For each strategy, evaluate the table rows from top downwards, the first match wins.
+
+ The spread carries with it the type of its source - whether it's a block spreads.
+ It also carries the identification of the actual source. The exact type of the identification
+ depends on the source kind:
+
+
Setting up the ZeroBrane Studio IDE
+
+ This article will explain how to set up ZeroBrane Studio, an IDE for writing Lua code, so that you can develop MCServer plugins with the comfort of an IDE.
+
+
+
+
To quickly introduce ZeroBrane Studio, it is an IDE for writing Lua code. It has the basic features expected of an IDE - it allows you to manage groups of files as a project, you can edit multiple files in a tabbed editor, the code is syntax-highlighted. Code completion, symbol browsing, and more. It also features a Lua debugger that allows you to debug your Lua code within any application that uses Lua and can load Lua packages. It is written using the multiplatform WxWidgets toolkit, and runs on multiple platforms, including Windows, Linux and MacOS.
+
Here's a screenshot of a default ZBS window with the debugger stepping through the code (scaled down):
+
As you can see, you can set breakpoints in the code, inspect variables' values, view the Lua call-stacks.
+
ZBS is open-source, the sources are on GitHub: https://github.com/pkulchenko/ZeroBraneStudio . The project's homepage is at http://studio.zerobrane.com/ .
+
+
+
Since ZBS is a universal Lua IDE, you need to first set it up so that it is ready for MCS plugin development. For that, you need to download one file, mcserver.lua from the ZBS's plugin repository . Place that file in the "packages" folder inside your ZBS's folder. Note that there are other useful plugins in the repository and you may want to have a look there later on to further customize your ZBS. To install them, simply save them into the same folder.
+
Next you should install the code-completion support specific for MCServer. You should repeat this step from time to time, because the API evolves in time so new functions and classes are added to it quite often. You should have an APIDump plugin in your MCServer installation. Enable the APIDump plugin in the server settings, it's very cheap to keep it enabled and it doesn't cost any performance during normal gameplay. To generate the code-completion support file, enter the api command into the server console. This will create a new file, "mcserver_api.lua", next to the MCS executable. Move that file into the "api/lua" subfolder inside your ZBS's folder.
+
After you download the mcserver.lua file and install the completion support, you need to restart ZBS in order for the plugin to load. If there are no errors, you should see two new items in the Project -> Lua Interpreter submenu: "MCServer - debug mode" and "MCServer - release mode". The only difference between the two is which filename they use to launch MCServer - mcserver_debug(.exe) for the debug option and "mcserver(.exe)" for the release option. If you built your own MCServer executable and you built it in debug mode, you should select the debug mode option. In all other cases, including if you downloaded the already-compiled MCServer executable from the internet, you should select the release mode option.
+
For a first time user, it might be a bit overwhelming that there are no GUI settings in the ZBS, yet the IDE is very configurable. There are two files that you edit in order to change settings, either system-wide (all users of the computer share those settings) or user-wide (the settings are only for a specific user of the computer). Those files are regular Lua sources and you can quickly locate them and edit them from within the IDE itself, select Edit -> Preferences -> Settings: XYZ from the menu, with XYZ being either System or User.
+
There is a documentation on most of the settings on ZBS's webpage, have a look at http://studio.zerobrane.com/documentation.html , especially the Preferences section. Personally I recommend setting editor.usetabs to true and possibly adjusting the editor.tabwidth, turn off the editor.smartindent feature and for debugging the option debugger.alloweditting should be set to true unless you feel like punishing yourself.
+
+
+
ZBS works with projects, it considers all files and subfolder in a specific folder to be a project. There's no need for a special project file nor for adding individual files to the workspace, all files are added automatically. To open a MCS plugin as the project, click the triple-dot button in the Project pane, or select Project -> Project directory -> Choose... from the menu. Browse and select the MCS plugin's folder. ZBS will load all the files in the plugin's folder and you can start editting code.
+
Note that although ZBS allows you to work with subfolders in your plugins (and you should, especially with larger plugins), the current mcserver ZBS plugin will not be able to start debugging unless you have a file open in the editor that is at the root level of the MCS plugin's folder.
+
+
+
You are now ready to debug your code. Before doing that, though, don't forget to save your project files. If you haven't done so already, enable your plugin in the settings.ini file. If you want the program to break at a certain line, it is best to set the breakpoint before starting the program. Set the cursor on the line and hit F9 (or use menu Project -> Toggle Breakpoint) to toggle a breakpoint on that line. Finally, hit F5, or select menu Project -> Start Debugging to launch MCServer under the debugger. The MCServer window comes up and loads your plugin. If the window doesn't come up, inspect the Output pane in ZBS, there are usually two reasons for failure:
+ Your code in the currently open file has a hard syntax error. These are reported as "Compilation error" in the Output pane, double-click the line to go to the error
+ ZBS cannot find the MCServer executable. Make sure you are editting a file two levels down the folder hierarchy from the MCS executable and that the MCS executable is named properly (mcserver[.exe] or mcserver_debug[.exe]). Also make sure you have selected the right Interpreter (menu Project -> Lua Interpreter).
+
+
Once running, if the execution hits a breakpoint, the ZBS window will come up and a green arrow is displayed next to the breakpoint line. You can step through the code using F10 (Step Into) and Shift+F10 (Step Over). You can also use the Watch window to inspect variable values, or simply hover your mouse over a variable to display its value in the tooltip. Use the Remote console pane to execute commands directly *inside* the MCServer's plugin context.
+
You can also use the Project -> Break menu item to break into the debugger as soon as possible. You can also set breakpoints while the MCS plugin is running. Note that due to the way in which the debugger is implemented, MCS may execute some more Lua code before the break / breakpoint comes into effect. If MCS is not executing any Lua code in your plugin, it will not break until the plugin code kicks in again. This may result in missed breakpoints and delays before the Break command becomes effective. Therefore it's best to set breakpoints before running the program, or while the program is waiting in another breakpoint.
