaState_Call.lua
|
||||||
|
// Make changes to the generator instead of to this file!
|
||||||
|
|
||||||
|
// This file contains the various overloads for the cLuaState::Call() function
|
||||||
|
// Each overload handles a different number of parameters / return values
|
||||||
|
]])
|
||||||
|
f:write("\n\n\n\n\n")
|
||||||
|
|
||||||
|
-- Write out a template function for each overload:
|
||||||
|
for _, combination in ipairs(Combinations) do
|
||||||
|
WriteOverload(f, combination[1], combination[2])
|
||||||
|
end
|
||||||
|
|
||||||
|
-- Close the generated file
|
||||||
|
f:close()
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
print("LuaState_Call.inc generated")
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -3,6 +3,20 @@ local disable_virtual_hooks = true
|
||||||
local enable_pure_virtual = true
|
local enable_pure_virtual = true
|
||||||
local default_private_access = false
|
local default_private_access = false
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
-- Code generators used by the build
|
||||||
|
-- Note that these are not exactly needed for the bindings, but rather we
|
||||||
|
-- misuse tolua's Lua engine to process files for us
|
||||||
|
dofile("gen_LuaState_Call.lua")
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
local access = {public = 0, protected = 1, private = 2}
|
local access = {public = 0, protected = 1, private = 2}
|
||||||
|
|
||||||
function preparse_hook(p)
|
function preparse_hook(p)
|
||||||
|
|
|
@ -15,7 +15,7 @@ static struct {
|
||||||
const char * m_String;
|
const char * m_String;
|
||||||
} g_BiomeMap[] =
|
} g_BiomeMap[] =
|
||||||
{
|
{
|
||||||
{biOcean, "Ocean"} ,
|
{biOcean, "Ocean"},
|
||||||
{biPlains, "Plains"},
|
{biPlains, "Plains"},
|
||||||
{biDesert, "Desert"},
|
{biDesert, "Desert"},
|
||||||
{biExtremeHills, "ExtremeHills"},
|
{biExtremeHills, "ExtremeHills"},
|
||||||
|
|
|
@ -59,7 +59,7 @@ void InternalMergeBlocks(
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
BLOCKTYPE FakeDestMeta = 0;
|
NIBBLETYPE FakeDestMeta = 0;
|
||||||
Combinator(a_DstTypes[DstIdx], a_SrcTypes[SrcIdx], FakeDestMeta, (NIBBLETYPE)0);
|
Combinator(a_DstTypes[DstIdx], a_SrcTypes[SrcIdx], FakeDestMeta, (NIBBLETYPE)0);
|
||||||
}
|
}
|
||||||
++DstIdx;
|
++DstIdx;
|
||||||
|
@ -269,7 +269,7 @@ void MergeCombinatorMask(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cBlockArea:
|
// cBlockArea:
|
||||||
|
|
||||||
cBlockArea::cBlockArea(void) :
|
cBlockArea::cBlockArea(void) :
|
||||||
|
@ -1759,7 +1759,7 @@ NIBBLETYPE cBlockArea::GetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBL
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cBlockArea::cChunkReader:
|
// cBlockArea::cChunkReader:
|
||||||
|
|
||||||
cBlockArea::cChunkReader::cChunkReader(cBlockArea & a_Area) :
|
cBlockArea::cChunkReader::cChunkReader(cBlockArea & a_Area) :
|
||||||
|
|
|
@ -28,24 +28,26 @@ cBlockEntity * cBlockEntity::CreateByBlockType(BLOCKTYPE a_BlockType, NIBBLETYPE
|
||||||
switch (a_BlockType)
|
switch (a_BlockType)
|
||||||
{
|
{
|
||||||
case E_BLOCK_BEACON: return new cBeaconEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
case E_BLOCK_BEACON: return new cBeaconEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
case E_BLOCK_CHEST: return new cChestEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
case E_BLOCK_CHEST: return new cChestEntity (a_BlockX, a_BlockY, a_BlockZ, a_World, a_BlockType);
|
||||||
case E_BLOCK_COMMAND_BLOCK: return new cCommandBlockEntity(a_BlockX, a_BlockY, a_BlockZ, a_World);
|
case E_BLOCK_COMMAND_BLOCK: return new cCommandBlockEntity(a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
case E_BLOCK_DISPENSER: return new cDispenserEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
case E_BLOCK_DISPENSER: return new cDispenserEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
case E_BLOCK_DROPPER: return new cDropperEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
case E_BLOCK_DROPPER: return new cDropperEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
case E_BLOCK_ENDER_CHEST: return new cEnderChestEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
case E_BLOCK_ENDER_CHEST: return new cEnderChestEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
case E_BLOCK_FLOWER_POT: return new cFlowerPotEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
case E_BLOCK_FLOWER_POT: return new cFlowerPotEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
case E_BLOCK_HEAD: return new cMobHeadEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
|
||||||
case E_BLOCK_LIT_FURNACE: return new cFurnaceEntity (a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta, a_World);
|
|
||||||
case E_BLOCK_FURNACE: return new cFurnaceEntity (a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta, a_World);
|
case E_BLOCK_FURNACE: return new cFurnaceEntity (a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta, a_World);
|
||||||
|
case E_BLOCK_HEAD: return new cMobHeadEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
case E_BLOCK_HOPPER: return new cHopperEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
case E_BLOCK_HOPPER: return new cHopperEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
|
case E_BLOCK_JUKEBOX: return new cJukeboxEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
|
case E_BLOCK_LIT_FURNACE: return new cFurnaceEntity (a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta, a_World);
|
||||||
case E_BLOCK_SIGN_POST: return new cSignEntity (a_BlockType, a_BlockX, a_BlockY, a_BlockZ, a_World);
|
case E_BLOCK_SIGN_POST: return new cSignEntity (a_BlockType, a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
|
case E_BLOCK_TRAPPED_CHEST: return new cChestEntity (a_BlockX, a_BlockY, a_BlockZ, a_World, a_BlockType);
|
||||||
case E_BLOCK_WALLSIGN: return new cSignEntity (a_BlockType, a_BlockX, a_BlockY, a_BlockZ, a_World);
|
case E_BLOCK_WALLSIGN: return new cSignEntity (a_BlockType, a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
case E_BLOCK_NOTE_BLOCK: return new cNoteEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
case E_BLOCK_NOTE_BLOCK: return new cNoteEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
||||||
case E_BLOCK_JUKEBOX: return new cJukeboxEntity (a_BlockX, a_BlockY, a_BlockZ, a_World);
|
|
||||||
}
|
}
|
||||||
LOGD("%s: Requesting creation of an unknown block entity - block type %d (%s)",
|
LOGD("%s: Requesting creation of an unknown block entity - block type %d (%s)",
|
||||||
__FUNCTION__, a_BlockType, ItemTypeToString(a_BlockType).c_str()
|
__FUNCTION__, a_BlockType, ItemTypeToString(a_BlockType).c_str()
|
||||||
);
|
);
|
||||||
|
ASSERT(!"Requesting creation of an unknown block entity");
|
||||||
return NULL;
|
return NULL;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -11,8 +11,9 @@
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
cChestEntity::cChestEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World) :
|
cChestEntity::cChestEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World, BLOCKTYPE a_Type) :
|
||||||
super(E_BLOCK_CHEST, a_BlockX, a_BlockY, a_BlockZ, ContentsWidth, ContentsHeight, a_World)
|
super(a_Type, a_BlockX, a_BlockY, a_BlockZ, ContentsWidth, ContentsHeight, a_World),
|
||||||
|
m_NumActivePlayers(0)
|
||||||
{
|
{
|
||||||
cBlockEntityWindowOwner::SetBlockEntity(this);
|
cBlockEntityWindowOwner::SetBlockEntity(this);
|
||||||
}
|
}
|
||||||
|
@ -113,7 +114,7 @@ void cChestEntity::UsedBy(cPlayer * a_Player)
|
||||||
// The few false positives aren't much to worry about
|
// The few false positives aren't much to worry about
|
||||||
int ChunkX, ChunkZ;
|
int ChunkX, ChunkZ;
|
||||||
cChunkDef::BlockToChunk(m_PosX, m_PosZ, ChunkX, ChunkZ);
|
cChunkDef::BlockToChunk(m_PosX, m_PosZ, ChunkX, ChunkZ);
|
||||||
m_World->MarkChunkDirty(ChunkX, ChunkZ);
|
m_World->MarkChunkDirty(ChunkX, ChunkZ, true);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -168,8 +169,8 @@ void cChestEntity::OpenNewWindow(void)
|
||||||
if (
|
if (
|
||||||
m_World->DoWithChestAt(m_PosX - 1, m_PosY, m_PosZ, OpenDbl) ||
|
m_World->DoWithChestAt(m_PosX - 1, m_PosY, m_PosZ, OpenDbl) ||
|
||||||
m_World->DoWithChestAt(m_PosX + 1, m_PosY, m_PosZ, OpenDbl) ||
|
m_World->DoWithChestAt(m_PosX + 1, m_PosY, m_PosZ, OpenDbl) ||
|
||||||
m_World->DoWithChestAt(m_PosX , m_PosY, m_PosZ - 1, OpenDbl) ||
|
m_World->DoWithChestAt(m_PosX, m_PosY, m_PosZ - 1, OpenDbl) ||
|
||||||
m_World->DoWithChestAt(m_PosX , m_PosY, m_PosZ + 1, OpenDbl)
|
m_World->DoWithChestAt(m_PosX, m_PosY, m_PosZ + 1, OpenDbl)
|
||||||
)
|
)
|
||||||
{
|
{
|
||||||
// The double-chest window has been opened in the callback
|
// The double-chest window has been opened in the callback
|
||||||
|
|
|
@ -34,8 +34,8 @@ public:
|
||||||
|
|
||||||
// tolua_end
|
// tolua_end
|
||||||
|
|
||||||
/// Constructor used for normal operation
|
/** Constructor used for normal operation */
|
||||||
cChestEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World);
|
cChestEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World, BLOCKTYPE a_Type);
|
||||||
|
|
||||||
virtual ~cChestEntity();
|
virtual ~cChestEntity();
|
||||||
|
|
||||||
|
@ -48,8 +48,20 @@ public:
|
||||||
virtual void SendTo(cClientHandle & a_Client) override;
|
virtual void SendTo(cClientHandle & a_Client) override;
|
||||||
virtual void UsedBy(cPlayer * a_Player) override;
|
virtual void UsedBy(cPlayer * a_Player) override;
|
||||||
|
|
||||||
/// Opens a new chest window for this chest. Scans for neighbors to open a double chest window, if appropriate.
|
/** Opens a new chest window for this chest.
|
||||||
|
Scans for neighbors to open a double chest window, if appropriate. */
|
||||||
void OpenNewWindow(void);
|
void OpenNewWindow(void);
|
||||||
|
|
||||||
|
/** Gets the number of players who currently have this chest open */
|
||||||
|
int GetNumberOfPlayers(void) const { return m_NumActivePlayers; }
|
||||||
|
|
||||||
|
/** Sets the number of players who currently have this chest open */
|
||||||
|
void SetNumberOfPlayers(int a_NumActivePlayers) { m_NumActivePlayers = a_NumActivePlayers; }
|
||||||
|
|
||||||
|
private:
|
||||||
|
|
||||||
|
/** Number of players who currently have this chest open */
|
||||||
|
int m_NumActivePlayers;
|
||||||
} ; // tolua_export
|
} ; // tolua_export
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -42,7 +42,7 @@ cDropSpenserEntity::~cDropSpenserEntity()
|
||||||
|
|
||||||
void cDropSpenserEntity::AddDropSpenserDir(int & a_BlockX, int & a_BlockY, int & a_BlockZ, NIBBLETYPE a_Direction)
|
void cDropSpenserEntity::AddDropSpenserDir(int & a_BlockX, int & a_BlockY, int & a_BlockZ, NIBBLETYPE a_Direction)
|
||||||
{
|
{
|
||||||
switch (a_Direction)
|
switch (a_Direction & 0x07) // Vanilla uses the 8th bit to determine power state - we don't
|
||||||
{
|
{
|
||||||
case E_META_DROPSPENSER_FACING_YM: a_BlockY--; return;
|
case E_META_DROPSPENSER_FACING_YM: a_BlockY--; return;
|
||||||
case E_META_DROPSPENSER_FACING_YP: a_BlockY++; return;
|
case E_META_DROPSPENSER_FACING_YP: a_BlockY++; return;
|
||||||
|
|
|
@ -12,9 +12,8 @@
|
||||||
|
|
||||||
|
|
||||||
cEnderChestEntity::cEnderChestEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World) :
|
cEnderChestEntity::cEnderChestEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World) :
|
||||||
super(E_BLOCK_ENDER_CHEST, a_BlockX, a_BlockY, a_BlockZ, ContentsWidth, ContentsHeight, a_World)
|
super(E_BLOCK_ENDER_CHEST, a_BlockX, a_BlockY, a_BlockZ, a_World)
|
||||||
{
|
{
|
||||||
cBlockEntityWindowOwner::SetBlockEntity(this);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -34,60 +33,6 @@ cEnderChestEntity::~cEnderChestEntity()
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cEnderChestEntity::LoadFromJson(const Json::Value & a_Value)
|
|
||||||
{
|
|
||||||
m_PosX = a_Value.get("x", 0).asInt();
|
|
||||||
m_PosY = a_Value.get("y", 0).asInt();
|
|
||||||
m_PosZ = a_Value.get("z", 0).asInt();
|
|
||||||
|
|
||||||
Json::Value AllSlots = a_Value.get("Slots", 0);
|
|
||||||
int SlotIdx = 0;
|
|
||||||
for (Json::Value::iterator itr = AllSlots.begin(); itr != AllSlots.end(); ++itr)
|
|
||||||
{
|
|
||||||
cItem Item;
|
|
||||||
Item.FromJson(*itr);
|
|
||||||
SetSlot(SlotIdx, Item);
|
|
||||||
SlotIdx++;
|
|
||||||
}
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cEnderChestEntity::SaveToJson(Json::Value & a_Value)
|
|
||||||
{
|
|
||||||
a_Value["x"] = m_PosX;
|
|
||||||
a_Value["y"] = m_PosY;
|
|
||||||
a_Value["z"] = m_PosZ;
|
|
||||||
|
|
||||||
Json::Value AllSlots;
|
|
||||||
for (int i = m_Contents.GetNumSlots() - 1; i >= 0; i--)
|
|
||||||
{
|
|
||||||
Json::Value Slot;
|
|
||||||
m_Contents.GetSlot(i).GetJson(Slot);
|
|
||||||
AllSlots.append(Slot);
|
|
||||||
}
|
|
||||||
a_Value["Slots"] = AllSlots;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cEnderChestEntity::SendTo(cClientHandle & a_Client)
|
|
||||||
{
|
|
||||||
// The chest entity doesn't need anything sent to the client when it's created / gets in the viewdistance
|
|
||||||
// All the actual handling is in the cWindow UI code that gets called when the chest is rclked
|
|
||||||
|
|
||||||
UNUSED(a_Client);
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cEnderChestEntity::UsedBy(cPlayer * a_Player)
|
void cEnderChestEntity::UsedBy(cPlayer * a_Player)
|
||||||
{
|
{
|
||||||
// If the window is not created, open it anew:
|
// If the window is not created, open it anew:
|
||||||
|
@ -106,21 +51,13 @@ void cEnderChestEntity::UsedBy(cPlayer * a_Player)
|
||||||
a_Player->OpenWindow(Window);
|
a_Player->OpenWindow(Window);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// This is rather a hack
|
|
||||||
// Instead of marking the chunk as dirty upon chest contents change, we mark it dirty now
|
|
||||||
// We cannot properly detect contents change, but such a change doesn't happen without a player opening the chest first.
|
|
||||||
// The few false positives aren't much to worry about
|
|
||||||
int ChunkX, ChunkZ;
|
|
||||||
cChunkDef::BlockToChunk(m_PosX, m_PosZ, ChunkX, ChunkZ);
|
|
||||||
m_World->MarkChunkDirty(ChunkX, ChunkZ);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cEnderChestEntity::OpenNewWindow(void)
|
void cEnderChestEntity::OpenNewWindow()
|
||||||
{
|
{
|
||||||
OpenWindow(new cEnderChestWindow(this));
|
OpenWindow(new cEnderChestWindow(this));
|
||||||
}
|
}
|
||||||
|
@ -128,3 +65,33 @@ void cEnderChestEntity::OpenNewWindow(void)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
void cEnderChestEntity::LoadFromJson(const Json::Value & a_Value, cItemGrid & a_Grid)
|
||||||
|
{
|
||||||
|
int SlotIdx = 0;
|
||||||
|
for (Json::Value::iterator itr = a_Value.begin(); itr != a_Value.end(); ++itr)
|
||||||
|
{
|
||||||
|
cItem Item;
|
||||||
|
Item.FromJson(*itr);
|
||||||
|
a_Grid.SetSlot(SlotIdx, Item);
|
||||||
|
SlotIdx++;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
void cEnderChestEntity::SaveToJson(Json::Value & a_Value, const cItemGrid & a_Grid)
|
||||||
|
{
|
||||||
|
for (int i = 0; i < a_Grid.GetNumSlots(); i++)
|
||||||
|
{
|
||||||
|
Json::Value Slot;
|
||||||
|
a_Grid.GetSlot(i).GetJson(Slot);
|
||||||
|
a_Value.append(Slot);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -1,20 +1,9 @@
|
||||||
|
|
||||||
#pragma once
|
#pragma once
|
||||||
|
|
||||||
#include "BlockEntityWithItems.h"
|
#include "BlockEntity.h"
|
||||||
|
#include "UI/WindowOwner.h"
|
||||||
|
#include "json/json.h"
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
namespace Json
|
|
||||||
{
|
|
||||||
class Value;
|
|
||||||
};
|
|
||||||
|
|
||||||
class cClientHandle;
|
|
||||||
class cServer;
|
|
||||||
class cNBTData;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -22,33 +11,28 @@ class cNBTData;
|
||||||
|
|
||||||
// tolua_begin
|
// tolua_begin
|
||||||
class cEnderChestEntity :
|
class cEnderChestEntity :
|
||||||
public cBlockEntityWithItems
|
public cBlockEntity,
|
||||||
|
public cBlockEntityWindowOwner
|
||||||
{
|
{
|
||||||
typedef cBlockEntityWithItems super;
|
typedef cBlockEntity super;
|
||||||
|
|
||||||
public:
|
public:
|
||||||
enum {
|
|
||||||
ContentsHeight = 3,
|
|
||||||
ContentsWidth = 9,
|
|
||||||
} ;
|
|
||||||
|
|
||||||
// tolua_end
|
// tolua_end
|
||||||
|
|
||||||
/// Constructor used for normal operation
|
|
||||||
cEnderChestEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World);
|
cEnderChestEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World);
|
||||||
|
|
||||||
virtual ~cEnderChestEntity();
|
virtual ~cEnderChestEntity();
|
||||||
|
|
||||||
static const char * GetClassStatic(void) { return "cEnderChestEntity"; }
|
static const char * GetClassStatic(void) { return "cEnderChestEntity"; }
|
||||||
|
|
||||||
bool LoadFromJson(const Json::Value & a_Value);
|
|
||||||
|
|
||||||
// cBlockEntity overrides:
|
// cBlockEntity overrides:
|
||||||
virtual void SaveToJson(Json::Value & a_Value) override;
|
|
||||||
virtual void SendTo(cClientHandle & a_Client) override;
|
|
||||||
virtual void UsedBy(cPlayer * a_Player) override;
|
virtual void UsedBy(cPlayer * a_Player) override;
|
||||||
|
virtual void SaveToJson(Json::Value & a_Value) override { UNUSED(a_Value); }
|
||||||
|
virtual void SendTo(cClientHandle & a_Client) override { UNUSED(a_Client); }
|
||||||
|
|
||||||
/// Opens a new chest window for this chest. Scans for neighbors to open a double chest window, if appropriate.
|
static void LoadFromJson(const Json::Value & a_Value, cItemGrid & a_Grid);
|
||||||
|
static void SaveToJson(Json::Value & a_Value, const cItemGrid & a_Grid);
|
||||||
|
|
||||||
|
/** Opens a new enderchest window for this enderchest */
|
||||||
void OpenNewWindow(void);
|
void OpenNewWindow(void);
|
||||||
} ; // tolua_export
|
} ; // tolua_export
|
||||||
|
|
||||||
|
|
|
@ -53,7 +53,7 @@ public:
|
||||||
cItem GetItem(void) const { return m_Item; }
|
cItem GetItem(void) const { return m_Item; }
|
||||||
|
|
||||||
/** Set the item in the flower pot */
|
/** Set the item in the flower pot */
|
||||||
void SetItem(const cItem a_Item) { m_Item = a_Item; }
|
void SetItem(const cItem & a_Item) { m_Item = a_Item; }
|
||||||
|
|
||||||
// tolua_end
|
// tolua_end
|
||||||
|
|
||||||
|
|
|
@ -157,6 +157,7 @@ bool cHopperEntity::MoveItemsIn(cChunk & a_Chunk, Int64 a_CurrentTick)
|
||||||
bool res = false;
|
bool res = false;
|
||||||
switch (a_Chunk.GetBlock(m_RelX, m_PosY + 1, m_RelZ))
|
switch (a_Chunk.GetBlock(m_RelX, m_PosY + 1, m_RelZ))
|
||||||
{
|
{
|
||||||
|
case E_BLOCK_TRAPPED_CHEST:
|
||||||
case E_BLOCK_CHEST:
|
case E_BLOCK_CHEST:
|
||||||
{
|
{
|
||||||
// Chests have special handling because of double-chests
|
// Chests have special handling because of double-chests
|
||||||
|
@ -322,6 +323,7 @@ bool cHopperEntity::MoveItemsOut(cChunk & a_Chunk, Int64 a_CurrentTick)
|
||||||
bool res = false;
|
bool res = false;
|
||||||
switch (DestChunk->GetBlock(OutRelX, OutY, OutRelZ))
|
switch (DestChunk->GetBlock(OutRelX, OutY, OutRelZ))
|
||||||
{
|
{
|
||||||
|
case E_BLOCK_TRAPPED_CHEST:
|
||||||
case E_BLOCK_CHEST:
|
case E_BLOCK_CHEST:
|
||||||
{
|
{
|
||||||
// Chests have special handling because of double-chests
|
// Chests have special handling because of double-chests
|
||||||
|
@ -366,19 +368,19 @@ bool cHopperEntity::MoveItemsOut(cChunk & a_Chunk, Int64 a_CurrentTick)
|
||||||
/// Moves items from a chest (dblchest) above the hopper into this hopper. Returns true if contents have changed.
|
/// Moves items from a chest (dblchest) above the hopper into this hopper. Returns true if contents have changed.
|
||||||
bool cHopperEntity::MoveItemsFromChest(cChunk & a_Chunk)
|
bool cHopperEntity::MoveItemsFromChest(cChunk & a_Chunk)
|
||||||
{
|
{
|
||||||
cChestEntity * Chest = (cChestEntity *)a_Chunk.GetBlockEntity(m_PosX, m_PosY + 1, m_PosZ);
|
cChestEntity * MainChest = (cChestEntity *)a_Chunk.GetBlockEntity(m_PosX, m_PosY + 1, m_PosZ);
|
||||||
if (Chest == NULL)
|
if (MainChest == NULL)
|
||||||
{
|
{
|
||||||
LOGWARNING("%s: A chest entity was not found where expected, at {%d, %d, %d}", __FUNCTION__, m_PosX, m_PosY + 1, m_PosZ);
|
LOGWARNING("%s: A chest entity was not found where expected, at {%d, %d, %d}", __FUNCTION__, m_PosX, m_PosY + 1, m_PosZ);
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
if (MoveItemsFromGrid(*Chest))
|
if (MoveItemsFromGrid(*MainChest))
|
||||||
{
|
{
|
||||||
// Moved the item from the chest directly above the hopper
|
// Moved the item from the chest directly above the hopper
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
// Check if the chest is a double-chest, if so, try to move from there:
|
// Check if the chest is a double-chest (chest directly above was empty), if so, try to move from there:
|
||||||
static const struct
|
static const struct
|
||||||
{
|
{
|
||||||
int x, z;
|
int x, z;
|
||||||
|
@ -395,21 +397,26 @@ bool cHopperEntity::MoveItemsFromChest(cChunk & a_Chunk)
|
||||||
int x = m_RelX + Coords[i].x;
|
int x = m_RelX + Coords[i].x;
|
||||||
int z = m_RelZ + Coords[i].z;
|
int z = m_RelZ + Coords[i].z;
|
||||||
cChunk * Neighbor = a_Chunk.GetRelNeighborChunkAdjustCoords(x, z);
|
cChunk * Neighbor = a_Chunk.GetRelNeighborChunkAdjustCoords(x, z);
|
||||||
if (
|
if (Neighbor == NULL)
|
||||||
(Neighbor == NULL) ||
|
|
||||||
(Neighbor->GetBlock(x, m_PosY + 1, z) != E_BLOCK_CHEST)
|
|
||||||
)
|
|
||||||
{
|
{
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
Chest = (cChestEntity *)Neighbor->GetBlockEntity(m_PosX + Coords[i].x, m_PosY + 1, m_PosZ + Coords[i].z);
|
|
||||||
if (Chest == NULL)
|
BLOCKTYPE Block = Neighbor->GetBlock(x, m_PosY + 1, z);
|
||||||
|
if (Block != MainChest->GetBlockType())
|
||||||
|
{
|
||||||
|
// Not the same kind of chest
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
cChestEntity * SideChest = (cChestEntity *)Neighbor->GetBlockEntity(m_PosX + Coords[i].x, m_PosY + 1, m_PosZ + Coords[i].z);
|
||||||
|
if (SideChest == NULL)
|
||||||
{
|
{
|
||||||
LOGWARNING("%s: A chest entity was not found where expected, at {%d, %d, %d}", __FUNCTION__, m_PosX + Coords[i].x, m_PosY + 1, m_PosZ + Coords[i].z);
|
LOGWARNING("%s: A chest entity was not found where expected, at {%d, %d, %d}", __FUNCTION__, m_PosX + Coords[i].x, m_PosY + 1, m_PosZ + Coords[i].z);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
if (MoveItemsFromGrid(*Chest))
|
if (MoveItemsFromGrid(*SideChest))
|
||||||
{
|
{
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
@ -550,10 +557,11 @@ bool cHopperEntity::MoveItemsToChest(cChunk & a_Chunk, int a_BlockX, int a_Block
|
||||||
}
|
}
|
||||||
if (MoveItemsToGrid(*Chest))
|
if (MoveItemsToGrid(*Chest))
|
||||||
{
|
{
|
||||||
|
// Chest block directly connected was not full
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
// Check if the chest is a double-chest, if so, try to move into the other half:
|
// Check if the chest is a double-chest (chest block directly connected was full), if so, try to move into the other half:
|
||||||
static const struct
|
static const struct
|
||||||
{
|
{
|
||||||
int x, z;
|
int x, z;
|
||||||
|
@ -572,13 +580,18 @@ bool cHopperEntity::MoveItemsToChest(cChunk & a_Chunk, int a_BlockX, int a_Block
|
||||||
int x = RelX + Coords[i].x;
|
int x = RelX + Coords[i].x;
|
||||||
int z = RelZ + Coords[i].z;
|
int z = RelZ + Coords[i].z;
|
||||||
cChunk * Neighbor = a_Chunk.GetRelNeighborChunkAdjustCoords(x, z);
|
cChunk * Neighbor = a_Chunk.GetRelNeighborChunkAdjustCoords(x, z);
|
||||||
if (
|
if (Neighbor == NULL)
|
||||||
(Neighbor == NULL) ||
|
|
||||||
(Neighbor->GetBlock(x, a_BlockY, z) != E_BLOCK_CHEST)
|
|
||||||
)
|
|
||||||
{
|
{
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
BLOCKTYPE Block = Neighbor->GetBlock(x, a_BlockY, z);
|
||||||
|
if (Block != Chest->GetBlockType())
|
||||||
|
{
|
||||||
|
// Not the same kind of chest
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
Chest = (cChestEntity *)Neighbor->GetBlockEntity(a_BlockX + Coords[i].x, a_BlockY, a_BlockZ + Coords[i].z);
|
Chest = (cChestEntity *)Neighbor->GetBlockEntity(a_BlockX + Coords[i].x, a_BlockY, a_BlockZ + Coords[i].z);
|
||||||
if (Chest == NULL)
|
if (Chest == NULL)
|
||||||
{
|
{
|
||||||
|
|
|
@ -91,7 +91,7 @@ void cNoteEntity::MakeSound(void)
|
||||||
|
|
||||||
// TODO: instead of calculating the power function over and over, make a precalculated table - there's only 24 pitches after all
|
// TODO: instead of calculating the power function over and over, make a precalculated table - there's only 24 pitches after all
|
||||||
float calcPitch = pow(2.0f, ((float)m_Pitch - 12.0f) / 12.0f);
|
float calcPitch = pow(2.0f, ((float)m_Pitch - 12.0f) / 12.0f);
|
||||||
m_World->BroadcastSoundEffect(sampleName, m_PosX * 8, m_PosY * 8, m_PosZ * 8, 3.0f, calcPitch);
|
m_World->BroadcastSoundEffect(sampleName, (double)m_PosX, (double)m_PosY, (double)m_PosZ, 3.0f, calcPitch);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -394,6 +394,7 @@ AString DamageTypeToString(eDamageType a_DamageType)
|
||||||
case dtLightning: return "dtLightning";
|
case dtLightning: return "dtLightning";
|
||||||
case dtOnFire: return "dtOnFire";
|
case dtOnFire: return "dtOnFire";
|
||||||
case dtPoisoning: return "dtPoisoning";
|
case dtPoisoning: return "dtPoisoning";
|
||||||
|
case dtWithering: return "dtWithering";
|
||||||
case dtPotionOfHarming: return "dtPotionOfHarming";
|
case dtPotionOfHarming: return "dtPotionOfHarming";
|
||||||
case dtRangedAttack: return "dtRangedAttack";
|
case dtRangedAttack: return "dtRangedAttack";
|
||||||
case dtStarving: return "dtStarving";
|
case dtStarving: return "dtStarving";
|
||||||
|
@ -439,6 +440,7 @@ eDamageType StringToDamageType(const AString & a_DamageTypeString)
|
||||||
{ dtCactusContact, "dtCactusContact"},
|
{ dtCactusContact, "dtCactusContact"},
|
||||||
{ dtLavaContact, "dtLavaContact"},
|
{ dtLavaContact, "dtLavaContact"},
|
||||||
{ dtPoisoning, "dtPoisoning"},
|
{ dtPoisoning, "dtPoisoning"},
|
||||||
|
{ dtWithering, "dtWithering"},
|
||||||
{ dtOnFire, "dtOnFire"},
|
{ dtOnFire, "dtOnFire"},
|
||||||
{ dtFireContact, "dtFireContact"},
|
{ dtFireContact, "dtFireContact"},
|
||||||
{ dtInVoid, "dtInVoid"},
|
{ dtInVoid, "dtInVoid"},
|
||||||
|
@ -464,6 +466,7 @@ eDamageType StringToDamageType(const AString & a_DamageTypeString)
|
||||||
{ dtCactusContact, "dtCacti"},
|
{ dtCactusContact, "dtCacti"},
|
||||||
{ dtLavaContact, "dtLava"},
|
{ dtLavaContact, "dtLava"},
|
||||||
{ dtPoisoning, "dtPoison"},
|
{ dtPoisoning, "dtPoison"},
|
||||||
|
{ dtWithering, "dtWither"},
|
||||||
{ dtOnFire, "dtBurning"},
|
{ dtOnFire, "dtBurning"},
|
||||||
{ dtFireContact, "dtInFire"},
|
{ dtFireContact, "dtInFire"},
|
||||||
{ dtAdmin, "dtPlugin"},
|
{ dtAdmin, "dtPlugin"},
|
||||||
|
|
|
@ -319,7 +319,8 @@ enum ENUM_ITEM_ID
|
||||||
E_ITEM_GHAST_TEAR = 370,
|
E_ITEM_GHAST_TEAR = 370,
|
||||||
E_ITEM_GOLD_NUGGET = 371,
|
E_ITEM_GOLD_NUGGET = 371,
|
||||||
E_ITEM_NETHER_WART = 372,
|
E_ITEM_NETHER_WART = 372,
|
||||||
E_ITEM_POTIONS = 373,
|
E_ITEM_POTION = 373,
|
||||||
|
E_ITEM_POTIONS = 373, // OBSOLETE, use E_ITEM_POTION instead
|
||||||
E_ITEM_GLASS_BOTTLE = 374,
|
E_ITEM_GLASS_BOTTLE = 374,
|
||||||
E_ITEM_SPIDER_EYE = 375,
|
E_ITEM_SPIDER_EYE = 375,
|
||||||
E_ITEM_FERMENTED_SPIDER_EYE = 376,
|
E_ITEM_FERMENTED_SPIDER_EYE = 376,
|
||||||
|
@ -398,7 +399,7 @@ enum
|
||||||
// Please keep this list alpha-sorted by the blocktype / itemtype part
|
// Please keep this list alpha-sorted by the blocktype / itemtype part
|
||||||
// then number-sorted for the same block / item
|
// then number-sorted for the same block / item
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// Block metas:
|
// Block metas:
|
||||||
|
|
||||||
// E_BLOCK_BIG_FLOWER metas
|
// E_BLOCK_BIG_FLOWER metas
|
||||||
|
@ -677,7 +678,7 @@ enum
|
||||||
E_META_WOOL_RED = 14,
|
E_META_WOOL_RED = 14,
|
||||||
E_META_WOOL_BLACK = 15,
|
E_META_WOOL_BLACK = 15,
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// Item metas:
|
// Item metas:
|
||||||
|
|
||||||
// E_ITEM_COAL metas:
|
// E_ITEM_COAL metas:
|
||||||
|
@ -811,6 +812,7 @@ enum eDamageType
|
||||||
dtCactusContact, // Contact with a cactus block
|
dtCactusContact, // Contact with a cactus block
|
||||||
dtLavaContact, // Contact with a lava block
|
dtLavaContact, // Contact with a lava block
|
||||||
dtPoisoning, // Having the poison effect
|
dtPoisoning, // Having the poison effect
|
||||||
|
dtWithering, // Having the wither effect
|
||||||
dtOnFire, // Being on fire
|
dtOnFire, // Being on fire
|
||||||
dtFireContact, // Standing inside a fire block
|
dtFireContact, // Standing inside a fire block
|
||||||
dtInVoid, // Falling into the Void (Y < 0)
|
dtInVoid, // Falling into the Void (Y < 0)
|
||||||
|
@ -837,6 +839,7 @@ enum eDamageType
|
||||||
dtCacti = dtCactusContact,
|
dtCacti = dtCactusContact,
|
||||||
dtLava = dtLavaContact,
|
dtLava = dtLavaContact,
|
||||||
dtPoison = dtPoisoning,
|
dtPoison = dtPoisoning,
|
||||||
|
dtWither = dtWithering,
|
||||||
dtBurning = dtOnFire,
|
dtBurning = dtOnFire,
|
||||||
dtInFire = dtFireContact,
|
dtInFire = dtFireContact,
|
||||||
dtPlugin = dtAdmin,
|
dtPlugin = dtAdmin,
|
||||||
|
|
|
@ -8,20 +8,13 @@
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
cBlockInfo cBlockInfo::ms_Info[256];
|
|
||||||
static bool g_IsBlockInfoInitialized = false;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
cBlockInfo::cBlockInfo()
|
cBlockInfo::cBlockInfo()
|
||||||
: m_LightValue(0x00)
|
: m_LightValue(0x00)
|
||||||
, m_SpreadLightFalloff(0x0f)
|
, m_SpreadLightFalloff(0x0f)
|
||||||
, m_Transparent(false)
|
, m_Transparent(false)
|
||||||
, m_OneHitDig(false)
|
, m_OneHitDig(false)
|
||||||
, m_PistonBreakable(false)
|
, m_PistonBreakable(false)
|
||||||
, m_IsSnowable(true)
|
, m_IsSnowable(false)
|
||||||
, m_RequiresSpecialTool(false)
|
, m_RequiresSpecialTool(false)
|
||||||
, m_IsSolid(true)
|
, m_IsSolid(true)
|
||||||
, m_FullyOccupiesVoxel(false)
|
, m_FullyOccupiesVoxel(false)
|
||||||
|
@ -42,12 +35,17 @@ cBlockInfo::~cBlockInfo()
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/** This accessor makes sure that the cBlockInfo structures are properly initialized exactly once.
|
||||||
|
It does so by using the C++ singleton approximation - storing the actual singleton as the function's static variable.
|
||||||
|
It works only if it is called for the first time before the app spawns other threads. */
|
||||||
cBlockInfo & cBlockInfo::Get(BLOCKTYPE a_Type)
|
cBlockInfo & cBlockInfo::Get(BLOCKTYPE a_Type)
|
||||||
{
|
{
|
||||||
if (!g_IsBlockInfoInitialized)
|
static cBlockInfo ms_Info[256];
|
||||||
|
static bool IsBlockInfoInitialized = false;
|
||||||
|
if (!IsBlockInfoInitialized)
|
||||||
{
|
{
|
||||||
cBlockInfo::Initialize();
|
cBlockInfo::Initialize(ms_Info);
|
||||||
g_IsBlockInfoInitialized = true;
|
IsBlockInfoInitialized = true;
|
||||||
}
|
}
|
||||||
return ms_Info[a_Type];
|
return ms_Info[a_Type];
|
||||||
}
|
}
|
||||||
|
@ -56,399 +54,545 @@ cBlockInfo & cBlockInfo::Get(BLOCKTYPE a_Type)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cBlockInfo::Initialize(void)
|
void cBlockInfo::Initialize(cBlockInfoArray & a_Info)
|
||||||
{
|
{
|
||||||
for (unsigned int i = 0; i < 256; ++i)
|
for (unsigned int i = 0; i < 256; ++i)
|
||||||
{
|
{
|
||||||
if (ms_Info[i].m_Handler == NULL)
|
if (a_Info[i].m_Handler == NULL)
|
||||||
{
|
{
|
||||||
ms_Info[i].m_Handler = cBlockHandler::CreateBlockHandler((BLOCKTYPE) i);
|
a_Info[i].m_Handler = cBlockHandler::CreateBlockHandler((BLOCKTYPE) i);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// Emissive blocks
|
// Emissive blocks
|
||||||
ms_Info[E_BLOCK_FIRE ].m_LightValue = 15;
|
a_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_LightValue = 9;
|
||||||
ms_Info[E_BLOCK_GLOWSTONE ].m_LightValue = 15;
|
a_Info[E_BLOCK_BEACON ].m_LightValue = 15;
|
||||||
ms_Info[E_BLOCK_JACK_O_LANTERN ].m_LightValue = 15;
|
a_Info[E_BLOCK_BREWING_STAND ].m_LightValue = 1;
|
||||||
ms_Info[E_BLOCK_LAVA ].m_LightValue = 15;
|
a_Info[E_BLOCK_BROWN_MUSHROOM ].m_LightValue = 1;
|
||||||
ms_Info[E_BLOCK_STATIONARY_LAVA ].m_LightValue = 15;
|
a_Info[E_BLOCK_BURNING_FURNACE ].m_LightValue = 13;
|
||||||
ms_Info[E_BLOCK_END_PORTAL ].m_LightValue = 15;
|
a_Info[E_BLOCK_DRAGON_EGG ].m_LightValue = 1;
|
||||||
ms_Info[E_BLOCK_REDSTONE_LAMP_ON ].m_LightValue = 15;
|
a_Info[E_BLOCK_END_PORTAL ].m_LightValue = 15;
|
||||||
ms_Info[E_BLOCK_TORCH ].m_LightValue = 14;
|
a_Info[E_BLOCK_END_PORTAL_FRAME ].m_LightValue = 1;
|
||||||
ms_Info[E_BLOCK_BURNING_FURNACE ].m_LightValue = 13;
|
a_Info[E_BLOCK_ENDER_CHEST ].m_LightValue = 7;
|
||||||
ms_Info[E_BLOCK_NETHER_PORTAL ].m_LightValue = 11;
|
a_Info[E_BLOCK_FIRE ].m_LightValue = 15;
|
||||||
ms_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_LightValue = 9;
|
a_Info[E_BLOCK_GLOWSTONE ].m_LightValue = 15;
|
||||||
ms_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_LightValue = 9;
|
a_Info[E_BLOCK_JACK_O_LANTERN ].m_LightValue = 15;
|
||||||
ms_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_LightValue = 7;
|
a_Info[E_BLOCK_LAVA ].m_LightValue = 15;
|
||||||
ms_Info[E_BLOCK_BREWING_STAND ].m_LightValue = 1;
|
a_Info[E_BLOCK_NETHER_PORTAL ].m_LightValue = 11;
|
||||||
ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_LightValue = 1;
|
a_Info[E_BLOCK_REDSTONE_LAMP_ON ].m_LightValue = 15;
|
||||||
ms_Info[E_BLOCK_DRAGON_EGG ].m_LightValue = 1;
|
a_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_LightValue = 9;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_LightValue = 9;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_LightValue = 7;
|
||||||
|
a_Info[E_BLOCK_STATIONARY_LAVA ].m_LightValue = 15;
|
||||||
|
a_Info[E_BLOCK_TORCH ].m_LightValue = 14;
|
||||||
|
|
||||||
|
|
||||||
// Spread blocks
|
// Spread blocks
|
||||||
ms_Info[E_BLOCK_AIR ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_ACTIVATOR_RAIL ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_CAKE ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_CHEST ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_AIR ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_COBWEB ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_ANVIL ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_CROPS ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_BEACON ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_FENCE ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_BED ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_FENCE_GATE ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_BIG_FLOWER ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_FIRE ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_BROWN_MUSHROOM ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_GLASS ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_BREWING_STAND ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_GLASS_PANE ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_CACTUS ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_GLOWSTONE ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_CAKE ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_IRON_BARS ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_CARPET ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_IRON_DOOR ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_CARROTS ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_LEAVES ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_CAULDRON ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_NEW_LEAVES ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_CHEST ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_SIGN_POST ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_COBBLESTONE_WALL ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_TORCH ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_COCOA_POD ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_VINES ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_COBWEB ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_WALLSIGN ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_CROPS ].m_SpreadLightFalloff = 1;
|
||||||
ms_Info[E_BLOCK_WOODEN_DOOR ].m_SpreadLightFalloff = 1;
|
a_Info[E_BLOCK_DANDELION ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_DAYLIGHT_SENSOR ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_DEAD_BUSH ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_DETECTOR_RAIL ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_DRAGON_EGG ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_ENCHANTMENT_TABLE ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_ENDER_CHEST ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_END_PORTAL ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_END_PORTAL_FRAME ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_FARMLAND ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_FENCE ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_FENCE_GATE ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_FIRE ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_FLOWER ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_FLOWER_POT ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_GLASS ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_GLASS_PANE ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_HEAD ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_HOPPER ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_ICE ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_IRON_BARS ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_IRON_DOOR ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_LADDER ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_LEAVES ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_LEVER ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_LILY_PAD ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_MELON_STEM ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_MOB_SPAWNER ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_NETHER_PORTAL ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_NETHER_WART ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_NEW_LEAVES ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_PISTON ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_PISTON_EXTENSION ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_PISTON_MOVED_BLOCK ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_POTATOES ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_POWERED_RAIL ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_PUMPKIN_STEM ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_RAIL ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_RED_MUSHROOM ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_REPEATER_OFF].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_WIRE ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_SAPLING ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_SIGN_POST ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_SNOW ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_STAINED_GLASS ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_STAINED_GLASS_PANE ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_STICKY_PISTON ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_STONE_BUTTON ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_STONE_SLAB ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_SUGARCANE ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_TALL_GRASS ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_TORCH ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_TRAPDOOR ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_TRAPPED_CHEST ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_TRIPWIRE ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_TRIPWIRE_HOOK ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_VINES ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_WALLSIGN ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_WOODEN_BUTTON ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_WOODEN_DOOR ].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_WOODEN_PRESSURE_PLATE].m_SpreadLightFalloff = 1;
|
||||||
|
a_Info[E_BLOCK_WOODEN_SLAB ].m_SpreadLightFalloff = 1;
|
||||||
|
|
||||||
// Light in water and lava dissapears faster:
|
// Light in water and lava dissapears faster:
|
||||||
ms_Info[E_BLOCK_LAVA ].m_SpreadLightFalloff = 3;
|
a_Info[E_BLOCK_LAVA ].m_SpreadLightFalloff = 3;
|
||||||
ms_Info[E_BLOCK_STATIONARY_LAVA ].m_SpreadLightFalloff = 3;
|
a_Info[E_BLOCK_STATIONARY_LAVA ].m_SpreadLightFalloff = 3;
|
||||||
ms_Info[E_BLOCK_STATIONARY_WATER ].m_SpreadLightFalloff = 3;
|
a_Info[E_BLOCK_STATIONARY_WATER ].m_SpreadLightFalloff = 3;
|
||||||
ms_Info[E_BLOCK_WATER ].m_SpreadLightFalloff = 3;
|
a_Info[E_BLOCK_WATER ].m_SpreadLightFalloff = 3;
|
||||||
|
|
||||||
|
|
||||||
// Transparent blocks
|
// Transparent blocks
|
||||||
ms_Info[E_BLOCK_ACTIVATOR_RAIL ].m_Transparent = true;
|
a_Info[E_BLOCK_ACTIVATOR_RAIL ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_AIR ].m_Transparent = true;
|
a_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_ANVIL ].m_Transparent = true;
|
a_Info[E_BLOCK_AIR ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_BIG_FLOWER ].m_Transparent = true;
|
a_Info[E_BLOCK_ANVIL ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_Transparent = true;
|
a_Info[E_BLOCK_BEACON ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_CAKE ].m_Transparent = true;
|
a_Info[E_BLOCK_BED ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_CARROTS ].m_Transparent = true;
|
a_Info[E_BLOCK_BIG_FLOWER ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_CHEST ].m_Transparent = true;
|
a_Info[E_BLOCK_BROWN_MUSHROOM ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_COBBLESTONE_WALL ].m_Transparent = true;
|
a_Info[E_BLOCK_BREWING_STAND ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_COBWEB ].m_Transparent = true;
|
a_Info[E_BLOCK_CACTUS ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_CROPS ].m_Transparent = true;
|
a_Info[E_BLOCK_CAKE ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_DANDELION ].m_Transparent = true;
|
a_Info[E_BLOCK_CARPET ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_DETECTOR_RAIL ].m_Transparent = true;
|
a_Info[E_BLOCK_CARROTS ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_ENDER_CHEST ].m_Transparent = true;
|
a_Info[E_BLOCK_CAULDRON ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_FENCE ].m_Transparent = true;
|
a_Info[E_BLOCK_CHEST ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_FENCE_GATE ].m_Transparent = true;
|
a_Info[E_BLOCK_COBBLESTONE_WALL ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_FIRE ].m_Transparent = true;
|
a_Info[E_BLOCK_COCOA_POD ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_FLOWER ].m_Transparent = true;
|
a_Info[E_BLOCK_COBWEB ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_FLOWER_POT ].m_Transparent = true;
|
a_Info[E_BLOCK_CROPS ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_GLASS ].m_Transparent = true;
|
a_Info[E_BLOCK_DANDELION ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_GLASS_PANE ].m_Transparent = true;
|
a_Info[E_BLOCK_DAYLIGHT_SENSOR ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_HEAD ].m_Transparent = true;
|
a_Info[E_BLOCK_DEAD_BUSH ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_Transparent = true;
|
a_Info[E_BLOCK_DETECTOR_RAIL ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_ICE ].m_Transparent = true;
|
a_Info[E_BLOCK_DRAGON_EGG ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_IRON_DOOR ].m_Transparent = true;
|
a_Info[E_BLOCK_ENCHANTMENT_TABLE ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_LADDER ].m_Transparent = true;
|
a_Info[E_BLOCK_ENDER_CHEST ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_LAVA ].m_Transparent = true;
|
a_Info[E_BLOCK_END_PORTAL ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_LEAVES ].m_Transparent = true;
|
a_Info[E_BLOCK_END_PORTAL_FRAME ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_LEVER ].m_Transparent = true;
|
a_Info[E_BLOCK_FARMLAND ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_Transparent = true;
|
a_Info[E_BLOCK_FENCE ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_MELON_STEM ].m_Transparent = true;
|
a_Info[E_BLOCK_FENCE_GATE ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_NETHER_BRICK_FENCE ].m_Transparent = true;
|
a_Info[E_BLOCK_FIRE ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_NEW_LEAVES ].m_Transparent = true;
|
a_Info[E_BLOCK_FLOWER ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_POTATOES ].m_Transparent = true;
|
a_Info[E_BLOCK_FLOWER_POT ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_POWERED_RAIL ].m_Transparent = true;
|
a_Info[E_BLOCK_GLASS ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_PISTON_EXTENSION ].m_Transparent = true;
|
a_Info[E_BLOCK_GLASS_PANE ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_PUMPKIN_STEM ].m_Transparent = true;
|
a_Info[E_BLOCK_HEAD ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_RAIL ].m_Transparent = true;
|
a_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_RED_MUSHROOM ].m_Transparent = true;
|
a_Info[E_BLOCK_HOPPER ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_SIGN_POST ].m_Transparent = true;
|
a_Info[E_BLOCK_ICE ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_SNOW ].m_Transparent = true;
|
a_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_STAINED_GLASS ].m_Transparent = true;
|
a_Info[E_BLOCK_IRON_BARS ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_STAINED_GLASS_PANE ].m_Transparent = true;
|
a_Info[E_BLOCK_IRON_DOOR ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_STATIONARY_LAVA ].m_Transparent = true;
|
a_Info[E_BLOCK_LADDER ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_STATIONARY_WATER ].m_Transparent = true;
|
a_Info[E_BLOCK_LAVA ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_STONE_BUTTON ].m_Transparent = true;
|
a_Info[E_BLOCK_LEAVES ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_Transparent = true;
|
a_Info[E_BLOCK_LEVER ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_TALL_GRASS ].m_Transparent = true;
|
a_Info[E_BLOCK_LILY_PAD ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_TORCH ].m_Transparent = true;
|
a_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_VINES ].m_Transparent = true;
|
a_Info[E_BLOCK_MELON_STEM ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_WALLSIGN ].m_Transparent = true;
|
a_Info[E_BLOCK_MOB_SPAWNER ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_WATER ].m_Transparent = true;
|
a_Info[E_BLOCK_NETHER_BRICK_FENCE ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_WOODEN_BUTTON ].m_Transparent = true;
|
a_Info[E_BLOCK_NETHER_PORTAL ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_WOODEN_DOOR ].m_Transparent = true;
|
a_Info[E_BLOCK_NETHER_WART ].m_Transparent = true;
|
||||||
ms_Info[E_BLOCK_WOODEN_PRESSURE_PLATE].m_Transparent = true;
|
a_Info[E_BLOCK_NEW_LEAVES ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_PISTON ].m_Transparent = true;
|
||||||
// TODO: Any other transparent blocks?