+
]]);
- for i, extra in ipairs(g_APIDesc.ExtraPages) do
+ for _, extra in ipairs(g_APIDesc.ExtraPages) do
local SrcFileName = g_PluginFolder .. "/" .. extra.FileName;
if (cFile:Exists(SrcFileName)) then
local DstFileName = "API/" .. extra.FileName;
@@ -279,590 +171,8 @@ end
-local function WriteClasses(f, a_API, a_ClassMenu)
- f:write([[
- Class index The following classes are available in the MCServer Lua scripting language:
-
- ]]);
- for i, cls in ipairs(a_API) do
- f:write("", cls.Name, "
- Hooks
- A plugin can register to be called whenever an "interesting event" occurs. It does so by calling
- cPluginManager 's AddHook() function and implementing a callback
- function to handle the event.
-
- A plugin can decide whether it will let the event pass through to the rest of the plugins, or hide it
- from them. This is determined by the return value from the hook callback function. If the function
- returns false or no value, the event is propagated further. If the function returns true, the processing
- is stopped, no other plugin receives the notification (and possibly MCServer disables the default
- behavior for the event). See each hook's details to see the exact behavior.
-
-
- Hook name
- Called when
-
- ]]);
- for i, hook in ipairs(a_Hooks) do
- if (hook.DefaultFnName == nil) then
- -- The hook is not documented yet
- f:write(" \n " .. hook.Name .. " \n (No documentation yet) \n");
- table.insert(a_UndocumentedHooks, hook.Name);
- else
- f:write(" \n " .. hook.Name .. " " .. LinkifyString(hook.CalledWhen, hook.Name) .. " \n \n");
- WriteHtmlHook(hook, a_HookNav);
- end
- end
- f:write([[
-
- ");
- table.insert(ClassMenuTab, cls.Name);
- table.insert(ClassMenuTab, " ");
- table.insert(HookNavTab, (hook.Name:gsub("^HOOK_", ""))); -- remove the "HOOK_" part of the name
- table.insert(HookNavTab, " MCServer API - Index
-
-
- MCServer API - Index
-
-
The API reference is divided into the following sections:
-
-
- ]]);
-
- WriteArticles(f);
- WriteClasses(f, API, ClassMenu);
- WriteHooks(f, Hooks, UndocumentedHooks, HookNav);
-
- -- Copy the static files to the output folder:
- local StaticFiles =
- {
- "main.css",
- "prettify.js",
- "prettify.css",
- "lang-lua.js",
- };
- for idx, fnam in ipairs(StaticFiles) do
- cFile:Delete("API/" .. fnam);
- cFile:Copy(g_Plugin:GetLocalFolder() .. "/" .. fnam, "API/" .. fnam);
- end
-
- -- List the documentation problems:
- LOG("Listing leftovers...");
- ListUndocumentedObjects(API, UndocumentedHooks);
- ListUnexportedObjects();
- ListMissingPages();
-
- WriteStats(f);
-
- f:write([[
-
(constructor) ";
- elseif (fn.Name == ".add") then
- fn.DocID = "operator_plus";
- fn.Name = "operator + ";
- elseif (fn.Name == ".div") then
- fn.DocID = "operator_div";
- fn.Name = "operator / ";
- elseif (fn.Name == ".mul") then
- fn.DocID = "operator_mul";
- fn.Name = "operator * ";
- elseif (fn.Name == ".sub") then
- fn.DocID = "operator_sub";
- fn.Name = "operator - ";
- elseif (fn.Name == ".eq") then
- fn.DocID = "operator_eq";
- fn.Name = "operator == ";
- end
- end
-
- local APIDesc = g_APIDesc.Classes[cls.Name];
- if (APIDesc ~= nil) then
- APIDesc.IsExported = true;
- cls.Desc = APIDesc.Desc;
- cls.AdditionalInfo = APIDesc.AdditionalInfo;
-
- -- Process inheritance:
- if (APIDesc.Inherits ~= nil) then
- for j, icls in ipairs(a_API) do
- if (icls.Name == APIDesc.Inherits) then
- table.insert(icls.Descendants, cls);
- cls.Inherits = icls;
- end
- end
- end
-
- cls.UndocumentedFunctions = {}; -- This will contain names of all the functions that are not documented
- cls.UndocumentedConstants = {}; -- This will contain names of all the constants that are not documented
- cls.UndocumentedVariables = {}; -- This will contain names of all the variables that are not documented
-
- local DoxyFunctions = {}; -- This will contain all the API functions together with their documentation
-
- local function AddFunction(a_Name, a_Params, a_Return, a_Notes)
- table.insert(DoxyFunctions, {Name = a_Name, Params = a_Params, Return = a_Return, Notes = a_Notes});
- end
-
- if (APIDesc.Functions ~= nil) then
- -- Assign function descriptions:
- for j, func in ipairs(cls.Functions) do
- local FnName = func.DocID or func.Name;
- local FnDesc = APIDesc.Functions[FnName];
- if (FnDesc == nil) then
- -- No description for this API function
- AddFunction(func.Name);
- if not(IsFunctionIgnored(cls.Name, FnName)) then
- table.insert(cls.UndocumentedFunctions, FnName);
- end
- else
- -- Description is available
- if (FnDesc[1] == nil) then
- -- Single function definition
- AddFunction(func.Name, FnDesc.Params, FnDesc.Return, FnDesc.Notes);
- else
- -- Multiple function overloads
- for k, desc in ipairs(FnDesc) do
- AddFunction(func.Name, desc.Params, desc.Return, desc.Notes);
- end -- for k, desc - FnDesc[]
- end
- FnDesc.IsExported = true;
- end
- end -- for j, func
-
- -- Replace functions with their described and overload-expanded versions:
- cls.Functions = DoxyFunctions;
- else -- if (APIDesc.Functions ~= nil)
- for j, func in ipairs(cls.Functions) do
- local FnName = func.DocID or func.Name;
- if not(IsFunctionIgnored(cls.Name, FnName)) then
- table.insert(cls.UndocumentedFunctions, FnName);
- end
- end
- end -- if (APIDesc.Functions ~= nil)
-
- if (APIDesc.Constants ~= nil) then
- -- Assign constant descriptions:
- for j, cons in ipairs(cls.Constants) do