|
a_Info[E_BLOCK_PISTON_EXTENSION ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_PISTON_MOVED_BLOCK ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_POTATOES ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_POWERED_RAIL ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_PUMPKIN_STEM ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_RAIL ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_RED_MUSHROOM ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_REPEATER_OFF].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_WIRE ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_SAPLING ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_SIGN_POST ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_SNOW ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_STAINED_GLASS ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_STAINED_GLASS_PANE ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_STATIONARY_LAVA ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_STATIONARY_WATER ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_STICKY_PISTON ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_STONE_BUTTON ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_STONE_SLAB ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_SUGARCANE ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_TALL_GRASS ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_TORCH ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_TRAPDOOR ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_TRAPPED_CHEST ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_TRIPWIRE ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_TRIPWIRE_HOOK ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_VINES ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_WALLSIGN ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_WATER ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_WOODEN_BUTTON ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_WOODEN_DOOR ].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_WOODEN_PRESSURE_PLATE].m_Transparent = true;
|
||||||
|
a_Info[E_BLOCK_WOODEN_SLAB ].m_Transparent = true;
|
||||||
|
|
||||||
|
|
||||||
// One hit break blocks:
|
// One hit break blocks:
|
||||||
ms_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_OneHitDig = true;
|
a_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_BIG_FLOWER ].m_OneHitDig = true;
|
a_Info[E_BLOCK_BIG_FLOWER ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_OneHitDig = true;
|
a_Info[E_BLOCK_BROWN_MUSHROOM ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_CARROTS ].m_OneHitDig = true;
|
a_Info[E_BLOCK_CARROTS ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_CROPS ].m_OneHitDig = true;
|
a_Info[E_BLOCK_CROPS ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_DANDELION ].m_OneHitDig = true;
|
a_Info[E_BLOCK_DANDELION ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_FIRE ].m_OneHitDig = true;
|
a_Info[E_BLOCK_DEAD_BUSH ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_FLOWER ].m_OneHitDig = true;
|
a_Info[E_BLOCK_FIRE ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_FLOWER_POT ].m_OneHitDig = true;
|
a_Info[E_BLOCK_FLOWER ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_OneHitDig = true;
|
a_Info[E_BLOCK_FLOWER_POT ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_MELON_STEM ].m_OneHitDig = true;
|
a_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_POTATOES ].m_OneHitDig = true;
|
a_Info[E_BLOCK_LILY_PAD ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_PUMPKIN_STEM ].m_OneHitDig = true;
|
a_Info[E_BLOCK_MELON_STEM ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_REPEATER_OFF].m_OneHitDig = true;
|
a_Info[E_BLOCK_POTATOES ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_OneHitDig = true;
|
a_Info[E_BLOCK_PUMPKIN_STEM ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_OneHitDig = true;
|
a_Info[E_BLOCK_REDSTONE_REPEATER_OFF].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_OneHitDig = true;
|
a_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_WIRE ].m_OneHitDig = true;
|
a_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_RED_MUSHROOM ].m_OneHitDig = true;
|
a_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_REEDS ].m_OneHitDig = true;
|
a_Info[E_BLOCK_REDSTONE_WIRE ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_SAPLING ].m_OneHitDig = true;
|
a_Info[E_BLOCK_RED_MUSHROOM ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_TNT ].m_OneHitDig = true;
|
a_Info[E_BLOCK_REEDS ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_TALL_GRASS ].m_OneHitDig = true;
|
a_Info[E_BLOCK_SAPLING ].m_OneHitDig = true;
|
||||||
ms_Info[E_BLOCK_TORCH ].m_OneHitDig = true;
|
a_Info[E_BLOCK_TNT ].m_OneHitDig = true;
|
||||||
|
a_Info[E_BLOCK_TALL_GRASS ].m_OneHitDig = true;
|
||||||
|
a_Info[E_BLOCK_TORCH ].m_OneHitDig = true;
|
||||||
|
a_Info[E_BLOCK_TRIPWIRE ].m_OneHitDig = true;
|
||||||
|
|
||||||
|
|
||||||
// Blocks that break when pushed by piston:
|
// Blocks that break when pushed by piston:
|
||||||
ms_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_AIR ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_AIR ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_BED ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_BED ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_BIG_FLOWER ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_BIG_FLOWER ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_BROWN_MUSHROOM ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_CAKE ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_CACTUS ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_COBWEB ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_CAKE ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_CROPS ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_CARROTS ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_DANDELION ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_COCOA_POD ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_DEAD_BUSH ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_COBWEB ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_FIRE ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_CROPS ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_FLOWER ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_DANDELION ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_HEAD ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_DEAD_BUSH ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_PistonBreakable = true;
|
a_Info[E_BLOCK_DRAGON_EGG ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_FIRE ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_IRON_DOOR ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_FLOWER ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_JACK_O_LANTERN ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_FLOWER_POT ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_PistonBreakable = true;
|
a_Info[E_BLOCK_HEAD ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_LADDER ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_LAVA ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_LEVER ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_IRON_DOOR ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_MELON ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_JACK_O_LANTERN ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_MELON_STEM ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_PUMPKIN ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_LILY_PAD ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_PUMPKIN_STEM ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_LADDER ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_REPEATER_OFF].m_PistonBreakable = true;
|
a_Info[E_BLOCK_LAVA ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_PistonBreakable = true;
|
a_Info[E_BLOCK_LEVER ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_MELON ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_MELON_STEM ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_WIRE ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_NETHER_WART ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_RED_MUSHROOM ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_POTATOES ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_REEDS ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_PUMPKIN ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_SNOW ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_PUMPKIN_STEM ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_STATIONARY_LAVA ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_REDSTONE_REPEATER_OFF].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_STATIONARY_WATER ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_STONE_BUTTON ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_PistonBreakable = true;
|
a_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_TALL_GRASS ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_REDSTONE_WIRE ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_TORCH ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_RED_MUSHROOM ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_VINES ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_REEDS ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_WATER ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_SAPLING ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_WOODEN_BUTTON ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_SIGN_POST ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_WOODEN_DOOR ].m_PistonBreakable = true;
|
a_Info[E_BLOCK_SNOW ].m_PistonBreakable = true;
|
||||||
ms_Info[E_BLOCK_WOODEN_PRESSURE_PLATE].m_PistonBreakable = true;
|
a_Info[E_BLOCK_STATIONARY_LAVA ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_STATIONARY_WATER ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_STONE_BUTTON ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_TALL_GRASS ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_TORCH ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_TRAPDOOR ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_TRIPWIRE ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_TRIPWIRE_HOOK ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_VINES ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_WALLSIGN ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_WATER ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_WOODEN_BUTTON ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_WOODEN_DOOR ].m_PistonBreakable = true;
|
||||||
|
a_Info[E_BLOCK_WOODEN_PRESSURE_PLATE].m_PistonBreakable = true;
|
||||||
|
|
||||||
|
|
||||||
// Blocks that cannot be snowed over:
|
// Blocks that can be snowed over:
|
||||||
ms_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_IsSnowable = false;
|
a_Info[E_BLOCK_BEDROCK ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_AIR ].m_IsSnowable = false;
|
a_Info[E_BLOCK_BLOCK_OF_COAL ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_BIG_FLOWER ].m_IsSnowable = false;
|
a_Info[E_BLOCK_BLOCK_OF_REDSTONE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_IsSnowable = false;
|
a_Info[E_BLOCK_BOOKCASE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_CACTUS ].m_IsSnowable = false;
|
a_Info[E_BLOCK_BRICK ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_CHEST ].m_IsSnowable = false;
|
a_Info[E_BLOCK_CLAY ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_CROPS ].m_IsSnowable = false;
|
a_Info[E_BLOCK_CRAFTING_TABLE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_COBBLESTONE_WALL ].m_IsSnowable = false;
|
a_Info[E_BLOCK_COAL_ORE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_DANDELION ].m_IsSnowable = false;
|
a_Info[E_BLOCK_COMMAND_BLOCK ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_FIRE ].m_IsSnowable = false;
|
a_Info[E_BLOCK_COBBLESTONE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_FLOWER ].m_IsSnowable = false;
|
a_Info[E_BLOCK_DIAMOND_BLOCK ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_GLASS ].m_IsSnowable = false;
|
a_Info[E_BLOCK_DIAMOND_ORE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_ICE ].m_IsSnowable = false;
|
a_Info[E_BLOCK_DIRT ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_IsSnowable = false;
|
a_Info[E_BLOCK_DISPENSER ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_LAVA ].m_IsSnowable = false;
|
a_Info[E_BLOCK_DOUBLE_STONE_SLAB ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_LILY_PAD ].m_IsSnowable = false;
|
a_Info[E_BLOCK_DOUBLE_WOODEN_SLAB ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_REPEATER_OFF].m_IsSnowable = false;
|
a_Info[E_BLOCK_DROPPER ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_IsSnowable = false;
|
a_Info[E_BLOCK_EMERALD_BLOCK ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_IsSnowable = false;
|
a_Info[E_BLOCK_EMERALD_ORE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_IsSnowable = false;
|
a_Info[E_BLOCK_END_STONE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_WIRE ].m_IsSnowable = false;
|
a_Info[E_BLOCK_FURNACE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_RED_MUSHROOM ].m_IsSnowable = false;
|
a_Info[E_BLOCK_GLOWSTONE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_REEDS ].m_IsSnowable = false;
|
a_Info[E_BLOCK_GOLD_BLOCK ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_SAPLING ].m_IsSnowable = false;
|
a_Info[E_BLOCK_GOLD_ORE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_SIGN_POST ].m_IsSnowable = false;
|
a_Info[E_BLOCK_GRASS ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_SNOW ].m_IsSnowable = false;
|
a_Info[E_BLOCK_GRAVEL ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_STAINED_GLASS ].m_IsSnowable = false;
|
a_Info[E_BLOCK_HARDENED_CLAY ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_STAINED_GLASS_PANE ].m_IsSnowable = false;
|
a_Info[E_BLOCK_HAY_BALE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_STATIONARY_LAVA ].m_IsSnowable = false;
|
a_Info[E_BLOCK_HUGE_BROWN_MUSHROOM ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_STATIONARY_WATER ].m_IsSnowable = false;
|
a_Info[E_BLOCK_HUGE_RED_MUSHROOM ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_TALL_GRASS ].m_IsSnowable = false;
|
a_Info[E_BLOCK_IRON_BLOCK ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_TNT ].m_IsSnowable = false;
|
a_Info[E_BLOCK_IRON_ORE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_TORCH ].m_IsSnowable = false;
|
a_Info[E_BLOCK_JACK_O_LANTERN ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_VINES ].m_IsSnowable = false;
|
a_Info[E_BLOCK_JUKEBOX ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_WALLSIGN ].m_IsSnowable = false;
|
a_Info[E_BLOCK_LAPIS_BLOCK ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_WATER ].m_IsSnowable = false;
|
a_Info[E_BLOCK_LAPIS_ORE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_RAIL ].m_IsSnowable = false;
|
a_Info[E_BLOCK_LEAVES ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_ACTIVATOR_RAIL ].m_IsSnowable = false;
|
a_Info[E_BLOCK_LIT_FURNACE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_POWERED_RAIL ].m_IsSnowable = false;
|
a_Info[E_BLOCK_LOG ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_DETECTOR_RAIL ].m_IsSnowable = false;
|
a_Info[E_BLOCK_MELON ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_COBWEB ].m_IsSnowable = false;
|
a_Info[E_BLOCK_MOSSY_COBBLESTONE ].m_IsSnowable = true;
|
||||||
ms_Info[E_BLOCK_HEAD ].m_IsSnowable = false;
|
a_Info[E_BLOCK_MYCELIUM ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_NETHER_BRICK ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_NETHER_QUARTZ_ORE ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_NETHERRACK ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_NEW_LEAVES ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_NEW_LOG ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_NOTE_BLOCK ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_OBSIDIAN ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_PLANKS ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_PUMPKIN ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_QUARTZ_BLOCK ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_LAMP_OFF ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_LAMP_ON ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_ORE ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_SAND ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_SANDSTONE ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_SILVERFISH_EGG ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_SNOW_BLOCK ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_SOULSAND ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_SPONGE ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_STAINED_CLAY ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_STONE ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_STONE_BRICKS ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_TNT ].m_IsSnowable = true;
|
||||||
|
a_Info[E_BLOCK_WOOL ].m_IsSnowable = true;
|
||||||
|
|
||||||
|
|
||||||
// Blocks that don't drop without a special tool:
|
// Blocks that don't drop without a special tool:
|
||||||
ms_Info[E_BLOCK_BRICK ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_BRICK ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_CAULDRON ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_CAULDRON ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_COAL_ORE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_COAL_ORE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_COBBLESTONE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_COBBLESTONE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_COBBLESTONE_WALL ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_COBBLESTONE_WALL ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_COBBLESTONE_STAIRS ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_COBBLESTONE_STAIRS ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_COBWEB ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_COBWEB ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_DIAMOND_BLOCK ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_DIAMOND_BLOCK ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_DIAMOND_ORE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_DIAMOND_ORE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_DOUBLE_STONE_SLAB ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_DOUBLE_STONE_SLAB ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_EMERALD_ORE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_EMERALD_ORE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_END_STONE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_END_STONE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_GOLD_BLOCK ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_GOLD_BLOCK ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_GOLD_ORE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_GOLD_ORE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_IRON_BLOCK ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_IRON_BLOCK ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_IRON_ORE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_IRON_ORE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_LAPIS_BLOCK ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_LAPIS_BLOCK ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_LAPIS_ORE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_LAPIS_ORE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_LEAVES ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_MOSSY_COBBLESTONE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_NETHERRACK ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_MOSSY_COBBLESTONE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_NETHER_BRICK ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_NETHERRACK ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_NETHER_BRICK_STAIRS ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_NETHER_BRICK ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_OBSIDIAN ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_NETHER_BRICK_STAIRS ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_ORE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_OBSIDIAN ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_REDSTONE_ORE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_SANDSTONE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_SANDSTONE_STAIRS ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_SANDSTONE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_SNOW ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_SANDSTONE_STAIRS ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_STONE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_SNOW ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_STONE_BRICKS ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_STONE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_STONE_BRICK_STAIRS ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_STONE_BRICKS ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_STONE_BRICK_STAIRS ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_STONE_SLAB ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_VINES ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_STONE_SLAB ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_FURNACE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_VINES ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_LIT_FURNACE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_FURNACE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_ANVIL ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_LIT_FURNACE ].m_RequiresSpecialTool = true;
|
||||||
ms_Info[E_BLOCK_ENCHANTMENT_TABLE ].m_RequiresSpecialTool = true;
|
a_Info[E_BLOCK_ANVIL ].m_RequiresSpecialTool = true;
|
||||||
|
a_Info[E_BLOCK_ENCHANTMENT_TABLE ].m_RequiresSpecialTool = true;
|
||||||
|
|
||||||
|
|
||||||
// Nonsolid blocks:
|
// Nonsolid blocks:
|
||||||
ms_Info[E_BLOCK_ACTIVATOR_RAIL ].m_IsSolid = false;
|
a_Info[E_BLOCK_ACTIVATOR_RAIL ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_AIR ].m_IsSolid = false;
|
a_Info[E_BLOCK_AIR ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_BIG_FLOWER ].m_IsSolid = false;
|
a_Info[E_BLOCK_BIG_FLOWER ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_IsSolid = false;
|
a_Info[E_BLOCK_BROWN_MUSHROOM ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_CAKE ].m_IsSolid = false;
|
a_Info[E_BLOCK_CAKE ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_CARROTS ].m_IsSolid = false;
|
a_Info[E_BLOCK_CARROTS ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_COBWEB ].m_IsSolid = false;
|
a_Info[E_BLOCK_COBWEB ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_CROPS ].m_IsSolid = false;
|
a_Info[E_BLOCK_CROPS ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_DANDELION ].m_IsSolid = false;
|
a_Info[E_BLOCK_DANDELION ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_DETECTOR_RAIL ].m_IsSolid = false;
|
a_Info[E_BLOCK_DETECTOR_RAIL ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_END_PORTAL ].m_IsSolid = false;
|
a_Info[E_BLOCK_FIRE ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_FENCE ].m_IsSolid = false;
|
a_Info[E_BLOCK_FLOWER ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_FENCE_GATE ].m_IsSolid = false;
|
a_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_FIRE ].m_IsSolid = false;
|
a_Info[E_BLOCK_LAVA ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_FLOWER ].m_IsSolid = false;
|
a_Info[E_BLOCK_LEVER ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_IsSolid = false;
|
a_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_LAVA ].m_IsSolid = false;
|
a_Info[E_BLOCK_MELON_STEM ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_LEVER ].m_IsSolid = false;
|
a_Info[E_BLOCK_NETHER_PORTAL ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_IsSolid = false;
|
a_Info[E_BLOCK_POTATOES ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_MELON_STEM ].m_IsSolid = false;
|
a_Info[E_BLOCK_POWERED_RAIL ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_NETHER_PORTAL ].m_IsSolid = false;
|
a_Info[E_BLOCK_RAIL ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_PISTON_EXTENSION ].m_IsSolid = false;
|
a_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_POTATOES ].m_IsSolid = false;
|
a_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_POWERED_RAIL ].m_IsSolid = false;
|
a_Info[E_BLOCK_REDSTONE_WIRE ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_RAIL ].m_IsSolid = false;
|
a_Info[E_BLOCK_RED_MUSHROOM ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_IsSolid = false;
|
a_Info[E_BLOCK_REEDS ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_IsSolid = false;
|
a_Info[E_BLOCK_SAPLING ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_REDSTONE_WIRE ].m_IsSolid = false;
|
a_Info[E_BLOCK_SIGN_POST ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_RED_MUSHROOM ].m_IsSolid = false;
|
a_Info[E_BLOCK_SNOW ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_REEDS ].m_IsSolid = false;
|
a_Info[E_BLOCK_STATIONARY_LAVA ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_SAPLING ].m_IsSolid = false;
|
a_Info[E_BLOCK_STATIONARY_WATER ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_SIGN_POST ].m_IsSolid = false;
|
a_Info[E_BLOCK_STONE_BUTTON ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_SNOW ].m_IsSolid = false;
|
a_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_STATIONARY_LAVA ].m_IsSolid = false;
|
a_Info[E_BLOCK_TALL_GRASS ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_STATIONARY_WATER ].m_IsSolid = false;
|
a_Info[E_BLOCK_TORCH ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_STONE_BUTTON ].m_IsSolid = false;
|
a_Info[E_BLOCK_TRIPWIRE ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_IsSolid = false;
|
a_Info[E_BLOCK_VINES ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_TALL_GRASS ].m_IsSolid = false;
|
a_Info[E_BLOCK_WALLSIGN ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_TORCH ].m_IsSolid = false;
|
a_Info[E_BLOCK_WATER ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_TRIPWIRE ].m_IsSolid = false;
|
a_Info[E_BLOCK_WOODEN_BUTTON ].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_VINES ].m_IsSolid = false;
|
a_Info[E_BLOCK_WOODEN_PRESSURE_PLATE].m_IsSolid = false;
|
||||||
ms_Info[E_BLOCK_WALLSIGN ].m_IsSolid = false;
|
|
||||||
ms_Info[E_BLOCK_WATER ].m_IsSolid = false;
|
|
||||||
ms_Info[E_BLOCK_WOODEN_BUTTON ].m_IsSolid = false;
|
|
||||||
ms_Info[E_BLOCK_WOODEN_PRESSURE_PLATE].m_IsSolid = false;
|
|
||||||
ms_Info[E_BLOCK_WOODEN_SLAB ].m_IsSolid = false;
|
|
||||||
|
|
||||||
|
|
||||||
// Blocks that fully occupy their voxel - used as a guide for torch placeable blocks, amongst other things:
|
// Blocks that fully occupy their voxel - used as a guide for torch placeable blocks, amongst other things:
|
||||||
ms_Info[E_BLOCK_NEW_LOG ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_NEW_LOG ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_BEDROCK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_BEDROCK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_BLOCK_OF_COAL ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_BLOCK_OF_COAL ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_BLOCK_OF_REDSTONE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_BLOCK_OF_REDSTONE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_BOOKCASE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_BOOKCASE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_BRICK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_BRICK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_CLAY ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_CLAY ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_COAL_ORE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_COAL_ORE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_COBBLESTONE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_COBBLESTONE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_COMMAND_BLOCK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_COMMAND_BLOCK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_CRAFTING_TABLE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_CRAFTING_TABLE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_DIAMOND_BLOCK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_DIAMOND_BLOCK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_DIAMOND_ORE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_DIAMOND_ORE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_DIRT ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_DIRT ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_DISPENSER ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_DISPENSER ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_DOUBLE_STONE_SLAB ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_DOUBLE_STONE_SLAB ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_DOUBLE_WOODEN_SLAB ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_DOUBLE_WOODEN_SLAB ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_DROPPER ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_DROPPER ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_EMERALD_BLOCK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_EMERALD_BLOCK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_EMERALD_ORE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_EMERALD_ORE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_END_STONE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_END_STONE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_FURNACE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_FURNACE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_GLOWSTONE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_GLOWSTONE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_GOLD_BLOCK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_GOLD_BLOCK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_GOLD_ORE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_GOLD_ORE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_GRASS ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_GRASS ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_GRAVEL ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_GRAVEL ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_HARDENED_CLAY ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_HARDENED_CLAY ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_HAY_BALE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_HAY_BALE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_HUGE_BROWN_MUSHROOM ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_HUGE_BROWN_MUSHROOM ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_HUGE_RED_MUSHROOM ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_HUGE_RED_MUSHROOM ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_ICE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_ICE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_IRON_BLOCK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_IRON_BLOCK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_IRON_ORE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_IRON_ORE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_JACK_O_LANTERN ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_JACK_O_LANTERN ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_JUKEBOX ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_JUKEBOX ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_LAPIS_BLOCK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_LAPIS_BLOCK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_LAPIS_ORE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_LAPIS_ORE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_LOG ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_LOG ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_MELON ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_MELON ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_MOSSY_COBBLESTONE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_MOSSY_COBBLESTONE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_MYCELIUM ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_MYCELIUM ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_NETHERRACK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_NETHERRACK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_NETHER_BRICK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_NETHER_BRICK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_NETHER_QUARTZ_ORE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_NETHER_QUARTZ_ORE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_NOTE_BLOCK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_NOTE_BLOCK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_OBSIDIAN ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_OBSIDIAN ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_PACKED_ICE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_PACKED_ICE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_PLANKS ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_PLANKS ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_PUMPKIN ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_PUMPKIN ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_QUARTZ_BLOCK ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_QUARTZ_BLOCK ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_LAMP_OFF ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_REDSTONE_LAMP_OFF ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_LAMP_ON ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_REDSTONE_LAMP_ON ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_ORE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_REDSTONE_ORE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_SANDSTONE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_SANDSTONE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_SAND ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_SAND ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_SILVERFISH_EGG ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_SILVERFISH_EGG ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_SPONGE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_SPONGE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_STAINED_CLAY ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_STAINED_CLAY ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_WOOL ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_STONE ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_STONE ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_STONE_BRICKS ].m_FullyOccupiesVoxel = true;
|
||||||
ms_Info[E_BLOCK_STONE_BRICKS ].m_FullyOccupiesVoxel = true;
|
a_Info[E_BLOCK_WOOL ].m_FullyOccupiesVoxel = true;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -16,18 +16,8 @@ class cBlockHandler;
|
||||||
class cBlockInfo
|
class cBlockInfo
|
||||||
{
|
{
|
||||||
public:
|
public:
|
||||||
// tolua_end
|
|
||||||
|
|
||||||
cBlockInfo();
|
/** Returns the associated BlockInfo structure for the specified block type. */
|
||||||
|
|
||||||
~cBlockInfo();
|
|
||||||
|
|
||||||
/** (Re-)Initializes the internal BlockInfo structures. */
|
|
||||||
static void Initialize(void);
|
|
||||||
|
|
||||||
// tolua_begin
|
|
||||||
|
|
||||||
/** Returns the associated BlockInfo structure. */
|
|
||||||
static cBlockInfo & Get(BLOCKTYPE a_Type);
|
static cBlockInfo & Get(BLOCKTYPE a_Type);
|
||||||
|
|
||||||
|
|
||||||
|
@ -79,13 +69,18 @@ public:
|
||||||
|
|
||||||
inline static cBlockHandler * GetHandler (BLOCKTYPE a_Type) { return Get(a_Type).m_Handler; }
|
inline static cBlockHandler * GetHandler (BLOCKTYPE a_Type) { return Get(a_Type).m_Handler; }
|
||||||
|
|
||||||
|
|
||||||
protected:
|
protected:
|
||||||
|
/** Storage for all the BlockInfo structures. */
|
||||||
|
typedef cBlockInfo cBlockInfoArray[256];
|
||||||
|
|
||||||
// TODO xdot: Change to std::vector to support dynamic block IDs
|
/** Creates a default BlockInfo structure, initializes all values to their defaults */
|
||||||
static cBlockInfo ms_Info[256];
|
cBlockInfo();
|
||||||
|
|
||||||
|
/** Cleans up the stored values */
|
||||||
|
~cBlockInfo();
|
||||||
|
|
||||||
|
/** Initializes the specified BlockInfo structures with block-specific values. */
|
||||||
|
static void Initialize(cBlockInfoArray & a_BlockInfos);
|
||||||
}; // tolua_export
|
}; // tolua_export
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -23,7 +23,8 @@ public:
|
||||||
NIBBLETYPE Meta = (a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) | 0x08);
|
NIBBLETYPE Meta = (a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) | 0x08);
|
||||||
|
|
||||||
a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta);
|
a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta);
|
||||||
a_WorldInterface.GetBroadcastManager().BroadcastSoundEffect("random.click", a_BlockX * 8, a_BlockY * 8, a_BlockZ * 8, 0.5f, (Meta & 0x08) ? 0.6f : 0.5f);
|
a_WorldInterface.WakeUpSimulators(a_BlockX, a_BlockY, a_BlockZ);
|
||||||
|
a_WorldInterface.GetBroadcastManager().BroadcastSoundEffect("random.click", (double)a_BlockX, (double)a_BlockY, (double)a_BlockZ, 0.5f, (Meta & 0x08) ? 0.6f : 0.5f);
|
||||||
|
|
||||||
// Queue a button reset (unpress)
|
// Queue a button reset (unpress)
|
||||||
a_ChunkInterface.QueueSetBlock(a_BlockX, a_BlockY, a_BlockZ, m_BlockType, (a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) & 0x07), m_BlockType == E_BLOCK_STONE_BUTTON ? 20 : 30, m_BlockType, a_WorldInterface);
|
a_ChunkInterface.QueueSetBlock(a_BlockX, a_BlockY, a_BlockZ, m_BlockType, (a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) & 0x07), m_BlockType == E_BLOCK_STONE_BUTTON ? 20 : 30, m_BlockType, a_WorldInterface);
|
||||||
|
@ -102,7 +103,7 @@ public:
|
||||||
AddFaceDirection(a_RelX, a_RelY, a_RelZ, BlockMetaDataToBlockFace(Meta), true);
|
AddFaceDirection(a_RelX, a_RelY, a_RelZ, BlockMetaDataToBlockFace(Meta), true);
|
||||||
BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn);
|
BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn);
|
||||||
|
|
||||||
return (a_RelY > 0) && (cBlockInfo::IsSolid(BlockIsOn));
|
return (a_RelY > 0) && (cBlockInfo::FullyOccupiesVoxel(BlockIsOn));
|
||||||
}
|
}
|
||||||
} ;
|
} ;
|
||||||
|
|
||||||
|
|
|
@ -44,16 +44,16 @@ public:
|
||||||
}
|
}
|
||||||
double yaw = a_Player->GetYaw();
|
double yaw = a_Player->GetYaw();
|
||||||
if (
|
if (
|
||||||
(Area.GetRelBlockType(0, 0, 1) == E_BLOCK_CHEST) ||
|
(Area.GetRelBlockType(0, 0, 1) == m_BlockType) ||
|
||||||
(Area.GetRelBlockType(2, 0, 1) == E_BLOCK_CHEST)
|
(Area.GetRelBlockType(2, 0, 1) == m_BlockType)
|
||||||
)
|
)
|
||||||
{
|
{
|
||||||
a_BlockMeta = ((yaw >= -90) && (yaw < 90)) ? 2 : 3;
|
a_BlockMeta = ((yaw >= -90) && (yaw < 90)) ? 2 : 3;
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
if (
|
if (
|
||||||
(Area.GetRelBlockType(0, 0, 1) == E_BLOCK_CHEST) ||
|
(Area.GetRelBlockType(0, 0, 1) == m_BlockType) ||
|
||||||
(Area.GetRelBlockType(2, 0, 1) == E_BLOCK_CHEST)
|
(Area.GetRelBlockType(2, 0, 1) == m_BlockType)
|
||||||
)
|
)
|
||||||
{
|
{
|
||||||
// FIXME: This is unreachable, as the condition is the same as the above one
|
// FIXME: This is unreachable, as the condition is the same as the above one
|
||||||
|
@ -130,12 +130,12 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
int NumChestNeighbors = 0;
|
int NumChestNeighbors = 0;
|
||||||
if (Area.GetRelBlockType(1, 0, 2) == E_BLOCK_CHEST)
|
if (Area.GetRelBlockType(1, 0, 2) == m_BlockType)
|
||||||
{
|
{
|
||||||
if (
|
if (
|
||||||
(Area.GetRelBlockType(0, 0, 2) == E_BLOCK_CHEST) ||
|
(Area.GetRelBlockType(0, 0, 2) == m_BlockType) ||
|
||||||
(Area.GetRelBlockType(1, 0, 1) == E_BLOCK_CHEST) ||
|
(Area.GetRelBlockType(1, 0, 1) == m_BlockType) ||
|
||||||
(Area.GetRelBlockType(1, 0, 3) == E_BLOCK_CHEST)
|
(Area.GetRelBlockType(1, 0, 3) == m_BlockType)
|
||||||
)
|
)
|
||||||
{
|
{
|
||||||
// Already a doublechest neighbor, disallow:
|
// Already a doublechest neighbor, disallow:
|
||||||
|
@ -143,12 +143,12 @@ public:
|
||||||
}
|
}
|
||||||
NumChestNeighbors += 1;
|
NumChestNeighbors += 1;
|
||||||
}
|
}
|
||||||
if (Area.GetRelBlockType(3, 0, 2) == E_BLOCK_CHEST)
|
if (Area.GetRelBlockType(3, 0, 2) == m_BlockType)
|
||||||
{
|
{
|
||||||
if (
|
if (
|
||||||
(Area.GetRelBlockType(4, 0, 2) == E_BLOCK_CHEST) ||
|
(Area.GetRelBlockType(4, 0, 2) == m_BlockType) ||
|
||||||
(Area.GetRelBlockType(3, 0, 1) == E_BLOCK_CHEST) ||
|
(Area.GetRelBlockType(3, 0, 1) == m_BlockType) ||
|
||||||
(Area.GetRelBlockType(3, 0, 3) == E_BLOCK_CHEST)
|
(Area.GetRelBlockType(3, 0, 3) == m_BlockType)
|
||||||
)
|
)
|
||||||
{
|
{
|
||||||
// Already a doublechest neighbor, disallow:
|
// Already a doublechest neighbor, disallow:
|
||||||
|
@ -156,12 +156,12 @@ public:
|
||||||
}
|
}
|
||||||
NumChestNeighbors += 1;
|
NumChestNeighbors += 1;
|
||||||
}
|
}
|
||||||
if (Area.GetRelBlockType(2, 0, 1) == E_BLOCK_CHEST)
|
if (Area.GetRelBlockType(2, 0, 1) == m_BlockType)
|
||||||
{
|
{
|
||||||
if (
|
if (
|
||||||
(Area.GetRelBlockType(2, 0, 0) == E_BLOCK_CHEST) ||
|
(Area.GetRelBlockType(2, 0, 0) == m_BlockType) ||
|
||||||
(Area.GetRelBlockType(1, 0, 1) == E_BLOCK_CHEST) ||
|
(Area.GetRelBlockType(1, 0, 1) == m_BlockType) ||
|
||||||
(Area.GetRelBlockType(3, 0, 1) == E_BLOCK_CHEST)
|
(Area.GetRelBlockType(3, 0, 1) == m_BlockType)
|
||||||
)
|
)
|
||||||
{
|
{
|
||||||
// Already a doublechest neighbor, disallow:
|
// Already a doublechest neighbor, disallow:
|
||||||
|
@ -169,12 +169,12 @@ public:
|
||||||
}
|
}
|
||||||
NumChestNeighbors += 1;
|
NumChestNeighbors += 1;
|
||||||
}
|
}
|
||||||
if (Area.GetRelBlockType(2, 0, 3) == E_BLOCK_CHEST)
|
if (Area.GetRelBlockType(2, 0, 3) == m_BlockType)
|
||||||
{
|
{
|
||||||
if (
|
if (
|
||||||
(Area.GetRelBlockType(2, 0, 4) == E_BLOCK_CHEST) ||
|
(Area.GetRelBlockType(2, 0, 4) == m_BlockType) ||
|
||||||
(Area.GetRelBlockType(1, 0, 3) == E_BLOCK_CHEST) ||
|
(Area.GetRelBlockType(1, 0, 3) == m_BlockType) ||
|
||||||
(Area.GetRelBlockType(3, 0, 3) == E_BLOCK_CHEST)
|
(Area.GetRelBlockType(3, 0, 3) == m_BlockType)
|
||||||
)
|
)
|
||||||
{
|
{
|
||||||
// Already a doublechest neighbor, disallow:
|
// Already a doublechest neighbor, disallow:
|
||||||
|
@ -217,7 +217,7 @@ public:
|
||||||
/// If there's a chest in the a_Area in the specified coords, modifies its meta to a_NewMeta and returns true.
|
/// If there's a chest in the a_Area in the specified coords, modifies its meta to a_NewMeta and returns true.