- local CnDesc = APIDesc.Constants[cons.Name];
- if (CnDesc == nil) then
- -- Not documented
- if not(IsConstantIgnored(cls.Name .. "." .. cons.Name)) then
- table.insert(cls.UndocumentedConstants, cons.Name);
- end
- else
- cons.Notes = CnDesc.Notes;
- CnDesc.IsExported = true;
- end
- end -- for j, cons
- else -- if (APIDesc.Constants ~= nil)
- for j, cons in ipairs(cls.Constants) do
- if not(IsConstantIgnored(cls.Name .. "." .. cons.Name)) then
- table.insert(cls.UndocumentedConstants, cons.Name);
- end
- end
- end -- else if (APIDesc.Constants ~= nil)
-
- -- Assign member variables' descriptions:
- if (APIDesc.Variables ~= nil) then
- for j, var in ipairs(cls.Variables) do
- local VarDesc = APIDesc.Variables[var.Name];
- if (VarDesc == nil) then
- -- Not documented
- if not(IsVariableIgnored(cls.Name .. "." .. var.Name)) then
- table.insert(cls.UndocumentedVariables, var.Name);
- end
- else
- -- Copy all documentation:
- for k, v in pairs(VarDesc) do
- var[k] = v
- end
- end
- end -- for j, var
- else -- if (APIDesc.Variables ~= nil)
- for j, var in ipairs(cls.Variables) do
- if not(IsVariableIgnored(cls.Name .. "." .. var.Name)) then
- table.insert(cls.UndocumentedVariables, var.Name);
- end
- end
- end -- else if (APIDesc.Variables ~= nil)
-
- if (APIDesc.ConstantGroups ~= nil) then
- -- Create links between the constants and the groups:
- local NumInGroups = 0;
- local NumInDescendantGroups = 0;
- for j, group in pairs(APIDesc.ConstantGroups) do
- group.Name = j;
- group.Constants = {};
- if (type(group.Include) == "string") then
- group.Include = { group.Include };
- end
- local NumInGroup = 0;
- for idx, incl in ipairs(group.Include or {}) do
- for cidx, cons in ipairs(cls.Constants) do
- if ((cons.Group == nil) and cons.Name:match(incl)) then
- cons.Group = group;
- table.insert(group.Constants, cons);
- NumInGroup = NumInGroup + 1;
- end
- end -- for cidx - cls.Constants[]
- end -- for idx - group.Include[]
- NumInGroups = NumInGroups + NumInGroup;
- if (group.ShowInDescendants) then
- NumInDescendantGroups = NumInDescendantGroups + NumInGroup;
- end
-
- -- Sort the constants:
- table.sort(group.Constants,
- function(c1, c2)
- return (c1.Name < c2.Name);
- end
- );
- end -- for j - APIDesc.ConstantGroups[]
- cls.ConstantGroups = APIDesc.ConstantGroups;
- cls.NumConstantsInGroups = NumInGroups;
- cls.NumConstantsInGroupsForDescendants = NumInDescendantGroups;
-
- -- Remove grouped constants from the normal list:
- local NewConstants = {};
- for idx, cons in ipairs(cls.Constants) do
- if (cons.Group == nil) then
- table.insert(NewConstants, cons);
- end
- end
- cls.Constants = NewConstants;
- end -- if (ConstantGroups ~= nil)
-
- else -- if (APIDesc ~= nil)
-
- -- Class is not documented at all, add all its members to Undocumented lists:
- cls.UndocumentedFunctions = {};
- cls.UndocumentedConstants = {};
- cls.UndocumentedVariables = {};
- cls.Variables = cls.Variables or {};
- g_Stats.NumUndocumentedClasses = g_Stats.NumUndocumentedClasses + 1;
- for j, func in ipairs(cls.Functions) do
- local FnName = func.DocID or func.Name;
- if not(IsFunctionIgnored(cls.Name, FnName)) then
- table.insert(cls.UndocumentedFunctions, FnName);
- end
- end -- for j, func - cls.Functions[]
- for j, cons in ipairs(cls.Constants) do
- if not(IsConstantIgnored(cls.Name .. "." .. cons.Name)) then
- table.insert(cls.UndocumentedConstants, cons.Name);
- end
- end -- for j, cons - cls.Constants[]
- for j, var in ipairs(cls.Variables) do
- if not(IsConstantIgnored(cls.Name .. "." .. var.Name)) then
- table.insert(cls.UndocumentedVariables, var.Name);
- end
- end -- for j, var - cls.Variables[]
- end -- else if (APIDesc ~= nil)
-
- -- Remove ignored functions:
- local NewFunctions = {};
- for j, fn in ipairs(cls.Functions) do
- if (not(IsFunctionIgnored(cls.Name, fn.Name))) then
- table.insert(NewFunctions, fn);
- end
- end -- for j, fn
- cls.Functions = NewFunctions;
-
- -- Sort the functions (they may have been renamed):
- table.sort(cls.Functions,
- function(f1, f2)
- if (f1.Name == f2.Name) then
- -- Same name, either comparing the same function to itself, or two overloads, in which case compare the params
- if ((f1.Params == nil) or (f2.Params == nil)) then
- return 0;
- end
- return (f1.Params < f2.Params);
- end
- return (f1.Name < f2.Name);
- end
- );
-
- -- Remove ignored constants:
- local NewConstants = {};
- for j, cn in ipairs(cls.Constants) do
- if (not(IsFunctionIgnored(cls.Name, cn.Name))) then
- table.insert(NewConstants, cn);
- end
- end -- for j, cn
- cls.Constants = NewConstants;
-
- -- Sort the constants:
- table.sort(cls.Constants,
- function(c1, c2)
- return (c1.Name < c2.Name);
- end
- );
-
- -- Remove ignored member variables:
- local NewVariables = {};
- for j, var in ipairs(cls.Variables) do
- if (not(IsVariableIgnored(cls.Name .. "." .. var.Name))) then
- table.insert(NewVariables, var);
- end
- end -- for j, var
- cls.Variables = NewVariables;
-
- -- Sort the member variables:
- table.sort(cls.Variables,
- function(v1, v2)
- return (v1.Name < v2.Name);
- end
- );
- end -- for i, cls
-
- -- Sort the descendants lists:
- for i, cls in ipairs(a_API) do
- table.sort(cls.Descendants,
- function(c1, c2)
- return (c1.Name < c2.Name);
- end
- );
- end -- for i, cls
-end
-
-
-
-
-
-function ReadHooks(a_Hooks)
- --[[
- a_Hooks = {
- { Name = "HOOK_1"},
- { Name = "HOOK_2"},
- ...