|
||||||
bool CheckAndAdjustNeighbor(cChunkInterface & a_ChunkInterface, const cBlockArea & a_Area, int a_RelX, int a_RelZ, NIBBLETYPE a_NewMeta)
|
bool CheckAndAdjustNeighbor(cChunkInterface & a_ChunkInterface, const cBlockArea & a_Area, int a_RelX, int a_RelZ, NIBBLETYPE a_NewMeta)
|
||||||
{
|
{
|
||||||
if (a_Area.GetRelBlockType(a_RelX, 0, a_RelZ) != E_BLOCK_CHEST)
|
if (a_Area.GetRelBlockType(a_RelX, 0, a_RelZ) != m_BlockType)
|
||||||
{
|
{
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
@ -228,7 +228,7 @@ public:
|
||||||
|
|
||||||
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
||||||
{
|
{
|
||||||
a_Pickups.push_back(cItem(E_BLOCK_CHEST, 1, 0));
|
a_Pickups.push_back(cItem(m_BlockType, 1, 0));
|
||||||
}
|
}
|
||||||
} ;
|
} ;
|
||||||
|
|
||||||
|
|
|
@ -16,13 +16,6 @@ public:
|
||||||
{
|
{
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
|
||||||
{
|
|
||||||
a_Pickups.push_back(cItem(E_BLOCK_WOOL, 1, a_BlockMeta));
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
virtual const char * GetStepSound(void) override
|
virtual const char * GetStepSound(void) override
|
||||||
{
|
{
|
||||||
return "step.cloth";
|
return "step.cloth";
|
||||||
|
|
|
@ -18,7 +18,7 @@ public:
|
||||||
|
|
||||||
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
||||||
{
|
{
|
||||||
//todo: Drop Ender Chest if using silk touch pickaxe
|
// todo: Drop Ender Chest if using silk touch pickaxe
|
||||||
a_Pickups.push_back(cItem(E_BLOCK_OBSIDIAN, 8, 0));
|
a_Pickups.push_back(cItem(E_BLOCK_OBSIDIAN, 8, 0));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -19,15 +19,13 @@
|
||||||
class cBlockFarmlandHandler :
|
class cBlockFarmlandHandler :
|
||||||
public cBlockHandler
|
public cBlockHandler
|
||||||
{
|
{
|
||||||
typedef cBlockHandler super;
|
|
||||||
|
|
||||||
public:
|
public:
|
||||||
cBlockFarmlandHandler(void) :
|
cBlockFarmlandHandler(BLOCKTYPE a_BlockType) :
|
||||||
super(E_BLOCK_FARMLAND)
|
cBlockHandler(a_BlockType)
|
||||||
{
|
{
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
virtual void OnUpdate(cChunkInterface & cChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_PluginInterface, cChunk & a_Chunk, int a_RelX, int a_RelY, int a_RelZ) override
|
virtual void OnUpdate(cChunkInterface & cChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_PluginInterface, cChunk & a_Chunk, int a_RelX, int a_RelY, int a_RelZ) override
|
||||||
{
|
{
|
||||||
bool Found = false;
|
bool Found = false;
|
||||||
|
@ -105,6 +103,11 @@ public:
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
||||||
|
{
|
||||||
|
a_Pickups.Add(E_BLOCK_DIRT, 1, 0); // Reset meta
|
||||||
|
}
|
||||||
} ;
|
} ;
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -65,6 +65,8 @@
|
||||||
#include "BlockRedstoneRepeater.h"
|
#include "BlockRedstoneRepeater.h"
|
||||||
#include "BlockRedstoneTorch.h"
|
#include "BlockRedstoneTorch.h"
|
||||||
#include "BlockTNT.h"
|
#include "BlockTNT.h"
|
||||||
|
#include "BlockTripwire.h"
|
||||||
|
#include "BlockTripwireHook.h"
|
||||||
#include "BlockSand.h"
|
#include "BlockSand.h"
|
||||||
#include "BlockSapling.h"
|
#include "BlockSapling.h"
|
||||||
#include "BlockSideways.h"
|
#include "BlockSideways.h"
|
||||||
|
@ -209,7 +211,7 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType)
|
||||||
case E_BLOCK_EMERALD_ORE: return new cBlockOreHandler (a_BlockType);
|
case E_BLOCK_EMERALD_ORE: return new cBlockOreHandler (a_BlockType);
|
||||||
case E_BLOCK_ENCHANTMENT_TABLE: return new cBlockEnchantmentTableHandler(a_BlockType);
|
case E_BLOCK_ENCHANTMENT_TABLE: return new cBlockEnchantmentTableHandler(a_BlockType);
|
||||||
case E_BLOCK_ENDER_CHEST: return new cBlockEnderchestHandler (a_BlockType);
|
case E_BLOCK_ENDER_CHEST: return new cBlockEnderchestHandler (a_BlockType);
|
||||||
case E_BLOCK_FARMLAND: return new cBlockFarmlandHandler ( );
|
case E_BLOCK_FARMLAND: return new cBlockFarmlandHandler (a_BlockType);
|
||||||
case E_BLOCK_FENCE_GATE: return new cBlockFenceGateHandler (a_BlockType);
|
case E_BLOCK_FENCE_GATE: return new cBlockFenceGateHandler (a_BlockType);
|
||||||
case E_BLOCK_FIRE: return new cBlockFireHandler (a_BlockType);
|
case E_BLOCK_FIRE: return new cBlockFireHandler (a_BlockType);
|
||||||
case E_BLOCK_FLOWER_POT: return new cBlockFlowerPotHandler (a_BlockType);
|
case E_BLOCK_FLOWER_POT: return new cBlockFlowerPotHandler (a_BlockType);
|
||||||
|
@ -236,9 +238,9 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType)
|
||||||
case E_BLOCK_LAPIS_ORE: return new cBlockOreHandler (a_BlockType);
|
case E_BLOCK_LAPIS_ORE: return new cBlockOreHandler (a_BlockType);
|
||||||
case E_BLOCK_LAVA: return new cBlockLavaHandler (a_BlockType);
|
case E_BLOCK_LAVA: return new cBlockLavaHandler (a_BlockType);
|
||||||
case E_BLOCK_LEAVES: return new cBlockLeavesHandler (a_BlockType);
|
case E_BLOCK_LEAVES: return new cBlockLeavesHandler (a_BlockType);
|
||||||
|
case E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE: return new cBlockPressurePlateHandler(a_BlockType);
|
||||||
case E_BLOCK_LILY_PAD: return new cBlockLilypadHandler (a_BlockType);
|
case E_BLOCK_LILY_PAD: return new cBlockLilypadHandler (a_BlockType);
|
||||||
case E_BLOCK_LIT_FURNACE: return new cBlockFurnaceHandler (a_BlockType);
|
case E_BLOCK_LIT_FURNACE: return new cBlockFurnaceHandler (a_BlockType);
|
||||||
case E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE: return new cBlockPressurePlateHandler(a_BlockType);
|
|
||||||
case E_BLOCK_LOG: return new cBlockSidewaysHandler (a_BlockType);
|
case E_BLOCK_LOG: return new cBlockSidewaysHandler (a_BlockType);
|
||||||
case E_BLOCK_MELON: return new cBlockMelonHandler (a_BlockType);
|
case E_BLOCK_MELON: return new cBlockMelonHandler (a_BlockType);
|
||||||
case E_BLOCK_MELON_STEM: return new cBlockStemsHandler (a_BlockType);
|
case E_BLOCK_MELON_STEM: return new cBlockStemsHandler (a_BlockType);
|
||||||
|
@ -291,6 +293,9 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType)
|
||||||
case E_BLOCK_TORCH: return new cBlockTorchHandler (a_BlockType);
|
case E_BLOCK_TORCH: return new cBlockTorchHandler (a_BlockType);
|
||||||
case E_BLOCK_TRAPDOOR: return new cBlockTrapdoorHandler (a_BlockType);
|
case E_BLOCK_TRAPDOOR: return new cBlockTrapdoorHandler (a_BlockType);
|
||||||
case E_BLOCK_TNT: return new cBlockTNTHandler (a_BlockType);
|
case E_BLOCK_TNT: return new cBlockTNTHandler (a_BlockType);
|
||||||
|
case E_BLOCK_TRAPPED_CHEST: return new cBlockChestHandler (a_BlockType);
|
||||||
|
case E_BLOCK_TRIPWIRE: return new cBlockTripwireHandler (a_BlockType);
|
||||||
|
case E_BLOCK_TRIPWIRE_HOOK: return new cBlockTripwireHookHandler (a_BlockType);
|
||||||
case E_BLOCK_VINES: return new cBlockVineHandler (a_BlockType);
|
case E_BLOCK_VINES: return new cBlockVineHandler (a_BlockType);
|
||||||
case E_BLOCK_WALLSIGN: return new cBlockSignHandler (a_BlockType); // TODO: This needs a special handler
|
case E_BLOCK_WALLSIGN: return new cBlockSignHandler (a_BlockType); // TODO: This needs a special handler
|
||||||
case E_BLOCK_WATER: return new cBlockFluidHandler (a_BlockType);
|
case E_BLOCK_WATER: return new cBlockFluidHandler (a_BlockType);
|
||||||
|
|
|
@ -1,7 +1,6 @@
|
||||||
|
|
||||||
#pragma once
|
#pragma once
|
||||||
|
|
||||||
#include "BlockHandler.h"
|
|
||||||
#include "BlockSideways.h"
|
#include "BlockSideways.h"
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -3,17 +3,19 @@
|
||||||
|
|
||||||
#include "BlockHandler.h"
|
#include "BlockHandler.h"
|
||||||
#include "../World.h"
|
#include "../World.h"
|
||||||
|
#include "ClearMetaOnDrop.h"
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
class cBlockLadderHandler :
|
class cBlockLadderHandler :
|
||||||
public cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
|
public cClearMetaOnDrop<cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04> >
|
||||||
{
|
{
|
||||||
|
typedef cClearMetaOnDrop<cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04> > super;
|
||||||
public:
|
public:
|
||||||
cBlockLadderHandler(BLOCKTYPE a_BlockType)
|
cBlockLadderHandler(BLOCKTYPE a_BlockType)
|
||||||
: cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
|
: super(a_BlockType)
|
||||||
{
|
{
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -41,8 +43,14 @@ public:
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
static NIBBLETYPE DirectionToMetaData(eBlockFace a_Direction) // tolua_export
|
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
||||||
{ // tolua_export
|
{
|
||||||
|
a_Pickups.Add(m_BlockType, 1, 0); // Reset meta
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
static NIBBLETYPE DirectionToMetaData(eBlockFace a_Direction)
|
||||||
|
{
|
||||||
switch (a_Direction)
|
switch (a_Direction)
|
||||||
{
|
{
|
||||||
case BLOCK_FACE_ZM: return 0x2;
|
case BLOCK_FACE_ZM: return 0x2;
|
||||||
|
@ -51,11 +59,11 @@ public:
|
||||||
case BLOCK_FACE_XP: return 0x5;
|
case BLOCK_FACE_XP: return 0x5;
|
||||||
default: return 0x2;
|
default: return 0x2;
|
||||||
}
|
}
|
||||||
} // tolua_export
|
}
|
||||||
|
|
||||||
|
|
||||||
static eBlockFace MetaDataToDirection(NIBBLETYPE a_MetaData) // tolua_export
|
static eBlockFace MetaDataToDirection(NIBBLETYPE a_MetaData)
|
||||||
{ // tolua_export
|
{
|
||||||
switch (a_MetaData)
|
switch (a_MetaData)
|
||||||
{
|
{
|
||||||
case 0x2: return BLOCK_FACE_ZM;
|
case 0x2: return BLOCK_FACE_ZM;
|
||||||
|
@ -64,10 +72,10 @@ public:
|
||||||
case 0x5: return BLOCK_FACE_XP;
|
case 0x5: return BLOCK_FACE_XP;
|
||||||
default: return BLOCK_FACE_ZM;
|
default: return BLOCK_FACE_ZM;
|
||||||
}
|
}
|
||||||
} // tolua_export
|
}
|
||||||
|
|
||||||
|
|
||||||
/// Finds a suitable Direction for the Ladder. Returns BLOCK_FACE_BOTTOM on failure
|
/** Finds a suitable Direction for the Ladder. Returns BLOCK_FACE_BOTTOM on failure */
|
||||||
static eBlockFace FindSuitableBlockFace(cChunkInterface & a_ChunkInterface, int a_BlockX, int a_BlockY, int a_BlockZ)
|
static eBlockFace FindSuitableBlockFace(cChunkInterface & a_ChunkInterface, int a_BlockX, int a_BlockY, int a_BlockZ)
|
||||||
{
|
{
|
||||||
for (int FaceInt = BLOCK_FACE_ZM; FaceInt <= BLOCK_FACE_XP; FaceInt++)
|
for (int FaceInt = BLOCK_FACE_ZM; FaceInt <= BLOCK_FACE_XP; FaceInt++)
|
||||||
|
|
|
@ -22,8 +22,9 @@ public:
|
||||||
// Flip the ON bit on/off using the XOR bitwise operation
|
// Flip the ON bit on/off using the XOR bitwise operation
|
||||||
NIBBLETYPE Meta = (a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) ^ 0x08);
|
NIBBLETYPE Meta = (a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) ^ 0x08);
|
||||||
|
|
||||||
a_ChunkInterface.SetBlock(a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_LEVER, Meta); // SetMeta doesn't work for unpowering levers, so setblock
|
a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta);
|
||||||
a_WorldInterface.GetBroadcastManager().BroadcastSoundEffect("random.click", a_BlockX * 8, a_BlockY * 8, a_BlockZ * 8, 0.5f, (Meta & 0x08) ? 0.6f : 0.5f);
|
a_WorldInterface.WakeUpSimulators(a_BlockX, a_BlockY, a_BlockZ);
|
||||||
|
a_WorldInterface.GetBroadcastManager().BroadcastSoundEffect("random.click", (double)a_BlockX, (double)a_BlockY, (double)a_BlockZ, 0.5f, (Meta & 0x08) ? 0.6f : 0.5f);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -104,7 +105,7 @@ public:
|
||||||
AddFaceDirection(a_RelX, a_RelY, a_RelZ, BlockMetaDataToBlockFace(Meta), true);
|
AddFaceDirection(a_RelX, a_RelY, a_RelZ, BlockMetaDataToBlockFace(Meta), true);
|
||||||
BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn);
|
BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn);
|
||||||
|
|
||||||
return (a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn);
|
return (a_RelY > 0) && cBlockInfo::FullyOccupiesVoxel(BlockIsOn);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -8,18 +8,14 @@
|
||||||
|
|
||||||
|
|
||||||
class cBlockLilypadHandler :
|
class cBlockLilypadHandler :
|
||||||
public cBlockHandler
|
public cClearMetaOnDrop<cBlockHandler>
|
||||||
{
|
{
|
||||||
|
typedef cClearMetaOnDrop<cBlockHandler> super;
|
||||||
public:
|
public:
|
||||||
cBlockLilypadHandler(BLOCKTYPE a_BlockType)
|
|
||||||
: cBlockHandler(a_BlockType)
|
|
||||||
{
|
|
||||||
}
|
|
||||||
|
|
||||||
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
cBlockLilypadHandler(BLOCKTYPE a_BlockType) :
|
||||||
|
super(a_BlockType)
|
||||||
{
|
{
|
||||||
// Reset meta to zero
|
|
||||||
a_Pickups.push_back(cItem(E_BLOCK_LILY_PAD, 1, 0));
|
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
|
@ -85,7 +85,7 @@ int cBlockPistonHandler::FirstPassthroughBlock(int a_PistonX, int a_PistonY, int
|
||||||
NIBBLETYPE currMeta;
|
NIBBLETYPE currMeta;
|
||||||
AddPistonDir(a_PistonX, a_PistonY, a_PistonZ, pistonmeta, 1);
|
AddPistonDir(a_PistonX, a_PistonY, a_PistonZ, pistonmeta, 1);
|
||||||
a_World->GetBlockTypeMeta(a_PistonX, a_PistonY, a_PistonZ, currBlock, currMeta);
|
a_World->GetBlockTypeMeta(a_PistonX, a_PistonY, a_PistonZ, currBlock, currMeta);
|
||||||
if (CanBreakPush(currBlock))
|
if (cBlockInfo::IsPistonBreakable(currBlock))
|
||||||
{
|
{
|
||||||
// This block breaks when pushed, extend up to here
|
// This block breaks when pushed, extend up to here
|
||||||
return ret;
|
return ret;
|
||||||
|
@ -124,7 +124,7 @@ void cBlockPistonHandler::ExtendPiston(int a_BlockX, int a_BlockY, int a_BlockZ,
|
||||||
}
|
}
|
||||||
|
|
||||||
a_World->BroadcastBlockAction(a_BlockX, a_BlockY, a_BlockZ, 0, pistonMeta, pistonBlock);
|
a_World->BroadcastBlockAction(a_BlockX, a_BlockY, a_BlockZ, 0, pistonMeta, pistonBlock);
|
||||||
a_World->BroadcastSoundEffect("tile.piston.out", a_BlockX * 8, a_BlockY * 8, a_BlockZ * 8, 0.5f, 0.7f);
|
a_World->BroadcastSoundEffect("tile.piston.out", (double)a_BlockX, (double)a_BlockY, (double)a_BlockZ, 0.5f, 0.7f);
|
||||||
|
|
||||||
// Drop the breakable block in the line, if appropriate:
|
// Drop the breakable block in the line, if appropriate:
|
||||||
AddPistonDir(a_BlockX, a_BlockY, a_BlockZ, pistonMeta, dist + 1); // "a_Block" now at the breakable / empty block
|
AddPistonDir(a_BlockX, a_BlockY, a_BlockZ, pistonMeta, dist + 1); // "a_Block" now at the breakable / empty block
|
||||||
|
@ -198,7 +198,7 @@ void cBlockPistonHandler::RetractPiston(int a_BlockX, int a_BlockY, int a_BlockZ
|
||||||
AddPistonDir(a_BlockX, a_BlockY, a_BlockZ, pistonMeta, -1);
|
AddPistonDir(a_BlockX, a_BlockY, a_BlockZ, pistonMeta, -1);
|
||||||
a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, pistonBlock, pistonMeta & ~(8));
|
a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, pistonBlock, pistonMeta & ~(8));
|
||||||
a_World->BroadcastBlockAction(a_BlockX, a_BlockY, a_BlockZ, 1, pistonMeta & ~(8), pistonBlock);
|
a_World->BroadcastBlockAction(a_BlockX, a_BlockY, a_BlockZ, 1, pistonMeta & ~(8), pistonBlock);
|
||||||
a_World->BroadcastSoundEffect("tile.piston.in", a_BlockX * 8, a_BlockY * 8, a_BlockZ * 8, 0.5f, 0.7f);
|
a_World->BroadcastSoundEffect("tile.piston.in", (double)a_BlockX, (double)a_BlockY, (double)a_BlockZ, 0.5f, 0.7f);
|
||||||
AddPistonDir(a_BlockX, a_BlockY, a_BlockZ, pistonMeta, 1);
|
AddPistonDir(a_BlockX, a_BlockY, a_BlockZ, pistonMeta, 1);
|
||||||
|
|
||||||
// Retract the extension, pull block if appropriate
|
// Retract the extension, pull block if appropriate
|
||||||
|
@ -235,7 +235,7 @@ void cBlockPistonHandler::RetractPiston(int a_BlockX, int a_BlockY, int a_BlockZ
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cBlockPistonHeadHandler:
|
// cBlockPistonHeadHandler:
|
||||||
|
|
||||||
cBlockPistonHeadHandler::cBlockPistonHeadHandler(void) :
|
cBlockPistonHeadHandler::cBlockPistonHeadHandler(void) :
|
||||||
|
|
|
@ -94,7 +94,6 @@ private:
|
||||||
switch (a_BlockType)
|
switch (a_BlockType)
|
||||||
{
|
{
|
||||||
case E_BLOCK_ANVIL:
|
case E_BLOCK_ANVIL:
|
||||||
case E_BLOCK_BED:
|
|
||||||
case E_BLOCK_BEDROCK:
|
case E_BLOCK_BEDROCK:
|
||||||
case E_BLOCK_BREWING_STAND:
|
case E_BLOCK_BREWING_STAND:
|
||||||
case E_BLOCK_CHEST:
|
case E_BLOCK_CHEST:
|
||||||
|
@ -104,6 +103,7 @@ private:
|
||||||
case E_BLOCK_ENCHANTMENT_TABLE:
|
case E_BLOCK_ENCHANTMENT_TABLE:
|
||||||
case E_BLOCK_END_PORTAL:
|
case E_BLOCK_END_PORTAL:
|
||||||
case E_BLOCK_END_PORTAL_FRAME:
|
case E_BLOCK_END_PORTAL_FRAME:
|
||||||
|
// Notice the lack of an E_BLOCK_ENDER_CHEST here; its because ender chests can totally be pushed/pulled in MCS :)
|
||||||
case E_BLOCK_FURNACE:
|
case E_BLOCK_FURNACE:
|
||||||
case E_BLOCK_LIT_FURNACE:
|
case E_BLOCK_LIT_FURNACE:
|
||||||
case E_BLOCK_HOPPER:
|
case E_BLOCK_HOPPER:
|
||||||
|
@ -113,6 +113,7 @@ private:
|
||||||
case E_BLOCK_NOTE_BLOCK:
|
case E_BLOCK_NOTE_BLOCK:
|
||||||
case E_BLOCK_OBSIDIAN:
|
case E_BLOCK_OBSIDIAN:
|
||||||
case E_BLOCK_PISTON_EXTENSION:
|
case E_BLOCK_PISTON_EXTENSION:
|
||||||
|
case E_BLOCK_TRAPPED_CHEST:
|
||||||
{
|
{
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
@ -126,24 +127,10 @@ private:
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Returns true if the specified block can be pushed by a piston and broken / replaced
|
|
||||||
static inline bool CanBreakPush(BLOCKTYPE a_BlockType) { return cBlockInfo::IsPistonBreakable(a_BlockType); }
|
|
||||||
|
|
||||||
/// Returns true if the specified block can be pulled by a sticky piston
|
/// Returns true if the specified block can be pulled by a sticky piston
|
||||||
static inline bool CanPull(BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta)
|
static inline bool CanPull(BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta)
|
||||||
{
|
{
|
||||||
switch (a_BlockType)
|
if (cBlockInfo::IsPistonBreakable(a_BlockType))
|
||||||
{
|
|
||||||
case E_BLOCK_LAVA:
|
|
||||||
case E_BLOCK_STATIONARY_LAVA:
|
|
||||||
case E_BLOCK_STATIONARY_WATER:
|
|
||||||
case E_BLOCK_WATER:
|
|
||||||
{
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (CanBreakPush(a_BlockType))
|
|
||||||
{
|
{
|
||||||
return false; // CanBreakPush returns true, but we need false to prevent pulling
|
return false; // CanBreakPush returns true, but we need false to prevent pulling
|
||||||
}
|
}
|
||||||
|
|
|
@ -6,14 +6,17 @@
|
||||||
|
|
||||||
|
|
||||||
class cBlockPumpkinHandler :
|
class cBlockPumpkinHandler :
|
||||||
public cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false>
|
public cClearMetaOnDrop<cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false> >
|
||||||
{
|
{
|
||||||
|
typedef cClearMetaOnDrop<cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false> > super;
|
||||||
public:
|
public:
|
||||||
cBlockPumpkinHandler(BLOCKTYPE a_BlockType)
|
|
||||||
: cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false>(a_BlockType)
|
cBlockPumpkinHandler(BLOCKTYPE a_BlockType) :
|
||||||
|
super(a_BlockType)
|
||||||
{
|
{
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
virtual void OnPlacedByPlayer(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override
|
virtual void OnPlacedByPlayer(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override
|
||||||
{
|
{
|
||||||
// Check whether the pumpkin is a part of a golem or a snowman
|
// Check whether the pumpkin is a part of a golem or a snowman
|
||||||
|
|
|
@ -21,7 +21,7 @@ public:
|
||||||
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
||||||
{
|
{
|
||||||
// Only the first 2 bits contain the display information, the others are for growing
|
// Only the first 2 bits contain the display information, the others are for growing
|
||||||
a_Pickups.push_back(cItem(E_BLOCK_SAPLING, 1, a_BlockMeta & 3));
|
a_Pickups.push_back(cItem(E_BLOCK_SAPLING, 1, a_BlockMeta & 0x7));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -32,36 +32,36 @@ public:
|
||||||
|
|
||||||
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
||||||
{
|
{
|
||||||
a_Pickups.Add(m_BlockType, 1, a_BlockMeta & 0x3);
|
a_Pickups.Add(m_BlockType, 1, a_BlockMeta & 0x3); // Reset meta
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
inline static NIBBLETYPE BlockFaceToMetaData(eBlockFace a_BlockFace, NIBBLETYPE a_WoodMeta)
|
inline static NIBBLETYPE BlockFaceToMetaData(eBlockFace a_BlockFace, NIBBLETYPE a_Meta)
|
||||||
{
|
{
|
||||||
switch (a_BlockFace)
|
switch (a_BlockFace)
|
||||||
{
|
{
|
||||||
case BLOCK_FACE_YM:
|
case BLOCK_FACE_YM:
|
||||||
case BLOCK_FACE_YP:
|
case BLOCK_FACE_YP:
|
||||||
{
|
{
|
||||||
return a_WoodMeta; // Top or bottom, just return original
|
return a_Meta; // Top or bottom, just return original
|
||||||
}
|
}
|
||||||
|
|
||||||
case BLOCK_FACE_ZP:
|
case BLOCK_FACE_ZP:
|
||||||
case BLOCK_FACE_ZM:
|
case BLOCK_FACE_ZM:
|
||||||
{
|
{
|
||||||
return a_WoodMeta | 0x8; // North or south
|
return a_Meta | 0x8; // North or south
|
||||||
}
|
}
|
||||||
|
|
||||||
case BLOCK_FACE_XP:
|
case BLOCK_FACE_XP:
|
||||||
case BLOCK_FACE_XM:
|
case BLOCK_FACE_XM:
|
||||||
{
|
{
|
||||||
return a_WoodMeta | 0x4; // East or west
|
return a_Meta | 0x4; // East or west
|
||||||
}
|
}
|
||||||
|
|
||||||
default:
|
default:
|
||||||
{
|
{
|
||||||
ASSERT(!"Unhandled block face!");
|
ASSERT(!"Unhandled block face!");
|
||||||
return a_WoodMeta | 0xC; // No idea, give a special meta (all sides bark)
|
return a_Meta | 0xC; // No idea, give a special meta
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
|
@ -33,8 +33,8 @@ public:
|
||||||
if ((BlockBeforePlacement == E_BLOCK_SNOW) && (MetaBeforePlacement < 7))
|
if ((BlockBeforePlacement == E_BLOCK_SNOW) && (MetaBeforePlacement < 7))
|
||||||
{
|
{
|
||||||
// Only increment if:
|
// Only increment if:
|
||||||
// A snow block was already there (not first time placement) AND
|
// - A snow block was already there (not first time placement) AND
|
||||||
// Height is smaller than 7, the maximum possible height
|
// - Height is smaller than 7, the maximum possible height
|
||||||
MetaBeforePlacement++;
|
MetaBeforePlacement++;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -2,8 +2,6 @@
|
||||||
#pragma once
|
#pragma once
|
||||||
|
|
||||||
#include "BlockHandler.h"
|
#include "BlockHandler.h"
|
||||||
#include "../MersenneTwister.h"
|
|
||||||
#include "../World.h"
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -154,7 +154,11 @@ public:
|
||||||
|
|
||||||
if (
|
if (
|
||||||
(BlockInQuestion == E_BLOCK_GLASS) ||
|
(BlockInQuestion == E_BLOCK_GLASS) ||
|
||||||
|
(BlockInQuestion == E_BLOCK_STAINED_GLASS) ||
|
||||||
(BlockInQuestion == E_BLOCK_FENCE) ||
|
(BlockInQuestion == E_BLOCK_FENCE) ||
|
||||||
|
(BlockInQuestion == E_BLOCK_SOULSAND) ||
|
||||||
|
(BlockInQuestion == E_BLOCK_MOB_SPAWNER) ||
|
||||||
|
(BlockInQuestion == E_BLOCK_END_PORTAL_FRAME) || // Actual vanilla behaviour
|
||||||
(BlockInQuestion == E_BLOCK_NETHER_BRICK_FENCE) ||
|
(BlockInQuestion == E_BLOCK_NETHER_BRICK_FENCE) ||
|
||||||
(BlockInQuestion == E_BLOCK_COBBLESTONE_WALL)
|
(BlockInQuestion == E_BLOCK_COBBLESTONE_WALL)
|
||||||
)
|
)
|
||||||
|
|
32
src/Blocks/BlockTripwire.h
Normal file
32
src/Blocks/BlockTripwire.h
Normal file
|
@ -0,0 +1,32 @@
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "BlockHandler.h"
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
class cBlockTripwireHandler :
|
||||||
|
public cBlockHandler
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
cBlockTripwireHandler(BLOCKTYPE a_BlockType)
|
||||||
|
: cBlockHandler(a_BlockType)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
|
||||||
|
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
||||||
|
{
|
||||||
|
a_Pickups.push_back(cItem(E_ITEM_STRING, 1, 0));
|
||||||
|
}
|
||||||
|
|
||||||
|
virtual const char * GetStepSound(void) override
|
||||||
|
{
|
||||||
|
return "";
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
82
src/Blocks/BlockTripwireHook.h
Normal file
82
src/Blocks/BlockTripwireHook.h
Normal file
|
@ -0,0 +1,82 @@
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "BlockHandler.h"
|
||||||
|
#include "MetaRotator.h"
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
class cBlockTripwireHookHandler :
|
||||||
|
public cMetaRotator<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01>
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
cBlockTripwireHookHandler(BLOCKTYPE a_BlockType)
|
||||||
|
: cMetaRotator<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01>(a_BlockType)
|
||||||
|
{
|
||||||
|
}
|
||||||
|
|
||||||
|
virtual bool GetPlacementBlockTypeMeta(
|
||||||
|
cChunkInterface & a_ChunkInterface, cPlayer * a_Player,
|
||||||
|
int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace,
|
||||||
|
int a_CursorX, int a_CursorY, int a_CursorZ,
|
||||||
|
BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta
|
||||||
|
) override
|
||||||
|
{
|
||||||
|
a_BlockType = m_BlockType;
|
||||||
|
|
||||||
|
a_BlockMeta = DirectionToMetadata(a_BlockFace);
|
||||||
|
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
inline static NIBBLETYPE DirectionToMetadata(eBlockFace a_Direction)
|
||||||
|
{
|
||||||
|
switch (a_Direction)
|
||||||
|
{
|
||||||
|
case BLOCK_FACE_XM: return 0x1;
|
||||||
|
case BLOCK_FACE_XP: return 0x3;
|
||||||
|
case BLOCK_FACE_ZM: return 0x2;
|
||||||
|
case BLOCK_FACE_ZP: return 0x0;
|
||||||
|
default: ASSERT(!"Unhandled tripwire hook direction!"); return 0x0;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
inline static eBlockFace MetadataToDirection(NIBBLETYPE a_Meta)
|
||||||
|
{
|
||||||
|
switch (a_Meta & 0x03)
|
||||||
|
{
|
||||||
|
case 0x1: return BLOCK_FACE_XM;
|
||||||
|
case 0x3: return BLOCK_FACE_XP;
|
||||||
|
case 0x2: return BLOCK_FACE_ZM;
|
||||||
|
case 0x0: return BLOCK_FACE_ZP;
|
||||||
|
default: ASSERT(!"Unhandled tripwire hook metadata!"); return BLOCK_FACE_NONE;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
||||||
|
{
|
||||||
|
// Reset meta to 0
|
||||||
|
a_Pickups.push_back(cItem(E_BLOCK_TRIPWIRE_HOOK, 1, 0));
|
||||||
|
}
|
||||||
|
|
||||||
|
virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override
|
||||||
|
{
|
||||||
|
NIBBLETYPE Meta;
|
||||||
|
a_Chunk.UnboundedRelGetBlockMeta(a_RelX, a_RelY, a_RelZ, Meta);
|
||||||
|
|
||||||
|
AddFaceDirection(a_RelX, a_RelY, a_RelZ, MetadataToDirection(Meta), true);
|
||||||
|
BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn);
|
||||||
|
|
||||||
|
return (a_RelY > 0) && cBlockInfo::FullyOccupiesVoxel(BlockIsOn);
|
||||||
|
}
|
||||||
|
|
||||||
|
virtual const char * GetStepSound(void) override
|
||||||
|
{
|
||||||
|
return "step.wood";
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -7,6 +7,6 @@ public:
|
||||||
virtual ~cBroadcastInterface() {}
|
virtual ~cBroadcastInterface() {}
|
||||||
|
|
||||||
virtual void BroadcastUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ ) = 0;
|
virtual void BroadcastUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ ) = 0;
|
||||||
virtual void BroadcastSoundEffect(const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL) = 0;
|
virtual void BroadcastSoundEffect(const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL) = 0;
|
||||||
virtual void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL) = 0;
|
virtual void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL) = 0;
|
||||||
};
|
};
|
||||||
|
|
24
src/Blocks/ClearMetaOnDrop.h
Normal file
24
src/Blocks/ClearMetaOnDrop.h
Normal file
|
@ -0,0 +1,24 @@
|
||||||
|
|
||||||
|
#pragma once
|
||||||
|
|
||||||
|
// mixin for use to clear meta values when the block is converted to a pickup
|
||||||
|
|
||||||
|
// Usage: inherit from this class, passing the parent class as the parameter Base
|
||||||
|
// For example to use in class Foo which should inherit Bar use
|
||||||
|
// class Foo : public cClearMetaOnDrop<Bar>;
|
||||||
|
|
||||||
|
template<class Base>
|
||||||
|
class cClearMetaOnDrop : public Base
|
||||||
|
{
|
||||||
|
public:
|
||||||
|
|
||||||
|
cClearMetaOnDrop(BLOCKTYPE a_BlockType) :
|
||||||
|
Base(a_BlockType)
|
||||||
|
{}
|
||||||
|
|
||||||
|
virtual ~cClearMetaOnDrop() {}
|
||||||
|
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
|
||||||
|
{
|
||||||
|
a_Pickups.push_back(cItem(this->m_BlockType));
|
||||||
|
}
|
||||||
|
};
|
|
@ -51,4 +51,8 @@ public:
|
||||||
|
|
||||||
/** Returns the world height at the specified coords; waits for the chunk to get loaded / generated */
|
/** Returns the world height at the specified coords; waits for the chunk to get loaded / generated */
|
||||||
virtual int GetHeight(int a_BlockX, int a_BlockZ) = 0;
|
virtual int GetHeight(int a_BlockX, int a_BlockZ) = 0;
|
||||||
|
|
||||||
|
/** Wakes up the simulators for the specified block */
|
||||||
|
virtual void WakeUpSimulators(int a_BlockX, int a_BlockY, int a_BlockZ) = 0;
|
||||||
|
|
||||||
};
|
};
|
||||||
|
|
|
@ -140,7 +140,7 @@ protected:
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cByteBuffer:
|
// cByteBuffer:
|
||||||
|
|
||||||
cByteBuffer::cByteBuffer(size_t a_BufferSize) :
|
cByteBuffer::cByteBuffer(size_t a_BufferSize) :
|
||||||
|
|
|
@ -1,9 +1,9 @@
|
||||||
cmake_minimum_required (VERSION 2.8.2)
|
cmake_minimum_required (VERSION 2.8.2)
|
||||||
project (MCServer)
|
project (MCServer)
|
||||||
|
|
||||||
include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/")
|
include_directories (SYSTEM "${CMAKE_CURRENT_SOURCE_DIR}/../lib/")
|
||||||
include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/jsoncpp/include")
|
include_directories (SYSTEM "${CMAKE_CURRENT_SOURCE_DIR}/../lib/jsoncpp/include")
|
||||||
include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/polarssl/include")
|
include_directories (SYSTEM "${CMAKE_CURRENT_SOURCE_DIR}/../lib/polarssl/include")
|
||||||
|
|
||||||
set(FOLDERS OSSupport HTTPServer Items Blocks Protocol Generating PolarSSL++)
|
set(FOLDERS OSSupport HTTPServer Items Blocks Protocol Generating PolarSSL++)
|
||||||
set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities Generating/Prefabs)
|
set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities Generating/Prefabs)
|
||||||
|
@ -12,6 +12,7 @@ set(BINDING_DEPENDECIES
|
||||||
tolua
|
tolua
|
||||||
${CMAKE_CURRENT_SOURCE_DIR}/Bindings/virtual_method_hooks.lua
|
${CMAKE_CURRENT_SOURCE_DIR}/Bindings/virtual_method_hooks.lua
|
||||||
${CMAKE_CURRENT_SOURCE_DIR}/Bindings/AllToLua.pkg
|
${CMAKE_CURRENT_SOURCE_DIR}/Bindings/AllToLua.pkg
|
||||||
|
Bindings/gen_LuaState_Call.lua
|
||||||
Bindings/LuaFunctions.h
|
Bindings/LuaFunctions.h
|
||||||
Bindings/LuaWindow.h
|
Bindings/LuaWindow.h
|
||||||
Bindings/Plugin.h
|
Bindings/Plugin.h
|
||||||
|
@ -42,7 +43,7 @@ set(BINDING_DEPENDECIES
|
||||||
Cuboid.h
|
Cuboid.h
|
||||||
Defines.h
|
Defines.h
|
||||||
Enchantments.h
|
Enchantments.h
|
||||||
Entities/Effects.h
|
Entities/EntityEffect.h
|
||||||
Entities/Entity.h
|
Entities/Entity.h
|
||||||
Entities/Floater.h
|
Entities/Floater.h
|
||||||
Entities/Pawn.h
|
Entities/Pawn.h
|
||||||
|
@ -79,16 +80,22 @@ set(BINDING_DEPENDECIES
|
||||||
World.h
|
World.h
|
||||||
)
|
)
|
||||||
|
|
||||||
|
# List all the files that are generated as part of the Bindings build process
|
||||||
|
set (BINDING_OUTPUTS
|
||||||
|
${CMAKE_CURRENT_SOURCE_DIR}/Bindings/Bindings.cpp
|
||||||
|
${CMAKE_CURRENT_SOURCE_DIR}/Bindings/Bindings.h
|
||||||
|
${CMAKE_CURRENT_SOURCE_DIR}/Bindings/LuaState_Call.inc
|
||||||
|
)
|
||||||
|
|
||||||
include_directories(Bindings)
|
include_directories(Bindings)
|
||||||
include_directories(.)