- };
- We want to add hook descriptions to each hook in this array
- --]]
- for i, hook in ipairs(a_Hooks) do
- local HookDesc = g_APIDesc.Hooks[hook.Name];
- if (HookDesc ~= nil) then
- for key, val in pairs(HookDesc) do
- hook[key] = val;
- end
- end
- end -- for i, hook - a_Hooks[]
- g_Stats.NumTotalHooks = #a_Hooks;
-end
-
-
-
-
-
-- Make a link out of anything with the special linkifying syntax {{link|title}}
-function LinkifyString(a_String, a_Referrer)
+local function LinkifyString(a_String, a_Referrer)
assert(a_Referrer ~= nil);
assert(a_Referrer ~= "");
@@ -915,9 +225,494 @@ end
-function WriteHtmlClass(a_ClassAPI, a_AllAPI, a_ClassMenu)
+local function WriteHtmlHook(a_Hook, a_HookNav)
+ local fnam = "API/" .. a_Hook.DefaultFnName .. ".html";
+ local f, error = io.open(fnam, "w");
+ if (f == nil) then
+ LOG("Cannot write \"" .. fnam .. "\": \"" .. error .. "\".");
+ return;
+ end
+ local HookName = a_Hook.DefaultFnName;
+
+ f:write([[
+
+ MCServer API - ]], HookName, [[ Hook
+
+
+ ]], a_Hook.Name, [[
+
+
+ Index:Articles Classes Hooks
+ ]]);
+ f:write(LinkifyString(a_Hook.Desc, HookName));
+ f:write("
\nCallback function \nThe default name for the callback function is ");
+ f:write(a_Hook.DefaultFnName, ". It has the following signature:\n");
+ f:write("
function ", HookName, "(");
+ if (a_Hook.Params == nil) then
+ a_Hook.Params = {};
+ end
+ for i, param in ipairs(a_Hook.Params) do
+ if (i > 1) then
+ f:write(", ");
+ end
+ f:write(param.Name);
+ end
+ f:write(") \nParameters: \nName Type Notes ", param.Name, " ", LinkifyString(param.Type, HookName), " ", LinkifyString(param.Notes, HookName), "
\n" .. (a_Hook.Returns or "") .. "
\n\n");
+ f:write([[Code examples Registering the callback ]]);
+ f:write("\n");
+ f:write([[cPluginManager:AddHook(cPluginManager.]] .. a_Hook.Name .. ", My" .. a_Hook.DefaultFnName .. [[);]]);
+ f:write(" \n\n");
+ local Examples = a_Hook.CodeExamples or {};
+ for _, example in ipairs(Examples) do
+ f:write("", (example.Title or "missing Title "), " \n");
+ f:write("", (example.Desc or "missing Desc "), "
\n");
+ f:write("", (example.Code or "missing Code "), "\n \n\n");
+ end
+ f:write([[
Hooks
+ A plugin can register to be called whenever an "interesting event" occurs. It does so by calling
+ cPluginManager 's AddHook() function and implementing a callback
+ function to handle the event.
+
+ A plugin can decide whether it will let the event pass through to the rest of the plugins, or hide it
+ from them. This is determined by the return value from the hook callback function. If the function
+ returns false or no value, the event is propagated further. If the function returns true, the processing
+ is stopped, no other plugin receives the notification (and possibly MCServer disables the default
+ behavior for the event). See each hook's details to see the exact behavior.
+
+
+ Hook name
+ Called when
+
+ ]]);
+ for _, hook in ipairs(a_Hooks) do
+ if (hook.DefaultFnName == nil) then
+ -- The hook is not documented yet
+ f:write(" \n " .. hook.Name .. " \n (No documentation yet) \n");
+ table.insert(a_UndocumentedHooks, hook.Name);
+ else
+ f:write(" \n " .. hook.Name .. " " .. LinkifyString(hook.CalledWhen, hook.Name) .. " \n \n");
+ WriteHtmlHook(hook, a_HookNav);
+ end
+ end
+ f:write([[
+
+ (constructor) ";
+ elseif (fn.Name == ".add") then
+ fn.DocID = "operator_plus";
+ fn.Name = "operator + ";
+ elseif (fn.Name == ".div") then
+ fn.DocID = "operator_div";
+ fn.Name = "operator / ";
+ elseif (fn.Name == ".mul") then
+ fn.DocID = "operator_mul";
+ fn.Name = "operator * ";
+ elseif (fn.Name == ".sub") then
+ fn.DocID = "operator_sub";
+ fn.Name = "operator - ";
+ elseif (fn.Name == ".eq") then
+ fn.DocID = "operator_eq";
+ fn.Name = "operator == ";
+ end
+ end
+
+ local APIDesc = g_APIDesc.Classes[cls.Name];
+ if (APIDesc ~= nil) then
+ APIDesc.IsExported = true;
+ cls.Desc = APIDesc.Desc;
+ cls.AdditionalInfo = APIDesc.AdditionalInfo;
+
+ -- Process inheritance:
+ if (APIDesc.Inherits ~= nil) then
+ for _, icls in ipairs(a_API) do
+ if (icls.Name == APIDesc.Inherits) then
+ table.insert(icls.Descendants, cls);
+ cls.Inherits = icls;
+ end
+ end
+ end
+
+ cls.UndocumentedFunctions = {}; -- This will contain names of all the functions that are not documented
+ cls.UndocumentedConstants = {}; -- This will contain names of all the constants that are not documented
+ cls.UndocumentedVariables = {}; -- This will contain names of all the variables that are not documented
+
+ local DoxyFunctions = {}; -- This will contain all the API functions together with their documentation
+
+ local function AddFunction(a_Name, a_Params, a_Return, a_Notes)
+ table.insert(DoxyFunctions, {Name = a_Name, Params = a_Params, Return = a_Return, Notes = a_Notes});
+ end
+
+ if (APIDesc.Functions ~= nil) then
+ -- Assign function descriptions:
+ for _, func in ipairs(cls.Functions) do
+ local FnName = func.DocID or func.Name;
+ local FnDesc = APIDesc.Functions[FnName];
+ if (FnDesc == nil) then
+ -- No description for this API function
+ AddFunction(func.Name);
+ if not(IsFunctionIgnored(cls.Name, FnName)) then
+ table.insert(cls.UndocumentedFunctions, FnName);
+ end
+ else
+ -- Description is available
+ if (FnDesc[1] == nil) then
+ -- Single function definition
+ AddFunction(func.Name, FnDesc.Params, FnDesc.Return, FnDesc.Notes);
+ else
+ -- Multiple function overloads
+ for _, desc in ipairs(FnDesc) do
+ AddFunction(func.Name, desc.Params, desc.Return, desc.Notes);
+ end -- for k, desc - FnDesc[]
+ end
+ FnDesc.IsExported = true;
+ end
+ end -- for j, func
+
+ -- Replace functions with their described and overload-expanded versions:
+ cls.Functions = DoxyFunctions;
+ else -- if (APIDesc.Functions ~= nil)
+ for _, func in ipairs(cls.Functions) do
+ local FnName = func.DocID or func.Name;
+ if not(IsFunctionIgnored(cls.Name, FnName)) then
+ table.insert(cls.UndocumentedFunctions, FnName);
+ end
+ end
+ end -- if (APIDesc.Functions ~= nil)
+
+ if (APIDesc.Constants ~= nil) then
+ -- Assign constant descriptions:
+ for _, cons in ipairs(cls.Constants) do
+ local CnDesc = APIDesc.Constants[cons.Name];
+ if (CnDesc == nil) then
+ -- Not documented
+ if not(IsConstantIgnored(cls.Name .. "." .. cons.Name)) then
+ table.insert(cls.UndocumentedConstants, cons.Name);
+ end
+ else
+ cons.Notes = CnDesc.Notes;
+ CnDesc.IsExported = true;
+ end
+ end -- for j, cons
+ else -- if (APIDesc.Constants ~= nil)
+ for _, cons in ipairs(cls.Constants) do
+ if not(IsConstantIgnored(cls.Name .. "." .. cons.Name)) then
+ table.insert(cls.UndocumentedConstants, cons.Name);
+ end
+ end
+ end -- else if (APIDesc.Constants ~= nil)
+
+ -- Assign member variables' descriptions:
+ if (APIDesc.Variables ~= nil) then
+ for _, var in ipairs(cls.Variables) do
+ local VarDesc = APIDesc.Variables[var.Name];
+ if (VarDesc == nil) then
+ -- Not documented
+ if not(IsVariableIgnored(cls.Name .. "." .. var.Name)) then
+ table.insert(cls.UndocumentedVariables, var.Name);
+ end
+ else
+ -- Copy all documentation:
+ for k, v in pairs(VarDesc) do
+ var[k] = v
+ end
+ end
+ end -- for j, var
+ else -- if (APIDesc.Variables ~= nil)
+ for _, var in ipairs(cls.Variables) do