|
include_directories(.)
|
||||||
|
|
||||||
if (WIN32)
|
if (WIN32)
|
||||||
ADD_CUSTOM_COMMAND(
|
ADD_CUSTOM_COMMAND(
|
||||||
# add any new generated bindings here
|
OUTPUT ${BINDING_OUTPUTS}
|
||||||
OUTPUT ${CMAKE_CURRENT_SOURCE_DIR}/Bindings/Bindings.cpp ${CMAKE_CURRENT_SOURCE_DIR}/Bindings/Bindings.h
|
|
||||||
|
|
||||||
# Copy the Lua DLL into the Bindings folder, so that tolua can run from there:
|
# Copy the Lua DLL into the Bindings folder, so that tolua can run from there:
|
||||||
COMMAND copy /y ..\\..\\MCServer\\lua51.dll .
|
COMMAND ${CMAKE_COMMAND} -E copy_if_different ../../MCServer/lua51.dll ./lua51.dll
|
||||||
|
|
||||||
# Regenerate bindings:
|
# Regenerate bindings:
|
||||||
COMMAND tolua -L virtual_method_hooks.lua -o Bindings.cpp -H Bindings.h AllToLua.pkg
|
COMMAND tolua -L virtual_method_hooks.lua -o Bindings.cpp -H Bindings.h AllToLua.pkg
|
||||||
|
@ -119,6 +126,7 @@ if (NOT MSVC)
|
||||||
|
|
||||||
# lib dependencies are not included
|
# lib dependencies are not included
|
||||||
|
|
||||||
|
include_directories ("${CMAKE_CURRENT_SOURCE_DIR}/../lib/polarssl/include")
|
||||||
|
|
||||||
#add cpp files here
|
#add cpp files here
|
||||||
add_library(Bindings
|
add_library(Bindings
|
||||||
|
@ -134,7 +142,7 @@ if (NOT MSVC)
|
||||||
Bindings/WebPlugin
|
Bindings/WebPlugin
|
||||||
)
|
)
|
||||||
|
|
||||||
target_link_libraries(Bindings lua sqlite tolualib)
|
target_link_libraries(Bindings lua sqlite tolualib polarssl)
|
||||||
|
|
||||||
#clear file
|
#clear file
|
||||||
file(WRITE ${CMAKE_CURRENT_SOURCE_DIR}/Bindings/BindingDependecies.txt)
|
file(WRITE ${CMAKE_CURRENT_SOURCE_DIR}/Bindings/BindingDependecies.txt)
|
||||||
|
@ -260,4 +268,4 @@ endif ()
|
||||||
if (WIN32)
|
if (WIN32)
|
||||||
target_link_libraries(${EXECUTABLE} expat tolualib ws2_32.lib Psapi.lib)
|
target_link_libraries(${EXECUTABLE} expat tolualib ws2_32.lib Psapi.lib)
|
||||||
endif()
|
endif()
|
||||||
target_link_libraries(${EXECUTABLE} md5 luaexpat iniFile jsoncpp polarssl zlib lua sqlite)
|
target_link_libraries(${EXECUTABLE} luaexpat iniFile jsoncpp polarssl zlib sqlite lua)
|
||||||
|
|
215
src/CheckBasicStyle.lua
Normal file
215
src/CheckBasicStyle.lua
Normal file
|
@ -0,0 +1,215 @@
|
||||||
|
|
||||||
|
-- CheckBasicStyle.lua
|
||||||
|
|
||||||
|
--[[
|
||||||
|
Checks that all source files (*.cpp, *.h) use the basic style requirements of the project:
|
||||||
|
- Tabs for indentation, spaces for alignment
|
||||||
|
- Trailing whitespace on non-empty lines
|
||||||
|
- Two spaces between code and line-end comment ("//")
|
||||||
|
- Spaces after comma, not before (except in #define argument list)
|
||||||
|
- (TODO) Spaces before *, /, &
|
||||||
|
- (TODO) Hex numbers with even digit length
|
||||||
|
- (TODO) Hex numbers in lowercase
|
||||||
|
- (TODO) Braces not on the end of line
|
||||||
|
- (TODO) Line dividers (////...) exactly 80 slashes
|
||||||
|
- (TODO) Not using "* "-style doxy comments continuation lines
|
||||||
|
|
||||||
|
Violations that cannot be checked easily:
|
||||||
|
- Spaces around "+" (there are things like "a++", "++a", "a += 1", "X+", "stack +1" and ascii-drawn tables)
|
||||||
|
|
||||||
|
Reports all violations on stdout in a form that is readable by Visual Studio's parser, so that dblclicking
|
||||||
|
the line brings the editor directly to the violation.
|
||||||
|
|
||||||
|
Returns 0 on success, 1 on internal failure, 2 if any violations found
|
||||||
|
|
||||||
|
This script requires LuaFileSystem to be available in the current Lua interpreter.
|
||||||
|
--]]
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
-- Check that LFS is installed:
|
||||||
|
local hasLfs = pcall(require, "lfs")
|
||||||
|
if not(hasLfs) then
|
||||||
|
print("This script requires LuaFileSystem to be installed")
|
||||||
|
os.exit(1)
|
||||||
|
end
|
||||||
|
local lfs = require("lfs")
|
||||||
|
assert(lfs ~= nil)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
-- The list of file extensions that are processed:
|
||||||
|
local g_ShouldProcessExt =
|
||||||
|
{
|
||||||
|
["h"] = true,
|
||||||
|
["cpp"] = true,
|
||||||
|
}
|
||||||
|
|
||||||
|
--- The list of files not to be processed:
|
||||||
|
local g_IgnoredFiles =
|
||||||
|
{
|
||||||
|
"./Bindings/Bindings.cpp",
|
||||||
|
"./Bindings/DeprecatedBindings.cpp",
|
||||||
|
"./LeakFinder.cpp",
|
||||||
|
"./LeakFinder.h",
|
||||||
|
"./MersenneTwister.h",
|
||||||
|
"./StackWalker.cpp",
|
||||||
|
"./StackWalker.h",
|
||||||
|
}
|
||||||
|
|
||||||
|
--- The list of files not to be processed, as a dictionary (filename => true), built from g_IgnoredFiles
|
||||||
|
local g_ShouldIgnoreFile = {}
|
||||||
|
|
||||||
|
-- Initialize the g_ShouldIgnoreFile map:
|
||||||
|
for _, fnam in ipairs(g_IgnoredFiles) do
|
||||||
|
g_ShouldIgnoreFile[fnam] = true
|
||||||
|
end
|
||||||
|
|
||||||
|
--- Keeps track of the number of violations for this folder
|
||||||
|
local g_NumViolations = 0
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
--- Reports one violation
|
||||||
|
-- Pretty-prints the message
|
||||||
|
-- Also increments g_NumViolations
|
||||||
|
local function ReportViolation(a_FileName, a_LineNumber, a_Message)
|
||||||
|
print(a_FileName .. "(" .. a_LineNumber .. "): " .. a_Message)
|
||||||
|
g_NumViolations = g_NumViolations + 1
|
||||||
|
end
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
--- Searches for the specified pattern, if found, reports it as a violation with the given message
|
||||||
|
local function ReportViolationIfFound(a_Line, a_FileName, a_LineNum, a_Pattern, a_Message)
|
||||||
|
local patStart, patEnd = a_Line:find(a_Pattern)
|
||||||
|
if not(patStart) then
|
||||||
|
return
|
||||||
|
end
|
||||||
|
ReportViolation(a_FileName, a_LineNum, a_Message .. "(" .. patStart .. " .. " .. patEnd .. ")")
|
||||||
|
end
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
local g_ViolationPatterns =
|
||||||
|
{
|
||||||
|
-- Check against indenting using spaces:
|
||||||
|
{"^\t* +", "Indenting with a space"},
|
||||||
|
|
||||||
|
-- Check against alignment using tabs:
|
||||||
|
{"[^%s]\t+[^%s]", "Aligning with a tab"},
|
||||||
|
|
||||||
|
-- Check against trailing whitespace:
|
||||||
|
{"[^%s]%s+\n", "Trailing whitespace"},
|
||||||
|
|
||||||
|
-- Check that all "//"-style comments have at least two spaces in front (unless alone on line):
|
||||||
|
{"[^%s] //", "Needs at least two spaces in front of a \"//\"-style comment"},
|
||||||
|
|
||||||
|
-- Check that all "//"-style comments have at least one spaces after:
|
||||||
|
{"%s//[^%s/*<]", "Needs a space after a \"//\"-style comment"},
|
||||||
|
|
||||||
|
-- Check that all commas have spaces after them and not in front of them:
|
||||||
|
{" ,", "Extra space before a \",\""},
|
||||||
|
{"^\t*[^#].*,[^%s]", "Needs a space after a \",\""}, -- Anywhere except lines starting with "#" - avoid #define params
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
--- Processes one file
|
||||||
|
local function ProcessFile(a_FileName)
|
||||||
|
assert(type(a_FileName) == "string")
|
||||||
|
|
||||||
|
-- Read the whole file:
|
||||||
|
local f, err = io.open(a_FileName, "r")
|
||||||
|
if (f == nil) then
|
||||||
|
print("Cannot open file \"" .. a_FileName .. "\": " .. err)
|
||||||
|
print("Aborting")
|
||||||
|
os.exit(1)
|
||||||
|
end
|
||||||
|
local all = f:read("*all")
|
||||||
|
|
||||||
|
-- Check that the last line is empty - otherwise processing won't work properly:
|
||||||
|
local lastChar = string.byte(all, string.len(all))
|
||||||
|
if ((lastChar ~= 13) and (lastChar ~= 10)) then
|
||||||
|
local numLines = 1
|
||||||
|
string.gsub(all, "\n", function() numLines = numLines + 1 end) -- Count the number of line-ends
|
||||||
|
ReportViolation(a_FileName, numLines, "Missing empty line at file end")
|
||||||
|
return
|
||||||
|
end
|
||||||
|
|
||||||
|
-- Process each line separately:
|
||||||
|
-- Ref.: http://stackoverflow.com/questions/10416869/iterate-over-possibly-empty-lines-in-a-way-that-matches-the-expectations-of-exis
|
||||||
|
local lineCounter = 1
|
||||||
|
all:gsub("\r\n", "\n") -- normalize CRLF into LF-only
|
||||||
|
string.gsub(all .. "\n", "[^\n]*\n", -- Iterate over each line, while preserving empty lines
|
||||||
|
function(a_Line)
|
||||||
|
-- Check against each violation pattern:
|
||||||
|
for _, pat in ipairs(g_ViolationPatterns) do
|
||||||
|
ReportViolationIfFound(a_Line, a_FileName, lineCounter, pat[1], pat[2])
|
||||||
|
end
|
||||||
|
|
||||||
|
lineCounter = lineCounter + 1
|
||||||
|
end
|
||||||
|
)
|
||||||
|
end
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
--- Processes one item - a file or a folder
|
||||||
|
local function ProcessItem(a_ItemName)
|
||||||
|
assert(type(a_ItemName) == "string")
|
||||||
|
|
||||||
|
-- Skip files / folders that should be ignored
|
||||||
|
if (g_ShouldIgnoreFile[a_ItemName]) then
|
||||||
|
return
|
||||||
|
end
|
||||||
|
|
||||||
|
-- If the item is a folder, recurse:
|
||||||
|
local attrs = lfs.attributes(a_ItemName)
|
||||||
|
if (attrs and (attrs.mode == "directory")) then
|
||||||
|
for fnam in lfs.dir(a_ItemName) do
|
||||||
|
if ((fnam ~= ".") and (fnam ~= "..")) then
|
||||||
|
ProcessItem(a_ItemName .. "/" .. fnam)
|
||||||
|
end
|
||||||
|
end
|
||||||
|
return
|
||||||
|
end
|
||||||
|
|
||||||
|
local ext = a_ItemName:match("%.([^/%.]-)$")
|
||||||
|
if (g_ShouldProcessExt[ext]) then
|
||||||
|
ProcessFile(a_ItemName)
|
||||||
|
end
|
||||||
|
end
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
-- Process the entire current folder:
|
||||||
|
ProcessItem(".")
|
||||||
|
|
||||||
|
-- Report final verdict:
|
||||||
|
print("Number of violations found: " .. g_NumViolations)
|
||||||
|
if (g_NumViolations > 0) then
|
||||||
|
os.exit(2)
|
||||||
|
else
|
||||||
|
os.exit(0)
|
||||||
|
end
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
125
src/Chunk.cpp
125
src/Chunk.cpp
|
@ -41,7 +41,7 @@
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// sSetBlock:
|
// sSetBlock:
|
||||||
|
|
||||||
sSetBlock::sSetBlock( int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta ) // absolute block position
|
sSetBlock::sSetBlock( int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta ) // absolute block position
|
||||||
|
@ -58,7 +58,7 @@ sSetBlock::sSetBlock( int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_Bloc
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cChunk:
|
// cChunk:
|
||||||
|
|
||||||
cChunk::cChunk(
|
cChunk::cChunk(
|
||||||
|
@ -87,7 +87,8 @@ cChunk::cChunk(
|
||||||
m_NeighborZM(a_NeighborZM),
|
m_NeighborZM(a_NeighborZM),
|
||||||
m_NeighborZP(a_NeighborZP),
|
m_NeighborZP(a_NeighborZP),
|
||||||
m_WaterSimulatorData(a_World->GetWaterSimulator()->CreateChunkData()),
|
m_WaterSimulatorData(a_World->GetWaterSimulator()->CreateChunkData()),
|
||||||
m_LavaSimulatorData (a_World->GetLavaSimulator ()->CreateChunkData())
|
m_LavaSimulatorData (a_World->GetLavaSimulator ()->CreateChunkData()),
|
||||||
|
m_AlwaysTicked(0)
|
||||||
{
|
{
|
||||||
if (a_NeighborXM != NULL)
|
if (a_NeighborXM != NULL)
|
||||||
{
|
{
|
||||||
|
@ -447,7 +448,7 @@ void cChunk::CollectMobCensus(cMobCensus& toFill)
|
||||||
Vector3d currentPosition;
|
Vector3d currentPosition;
|
||||||
for (cEntityList::iterator itr = m_Entities.begin(); itr != m_Entities.end(); ++itr)
|
for (cEntityList::iterator itr = m_Entities.begin(); itr != m_Entities.end(); ++itr)
|
||||||
{
|
{
|
||||||
//LOGD("Counting entity #%i (%s)", (*itr)->GetUniqueID(), (*itr)->GetClass());
|
// LOGD("Counting entity #%i (%s)", (*itr)->GetUniqueID(), (*itr)->GetClass());
|
||||||
if ((*itr)->IsMob())
|
if ((*itr)->IsMob())
|
||||||
{
|
{
|
||||||
cMonster& Monster = (cMonster&)(**itr);
|
cMonster& Monster = (cMonster&)(**itr);
|
||||||
|
@ -463,7 +464,7 @@ void cChunk::CollectMobCensus(cMobCensus& toFill)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cChunk::getThreeRandomNumber(int& a_X, int& a_Y, int& a_Z,int a_MaxX, int a_MaxY, int a_MaxZ)
|
void cChunk::GetThreeRandomNumbers(int & a_X, int & a_Y, int & a_Z,int a_MaxX, int a_MaxY, int a_MaxZ)
|
||||||
{
|
{
|
||||||
ASSERT(a_MaxX * a_MaxY * a_MaxZ * 8 < 0x00ffffff);
|
ASSERT(a_MaxX * a_MaxY * a_MaxZ * 8 < 0x00ffffff);
|
||||||
int Random = m_World->GetTickRandomNumber(0x00ffffff);
|
int Random = m_World->GetTickRandomNumber(0x00ffffff);
|
||||||
|
@ -479,12 +480,12 @@ void cChunk::getThreeRandomNumber(int& a_X, int& a_Y, int& a_Z,int a_MaxX, int a
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cChunk::getRandomBlockCoords(int& a_X, int& a_Y, int& a_Z)
|
void cChunk::GetRandomBlockCoords(int & a_X, int & a_Y, int & a_Z)
|
||||||
{
|
{
|
||||||
// MG TODO : check if this kind of optimization (only one random call) is still needed
|
// MG TODO : check if this kind of optimization (only one random call) is still needed
|
||||||
// MG TODO : if so propagate it
|
// MG TODO : if so propagate it
|
||||||
|
|
||||||
getThreeRandomNumber(a_X, a_Y, a_Z, Width, Height-2, Width);
|
GetThreeRandomNumbers(a_X, a_Y, a_Z, Width, Height - 2, Width);
|
||||||
a_Y++;
|
a_Y++;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -494,33 +495,36 @@ void cChunk::getRandomBlockCoords(int& a_X, int& a_Y, int& a_Z)
|
||||||
|
|
||||||
void cChunk::SpawnMobs(cMobSpawner& a_MobSpawner)
|
void cChunk::SpawnMobs(cMobSpawner& a_MobSpawner)
|
||||||
{
|
{
|
||||||
int Center_X,Center_Y,Center_Z;
|
int CenterX, CenterY, CenterZ;
|
||||||
getRandomBlockCoords(Center_X,Center_Y,Center_Z);
|
GetRandomBlockCoords(CenterX, CenterY, CenterZ);
|
||||||
|
|
||||||
BLOCKTYPE PackCenterBlock = GetBlock(Center_X, Center_Y, Center_Z);
|
BLOCKTYPE PackCenterBlock = GetBlock(CenterX, CenterY, CenterZ);
|
||||||
if (a_MobSpawner.CheckPackCenter(PackCenterBlock))
|
if (!a_MobSpawner.CheckPackCenter(PackCenterBlock))
|
||||||
{
|
{
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
a_MobSpawner.NewPack();
|
a_MobSpawner.NewPack();
|
||||||
int NumberOfTries = 0;
|
int NumberOfTries = 0;
|
||||||
int NumberOfSuccess = 0;
|
int NumberOfSuccess = 0;
|
||||||
int MaxNbOfSuccess = 4; // this can be changed during the process for Wolves and Ghass
|
int MaxNbOfSuccess = 4; // This can be changed during the process for Wolves and Ghasts
|
||||||
while (NumberOfTries < 12 && NumberOfSuccess < MaxNbOfSuccess)
|
while ((NumberOfTries < 12) && (NumberOfSuccess < MaxNbOfSuccess))
|
||||||
{
|
{
|
||||||
const int HorizontalRange = 20; // MG TODO : relocate
|
const int HorizontalRange = 20; // MG TODO : relocate
|
||||||
const int VerticalRange = 0; // MG TODO : relocate
|
const int VerticalRange = 0; // MG TODO : relocate
|
||||||
int Try_X, Try_Y, Try_Z;
|
int TryX, TryY, TryZ;
|
||||||
getThreeRandomNumber(Try_X, Try_Y, Try_Z, 2*HorizontalRange+1 , 2*VerticalRange+1 , 2*HorizontalRange+1);
|
GetThreeRandomNumbers(TryX, TryY, TryZ, 2 * HorizontalRange + 1, 2 * VerticalRange + 1, 2 * HorizontalRange + 1);
|
||||||
Try_X -= HorizontalRange;
|
TryX -= HorizontalRange;
|
||||||
Try_Y -= VerticalRange;
|
TryY -= VerticalRange;
|
||||||
Try_Z -= HorizontalRange;
|
TryZ -= HorizontalRange;
|
||||||
Try_X += Center_X;
|
TryX += CenterX;
|
||||||
Try_Y += Center_Y;
|
TryY += CenterY;
|
||||||
Try_Z += Center_Z;
|
TryZ += CenterZ;
|
||||||
|
|
||||||
ASSERT(Try_Y > 0);
|
ASSERT(TryY > 0);
|
||||||
ASSERT(Try_Y < cChunkDef::Height-1);
|
ASSERT(TryY < cChunkDef::Height - 1);
|
||||||
|
|
||||||
EMCSBiome Biome = m_ChunkMap->GetBiomeAt (Try_X, Try_Z);
|
EMCSBiome Biome = m_ChunkMap->GetBiomeAt(TryX, TryZ);
|
||||||
// MG TODO :
|
// MG TODO :
|
||||||
// Moon cycle (for slime)
|
// Moon cycle (for slime)
|
||||||
// check player and playerspawn presence < 24 blocks
|
// check player and playerspawn presence < 24 blocks
|
||||||
|
@ -534,25 +538,25 @@ void cChunk::SpawnMobs(cMobSpawner& a_MobSpawner)
|
||||||
NIBBLETYPE BlockLight = 0;
|
NIBBLETYPE BlockLight = 0;
|
||||||
*/
|
*/
|
||||||
|
|
||||||
if (IsLightValid())
|
NumberOfTries++;
|
||||||
|
if (!IsLightValid())
|
||||||
{
|
{
|
||||||
cEntity* newMob = a_MobSpawner.TryToSpawnHere(this, Try_X, Try_Y, Try_Z, Biome, MaxNbOfSuccess);
|
continue;
|
||||||
if (newMob)
|
}
|
||||||
|
|
||||||
|
cEntity * newMob = a_MobSpawner.TryToSpawnHere(this, TryX, TryY, TryZ, Biome, MaxNbOfSuccess);
|
||||||
|
if (newMob == NULL)
|
||||||
{
|
{
|
||||||
|
continue;
|
||||||
|
}
|
||||||
int WorldX, WorldY, WorldZ;
|
int WorldX, WorldY, WorldZ;
|
||||||
PositionToWorldPosition(Try_X, Try_Y, Try_Z, WorldX, WorldY, WorldZ);
|
PositionToWorldPosition(TryX, TryY, TryZ, WorldX, WorldY, WorldZ);
|
||||||
double ActualX = WorldX + 0.5;
|
double ActualX = WorldX + 0.5;
|
||||||
double ActualZ = WorldZ + 0.5;
|
double ActualZ = WorldZ + 0.5;
|
||||||
newMob->SetPosition(ActualX, WorldY, ActualZ);
|
newMob->SetPosition(ActualX, WorldY, ActualZ);
|
||||||
LOGD("Spawning %s #%i at %d,%d,%d",newMob->GetClass(),newMob->GetUniqueID(),WorldX, WorldY, WorldZ);
|
LOGD("Spawning %s #%i at {%d, %d, %d}", newMob->GetClass(), newMob->GetUniqueID(), WorldX, WorldY, WorldZ);
|
||||||
NumberOfSuccess++;
|
NumberOfSuccess++;
|
||||||
}
|
} // while (retry)
|
||||||
}
|
|
||||||
|
|
||||||
NumberOfTries++;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -1297,6 +1301,7 @@ void cChunk::CreateBlockEntities(void)
|
||||||
switch (BlockType)
|
switch (BlockType)
|
||||||
{
|
{
|
||||||
case E_BLOCK_BEACON:
|
case E_BLOCK_BEACON:
|
||||||
|
case E_BLOCK_TRAPPED_CHEST:
|
||||||
case E_BLOCK_CHEST:
|
case E_BLOCK_CHEST:
|
||||||
case E_BLOCK_COMMAND_BLOCK:
|
case E_BLOCK_COMMAND_BLOCK:
|
||||||
case E_BLOCK_DISPENSER:
|
case E_BLOCK_DISPENSER:
|
||||||
|
@ -1427,6 +1432,7 @@ void cChunk::SetBlock(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE a_BlockType,
|
||||||
switch (a_BlockType)
|
switch (a_BlockType)
|
||||||
{
|
{
|
||||||
case E_BLOCK_BEACON:
|
case E_BLOCK_BEACON:
|
||||||
|
case E_BLOCK_TRAPPED_CHEST:
|
||||||
case E_BLOCK_CHEST:
|
case E_BLOCK_CHEST:
|
||||||
case E_BLOCK_COMMAND_BLOCK:
|
case E_BLOCK_COMMAND_BLOCK:
|
||||||
case E_BLOCK_DISPENSER:
|
case E_BLOCK_DISPENSER:
|
||||||
|
@ -1641,6 +1647,31 @@ cBlockEntity * cChunk::GetBlockEntity(int a_BlockX, int a_BlockY, int a_BlockZ)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
bool cChunk::ShouldBeTicked(void) const
|
||||||
|
{
|
||||||
|
return (HasAnyClients() || (m_AlwaysTicked > 0));
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
void cChunk::SetAlwaysTicked(bool a_AlwaysTicked)
|
||||||
|
{
|
||||||
|
if (a_AlwaysTicked)
|
||||||
|
{
|
||||||
|
m_AlwaysTicked += 1;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
m_AlwaysTicked -= 1;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cChunk::UseBlockEntity(cPlayer * a_Player, int a_X, int a_Y, int a_Z)
|
void cChunk::UseBlockEntity(cPlayer * a_Player, int a_X, int a_Y, int a_Z)
|
||||||
{
|
{
|
||||||
cBlockEntity * be = GetBlockEntity(a_X, a_Y, a_Z);
|
cBlockEntity * be = GetBlockEntity(a_X, a_Y, a_Z);
|
||||||
|
@ -1696,7 +1727,7 @@ void cChunk::CollectPickupsByPlayer(cPlayer * a_Player)
|
||||||
{
|
{
|
||||||
if ((!(*itr)->IsPickup()) && (!(*itr)->IsProjectile()))
|
if ((!(*itr)->IsPickup()) && (!(*itr)->IsProjectile()))
|
||||||
{
|
{
|
||||||
continue; // Only pickups and projectiles
|
continue; // Only pickups and projectiles can be picked up
|
||||||
}
|
}
|
||||||
float DiffX = (float)((*itr)->GetPosX() - PosX );
|
float DiffX = (float)((*itr)->GetPosX() - PosX );
|
||||||
float DiffY = (float)((*itr)->GetPosY() - PosY );
|
float DiffY = (float)((*itr)->GetPosY() - PosY );
|
||||||
|
@ -1852,7 +1883,7 @@ bool cChunk::HasClient(cClientHandle* a_Client)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
bool cChunk::HasAnyClients(void)
|
bool cChunk::HasAnyClients(void) const
|
||||||
{
|
{
|
||||||
return !m_LoadedByClient.empty();
|
return !m_LoadedByClient.empty();
|
||||||
}
|
}
|
||||||
|
@ -2116,7 +2147,7 @@ bool cChunk::DoWithChestAt(int a_BlockX, int a_BlockY, int a_BlockZ, cChestCallb
|
||||||
{
|
{
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
if ((*itr)->GetBlockType() != E_BLOCK_CHEST)
|
if (((*itr)->GetBlockType() != E_BLOCK_CHEST) && ((*itr)->GetBlockType() != E_BLOCK_TRAPPED_CHEST)) // Trapped chests use normal chests' handlers
|
||||||
{
|
{
|
||||||
// There is a block entity here, but of different type. No other block entity can be here, so we can safely bail out
|
// There is a block entity here, but of different type. No other block entity can be here, so we can safely bail out
|
||||||
return false;
|
return false;
|
||||||
|
@ -2290,7 +2321,7 @@ bool cChunk::DoWithNoteBlockAt(int a_BlockX, int a_BlockY, int a_BlockZ, cNoteBl
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
// The correct block entity is here,
|
// The correct block entity is here
|
||||||
if (a_Callback.Item((cNoteEntity *)*itr))
|
if (a_Callback.Item((cNoteEntity *)*itr))
|
||||||
{
|
{
|
||||||
return false;
|
return false;
|
||||||
|
@ -2386,7 +2417,7 @@ bool cChunk::DoWithFlowerPotAt(int a_BlockX, int a_BlockY, int a_BlockZ, cFlower
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
// The correct block entity is here,
|
// The correct block entity is here
|
||||||
if (a_Callback.Item((cFlowerPotEntity *)*itr))
|
if (a_Callback.Item((cFlowerPotEntity *)*itr))
|
||||||
{
|
{
|
||||||
return false;
|
return false;
|
||||||
|
@ -2496,8 +2527,8 @@ cChunk * cChunk::GetRelNeighborChunk(int a_RelX, int a_RelZ)
|
||||||
{
|
{
|
||||||
int BlockX = m_PosX * cChunkDef::Width + a_RelX;
|
int BlockX = m_PosX * cChunkDef::Width + a_RelX;
|
||||||
int BlockZ = m_PosZ * cChunkDef::Width + a_RelZ;
|
int BlockZ = m_PosZ * cChunkDef::Width + a_RelZ;
|
||||||
int BlockY, ChunkX, ChunkZ;
|
int ChunkX, ChunkZ;
|
||||||
AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ);
|
BlockToChunk(BlockX, BlockZ, ChunkX, ChunkZ);
|
||||||
return m_ChunkMap->GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ);
|
return m_ChunkMap->GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -2696,7 +2727,7 @@ void cChunk::BroadcastChunkData(cChunkDataSerializer & a_Serializer, const cClie
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cChunk::BroadcastCollectPickup(const cPickup & a_Pickup, const cPlayer & a_Player, const cClientHandle * a_Exclude)
|
void cChunk::BroadcastCollectEntity(const cEntity & a_Entity, const cPlayer & a_Player, const cClientHandle * a_Exclude)
|
||||||
{
|
{
|
||||||
for (cClientHandleList::iterator itr = m_LoadedByClient.begin(); itr != m_LoadedByClient.end(); ++itr )
|
for (cClientHandleList::iterator itr = m_LoadedByClient.begin(); itr != m_LoadedByClient.end(); ++itr )
|
||||||
{
|
{
|
||||||
|
@ -2704,7 +2735,7 @@ void cChunk::BroadcastCollectPickup(const cPickup & a_Pickup, const cPlayer & a_
|
||||||
{
|
{
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
(*itr)->SendCollectPickup(a_Pickup, a_Player);
|
(*itr)->SendCollectEntity(a_Entity, a_Player);
|
||||||
} // for itr - LoadedByClient[]
|
} // for itr - LoadedByClient[]
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -2920,7 +2951,7 @@ void cChunk::BroadcastRemoveEntityEffect(const cEntity & a_Entity, int a_EffectI
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cChunk::BroadcastSoundEffect(const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude)
|
void cChunk::BroadcastSoundEffect(const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude)
|
||||||
{
|
{
|
||||||
for (cClientHandleList::iterator itr = m_LoadedByClient.begin(); itr != m_LoadedByClient.end(); ++itr )
|
for (cClientHandleList::iterator itr = m_LoadedByClient.begin(); itr != m_LoadedByClient.end(); ++itr )
|
||||||
{
|
{
|
||||||
|
@ -2928,7 +2959,7 @@ void cChunk::BroadcastSoundEffect(const AString & a_SoundName, int a_SrcX, int a
|
||||||
{
|
{
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
(*itr)->SendSoundEffect(a_SoundName, a_SrcX, a_SrcY, a_SrcZ, a_Volume, a_Pitch);
|
(*itr)->SendSoundEffect(a_SoundName, a_X, a_Y, a_Z, a_Volume, a_Pitch);
|
||||||
} // for itr - LoadedByClient[]
|
} // for itr - LoadedByClient[]
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
39
src/Chunk.h
39
src/Chunk.h
|
@ -200,11 +200,16 @@ public:
|
||||||
void SendBlockTo(int a_RelX, int a_RelY, int a_RelZ, cClientHandle * a_Client);
|