+ if not(IsVariableIgnored(cls.Name .. "." .. var.Name)) then
+ table.insert(cls.UndocumentedVariables, var.Name);
+ end
+ end
+ end -- else if (APIDesc.Variables ~= nil)
+
+ if (APIDesc.ConstantGroups ~= nil) then
+ -- Create links between the constants and the groups:
+ local NumInGroups = 0;
+ local NumInDescendantGroups = 0;
+ for j, group in pairs(APIDesc.ConstantGroups) do
+ group.Name = j;
+ group.Constants = {};
+ if (type(group.Include) == "string") then
+ group.Include = { group.Include };
+ end
+ local NumInGroup = 0;
+ for _, incl in ipairs(group.Include or {}) do
+ for _, cons in ipairs(cls.Constants) do
+ if ((cons.Group == nil) and cons.Name:match(incl)) then
+ cons.Group = group;
+ table.insert(group.Constants, cons);
+ NumInGroup = NumInGroup + 1;
+ end
+ end -- for cidx - cls.Constants[]
+ end -- for idx - group.Include[]
+ NumInGroups = NumInGroups + NumInGroup;
+ if (group.ShowInDescendants) then
+ NumInDescendantGroups = NumInDescendantGroups + NumInGroup;
+ end
+
+ -- Sort the constants:
+ table.sort(group.Constants,
+ function(c1, c2)
+ return (c1.Name < c2.Name);
+ end
+ );
+ end -- for j - APIDesc.ConstantGroups[]
+ cls.ConstantGroups = APIDesc.ConstantGroups;
+ cls.NumConstantsInGroups = NumInGroups;
+ cls.NumConstantsInGroupsForDescendants = NumInDescendantGroups;
+
+ -- Remove grouped constants from the normal list:
+ local NewConstants = {};
+ for _, cons in ipairs(cls.Constants) do
+ if (cons.Group == nil) then
+ table.insert(NewConstants, cons);
+ end
+ end
+ cls.Constants = NewConstants;
+ end -- if (ConstantGroups ~= nil)
+
+ else -- if (APIDesc ~= nil)
+
+ -- Class is not documented at all, add all its members to Undocumented lists:
+ cls.UndocumentedFunctions = {};
+ cls.UndocumentedConstants = {};
+ cls.UndocumentedVariables = {};
+ cls.Variables = cls.Variables or {};
+ g_Stats.NumUndocumentedClasses = g_Stats.NumUndocumentedClasses + 1;
+ for _, func in ipairs(cls.Functions) do
+ local FnName = func.DocID or func.Name;
+ if not(IsFunctionIgnored(cls.Name, FnName)) then
+ table.insert(cls.UndocumentedFunctions, FnName);
+ end
+ end -- for j, func - cls.Functions[]
+ for _, cons in ipairs(cls.Constants) do
+ if not(IsConstantIgnored(cls.Name .. "." .. cons.Name)) then
+ table.insert(cls.UndocumentedConstants, cons.Name);
+ end
+ end -- for j, cons - cls.Constants[]
+ for _, var in ipairs(cls.Variables) do
+ if not(IsConstantIgnored(cls.Name .. "." .. var.Name)) then
+ table.insert(cls.UndocumentedVariables, var.Name);
+ end
+ end -- for j, var - cls.Variables[]
+ end -- else if (APIDesc ~= nil)
+
+ -- Remove ignored functions:
+ local NewFunctions = {};
+ for _, fn in ipairs(cls.Functions) do
+ if (not(IsFunctionIgnored(cls.Name, fn.Name))) then
+ table.insert(NewFunctions, fn);
+ end
+ end -- for j, fn
+ cls.Functions = NewFunctions;
+
+ -- Sort the functions (they may have been renamed):
+ table.sort(cls.Functions,
+ function(f1, f2)
+ if (f1.Name == f2.Name) then
+ -- Same name, either comparing the same function to itself, or two overloads, in which case compare the params
+ if ((f1.Params == nil) or (f2.Params == nil)) then
+ return 0;
+ end
+ return (f1.Params < f2.Params);
+ end
+ return (f1.Name < f2.Name);
+ end
+ );
+
+ -- Remove ignored constants:
+ local NewConstants = {};
+ for _, cn in ipairs(cls.Constants) do
+ if (not(IsFunctionIgnored(cls.Name, cn.Name))) then
+ table.insert(NewConstants, cn);
+ end
+ end -- for j, cn
+ cls.Constants = NewConstants;
+
+ -- Sort the constants:
+ table.sort(cls.Constants,
+ function(c1, c2)
+ return (c1.Name < c2.Name);
+ end
+ );
+
+ -- Remove ignored member variables:
+ local NewVariables = {};
+ for _, var in ipairs(cls.Variables) do
+ if (not(IsVariableIgnored(cls.Name .. "." .. var.Name))) then
+ table.insert(NewVariables, var);
+ end
+ end -- for j, var
+ cls.Variables = NewVariables;
+
+ -- Sort the member variables:
+ table.sort(cls.Variables,
+ function(v1, v2)
+ return (v1.Name < v2.Name);
+ end
+ );
+ end -- for i, cls
+
+ -- Sort the descendants lists:
+ for _, cls in ipairs(a_API) do
+ table.sort(cls.Descendants,
+ function(c1, c2)
+ return (c1.Name < c2.Name);
+ end
+ );
+ end -- for i, cls
+end
+
+
+
+
+
+local function ReadHooks(a_Hooks)
+ --[[
+ a_Hooks = {
+ { Name = "HOOK_1"},
+ { Name = "HOOK_2"},
+ ...