void SendBlockTo(int a_RelX, int a_RelY, int a_RelZ, cClientHandle * a_Client);
|
||||||
|
|
||||||
/** Adds a client to the chunk; returns true if added, false if already there */
|
/** Adds a client to the chunk; returns true if added, false if already there */
|
||||||
bool AddClient (cClientHandle* a_Client );
|
bool AddClient(cClientHandle * a_Client);
|
||||||
|
|
||||||
void RemoveClient (cClientHandle* a_Client );
|
/** Removes the specified client from the chunk; ignored if client not in chunk. */
|
||||||
bool HasClient (cClientHandle* a_Client );
|
void RemoveClient(cClientHandle * a_Client);
|
||||||
bool HasAnyClients(void); // Returns true if theres any client in the chunk; false otherwise
|
|
||||||
|
/** Returns true if the specified client is present in this chunk. */
|
||||||
|
bool HasClient(cClientHandle * a_Client);
|
||||||
|
|
||||||
|
/** Returns true if theres any client in the chunk; false otherwise */
|
||||||
|
bool HasAnyClients(void) const;
|
||||||
|
|
||||||
void AddEntity(cEntity * a_Entity);
|
void AddEntity(cEntity * a_Entity);
|
||||||
void RemoveEntity(cEntity * a_Entity);
|
void RemoveEntity(cEntity * a_Entity);
|
||||||
|
@ -269,7 +274,6 @@ public:
|
||||||
|
|
||||||
void UseBlockEntity(cPlayer * a_Player, int a_X, int a_Y, int a_Z); // [x, y, z] in world block coords
|
void UseBlockEntity(cPlayer * a_Player, int a_X, int a_Y, int a_Z); // [x, y, z] in world block coords
|
||||||
|
|
||||||
void CalculateLighting(); // Recalculate right now
|
|
||||||
void CalculateHeightmap(const BLOCKTYPE * a_BlockTypes);
|
void CalculateHeightmap(const BLOCKTYPE * a_BlockTypes);
|
||||||
|
|
||||||
// Broadcast various packets to all clients of this chunk:
|
// Broadcast various packets to all clients of this chunk:
|
||||||
|
@ -279,7 +283,7 @@ public:
|
||||||
void BroadcastBlockBreakAnimation(int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage, const cClientHandle * a_Exclude = NULL);
|
void BroadcastBlockBreakAnimation(int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastBlockEntity (int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL);
|
void BroadcastBlockEntity (int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastChunkData (cChunkDataSerializer & a_Serializer, const cClientHandle * a_Exclude = NULL);
|
void BroadcastChunkData (cChunkDataSerializer & a_Serializer, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastCollectPickup (const cPickup & a_Pickup, const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL);
|
void BroadcastCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastDestroyEntity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
|
void BroadcastDestroyEntity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration, const cClientHandle * a_Exclude = NULL);
|
void BroadcastEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item, const cClientHandle * a_Exclude = NULL);
|
void BroadcastEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item, const cClientHandle * a_Exclude = NULL);
|
||||||
|
@ -293,7 +297,7 @@ public:
|
||||||
void BroadcastEntityAnimation (const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL);
|
void BroadcastEntityAnimation (const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude = NULL);
|
void BroadcastParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL);
|
void BroadcastRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastSoundEffect (const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL); // a_Src coords are Block * 8
|
void BroadcastSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL);
|
void BroadcastSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastSpawnEntity (cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
|
void BroadcastSpawnEntity (cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL);
|
void BroadcastThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL);
|
||||||
|
@ -391,6 +395,17 @@ public:
|
||||||
cBlockEntity * GetBlockEntity(int a_BlockX, int a_BlockY, int a_BlockZ);
|
cBlockEntity * GetBlockEntity(int a_BlockX, int a_BlockY, int a_BlockZ);
|
||||||
cBlockEntity * GetBlockEntity(const Vector3i & a_BlockPos) { return GetBlockEntity(a_BlockPos.x, a_BlockPos.y, a_BlockPos.z); }
|
cBlockEntity * GetBlockEntity(const Vector3i & a_BlockPos) { return GetBlockEntity(a_BlockPos.x, a_BlockPos.y, a_BlockPos.z); }
|
||||||
|
|
||||||
|
/** Returns true if the chunk should be ticked in the tick-thread.
|
||||||
|
Checks if there are any clients and if the always-tick flag is set */
|
||||||
|
bool ShouldBeTicked(void) const;
|
||||||
|
|
||||||
|
/** Increments (a_AlwaysTicked == true) or decrements (false) the m_AlwaysTicked counter.
|
||||||
|
If the m_AlwaysTicked counter is greater than zero, the chunk is ticked in the tick-thread regardless of
|
||||||
|
whether it has any clients or not.
|
||||||
|
This function allows nesting and task-concurrency (multiple separate tasks can request ticking and as long
|
||||||
|
as at least one requests is active the chunk will be ticked). */
|
||||||
|
void SetAlwaysTicked(bool a_AlwaysTicked);
|
||||||
|
|
||||||
private:
|
private:
|
||||||
|
|
||||||
friend class cChunkMap;
|
friend class cChunkMap;
|
||||||
|
@ -463,9 +478,15 @@ private:
|
||||||
/** Indicates if simulate-once blocks should be updated by the redstone simulator */
|
/** Indicates if simulate-once blocks should be updated by the redstone simulator */
|
||||||
bool m_IsRedstoneDirty;
|
bool m_IsRedstoneDirty;
|
||||||
|
|
||||||
|
/** If greater than zero, the chunk is ticked even if it has no clients.
|
||||||
|
Manipulated by the SetAlwaysTicked() function, allows for nested calls of the function.
|
||||||
|
This is the support for plugin-accessible chunk tick forcing. */
|
||||||
|
int m_AlwaysTicked;
|
||||||
|
|
||||||
|
|
||||||
// Pick up a random block of this chunk
|
// Pick up a random block of this chunk
|
||||||
void getRandomBlockCoords(int& a_X, int& a_Y, int& a_Z);
|
void GetRandomBlockCoords(int & a_X, int & a_Y, int & a_Z);
|
||||||
void getThreeRandomNumber(int& a_X, int& a_Y, int& a_Z,int a_MaxX, int a_MaxY, int a_MaxZ);
|
void GetThreeRandomNumbers(int & a_X, int & a_Y, int & a_Z, int a_MaxX, int a_MaxY, int a_MaxZ);
|
||||||
|
|
||||||
void RemoveBlockEntity(cBlockEntity * a_BlockEntity);
|
void RemoveBlockEntity(cBlockEntity * a_BlockEntity);
|
||||||
void AddBlockEntity (cBlockEntity * a_BlockEntity);
|
void AddBlockEntity (cBlockEntity * a_BlockEntity);
|
||||||
|
|
|
@ -138,9 +138,9 @@ public:
|
||||||
{
|
{
|
||||||
#if AXIS_ORDER == AXIS_ORDER_XZY
|
#if AXIS_ORDER == AXIS_ORDER_XZY
|
||||||
// For some reason, NOT using the Horner schema is faster. Weird.
|
// For some reason, NOT using the Horner schema is faster. Weird.
|
||||||
return x + (z * cChunkDef::Width) + (y * cChunkDef::Width * cChunkDef::Width); // 1.2 is XZY
|
return x + (z * cChunkDef::Width) + (y * cChunkDef::Width * cChunkDef::Width); // 1.2 uses XZY
|
||||||
#elif AXIS_ORDER == AXIS_ORDER_YZX
|
#elif AXIS_ORDER == AXIS_ORDER_YZX
|
||||||
return y + (z * cChunkDef::Width) + (x * cChunkDef::Height * cChunkDef::Width); // 1.1 is YZX
|
return y + (z * cChunkDef::Width) + (x * cChunkDef::Height * cChunkDef::Width); // 1.1 uses YZX
|
||||||
#endif
|
#endif
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -33,12 +33,13 @@
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cChunkMap:
|
// cChunkMap:
|
||||||
|
|
||||||
cChunkMap::cChunkMap(cWorld * a_World )
|
cChunkMap::cChunkMap(cWorld * a_World) :
|
||||||
: m_World( a_World ),
|
m_World(a_World),
|
||||||
m_Pool(
|
m_Pool(
|
||||||
new cListAllocationPool<cChunkData::sChunkSection, 1600>(
|
new cListAllocationPool<cChunkData::sChunkSection, 1600>(
|
||||||
std::auto_ptr<cAllocationPool<cChunkData::sChunkSection>::cStarvationCallbacks>(
|
std::auto_ptr<cAllocationPool<cChunkData::sChunkSection>::cStarvationCallbacks>(
|
||||||
new cStarvationCallbacks())
|
new cStarvationCallbacks()
|
||||||
|
)
|
||||||
)
|
)
|
||||||
)
|
)
|
||||||
{
|
{
|
||||||
|
@ -419,16 +420,16 @@ void cChunkMap::BroadcastChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataSeriali
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cChunkMap::BroadcastCollectPickup(const cPickup & a_Pickup, const cPlayer & a_Player, const cClientHandle * a_Exclude)
|
void cChunkMap::BroadcastCollectEntity(const cEntity & a_Entity, const cPlayer & a_Player, const cClientHandle * a_Exclude)
|
||||||
{
|
{
|
||||||
cCSLock Lock(m_CSLayers);
|
cCSLock Lock(m_CSLayers);
|
||||||
cChunkPtr Chunk = GetChunkNoGen(a_Pickup.GetChunkX(), ZERO_CHUNK_Y, a_Pickup.GetChunkZ());
|
cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ());
|
||||||
if (Chunk == NULL)
|
if (Chunk == NULL)
|
||||||
{
|
{
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
// It's perfectly legal to broadcast packets even to invalid chunks!
|
// It's perfectly legal to broadcast packets even to invalid chunks!
|
||||||
Chunk->BroadcastCollectPickup(a_Pickup, a_Player, a_Exclude);
|
Chunk->BroadcastCollectEntity(a_Entity, a_Player, a_Exclude);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -647,19 +648,19 @@ void cChunkMap::BroadcastRemoveEntityEffect(const cEntity & a_Entity, int a_Effe
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cChunkMap::BroadcastSoundEffect(const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude)
|
void cChunkMap::BroadcastSoundEffect(const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude)
|
||||||
{
|
{
|
||||||
cCSLock Lock(m_CSLayers);
|
cCSLock Lock(m_CSLayers);
|
||||||
int ChunkX, ChunkZ;
|
int ChunkX, ChunkZ;
|
||||||
|
|
||||||
cChunkDef::BlockToChunk(a_SrcX / 8, a_SrcZ / 8, ChunkX, ChunkZ);
|
cChunkDef::BlockToChunk((int)std::floor(a_X), (int)std::floor(a_Z), ChunkX, ChunkZ);
|
||||||
cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ);
|
cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ);
|
||||||
if (Chunk == NULL)
|
if (Chunk == NULL)
|
||||||
{
|
{
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
// It's perfectly legal to broadcast packets even to invalid chunks!
|
// It's perfectly legal to broadcast packets even to invalid chunks!
|
||||||
Chunk->BroadcastSoundEffect(a_SoundName, a_SrcX, a_SrcY, a_SrcZ, a_Volume, a_Pitch, a_Exclude);
|
Chunk->BroadcastSoundEffect(a_SoundName, a_X, a_Y, a_Z, a_Volume, a_Pitch, a_Exclude);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -847,7 +848,22 @@ void cChunkMap::WakeUpSimulatorsInArea(int a_MinBlockX, int a_MaxBlockX, int a_M
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cChunkMap::MarkChunkDirty (int a_ChunkX, int a_ChunkZ)
|
void cChunkMap::MarkRedstoneDirty(int a_ChunkX, int a_ChunkZ)
|
||||||
|
{
|
||||||
|
cCSLock Lock(m_CSLayers);
|
||||||
|
cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ);
|
||||||
|
if ((Chunk == NULL) || !Chunk->IsValid())
|
||||||
|
{
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
Chunk->SetIsRedstoneDirty(true);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
void cChunkMap::MarkChunkDirty(int a_ChunkX, int a_ChunkZ, bool a_MarkRedstoneDirty)
|
||||||
{
|
{
|
||||||
cCSLock Lock(m_CSLayers);
|
cCSLock Lock(m_CSLayers);
|
||||||
cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ);
|
cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ);
|
||||||
|
@ -856,6 +872,10 @@ void cChunkMap::MarkChunkDirty (int a_ChunkX, int a_ChunkZ)
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
Chunk->MarkDirty();
|
Chunk->MarkDirty();
|
||||||
|
if (a_MarkRedstoneDirty)
|
||||||
|
{
|
||||||
|
Chunk->SetIsRedstoneDirty(true);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -1259,7 +1279,7 @@ void cChunkMap::SetBlockMeta(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYP
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cChunkMap::SetBlock(cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, BLOCKTYPE a_BlockMeta, bool a_SendToClients)
|
void cChunkMap::SetBlock(cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, bool a_SendToClients)
|
||||||
{
|
{
|
||||||
cChunkInterface ChunkInterface(this);
|
cChunkInterface ChunkInterface(this);
|
||||||
if (a_BlockType == E_BLOCK_AIR)
|
if (a_BlockType == E_BLOCK_AIR)
|
||||||
|
@ -1284,7 +1304,7 @@ void cChunkMap::SetBlock(cWorldInterface & a_WorldInterface, int a_BlockX, int a
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cChunkMap::QueueSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, BLOCKTYPE a_BlockMeta, Int64 a_Tick, BLOCKTYPE a_PreviousBlockType)
|
void cChunkMap::QueueSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, Int64 a_Tick, BLOCKTYPE a_PreviousBlockType)
|
||||||
{
|
{
|
||||||
int ChunkX, ChunkZ, X = a_BlockX, Y = a_BlockY, Z = a_BlockZ;
|
int ChunkX, ChunkZ, X = a_BlockX, Y = a_BlockY, Z = a_BlockZ;
|
||||||
cChunkDef::AbsoluteToRelative(X, Y, Z, ChunkX, ChunkZ);
|
cChunkDef::AbsoluteToRelative(X, Y, Z, ChunkX, ChunkZ);
|
||||||
|
@ -1530,7 +1550,7 @@ void cChunkMap::SendBlockTo(int a_X, int a_Y, int a_Z, cPlayer * a_Player)
|
||||||
|
|
||||||
cCSLock Lock(m_CSLayers);
|
cCSLock Lock(m_CSLayers);
|
||||||
cChunkPtr Chunk = GetChunk(ChunkX, ZERO_CHUNK_Y, ChunkZ);
|
cChunkPtr Chunk = GetChunk(ChunkX, ZERO_CHUNK_Y, ChunkZ);
|
||||||
if (Chunk->IsValid())
|
if ((Chunk != NULL) && (Chunk->IsValid()))
|
||||||
{
|
{
|
||||||
Chunk->SendBlockTo(a_X, a_Y, a_Z, a_Player->GetClientHandle());
|
Chunk->SendBlockTo(a_X, a_Y, a_Z, a_Player->GetClientHandle());
|
||||||
}
|
}
|
||||||
|
@ -1717,7 +1737,9 @@ void cChunkMap::RemoveEntity(cEntity * a_Entity)
|
||||||
{
|
{
|
||||||
cCSLock Lock(m_CSLayers);
|
cCSLock Lock(m_CSLayers);
|
||||||
cChunkPtr Chunk = GetChunkNoGen(a_Entity->GetChunkX(), ZERO_CHUNK_Y, a_Entity->GetChunkZ());
|
cChunkPtr Chunk = GetChunkNoGen(a_Entity->GetChunkX(), ZERO_CHUNK_Y, a_Entity->GetChunkZ());
|
||||||
if ((Chunk == NULL) || !Chunk->IsValid())
|
|
||||||
|
// Even if a chunk is not valid, it may still contain entities such as players; make sure to remove them (#1190)
|
||||||
|
if (Chunk == NULL)
|
||||||
{
|
{
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -1818,7 +1840,7 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
|
||||||
// Activate the TNT, with a random fuse between 10 to 30 game ticks
|
// Activate the TNT, with a random fuse between 10 to 30 game ticks
|
||||||
int FuseTime = 10 + m_World->GetTickRandomNumber(20);
|
int FuseTime = 10 + m_World->GetTickRandomNumber(20);
|
||||||
m_World->SpawnPrimedTNT(a_BlockX + x + 0.5, a_BlockY + y + 0.5, a_BlockZ + z + 0.5, FuseTime);
|
m_World->SpawnPrimedTNT(a_BlockX + x + 0.5, a_BlockY + y + 0.5, a_BlockZ + z + 0.5, FuseTime);
|
||||||
area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_AIR);
|
area.SetBlockTypeMeta(bx + x, by + y, bz + z, E_BLOCK_AIR, 0);
|
||||||
a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
|
a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
@ -1875,7 +1897,7 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
|
||||||
m_World->SpawnFallingBlock(bx + x, by + y + 5, bz + z, Block, area.GetBlockMeta(bx + x, by + y, bz + z));
|
m_World->SpawnFallingBlock(bx + x, by + y + 5, bz + z, Block, area.GetBlockMeta(bx + x, by + y, bz + z));
|
||||||
}
|
}
|
||||||
|
|
||||||
area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_AIR);
|
area.SetBlockTypeMeta(bx + x, by + y, bz + z, E_BLOCK_AIR, 0);
|
||||||
a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
|
a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
|
||||||
break;
|
break;
|
||||||
|
|
||||||
|
@ -2675,6 +2697,20 @@ void cChunkMap::QueueTickBlock(int a_BlockX, int a_BlockY, int a_BlockZ)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
void cChunkMap::SetChunkAlwaysTicked(int a_ChunkX, int a_ChunkZ, bool a_AlwaysTicked)
|
||||||
|
{
|
||||||
|
cCSLock Lock(m_CSLayers);
|
||||||
|
cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ);
|
||||||
|
if (Chunk != NULL)
|
||||||
|
{
|
||||||
|
Chunk->SetAlwaysTicked(a_AlwaysTicked);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cChunkMap::cChunkLayer:
|
// cChunkMap::cChunkLayer:
|
||||||
|
|
||||||
|
@ -2701,7 +2737,7 @@ cChunkMap::cChunkLayer::~cChunkLayer()
|
||||||
for (size_t i = 0; i < ARRAYCOUNT(m_Chunks); ++i)
|
for (size_t i = 0; i < ARRAYCOUNT(m_Chunks); ++i)
|
||||||
{
|
{
|
||||||
delete m_Chunks[i];
|
delete m_Chunks[i];
|
||||||
m_Chunks[i] = NULL; // // Must zero out, because further chunk deletions query the chunkmap for entities and that would touch deleted data
|
m_Chunks[i] = NULL; // Must zero out, because further chunk deletions query the chunkmap for entities and that would touch deleted data
|
||||||
} // for i - m_Chunks[]
|
} // for i - m_Chunks[]
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -2727,8 +2763,8 @@ cChunkPtr cChunkMap::cChunkLayer::GetChunk( int a_ChunkX, int a_ChunkY, int a_Ch
|
||||||
{
|
{
|
||||||
cChunk * neixm = (LocalX > 0) ? m_Chunks[Index - 1] : m_Parent->FindChunk(a_ChunkX - 1, a_ChunkZ);
|
cChunk * neixm = (LocalX > 0) ? m_Chunks[Index - 1] : m_Parent->FindChunk(a_ChunkX - 1, a_ChunkZ);
|
||||||
cChunk * neixp = (LocalX < LAYER_SIZE - 1) ? m_Chunks[Index + 1] : m_Parent->FindChunk(a_ChunkX + 1, a_ChunkZ);
|
cChunk * neixp = (LocalX < LAYER_SIZE - 1) ? m_Chunks[Index + 1] : m_Parent->FindChunk(a_ChunkX + 1, a_ChunkZ);
|
||||||
cChunk * neizm = (LocalZ > 0) ? m_Chunks[Index - LAYER_SIZE] : m_Parent->FindChunk(a_ChunkX , a_ChunkZ - 1);
|
cChunk * neizm = (LocalZ > 0) ? m_Chunks[Index - LAYER_SIZE] : m_Parent->FindChunk(a_ChunkX, a_ChunkZ - 1);
|
||||||
cChunk * neizp = (LocalZ < LAYER_SIZE - 1) ? m_Chunks[Index + LAYER_SIZE] : m_Parent->FindChunk(a_ChunkX , a_ChunkZ + 1);
|
cChunk * neizp = (LocalZ < LAYER_SIZE - 1) ? m_Chunks[Index + LAYER_SIZE] : m_Parent->FindChunk(a_ChunkX, a_ChunkZ + 1);
|
||||||
m_Chunks[Index] = new cChunk(a_ChunkX, 0, a_ChunkZ, m_Parent, m_Parent->GetWorld(), neixm, neixp, neizm, neizp, m_Pool);
|
m_Chunks[Index] = new cChunk(a_ChunkX, 0, a_ChunkZ, m_Parent, m_Parent->GetWorld(), neixm, neixp, neizm, neizp, m_Pool);
|
||||||
}
|
}
|
||||||
return m_Chunks[Index];
|
return m_Chunks[Index];
|
||||||
|
@ -2789,12 +2825,14 @@ void cChunkMap::cChunkLayer::SpawnMobs(cMobSpawner& a_MobSpawner)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cChunkMap::cChunkLayer::Tick(float a_Dt)
|
void cChunkMap::cChunkLayer::Tick(float a_Dt)
|
||||||
{
|
{
|
||||||
for (size_t i = 0; i < ARRAYCOUNT(m_Chunks); i++)
|
for (size_t i = 0; i < ARRAYCOUNT(m_Chunks); i++)
|
||||||
{
|
{
|
||||||
// Only tick chunks that are valid and have clients:
|
// Only tick chunks that are valid and should be ticked:
|
||||||
if ((m_Chunks[i] != NULL) && m_Chunks[i]->IsValid() && m_Chunks[i]->HasAnyClients())
|
if ((m_Chunks[i] != NULL) && m_Chunks[i]->IsValid() && m_Chunks[i]->ShouldBeTicked())
|
||||||
{
|
{
|
||||||
m_Chunks[i]->Tick(a_Dt);
|
m_Chunks[i]->Tick(a_Dt);
|
||||||
}
|
}
|
||||||
|
|
|
@ -70,6 +70,7 @@ public:
|
||||||
void BroadcastBlockBreakAnimation(int a_entityID, int a_blockX, int a_blockY, int a_blockZ, char a_stage, const cClientHandle * a_Exclude = NULL);
|
void BroadcastBlockBreakAnimation(int a_entityID, int a_blockX, int a_blockY, int a_blockZ, char a_stage, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastBlockEntity(int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude);
|
void BroadcastBlockEntity(int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude);
|
||||||
void BroadcastChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer, const cClientHandle * a_Exclude = NULL);
|
void BroadcastChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer, const cClientHandle * a_Exclude = NULL);
|
||||||
|
void BroadcastCollectEntity(const cEntity & a_Entity, const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastCollectPickup(const cPickup & a_Pickup, const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL);
|
void BroadcastCollectPickup(const cPickup & a_Pickup, const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastDestroyEntity(const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
|
void BroadcastDestroyEntity(const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastEntityEffect(const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration, const cClientHandle * a_Exclude = NULL);
|
void BroadcastEntityEffect(const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration, const cClientHandle * a_Exclude = NULL);
|
||||||
|
@ -84,7 +85,7 @@ public:
|
||||||
void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL);
|
void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude = NULL);
|
void BroadcastParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL);
|
void BroadcastRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastSoundEffect(const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL); // a_Src coords are Block * 8
|
void BroadcastSoundEffect(const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL);
|
void BroadcastSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastSpawnEntity(cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
|
void BroadcastSpawnEntity(cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
|
||||||
void BroadcastThunderbolt(int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL);
|
void BroadcastThunderbolt(int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL);
|
||||||
|
@ -105,7 +106,8 @@ public:
|
||||||
/** Wakes up the simulators for the specified area of blocks */
|
/** Wakes up the simulators for the specified area of blocks */
|
||||||
void WakeUpSimulatorsInArea(int a_MinBlockX, int a_MaxBlockX, int a_MinBlockY, int a_MaxBlockY, int a_MinBlockZ, int a_MaxBlockZ);
|
void WakeUpSimulatorsInArea(int a_MinBlockX, int a_MaxBlockX, int a_MinBlockY, int a_MaxBlockY, int a_MinBlockZ, int a_MaxBlockZ);
|
||||||
|
|
||||||
void MarkChunkDirty (int a_ChunkX, int a_ChunkZ);
|
void MarkRedstoneDirty (int a_ChunkX, int a_ChunkZ);
|
||||||
|
void MarkChunkDirty (int a_ChunkX, int a_ChunkZ, bool a_MarkRedstoneDirty = false);
|
||||||
void MarkChunkSaving (int a_ChunkX, int a_ChunkZ);
|
void MarkChunkSaving (int a_ChunkX, int a_ChunkZ);
|
||||||
void MarkChunkSaved (int a_ChunkX, int a_ChunkZ);
|
void MarkChunkSaved (int a_ChunkX, int a_ChunkZ);
|
||||||
|
|
||||||
|
@ -152,9 +154,9 @@ public:
|
||||||
NIBBLETYPE GetBlockMeta (int a_BlockX, int a_BlockY, int a_BlockZ);
|
NIBBLETYPE GetBlockMeta (int a_BlockX, int a_BlockY, int a_BlockZ);
|
||||||
NIBBLETYPE GetBlockSkyLight (int a_BlockX, int a_BlockY, int a_BlockZ);
|
NIBBLETYPE GetBlockSkyLight (int a_BlockX, int a_BlockY, int a_BlockZ);
|
||||||
NIBBLETYPE GetBlockBlockLight(int a_BlockX, int a_BlockY, int a_BlockZ);
|
NIBBLETYPE GetBlockBlockLight(int a_BlockX, int a_BlockY, int a_BlockZ);
|
||||||
void SetBlockMeta (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockMeta);
|
void SetBlockMeta (int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYPE a_BlockMeta);
|
||||||
void SetBlock (cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, BLOCKTYPE a_BlockMeta, bool a_SendToClients = true);
|
void SetBlock (cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, bool a_SendToClients = true);
|
||||||
void QueueSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, BLOCKTYPE a_BlockMeta, Int64 a_Tick, BLOCKTYPE a_PreviousBlockType = E_BLOCK_AIR);
|
void QueueSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, Int64 a_Tick, BLOCKTYPE a_PreviousBlockType = E_BLOCK_AIR);
|
||||||
bool GetBlockTypeMeta (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta);
|
bool GetBlockTypeMeta (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta);
|
||||||
bool GetBlockInfo (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_Meta, NIBBLETYPE & a_SkyLight, NIBBLETYPE & a_BlockLight);
|
bool GetBlockInfo (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_Meta, NIBBLETYPE & a_SkyLight, NIBBLETYPE & a_BlockLight);
|
||||||
|
|
||||||
|
@ -339,6 +341,13 @@ public:
|
||||||
/** Returns the CS for locking the chunkmap; only cWorld::cLock may use this function! */
|
/** Returns the CS for locking the chunkmap; only cWorld::cLock may use this function! */
|
||||||
cCriticalSection & GetCS(void) { return m_CSLayers; }
|
cCriticalSection & GetCS(void) { return m_CSLayers; }
|
||||||
|
|
||||||
|
/** Increments (a_AlwaysTicked == true) or decrements (false) the m_AlwaysTicked counter for the specified chunk.