+ };
+ We want to add hook descriptions to each hook in this array
+ --]]
+ for _, hook in ipairs(a_Hooks) do
+ local HookDesc = g_APIDesc.Hooks[hook.Name];
+ if (HookDesc ~= nil) then
+ for key, val in pairs(HookDesc) do
+ hook[key] = val;
+ end
+ end
+ end -- for i, hook - a_Hooks[]
+ g_Stats.NumTotalHooks = #a_Hooks;
+end
+
+
+
+
+
+local function WriteHtmlClass(a_ClassAPI, a_ClassMenu)
local cf, err = io.open("API/" .. a_ClassAPI.Name .. ".html", "w");
if (cf == nil) then
+ LOGINFO("Cannot write HTML API for class " .. a_ClassAPI.Name .. ": " .. err)
return;
end
@@ -931,7 +726,7 @@ function WriteHtmlClass(a_ClassAPI, a_AllAPI, a_ClassMenu)
cf:write("Functions inherited from ", a_InheritedName, " \n");
end
cf:write("\nName Parameters Return value Notes ", func.Name, " \n");
cf:write("", LinkifyString(func.Params or "", (a_InheritedName or a_ClassAPI.Name)), " \n");
cf:write("", LinkifyString(func.Return or "", (a_InheritedName or a_ClassAPI.Name)), " \n");
@@ -942,7 +737,7 @@ function WriteHtmlClass(a_ClassAPI, a_AllAPI, a_ClassMenu)
local function WriteConstantTable(a_Constants, a_Source)
cf:write("\nName Value Notes ", cons.Name, " \n");
cf:write("", cons.Value, " \n");
cf:write("", LinkifyString(cons.Notes or "", a_Source), " ");
cf:write(LinkifyString(group.TextBefore or "", Source));
@@ -985,7 +780,7 @@ function WriteHtmlClass(a_ClassAPI, a_AllAPI, a_ClassMenu)
end
cf:write("
Name Type Notes ", var.Name, " \n");
cf:write("", LinkifyString(var.Type or "(undocumented) ", a_InheritedName or a_ClassAPI.Name), " \n");
cf:write("", LinkifyString(var.Notes or "", a_InheritedName or a_ClassAPI.Name), " \n ");
+ table.insert(ClassMenuTab, cls.Name);
+ table.insert(ClassMenuTab, " ");
+ table.insert(HookNavTab, (hook.Name:gsub("^HOOK_", ""))); -- remove the "HOOK_" part of the name
+ table.insert(HookNavTab, " MCServer API - Index
+
+
+ MCServer API - Index
+
+
The API reference is divided into the following sections:
+
+
+ ]]);
+
+ WriteArticles(f);
+ WriteClasses(f, a_API, ClassMenu);
+ WriteHooks(f, Hooks, UndocumentedHooks, HookNav);
+
+ -- Copy the static files to the output folder:
+ local StaticFiles =
+ {
+ "main.css",
+ "prettify.js",
+ "prettify.css",
+ "lang-lua.js",
+ };
+ for _, fnam in ipairs(StaticFiles) do
+ cFile:Delete("API/" .. fnam);
+ cFile:Copy(g_Plugin:GetLocalFolder() .. "/" .. fnam, "API/" .. fnam);
+ end
+
+ -- List the documentation problems:
+ LOG("Listing leftovers...");
+ ListUndocumentedObjects(a_API, UndocumentedHooks);
+ ListUnexportedObjects();
+ ListMissingPages();
+
+ WriteStats(f);
+
+ f:write([[
+
", "\n")
+ res = res:gsub("
", "")
+
+ -- Replace list items with dashes:
+ res = res:gsub("", "")
+ res = res:gsub("", "\n - ")
+ res = res:gsub(" ", "")
+
+ return res
+end
+
+
+
+
+
+--- Writes a list of methods into the specified file in ZBS format
+local function WriteZBSMethods(f, a_Methods)
+ for _, func in ipairs(a_Methods or {}) do
+ f:write("\t\t\t[\"", func.Name, "\"] =\n")
+ f:write("\t\t\t{\n")
+ f:write("\t\t\t\ttype = \"method\",\n")
+ if ((func.Notes ~= nil) and (func.Notes ~= "")) then
+ f:write("\t\t\t\tdescription = [[", CleanUpDescription(func.Notes or ""), " ]],\n")
+ end
+ f:write("\t\t\t},\n")
+ end
+end
+
+
+
+
+
+--- Writes a list of constants into the specified file in ZBS format
+local function WriteZBSConstants(f, a_Constants)
+ for _, cons in ipairs(a_Constants or {}) do
+ f:write("\t\t\t[\"", cons.Name, "\"] =\n")
+ f:write("\t\t\t{\n")
+ f:write("\t\t\t\ttype = \"value\",\n")
+ if ((cons.Desc ~= nil) and (cons.Desc ~= "")) then
+ f:write("\t\t\t\tdescription = [[", CleanUpDescription(cons.Desc or ""), " ]],\n")
+ end
+ f:write("\t\t\t},\n")
+ end
+end
+
+
+
+
+
+--- Writes one MCS class definition into the specified file in ZBS format
+local function WriteZBSClass(f, a_Class)
+ assert(type(a_Class) == "table")
+
+ -- Write class header:
+ f:write("\t", a_Class.Name, " =\n\t{\n")
+ f:write("\t\ttype = \"class\",\n")
+ f:write("\t\tdescription = [[", CleanUpDescription(a_Class.Desc or ""), " ]],\n")
+ f:write("\t\tchilds =\n")
+ f:write("\t\t{\n")
+
+ -- Export methods and constants:
+ WriteZBSMethods(f, a_Class.Functions)
+ WriteZBSConstants(f, a_Class.Constants)
+
+ -- Finish the class definition:
+ f:write("\t\t},\n")
+ f:write("\t},\n\n")
+end
+
+
+
+
+
+--- Dumps the entire API table into a file in the ZBS format
+local function DumpAPIZBS(a_API)
+ LOG("Dumping ZBS API description...")
+ local f, err = io.open("mcserver_api.lua", "w")
+ if (f == nil) then
+ LOG("Cannot open mcserver_lua.lua for writing, ZBS API will not be dumped. " .. err)
+ return
+ end
+
+ -- Write the file header:
+ f:write("-- This is a MCServer API file automatically generated by the APIDump plugin\n")
+ f:write("-- Note that any manual changes will be overwritten by the next dump\n\n")
+ f:write("return {\n")
+
+ -- Export each class except Globals, store those aside:
+ local Globals
+ for _, cls in ipairs(a_API) do
+ if (cls.Name ~= "Globals") then
+ WriteZBSClass(f, cls)
+ else
+ Globals = cls
+ end
+ end
+
+ -- Export the globals:
+ if (Globals) then
+ WriteZBSMethods(f, Globals.Functions)
+ WriteZBSConstants(f, Globals.Constants)
+ end
+
+ -- Finish the file:
+ f:write("}\n")
+ f:close()
+ LOG("ZBS API dumped...")