|
||||||
|
If the m_AlwaysTicked counter is greater than zero, the chunk is ticked in the tick-thread regardless of
|
||||||
|
whether it has any clients or not.
|
||||||
|
This function allows nesting and task-concurrency (multiple separate tasks can request ticking and as long
|
||||||
|
as at least one requests is active the chunk will be ticked). */
|
||||||
|
void SetChunkAlwaysTicked(int a_ChunkX, int a_ChunkZ, bool a_AlwaysTicked);
|
||||||
|
|
||||||
private:
|
private:
|
||||||
|
|
||||||
// The chunks can manipulate neighbors while in their Tick() method, using LockedGetBlock() and LockedSetBlock()
|
// The chunks can manipulate neighbors while in their Tick() method, using LockedGetBlock() and LockedSetBlock()
|
||||||
|
|
|
@ -17,7 +17,7 @@
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cNotifyChunkSender:
|
// cNotifyChunkSender:
|
||||||
|
|
||||||
void cNotifyChunkSender::Call(int a_ChunkX, int a_ChunkZ)
|
void cNotifyChunkSender::Call(int a_ChunkX, int a_ChunkZ)
|
||||||
|
@ -29,7 +29,7 @@ void cNotifyChunkSender::Call(int a_ChunkX, int a_ChunkZ)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cChunkSender:
|
// cChunkSender:
|
||||||
|
|
||||||
cChunkSender::cChunkSender(void) :
|
cChunkSender::cChunkSender(void) :
|
||||||
|
|
|
@ -30,7 +30,7 @@
|
||||||
#include "CompositeChat.h"
|
#include "CompositeChat.h"
|
||||||
#include "Items/ItemSword.h"
|
#include "Items/ItemSword.h"
|
||||||
|
|
||||||
#include "md5/md5.h"
|
#include "polarssl/md5.h"
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -40,9 +40,6 @@
|
||||||
/** Maximum number of block change interactions a player can perform per tick - exceeding this causes a kick */
|
/** Maximum number of block change interactions a player can perform per tick - exceeding this causes a kick */
|
||||||
#define MAX_BLOCK_CHANGE_INTERACTIONS 20
|
#define MAX_BLOCK_CHANGE_INTERACTIONS 20
|
||||||
|
|
||||||
/** How many ticks before the socket is closed after the client is destroyed (#31) */
|
|
||||||
static const int TICKS_BEFORE_CLOSE = 20;
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -63,7 +60,7 @@ int cClientHandle::s_ClientCount = 0;
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cClientHandle:
|
// cClientHandle:
|
||||||
|
|
||||||
cClientHandle::cClientHandle(const cSocket * a_Socket, int a_ViewDistance) :
|
cClientHandle::cClientHandle(const cSocket * a_Socket, int a_ViewDistance) :
|
||||||
|
@ -79,7 +76,6 @@ cClientHandle::cClientHandle(const cSocket * a_Socket, int a_ViewDistance) :
|
||||||
m_PingID(1),
|
m_PingID(1),
|
||||||
m_BlockDigAnimStage(-1),
|
m_BlockDigAnimStage(-1),
|
||||||
m_HasStartedDigging(false),
|
m_HasStartedDigging(false),
|
||||||
m_TicksSinceDestruction(0),
|
|
||||||
m_State(csConnected),
|
m_State(csConnected),
|
||||||
m_ShouldCheckDownloaded(false),
|
m_ShouldCheckDownloaded(false),
|
||||||
m_NumExplosionsThisTick(0),
|
m_NumExplosionsThisTick(0),
|
||||||
|
@ -104,7 +100,7 @@ cClientHandle::cClientHandle(const cSocket * a_Socket, int a_ViewDistance) :
|
||||||
|
|
||||||
cClientHandle::~cClientHandle()
|
cClientHandle::~cClientHandle()
|
||||||
{
|
{
|
||||||
ASSERT(m_State >= csDestroyedWaiting); // Has Destroy() been called?
|
ASSERT(m_State == csDestroyed); // Has Destroy() been called?
|
||||||
|
|
||||||
LOGD("Deleting client \"%s\" at %p", GetUsername().c_str(), this);
|
LOGD("Deleting client \"%s\" at %p", GetUsername().c_str(), this);
|
||||||
|
|
||||||
|
@ -168,7 +164,7 @@ void cClientHandle::Destroy(void)
|
||||||
RemoveFromAllChunks();
|
RemoveFromAllChunks();
|
||||||
m_Player->GetWorld()->RemoveClientFromChunkSender(this);
|
m_Player->GetWorld()->RemoveClientFromChunkSender(this);
|
||||||
}
|
}
|
||||||
m_State = csDestroyedWaiting;
|
m_State = csDestroyed;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -238,18 +234,16 @@ AString cClientHandle::GenerateOfflineUUID(const AString & a_Username)
|
||||||
// xxxxxxxx-xxxx-3xxx-yxxx-xxxxxxxxxxxx where x is any hexadecimal digit and y is one of 8, 9, A, or B
|
// xxxxxxxx-xxxx-3xxx-yxxx-xxxxxxxxxxxx where x is any hexadecimal digit and y is one of 8, 9, A, or B
|
||||||
|
|
||||||
// Generate an md5 checksum, and use it as base for the ID:
|
// Generate an md5 checksum, and use it as base for the ID:
|
||||||
MD5 Checksum(a_Username);
|
unsigned char MD5[16];
|
||||||
AString UUID = Checksum.hexdigest();
|
md5((const unsigned char *)a_Username.c_str(), a_Username.length(), MD5);
|
||||||
UUID[12] = '3'; // Version 3 UUID
|
MD5[6] &= 0x0f; // Need to trim to 4 bits only...
|
||||||
UUID[16] = '8'; // Variant 1 UUID
|
MD5[8] &= 0x0f; // ... otherwise %01x overflows into two chars
|
||||||
|
return Printf("%02x%02x%02x%02x-%02x%02x-3%01x%02x-8%01x%02x-%02x%02x%02x%02x%02x%02x",
|
||||||
// Now the digest doesn't have the UUID slashes, but the client requires them, so add them into the appropriate positions:
|
MD5[0], MD5[1], MD5[2], MD5[3],
|
||||||
UUID.insert(8, "-");
|
MD5[4], MD5[5], MD5[6], MD5[7],
|
||||||
UUID.insert(13, "-");
|
MD5[8], MD5[9], MD5[10], MD5[11],
|
||||||
UUID.insert(18, "-");
|
MD5[12], MD5[13], MD5[14], MD5[15]
|
||||||
UUID.insert(23, "-");
|
);
|
||||||
|
|
||||||
return UUID;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -295,17 +289,18 @@ void cClientHandle::Kick(const AString & a_Reason)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cClientHandle::Authenticate(const AString & a_Name, const AString & a_UUID)
|
void cClientHandle::Authenticate(const AString & a_Name, const AString & a_UUID, const Json::Value & a_Properties)
|
||||||
{
|
{
|
||||||
if (m_State != csAuthenticating)
|
if (m_State != csAuthenticating)
|
||||||
{
|
{
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
ASSERT( m_Player == NULL );
|
ASSERT(m_Player == NULL);
|
||||||
|
|
||||||
m_Username = a_Name;
|
m_Username = a_Name;
|
||||||
m_UUID = a_UUID;
|
m_UUID = a_UUID;
|
||||||
|
m_Properties = a_Properties;
|
||||||
|
|
||||||
// Send login success (if the protocol supports it):
|
// Send login success (if the protocol supports it):
|
||||||
m_Protocol->SendLoginSuccess();
|
m_Protocol->SendLoginSuccess();
|
||||||
|
@ -329,7 +324,7 @@ void cClientHandle::Authenticate(const AString & a_Name, const AString & a_UUID)
|
||||||
if (!cRoot::Get()->GetPluginManager()->CallHookPlayerJoined(*m_Player))
|
if (!cRoot::Get()->GetPluginManager()->CallHookPlayerJoined(*m_Player))
|
||||||
{
|
{
|
||||||
cRoot::Get()->BroadcastChatJoin(Printf("%s has joined the game", GetUsername().c_str()));
|
cRoot::Get()->BroadcastChatJoin(Printf("%s has joined the game", GetUsername().c_str()));
|
||||||
LOGINFO("Player %s has joined the game.", m_Username.c_str());
|
LOGINFO("Player %s has joined the game", m_Username.c_str());
|
||||||
}
|
}
|
||||||
|
|
||||||
m_ConfirmPosition = m_Player->GetPosition();
|
m_ConfirmPosition = m_Player->GetPosition();
|
||||||
|
@ -364,6 +359,9 @@ void cClientHandle::Authenticate(const AString & a_Name, const AString & a_UUID)
|
||||||
// Send scoreboard data
|
// Send scoreboard data
|
||||||
World->GetScoreBoard().SendTo(*this);
|
World->GetScoreBoard().SendTo(*this);
|
||||||
|
|
||||||
|
// Send statistics
|
||||||
|
SendStatistics(m_Player->GetStatManager());
|
||||||
|
|
||||||
// Delay the first ping until the client "settles down"
|
// Delay the first ping until the client "settles down"
|
||||||
// This should fix #889, "BadCast exception, cannot convert bit to fm" error in client
|
// This should fix #889, "BadCast exception, cannot convert bit to fm" error in client
|
||||||
cTimer t1;
|
cTimer t1;
|
||||||
|
@ -878,7 +876,7 @@ void cClientHandle::HandleLeftClick(int a_BlockX, int a_BlockY, int a_BlockZ, eB
|
||||||
case DIG_STATUS_SHOOT_EAT:
|
case DIG_STATUS_SHOOT_EAT:
|
||||||
{
|
{
|
||||||
cItemHandler * ItemHandler = cItemHandler::GetItemHandler(m_Player->GetEquippedItem());
|
cItemHandler * ItemHandler = cItemHandler::GetItemHandler(m_Player->GetEquippedItem());
|
||||||
if (ItemHandler->IsFood())
|
if (ItemHandler->IsFood() || ItemHandler->IsDrinkable(m_Player->GetEquippedItem().m_ItemDamage))
|
||||||
{
|
{
|
||||||
m_Player->AbortEating();
|
m_Player->AbortEating();
|
||||||
return;
|
return;
|
||||||
|
@ -1084,12 +1082,7 @@ void cClientHandle::HandleBlockDigFinished(int a_BlockX, int a_BlockY, int a_Blo
|
||||||
|
|
||||||
void cClientHandle::FinishDigAnimation()
|
void cClientHandle::FinishDigAnimation()
|
||||||
{
|
{
|
||||||
if (
|
if (!m_HasStartedDigging) // Hasn't received the DIG_STARTED packet
|
||||||
!m_HasStartedDigging || // Hasn't received the DIG_STARTED packet
|
|
||||||
(m_LastDigBlockX == -1) ||
|
|
||||||
(m_LastDigBlockY == -1) ||
|
|
||||||
(m_LastDigBlockZ == -1)
|
|
||||||
)
|
|
||||||
{
|
{
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -1208,17 +1201,19 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
short EquippedDamage = Equipped.m_ItemDamage;
|
||||||
cItemHandler * ItemHandler = cItemHandler::GetItemHandler(Equipped.m_ItemType);
|
cItemHandler * ItemHandler = cItemHandler::GetItemHandler(Equipped.m_ItemType);
|
||||||
|
|
||||||
if (ItemHandler->IsPlaceable() && (a_BlockFace != BLOCK_FACE_NONE))
|
if (ItemHandler->IsPlaceable() && (a_BlockFace != BLOCK_FACE_NONE))
|
||||||
{
|
{
|
||||||
HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler);
|
HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler);
|
||||||
}
|
}
|
||||||
else if (ItemHandler->IsFood() && !m_Player->IsGameModeCreative())
|
else if ((ItemHandler->IsFood() || ItemHandler->IsDrinkable(EquippedDamage)))
|
||||||
{
|
{
|
||||||
if (m_Player->IsSatiated())
|
if ((m_Player->IsSatiated() || m_Player->IsGameModeCreative()) &&
|
||||||
|
ItemHandler->IsFood())
|
||||||
{
|
{
|
||||||
// The player is satiated, they cannot eat
|
// The player is satiated or in creative, and trying to eat
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
m_Player->StartEating();
|
m_Player->StartEating();
|
||||||
|
@ -1226,9 +1221,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
|
||||||
{
|
{
|
||||||
// A plugin won't let us eat, abort (send the proper packets to the client, too):
|
// A plugin won't let us eat, abort (send the proper packets to the client, too):
|
||||||
m_Player->AbortEating();
|
m_Player->AbortEating();
|
||||||
return;
|
|
||||||
}
|
}
|
||||||
return;
|
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -1370,7 +1363,7 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e
|
||||||
NewBlock->OnPlacedByPlayer(ChunkInterface,*World, m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, BlockType, BlockMeta);
|
NewBlock->OnPlacedByPlayer(ChunkInterface,*World, m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, BlockType, BlockMeta);
|
||||||
|
|
||||||
// Step sound with 0.8f pitch is used as block placement sound
|
// Step sound with 0.8f pitch is used as block placement sound
|
||||||
World->BroadcastSoundEffect(NewBlock->GetStepSound(), a_BlockX * 8, a_BlockY * 8, a_BlockZ * 8, 1.0f, 0.8f);
|
World->BroadcastSoundEffect(NewBlock->GetStepSound(), (double)a_BlockX, (double)a_BlockY, (double)a_BlockZ, 1.0f, 0.8f);
|
||||||
cRoot::Get()->GetPluginManager()->CallHookPlayerPlacedBlock(*m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, BlockType, BlockMeta);
|
cRoot::Get()->GetPluginManager()->CallHookPlayerPlacedBlock(*m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, BlockType, BlockMeta);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -1464,8 +1457,10 @@ void cClientHandle::HandleAnimation(char a_Animation)
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
default: // Anything else is the same
|
default: // Anything else is the same
|
||||||
|
{
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
m_Player->GetWorld()->BroadcastEntityAnimation(*m_Player, a_Animation, this);
|
m_Player->GetWorld()->BroadcastEntityAnimation(*m_Player, a_Animation, this);
|
||||||
}
|
}
|
||||||
|
@ -1828,17 +1823,6 @@ bool cClientHandle::CheckBlockInteractionsRate(void)
|
||||||
|
|
||||||
void cClientHandle::Tick(float a_Dt)
|
void cClientHandle::Tick(float a_Dt)
|
||||||
{
|
{
|
||||||
// Handle clients that are waiting for final close while destroyed:
|
|
||||||
if (m_State == csDestroyedWaiting)
|
|
||||||
{
|
|
||||||
m_TicksSinceDestruction += 1; // This field is misused for the timeout counting
|
|
||||||
if (m_TicksSinceDestruction > TICKS_BEFORE_CLOSE)
|
|
||||||
{
|
|
||||||
m_State = csDestroyed;
|
|
||||||
}
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Process received network data:
|
// Process received network data:
|
||||||
AString IncomingData;
|
AString IncomingData;
|
||||||
{
|
{
|
||||||
|
@ -1905,14 +1889,6 @@ void cClientHandle::Tick(float a_Dt)
|
||||||
|
|
||||||
void cClientHandle::ServerTick(float a_Dt)
|
void cClientHandle::ServerTick(float a_Dt)
|
||||||
{
|
{
|
||||||
// Handle clients that are waiting for final close while destroyed:
|
|
||||||
if (m_State == csDestroyedWaiting)
|
|
||||||
{
|
|
||||||
// Do not wait while the client is not in the world, simply cut them off.
|
|
||||||
m_State = csDestroyed;
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Process received network data:
|
// Process received network data:
|
||||||
AString IncomingData;
|
AString IncomingData;
|
||||||
{
|
{
|
||||||
|
@ -2075,9 +2051,9 @@ void cClientHandle::SendChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataSerializ
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cClientHandle::SendCollectPickup(const cPickup & a_Pickup, const cPlayer & a_Player)
|
void cClientHandle::SendCollectEntity(const cEntity & a_Entity, const cPlayer & a_Player)
|
||||||
{
|
{
|
||||||
m_Protocol->SendCollectPickup(a_Pickup, a_Player);
|
m_Protocol->SendCollectEntity(a_Entity, a_Player);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -2453,9 +2429,9 @@ void cClientHandle::SendDisplayObjective(const AString & a_Objective, cScoreboar
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cClientHandle::SendSoundEffect(const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch)
|
void cClientHandle::SendSoundEffect(const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch)
|
||||||
{
|
{
|
||||||
m_Protocol->SendSoundEffect(a_SoundName, a_SrcX, a_SrcY, a_SrcZ, a_Volume, a_Pitch);
|
m_Protocol->SendSoundEffect(a_SoundName, a_X, a_Y, a_Z, a_Volume, a_Pitch);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
|
@ -20,6 +20,7 @@
|
||||||
#include "Map.h"
|
#include "Map.h"
|
||||||
#include "Enchantments.h"
|
#include "Enchantments.h"
|
||||||
#include "UI/SlotArea.h"
|
#include "UI/SlotArea.h"
|
||||||
|
#include "json/json.h"
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -68,6 +69,8 @@ public:
|
||||||
const AString & GetUUID(void) const { return m_UUID; } // tolua_export
|
const AString & GetUUID(void) const { return m_UUID; } // tolua_export
|
||||||
void SetUUID(const AString & a_UUID) { m_UUID = a_UUID; }
|
void SetUUID(const AString & a_UUID) { m_UUID = a_UUID; }
|
||||||
|
|
||||||
|
const Json::Value & GetProperties(void) const { return m_Properties; }
|
||||||
|
|
||||||
/** Generates an UUID based on the username stored for this client, and stores it in the m_UUID member.
|
/** Generates an UUID based on the username stored for this client, and stores it in the m_UUID member.
|
||||||
This is used for the offline (non-auth) mode, when there's no UUID source.
|
This is used for the offline (non-auth) mode, when there's no UUID source.
|
||||||
Each username generates a unique and constant UUID, so that when the player reconnects with the same name, their UUID is the same.
|
Each username generates a unique and constant UUID, so that when the player reconnects with the same name, their UUID is the same.
|
||||||
|
@ -92,7 +95,9 @@ public:
|
||||||
static AString FormatChatPrefix(bool ShouldAppendChatPrefixes, AString a_ChatPrefixS, AString m_Color1, AString m_Color2);
|
static AString FormatChatPrefix(bool ShouldAppendChatPrefixes, AString a_ChatPrefixS, AString m_Color1, AString m_Color2);
|
||||||
|
|
||||||
void Kick(const AString & a_Reason); // tolua_export
|
void Kick(const AString & a_Reason); // tolua_export
|
||||||
void Authenticate(const AString & a_Name, const AString & a_UUID); // Called by cAuthenticator when the user passes authentication
|
|
||||||
|
/** Authenticates the specified user, called by cAuthenticator */
|
||||||
|
void Authenticate(const AString & a_Name, const AString & a_UUID, const Json::Value & a_Properties);
|
||||||
|
|
||||||
void StreamChunks(void);
|
void StreamChunks(void);
|
||||||
|
|
||||||
|
@ -123,7 +128,7 @@ public:
|
||||||
void SendChat (const AString & a_Message, eMessageType a_ChatPrefix, const AString & a_AdditionalData = "");
|
void SendChat (const AString & a_Message, eMessageType a_ChatPrefix, const AString & a_AdditionalData = "");
|
||||||
void SendChat (const cCompositeChat & a_Message);
|
void SendChat (const cCompositeChat & a_Message);
|
||||||
void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer);
|
void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer);
|
||||||
void SendCollectPickup (const cPickup & a_Pickup, const cPlayer & a_Player);
|
void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player);
|
||||||
void SendDestroyEntity (const cEntity & a_Entity);
|
void SendDestroyEntity (const cEntity & a_Entity);
|
||||||
void SendDisconnect (const AString & a_Reason);
|
void SendDisconnect (const AString & a_Reason);
|
||||||
void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ);
|
void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ);
|
||||||
|
@ -162,7 +167,7 @@ public:
|
||||||
void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode);
|
void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode);
|
||||||
void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode);
|
void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode);
|
||||||
void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display);
|
void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display);
|
||||||
void SendSoundEffect (const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch); // a_Src coords are Block * 8
|
void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch); // tolua_export
|
||||||
void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data);
|
void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data);
|
||||||
void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock);
|
void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock);
|
||||||
void SendSpawnMob (const cMonster & a_Mob);
|
void SendSpawnMob (const cMonster & a_Mob);
|
||||||
|
@ -266,20 +271,20 @@ public:
|
||||||
|
|
||||||
private:
|
private:
|
||||||
|
|
||||||
/** Handles the block placing packet when it is a real block placement (not block-using, item-using or eating) */
|
|
||||||
void HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, cItemHandler & a_ItemHandler);
|
|
||||||
|
|
||||||
/** The type used for storing the names of registered plugin channels. */
|
/** The type used for storing the names of registered plugin channels. */
|
||||||
typedef std::set<AString> cChannels;
|
typedef std::set<AString> cChannels;
|
||||||
|
|
||||||
int m_ViewDistance; // Number of chunks the player can see in each direction; 4 is the minimum ( http://wiki.vg/Protocol_FAQ#.E2.80.A6all_connecting_clients_spasm_and_jerk_uncontrollably.21 )
|
/** Number of chunks the player can see in each direction; 4 is the minimum ( http://wiki.vg/Protocol_FAQ#.E2.80.A6all_connecting_clients_spasm_and_jerk_uncontrollably.21 ) */
|
||||||
|
int m_ViewDistance;
|
||||||
|
|
||||||
static const int GENERATEDISTANCE = 2; // Server generates this many chunks AHEAD of player sight. 2 is the minimum, since foliage is generated 1 step behind chunk terrain generation
|
/** Server generates this many chunks AHEAD of player sight. */
|
||||||
|
static const int GENERATEDISTANCE = 2;
|
||||||
|
|
||||||
AString m_IPString;
|
AString m_IPString;
|
||||||
|
|
||||||
AString m_Username;
|
AString m_Username;
|
||||||
AString m_Password;
|
AString m_Password;
|
||||||
|
Json::Value m_Properties;
|
||||||
|
|
||||||
cCriticalSection m_CSChunkLists;
|
cCriticalSection m_CSChunkLists;
|
||||||
cChunkCoordsList m_LoadedChunks; // Chunks that the player belongs to
|
cChunkCoordsList m_LoadedChunks; // Chunks that the player belongs to
|
||||||
|
@ -311,7 +316,7 @@ private:
|
||||||
int m_PingID;
|
int m_PingID;
|
||||||
long long m_PingStartTime;
|
long long m_PingStartTime;
|
||||||
long long m_LastPingTime;
|
long long m_LastPingTime;
|
||||||
static const unsigned short PING_TIME_MS = 1000; //minecraft sends 1 per 20 ticks (1 second or every 1000 ms)
|
static const unsigned short PING_TIME_MS = 1000; // Vanilla sends 1 per 20 ticks (1 second or every 1000 ms)
|
||||||
|
|
||||||
// Values required for block dig animation
|
// Values required for block dig animation
|
||||||
int m_BlockDigAnimStage; // Current stage of the animation; -1 if not digging
|
int m_BlockDigAnimStage; // Current stage of the animation; -1 if not digging
|
||||||
|
@ -326,9 +331,6 @@ private:
|
||||||
int m_LastDigBlockY;
|
int m_LastDigBlockY;
|
||||||
int m_LastDigBlockZ;
|
int m_LastDigBlockZ;
|
||||||
|
|
||||||
/** Used while csDestroyedWaiting for counting the ticks until the connection is closed */
|
|
||||||
int m_TicksSinceDestruction;
|
|
||||||
|
|
||||||
enum eState
|
enum eState
|
||||||
{
|
{
|
||||||
csConnected, ///< The client has just connected, waiting for their handshake / login
|
csConnected, ///< The client has just connected, waiting for their handshake / login
|
||||||
|
@ -338,7 +340,6 @@ private:
|
||||||
csConfirmingPos, ///< The client has been sent the position packet, waiting for them to repeat the position back
|
csConfirmingPos, ///< The client has been sent the position packet, waiting for them to repeat the position back
|
||||||
csPlaying, ///< Normal gameplay
|
csPlaying, ///< Normal gameplay
|
||||||
csDestroying, ///< The client is being destroyed, don't queue any more packets / don't add to chunks
|
csDestroying, ///< The client is being destroyed, don't queue any more packets / don't add to chunks
|
||||||
csDestroyedWaiting, ///< The client has been destroyed, but is still kept so that the Kick packet is delivered (#31)
|
|
||||||
csDestroyed, ///< The client has been destroyed, the destructor is to be called from the owner thread
|
csDestroyed, ///< The client has been destroyed, the destructor is to be called from the owner thread
|
||||||
|
|
||||||
// TODO: Add Kicking here as well
|
// TODO: Add Kicking here as well
|
||||||
|
@ -372,6 +373,9 @@ private:
|
||||||
cChannels m_PluginChannels;
|
cChannels m_PluginChannels;
|
||||||
|
|
||||||
|
|
||||||
|
/** Handles the block placing packet when it is a real block placement (not block-using, item-using or eating) */
|
||||||
|
void HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, cItemHandler & a_ItemHandler);
|
||||||
|
|
||||||
/** Returns true if the rate block interactions is within a reasonable limit (bot protection) */
|
/** Returns true if the rate block interactions is within a reasonable limit (bot protection) */
|
||||||
bool CheckBlockInteractionsRate(void);
|
bool CheckBlockInteractionsRate(void);
|
||||||
|
|
||||||
|
|
|
@ -10,7 +10,7 @@
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCommandOutputCallback:
|
// cCommandOutputCallback:
|
||||||
|
|
||||||
void cCommandOutputCallback::Out(const char * a_Fmt, ...)
|
void cCommandOutputCallback::Out(const char * a_Fmt, ...)
|
||||||
|
@ -28,7 +28,7 @@ void cCommandOutputCallback::Out(const char * a_Fmt, ...)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cLogCommandOutputCallback:
|
// cLogCommandOutputCallback:
|
||||||
|
|
||||||
void cLogCommandOutputCallback::Out(const AString & a_Text)
|
void cLogCommandOutputCallback::Out(const AString & a_Text)
|
||||||
|
|
|
@ -100,7 +100,7 @@ public:
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCompositeChat:
|
// cCompositeChat:
|
||||||
|
|
||||||
cCompositeChat::cCompositeChat(void) :
|
cCompositeChat::cCompositeChat(void) :
|
||||||
|
@ -399,7 +399,7 @@ void cCompositeChat::AddStyle(AString & a_Style, const AString & a_AddStyle)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCompositeChat::cBasePart:
|
// cCompositeChat::cBasePart:
|
||||||
|
|
||||||
cCompositeChat::cBasePart::cBasePart(cCompositeChat::ePartType a_PartType, const AString & a_Text, const AString & a_Style) :
|
cCompositeChat::cBasePart::cBasePart(cCompositeChat::ePartType a_PartType, const AString & a_Text, const AString & a_Style) :
|
||||||
|
@ -413,7 +413,7 @@ cCompositeChat::cBasePart::cBasePart(cCompositeChat::ePartType a_PartType, const
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCompositeChat::cTextPart:
|
// cCompositeChat::cTextPart:
|
||||||
|
|
||||||
cCompositeChat::cTextPart::cTextPart(const AString & a_Text, const AString &a_Style) :
|
cCompositeChat::cTextPart::cTextPart(const AString & a_Text, const AString &a_Style) :
|
||||||
|
@ -425,7 +425,7 @@ cCompositeChat::cTextPart::cTextPart(const AString & a_Text, const AString &a_St
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCompositeChat::cClientTranslatedPart:
|
// cCompositeChat::cClientTranslatedPart:
|
||||||
|
|
||||||
cCompositeChat::cClientTranslatedPart::cClientTranslatedPart(const AString & a_TranslationID, const AStringVector & a_Parameters, const AString & a_Style) :
|
cCompositeChat::cClientTranslatedPart::cClientTranslatedPart(const AString & a_TranslationID, const AStringVector & a_Parameters, const AString & a_Style) :
|
||||||
|
@ -438,7 +438,7 @@ cCompositeChat::cClientTranslatedPart::cClientTranslatedPart(const AString & a_T
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCompositeChat::cUrlPart:
|
// cCompositeChat::cUrlPart:
|
||||||
|
|
||||||
cCompositeChat::cUrlPart::cUrlPart(const AString & a_Text, const AString & a_Url, const AString & a_Style) :
|
cCompositeChat::cUrlPart::cUrlPart(const AString & a_Text, const AString & a_Url, const AString & a_Style) :
|
||||||
|
@ -451,7 +451,7 @@ cCompositeChat::cUrlPart::cUrlPart(const AString & a_Text, const AString & a_Url
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCompositeChat::cCommandPart:
|
// cCompositeChat::cCommandPart:
|
||||||
|
|
||||||
cCompositeChat::cCommandPart::cCommandPart(ePartType a_PartType, const AString & a_Text, const AString & a_Command, const AString & a_Style) :
|
cCompositeChat::cCommandPart::cCommandPart(ePartType a_PartType, const AString & a_Text, const AString & a_Command, const AString & a_Style) :
|
||||||
|
@ -464,7 +464,7 @@ cCompositeChat::cCommandPart::cCommandPart(ePartType a_PartType, const AString &
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCompositeChat::cRunCommandPart:
|
// cCompositeChat::cRunCommandPart:
|
||||||
|
|
||||||
cCompositeChat::cRunCommandPart::cRunCommandPart(const AString & a_Text, const AString & a_Command, const AString & a_Style) :
|
cCompositeChat::cRunCommandPart::cRunCommandPart(const AString & a_Text, const AString & a_Command, const AString & a_Style) :
|
||||||
|
@ -475,7 +475,7 @@ cCompositeChat::cRunCommandPart::cRunCommandPart(const AString & a_Text, const A
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCompositeChat::cSuggestCommandPart:
|
// cCompositeChat::cSuggestCommandPart:
|
||||||
|
|
||||||
cCompositeChat::cSuggestCommandPart::cSuggestCommandPart(const AString & a_Text, const AString & a_Command, const AString & a_Style) :
|
cCompositeChat::cSuggestCommandPart::cSuggestCommandPart(const AString & a_Text, const AString & a_Command, const AString & a_Style) :
|
||||||
|
@ -487,7 +487,7 @@ cCompositeChat::cSuggestCommandPart::cSuggestCommandPart(const AString & a_Text,
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCompositeChat::cShowAchievementPart:
|
// cCompositeChat::cShowAchievementPart:
|
||||||
|
|
||||||
cCompositeChat::cShowAchievementPart::cShowAchievementPart(const AString & a_PlayerName, const AString & a_Achievement, const AString & a_Style) :
|
cCompositeChat::cShowAchievementPart::cShowAchievementPart(const AString & a_PlayerName, const AString & a_Achievement, const AString & a_Style) :
|
||||||
|
|
|
@ -12,7 +12,7 @@
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCraftingGrid:
|
// cCraftingGrid:
|
||||||
|
|
||||||
cCraftingGrid::cCraftingGrid(int a_Width, int a_Height) :
|
cCraftingGrid::cCraftingGrid(int a_Width, int a_Height) :
|
||||||
|
@ -206,7 +206,7 @@ void cCraftingGrid::Dump(void)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCraftingRecipe:
|
// cCraftingRecipe:
|
||||||
|
|
||||||
cCraftingRecipe::cCraftingRecipe(const cCraftingGrid & a_CraftingGrid) :
|
cCraftingRecipe::cCraftingRecipe(const cCraftingGrid & a_CraftingGrid) :
|
||||||
|
@ -259,7 +259,7 @@ void cCraftingRecipe::Dump(void)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCraftingRecipes:
|
// cCraftingRecipes:
|
||||||
|
|
||||||
cCraftingRecipes::cCraftingRecipes(void)
|
cCraftingRecipes::cCraftingRecipes(void)
|
||||||
|
|
|
@ -21,7 +21,7 @@ static bool DoIntervalsIntersect(int a_Min1, int a_Max1, int a_Min2, int a_Max2)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// cCuboid:
|
// cCuboid:
|
||||||
|
|
||||||
void cCuboid::Assign(int a_X1, int a_Y1, int a_Z1, int a_X2, int a_Y2, int a_Z2)
|
void cCuboid::Assign(int a_X1, int a_Y1, int a_Z1, int a_X2, int a_Y2, int a_Z2)
|
||||||
|
|
|
@ -1,7 +1,6 @@
|
||||||
|
|
||||||
#pragma once
|
#pragma once
|
||||||
|
|
||||||
#include "ChatColor.h"
|
|
||||||
#include <limits>
|
#include <limits>
|
||||||
#include <cmath>
|
#include <cmath>
|
||||||
|
|
||||||
|
@ -22,7 +21,7 @@ typedef std::vector<int> cSlotNums;
|
||||||
/// Experience Orb setup
|
/// Experience Orb setup
|
||||||
enum
|
enum
|
||||||
{
|
{
|
||||||
//open to suggestion on naming convention here :)
|
// Open to suggestion on naming convention here :)
|
||||||
MAX_EXPERIENCE_ORB_SIZE = 2000
|
MAX_EXPERIENCE_ORB_SIZE = 2000
|
||||||
} ;
|
} ;
|
||||||
|
|
||||||
|
|
|
@ -3,6 +3,7 @@
|
||||||
#include "Player.h"
|
#include "Player.h"
|
||||||
#include "ArrowEntity.h"
|
#include "ArrowEntity.h"
|
||||||
#include "../Chunk.h"
|
#include "../Chunk.h"
|
||||||
|
#include "FastRandom.h"
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
@ -44,6 +45,10 @@ cArrowEntity::cArrowEntity(cPlayer & a_Player, double a_Force) :
|
||||||
m_bIsCollected(false),
|
m_bIsCollected(false),
|
||||||
m_HitBlockPos(0, 0, 0)
|
m_HitBlockPos(0, 0, 0)
|
||||||
{
|
{
|
||||||
|
if (a_Player.IsGameModeCreative())
|
||||||
|
{
|
||||||
|
m_PickupState = psInCreative;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -68,25 +73,23 @@ bool cArrowEntity::CanPickup(const cPlayer & a_Player) const
|
||||||
|
|
||||||
void cArrowEntity::OnHitSolidBlock(const Vector3d & a_HitPos, eBlockFace a_HitFace)
|
void cArrowEntity::OnHitSolidBlock(const Vector3d & a_HitPos, eBlockFace a_HitFace)
|
||||||
{
|
{
|
||||||
if (a_HitFace == BLOCK_FACE_NONE) { return; }
|
if (GetSpeed().EqualsEps(Vector3d(0, 0, 0), 0.0000001))
|
||||||
|
|
||||||
super::OnHitSolidBlock(a_HitPos, a_HitFace);
|
|
||||||
int a_X = (int)a_HitPos.x, a_Y = (int)a_HitPos.y, a_Z = (int)a_HitPos.z;
|
|
||||||
|
|
||||||
switch (a_HitFace)
|
|
||||||
{
|
{
|
||||||
case BLOCK_FACE_XM: // Strangely, bounding boxes / block tracers return the actual block for these two directions, so AddFace not needed
|
SetSpeed(GetLookVector().NormalizeCopy() * 0.1); // Ensure that no division by zero happens later
|
||||||
case BLOCK_FACE_YM:
|
|
||||||
{
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
default: AddFaceDirection(a_X, a_Y, a_Z, a_HitFace, true);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
m_HitBlockPos = Vector3i(a_X, a_Y, a_Z);
|
Vector3d Hit = a_HitPos;
|
||||||
|
Vector3d SinkMovement = (GetSpeed() / 1000);
|
||||||
|
Hit += SinkMovement * (0.0005 / SinkMovement.Length()); // Make arrow sink into block a centimetre so it lodges (but not to far so it goes black clientside)
|
||||||
|
|
||||||
|
super::OnHitSolidBlock(Hit, a_HitFace);
|
||||||
|
Vector3i BlockHit = Hit.Floor();
|
||||||
|
|
||||||
|
int X = BlockHit.x, Y = BlockHit.y, Z = BlockHit.z;
|
||||||
|
m_HitBlockPos = Vector3i(X, Y, Z);
|
||||||
|
|
||||||
// Broadcast arrow hit sound
|
// Broadcast arrow hit sound
|
||||||
m_World->BroadcastSoundEffect("random.bowhit", (int)GetPosX() * 8, (int)GetPosY() * 8, (int)GetPosZ() * 8, 0.5f, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64));
|
m_World->BroadcastSoundEffect("random.bowhit", (double)X, (double)Y, (double)Z, 0.5f, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -95,12 +98,6 @@ void cArrowEntity::OnHitSolidBlock(const Vector3d & a_HitPos, eBlockFace a_HitFa
|
||||||
|
|
||||||
void cArrowEntity::OnHitEntity(cEntity & a_EntityHit, const Vector3d & a_HitPos)
|
void cArrowEntity::OnHitEntity(cEntity & a_EntityHit, const Vector3d & a_HitPos)
|
||||||
{
|
{
|
||||||
if (!a_EntityHit.IsMob() && !a_EntityHit.IsMinecart() && !a_EntityHit.IsPlayer() && !a_EntityHit.IsBoat())
|
|
||||||
{
|
|
||||||
// Not an entity that interacts with an arrow
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
|
|
||||||
int Damage = (int)(GetSpeed().Length() / 20 * m_DamageCoeff + 0.5);
|
int Damage = (int)(GetSpeed().Length() / 20 * m_DamageCoeff + 0.5);
|
||||||
if (m_IsCritical)
|
if (m_IsCritical)
|
||||||
{
|
{
|
||||||
|
@ -109,7 +106,7 @@ void cArrowEntity::OnHitEntity(cEntity & a_EntityHit, const Vector3d & a_HitPos)
|
||||||
a_EntityHit.TakeDamage(dtRangedAttack, this, Damage, 1);
|
a_EntityHit.TakeDamage(dtRangedAttack, this, Damage, 1);
|
||||||
|
|
||||||
// Broadcast successful hit sound
|
// Broadcast successful hit sound
|
||||||
m_World->BroadcastSoundEffect("random.successful_hit", (int)GetPosX() * 8, (int)GetPosY() * 8, (int)GetPosZ() * 8, 0.5, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64));
|
GetWorld()->BroadcastSoundEffect("random.successful_hit", GetPosX(), GetPosY(), GetPosZ(), 0.5, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64));
|
||||||
|
|
||||||
Destroy();
|
Destroy();
|
||||||
}
|
}
|
||||||
|
@ -120,17 +117,23 @@ void cArrowEntity::OnHitEntity(cEntity & a_EntityHit, const Vector3d & a_HitPos)
|
||||||
|
|
||||||
void cArrowEntity::CollectedBy(cPlayer * a_Dest)
|
void cArrowEntity::CollectedBy(cPlayer * a_Dest)
|
||||||
{
|
{
|
||||||
if ((m_IsInGround) && (!m_bIsCollected) && (CanPickup(*a_Dest)))
|
if (m_IsInGround && !m_bIsCollected && CanPickup(*a_Dest))
|
||||||
|
{
|
||||||
|
// Do not add the arrow to the inventory when the player is in creative:
|
||||||
|
if (!a_Dest->IsGameModeCreative())
|
||||||
{
|
{
|
||||||
int NumAdded = a_Dest->GetInventory().AddItem(E_ITEM_ARROW);
|
int NumAdded = a_Dest->GetInventory().AddItem(E_ITEM_ARROW);
|
||||||
if (NumAdded > 0) // Only play effects if there was space in inventory
|
if (NumAdded == 0)
|
||||||
{
|
{
|
||||||
m_World->BroadcastCollectPickup((const cPickup &)*this, *a_Dest);
|
// No space in the inventory
|
||||||
// Also send the "pop" sound effect with a somewhat random pitch (fast-random using EntityID ;)
|
return;
|
||||||
m_World->BroadcastSoundEffect("random.pop", (int)GetPosX() * 8, (int)GetPosY() * 8, (int)GetPosZ() * 8, 0.5, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64));
|
|
||||||
m_bIsCollected = true;
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
GetWorld()->BroadcastCollectEntity(*this, *a_Dest);
|
||||||
|
GetWorld()->BroadcastSoundEffect("random.pop", GetPosX(), GetPosY(), GetPosZ(), 0.5, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64));
|
||||||
|
m_bIsCollected = true;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -165,7 +168,7 @@ void cArrowEntity::Tick(float a_Dt, cChunk & a_Chunk)
|
||||||
|
|
||||||
if (!m_HasTeleported) // Sent a teleport already, don't do again
|
if (!m_HasTeleported) // Sent a teleport already, don't do again
|
||||||
{
|
{
|
||||||
if (m_HitGroundTimer > 1000.f) // Send after a second, could be less, but just in case
|
if (m_HitGroundTimer > 500.f) // Send after half a second, could be less, but just in case
|
||||||
{
|
{
|
||||||
m_World->BroadcastTeleportEntity(*this);
|
m_World->BroadcastTeleportEntity(*this);
|
||||||
m_HasTeleported = true;
|
m_HasTeleported = true;
|
||||||
|
|
|
@ -59,8 +59,14 @@ public:
|
||||||
/// Sets the IsCritical flag
|
/// Sets the IsCritical flag
|
||||||
void SetIsCritical(bool a_IsCritical) { m_IsCritical = a_IsCritical; }
|
void SetIsCritical(bool a_IsCritical) { m_IsCritical = a_IsCritical; }
|
||||||
|
|
||||||
|
/** Gets the block arrow is in */
|
||||||
|
Vector3i GetBlockHit(void) const { return m_HitBlockPos; }
|
||||||
|
|
||||||
// tolua_end
|
// tolua_end
|
||||||
|
|
||||||
|
/** Sets the block arrow is in. To be used by the MCA loader only! */
|
||||||
|
void SetBlockHit(const Vector3i & a_BlockHit) { m_HitBlockPos = a_BlockHit; }
|
||||||
|
|
||||||
protected:
|
protected:
|
||||||
|
|
||||||
/// Determines when the arrow can be picked up by players
|
/// Determines when the arrow can be picked up by players
|
||||||
|
|
|
@ -1,30 +0,0 @@
|
||||||
#pragma once
|
|
||||||
|
|
||||||
// tolua_begin
|
|
||||||
enum ENUM_ENTITY_EFFECT
|
|
||||||
{
|
|
||||||
E_EFFECT_SPEED = 1,
|
|
||||||
E_EFFECT_SLOWNESS = 2,
|
|
||||||
E_EFFECT_HASTE = 3,
|
|
||||||
E_EFFECT_MINING_FATIGUE = 4,
|
|
||||||
E_EFFECT_STENGTH = 5,
|
|
||||||
E_EFFECT_INSTANT_HEALTH = 6,
|
|
||||||
E_EFFECT_INSTANT_DAMAGE = 7,
|
|
||||||
E_EFFECT_JUMP_BOOST = 8,
|
|
||||||
E_EFFECT_NAUSEA = 9,
|
|
||||||
E_EFFECT_REGENERATION = 10,
|
|
||||||
E_EFFECT_RESISTANCE = 11,
|
|
||||||
E_EFFECT_FIRE_RESISTANCE = 12,
|
|
||||||
E_EFFECT_WATER_BREATHING = 13,
|
|
||||||
E_EFFECT_INVISIBILITY = 14,
|
|
||||||
E_EFFECT_BLINDNESS = 15,
|
|
||||||
E_EFFECT_NIGHT_VISION = 16,
|
|
||||||
E_EFFECT_HUNGER = 17,
|
|
||||||
E_EFFECT_WEAKNESS = 18,
|
|
||||||
E_EFFECT_POISON = 19,
|
|
||||||
E_EFFECT_WITHER = 20,
|
|
||||||
E_EFFECT_HEALTH_BOOST = 21,
|
|
||||||
E_EFFECT_ABSORPTION = 22,
|
|
||||||
E_EFFECT_SATURATION = 23,
|
|
||||||
} ;
|
|
||||||
// tolua_end
|
|
|
@ -42,9 +42,9 @@ void cEnderCrystal::Tick(float a_Dt, cChunk & a_Chunk)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cEnderCrystal::KilledBy(cEntity * a_Killer)
|
void cEnderCrystal::KilledBy(TakeDamageInfo & a_TDI)
|
||||||
{
|
{
|
||||||
super::KilledBy(a_Killer);
|
super::KilledBy(a_TDI);
|
||||||
|
|
||||||
m_World->DoExplosionAt(6.0, GetPosX(), GetPosY(), GetPosZ(), true, esEnderCrystal, this);
|
m_World->DoExplosionAt(6.0, GetPosX(), GetPosY(), GetPosZ(), true, esEnderCrystal, this);
|
||||||
|
|
||||||
|
|
|
@ -24,7 +24,7 @@ private:
|
||||||
// cEntity overrides:
|
// cEntity overrides:
|
||||||
virtual void SpawnOn(cClientHandle & a_ClientHandle) override;
|
virtual void SpawnOn(cClientHandle & a_ClientHandle) override;
|
||||||
virtual void Tick(float a_Dt, cChunk & a_Chunk) override;
|
virtual void Tick(float a_Dt, cChunk & a_Chunk) override;
|
||||||
virtual void KilledBy(cEntity * a_Killer) override;
|
virtual void KilledBy(TakeDamageInfo & a_TDI) override;
|
||||||
|
|
||||||
}; // tolua_export
|
}; // tolua_export
|
||||||
|
|
||||||
|
|
|
@ -311,11 +311,15 @@ bool cEntity::DoTakeDamage(TakeDamageInfo & a_TDI)
|
||||||
cPlayer * Player = (cPlayer *)a_TDI.Attacker;
|
cPlayer * Player = (cPlayer *)a_TDI.Attacker;
|
||||||
|
|
||||||
// IsOnGround() only is false if the player is moving downwards
|
// IsOnGround() only is false if the player is moving downwards
|
||||||
if (!Player->IsOnGround()) // TODO: Better damage increase, and check for enchantments (and use magic critical instead of plain)
|
// TODO: Better damage increase, and check for enchantments (and use magic critical instead of plain)
|
||||||
|
if (!Player->IsOnGround())
|
||||||
|
{
|
||||||
|
if ((a_TDI.DamageType == dtAttack) || (a_TDI.DamageType == dtArrowAttack))
|
||||||
{
|
{
|
||||||
a_TDI.FinalDamage += 2;
|
a_TDI.FinalDamage += 2;
|
||||||
m_World->BroadcastEntityAnimation(*this, 4); // Critical hit
|
m_World->BroadcastEntityAnimation(*this, 4); // Critical hit
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
Player->GetStatManager().AddValue(statDamageDealt, (StatValue)floor(a_TDI.FinalDamage * 10 + 0.5));
|
Player->GetStatManager().AddValue(statDamageDealt, (StatValue)floor(a_TDI.FinalDamage * 10 + 0.5));
|
||||||
}
|
}
|
||||||
|
@ -331,36 +335,21 @@ bool cEntity::DoTakeDamage(TakeDamageInfo & a_TDI)
|
||||||
|
|
||||||
if ((IsMob() || IsPlayer()) && (a_TDI.Attacker != NULL)) // Knockback for only players and mobs
|
if ((IsMob() || IsPlayer()) && (a_TDI.Attacker != NULL)) // Knockback for only players and mobs
|
||||||
{
|
{
|
||||||
int KnockbackLevel = 0;
|
int KnockbackLevel = a_TDI.Attacker->GetEquippedWeapon().m_Enchantments.GetLevel(cEnchantments::enchKnockback); // More common enchantment
|
||||||
if (a_TDI.Attacker->GetEquippedWeapon().m_ItemType == E_ITEM_BOW)
|
if (KnockbackLevel < 1)
|
||||||
{
|
{
|
||||||
|
// We support punch on swords and vice versa! :)
|
||||||
KnockbackLevel = a_TDI.Attacker->GetEquippedWeapon().m_Enchantments.GetLevel(cEnchantments::enchPunch);
|
KnockbackLevel = a_TDI.Attacker->GetEquippedWeapon().m_Enchantments.GetLevel(cEnchantments::enchPunch);
|
||||||
}
|
}
|
||||||
else
|
|
||||||
{
|
|
||||||
KnockbackLevel = a_TDI.Attacker->GetEquippedWeapon().m_Enchantments.GetLevel(cEnchantments::enchKnockback);
|
|
||||||
}
|
|
||||||
|
|
||||||
Vector3d additionalSpeed(0, 0, 0);
|
Vector3d AdditionalSpeed(0, 0, 0);
|
||||||
switch (KnockbackLevel)
|
switch (KnockbackLevel)
|
||||||
{
|
{
|
||||||
case 1:
|
case 1: AdditionalSpeed.Set(5, 0.3, 5); break;
|
||||||
{
|
case 2: AdditionalSpeed.Set(8, 0.3, 8); break;
|
||||||
additionalSpeed.Set(5, .3, 5);
|
default: break;
|
||||||
break;
|
|
||||||
}
|
}
|
||||||
case 2:
|
AddSpeed(a_TDI.Knockback + AdditionalSpeed);
|
||||||
{
|
|
||||||
additionalSpeed.Set(8, .3, 8);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
default:
|
|
||||||
{
|
|
||||||
additionalSpeed.Set(2, .3, 2);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
AddSpeed(a_TDI.Knockback * additionalSpeed);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
m_World->BroadcastEntityStatus(*this, esGenericHurt);
|
m_World->BroadcastEntityStatus(*this, esGenericHurt);
|
||||||
|
@ -369,7 +358,7 @@ bool cEntity::DoTakeDamage(TakeDamageInfo & a_TDI)
|
||||||
|
|
||||||
if (m_Health <= 0)
|
if (m_Health <= 0)
|
||||||
{
|
{
|
||||||
KilledBy(a_TDI.Attacker);
|
KilledBy(a_TDI);
|
||||||
|
|
||||||
if (a_TDI.Attacker != NULL)
|
if (a_TDI.Attacker != NULL)
|
||||||
{
|
{
|
||||||
|
@ -432,6 +421,7 @@ bool cEntity::ArmorCoversAgainst(eDamageType a_DamageType)
|
||||||
case dtStarving:
|
case dtStarving:
|
||||||
case dtInVoid:
|
case dtInVoid:
|
||||||
case dtPoisoning:
|
case dtPoisoning:
|
||||||
|
case dtWithering:
|
||||||
case dtPotionOfHarming:
|
case dtPotionOfHarming:
|
||||||
case dtFalling:
|
case dtFalling:
|
||||||
case dtLightning:
|
case dtLightning:
|
||||||
|
@ -525,11 +515,11 @@ double cEntity::GetKnockbackAmountAgainst(const cEntity & a_Receiver)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
void cEntity::KilledBy(cEntity * a_Killer)
|
void cEntity::KilledBy(TakeDamageInfo & a_TDI)
|
||||||
{
|
{
|
||||||
m_Health = 0;
|
m_Health = 0;
|
||||||
|
|
||||||
cRoot::Get()->GetPluginManager()->CallHookKilling(*this, a_Killer);
|
cRoot::Get()->GetPluginManager()->CallHookKilling(*this, a_TDI.Attacker, a_TDI);
|
||||||
|
|
||||||
if (m_Health > 0)
|
if (m_Health > 0)
|
||||||
{
|
{
|
||||||
|
@ -539,7 +529,7 @@ void cEntity::KilledBy(cEntity * a_Killer)
|
||||||
|
|
||||||
// Drop loot:
|
// Drop loot:
|
||||||
cItems Drops;
|
cItems Drops;
|
||||||
GetDrops(Drops, a_Killer);
|
GetDrops(Drops, a_TDI.Attacker);
|
||||||
m_World->SpawnItemPickups(Drops, GetPosX(), GetPosY(), GetPosZ());
|
m_World->SpawnItemPickups(Drops, GetPosX(), GetPosY(), GetPosZ());
|
||||||
|
|
||||||
m_World->BroadcastEntityStatus(*this, esGenericDead);
|
m_World->BroadcastEntityStatus(*this, esGenericDead);
|
||||||
|
@ -765,10 +755,10 @@ void cEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk)
|
||||||
NextSpeed.z *= 0.25;
|
NextSpeed.z *= 0.25;
|
||||||
}
|
}
|
||||||
|
|
||||||
//Get water direction
|
// Get water direction
|
||||||
Direction WaterDir = m_World->GetWaterSimulator()->GetFlowingDirection(BlockX, BlockY, BlockZ);
|
Direction WaterDir = m_World->GetWaterSimulator()->GetFlowingDirection(BlockX, BlockY, BlockZ);
|
||||||
|
|
||||||
m_WaterSpeed *= 0.9f; //Reduce speed each tick
|
m_WaterSpeed *= 0.9f; // Reduce speed each tick
|
||||||
|
|
||||||
switch(WaterDir)
|
switch(WaterDir)
|
||||||
{
|
{
|
||||||
|
@ -1247,8 +1237,11 @@ void cEntity::HandleAir(void)
|
||||||
// Get the type of block the entity is standing in:
|
// Get the type of block the entity is standing in:
|
||||||
|
|
||||||
if (IsSubmerged())
|
if (IsSubmerged())
|
||||||
|
{
|
||||||
|
if (!IsPlayer()) // Players control themselves
|
||||||
{
|
{
|
||||||
SetSpeedY(1); // Float in the water
|
SetSpeedY(1); // Float in the water
|
||||||
|
}
|
||||||
|
|
||||||
// Either reduce air level or damage player
|
// Either reduce air level or damage player
|
||||||
if (m_AirLevel < 1)
|
if (m_AirLevel < 1)
|
||||||
|
@ -1635,7 +1628,6 @@ void cEntity::SetWidth(double a_Width)
|
||||||
void cEntity::AddPosX(double a_AddPosX)
|
void cEntity::AddPosX(double a_AddPosX)
|
||||||
{
|
{
|
||||||
m_Pos.x += a_AddPosX;
|
m_Pos.x += a_AddPosX;
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -1644,7 +1636,6 @@ void cEntity::AddPosX(double a_AddPosX)
|
||||||
void cEntity::AddPosY(double a_AddPosY)
|
void cEntity::AddPosY(double a_AddPosY)
|
||||||
{
|
{
|
||||||
m_Pos.y += a_AddPosY;
|
m_Pos.y += a_AddPosY;
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -1653,7 +1644,6 @@ void cEntity::AddPosY(double a_AddPosY)
|
||||||
void cEntity::AddPosZ(double a_AddPosZ)
|
void cEntity::AddPosZ(double a_AddPosZ)
|
||||||
{
|
{
|
||||||
m_Pos.z += a_AddPosZ;
|
m_Pos.z += a_AddPosZ;
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -1664,7 +1654,6 @@ void cEntity::AddPosition(double a_AddPosX, double a_AddPosY, double a_AddPosZ)
|
||||||
m_Pos.x += a_AddPosX;
|
m_Pos.x += a_AddPosX;
|
||||||
m_Pos.y += a_AddPosY;
|
m_Pos.y += a_AddPosY;
|
||||||
m_Pos.z += a_AddPosZ;
|
m_Pos.z += a_AddPosZ;
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
@ -1741,7 +1730,7 @@ void cEntity::SteerVehicle(float a_Forward, float a_Sideways)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
//////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// Get look vector (this is NOT a rotation!)
|
// Get look vector (this is NOT a rotation!)
|
||||||
Vector3d cEntity::GetLookVector(void) const
|
Vector3d cEntity::GetLookVector(void) const
|
||||||
{
|
{
|
||||||
|
@ -1755,7 +1744,7 @@ Vector3d cEntity::GetLookVector(void) const
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
//////////////////////////////////////////////////////////////////////////
|
////////////////////////////////////////////////////////////////////////////////
|
||||||
// Set position
|
// Set position
|
||||||
void cEntity::SetPosition(double a_PosX, double a_PosY, double a_PosZ)
|
void cEntity::SetPosition(double a_PosX, double a_PosY, double a_PosZ)
|
||||||
{
|
{
|
||||||
|
|
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue
Block a user