+end
+
+
+
+
+
+local function DumpApi()
+ LOG("Dumping the API...")
+
+ -- Load the API descriptions from the Classes and Hooks subfolders:
+ -- This needs to be done each time the command is invoked because the export modifies the tables' contents
+ dofile(g_PluginFolder .. "/APIDesc.lua")
+ if (g_APIDesc.Classes == nil) then
+ g_APIDesc.Classes = {};
+ end
+ if (g_APIDesc.Hooks == nil) then
+ g_APIDesc.Hooks = {};
+ end
+ LoadAPIFiles("/Classes/", g_APIDesc.Classes);
+ LoadAPIFiles("/Hooks/", g_APIDesc.Hooks);
+
+ -- Reset the stats:
+ g_TrackedPages = {}; -- List of tracked pages, to be checked later whether they exist. Each item is an array of referring pagenames.
+ g_Stats = -- Statistics about the documentation
+ {
+ NumTotalClasses = 0,
+ NumUndocumentedClasses = 0,
+ NumTotalFunctions = 0,
+ NumUndocumentedFunctions = 0,
+ NumTotalConstants = 0,
+ NumUndocumentedConstants = 0,
+ NumTotalVariables = 0,
+ NumUndocumentedVariables = 0,
+ NumTotalHooks = 0,
+ NumUndocumentedHooks = 0,
+ NumTrackedLinks = 0,
+ NumInvalidLinks = 0,
+ }
+
+ -- Create the API tables:
+ local API, Globals = CreateAPITables();
+
+ -- Sort the classes by name:
+ table.sort(API,
+ function (c1, c2)
+ return (string.lower(c1.Name) < string.lower(c2.Name));
+ end
+ );
+ g_Stats.NumTotalClasses = #API;
+
+ -- Add Globals into the API:
+ Globals.Name = "Globals";
+ table.insert(API, Globals);
+
+ -- Read in the descriptions:
+ LOG("Reading descriptions...");
+ ReadDescriptions(API);
+
+ -- Dump all available API objects in HTML format into a subfolder:
+ DumpAPIHtml(API);
+
+ -- Dump all available API objects in format used by ZeroBraneStudio API descriptions:
+ DumpAPIZBS(API)
+
+ LOG("APIDump finished");
+ return true
+end
+
+
+
+
+
+local function HandleWebAdminDump(a_Request)
if (a_Request.PostParams["Dump"] ~= nil) then
DumpApi()
end
@@ -1467,3 +1525,32 @@ end
+
+local function HandleCmdApi(a_Split)
+ DumpApi()
+ return true
+end
+
+
+
+
+
+function Initialize(Plugin)
+ g_Plugin = Plugin;
+ g_PluginFolder = Plugin:GetLocalFolder();
+
+ LOG("Initialising " .. Plugin:GetName() .. " v." .. Plugin:GetVersion())
+
+ -- Bind a console command to dump the API:
+ cPluginManager:BindConsoleCommand("api", HandleCmdApi, "Dumps the Lua API docs into the API/ subfolder")
+
+ -- Add a WebAdmin tab that has a Dump button
+ g_Plugin:AddWebTab("APIDump", HandleWebAdminDump)
+
+ return true
+end
+
+
+
+
+
diff --git a/MCServer/Plugins/Debuggers/Debuggers.lua b/MCServer/Plugins/Debuggers/Debuggers.lua
index d2c9a2a49..064d5d772 100644
--- a/MCServer/Plugins/Debuggers/Debuggers.lua
+++ b/MCServer/Plugins/Debuggers/Debuggers.lua
@@ -27,11 +27,13 @@ function Initialize(Plugin)
PM:AddHook(cPluginManager.HOOK_CHAT, OnChat);
PM:AddHook(cPluginManager.HOOK_PLAYER_RIGHT_CLICKING_ENTITY, OnPlayerRightClickingEntity);
PM:AddHook(cPluginManager.HOOK_WORLD_TICK, OnWorldTick);
- PM:AddHook(cPluginManager.HOOK_CHUNK_GENERATED, OnChunkGenerated);
PM:AddHook(cPluginManager.HOOK_PLUGINS_LOADED, OnPluginsLoaded);
PM:AddHook(cPluginManager.HOOK_PLUGIN_MESSAGE, OnPluginMessage);
PM:AddHook(cPluginManager.HOOK_PLAYER_JOINED, OnPlayerJoined)
+ -- _X: Disabled so that the normal operation doesn't interfere with anything
+ -- PM:AddHook(cPluginManager.HOOK_CHUNK_GENERATED, OnChunkGenerated);
+
PM:BindCommand("/le", "debuggers", HandleListEntitiesCmd, "- Shows a list of all the loaded entities");
PM:BindCommand("/ke", "debuggers", HandleKillEntitiesCmd, "- Kills all the loaded entities");
PM:BindCommand("/wool", "debuggers", HandleWoolCmd, "- Sets all your armor to blue wool");
@@ -67,12 +69,22 @@ function Initialize(Plugin)
LOG("Initialized " .. Plugin:GetName() .. " v." .. Plugin:GetVersion())
- -- TestBlockAreas();
- -- TestSQLiteBindings();
- -- TestExpatBindings();
- -- TestPluginCalls();
+ -- TestBlockAreas()
+ -- TestSQLiteBindings()
+ -- TestExpatBindings()
+ -- TestPluginCalls()
TestBlockAreasString()
+ TestStringBase64()
+
+ --[[
+ -- Test cCompositeChat usage in console-logging:
+ LOGINFO(cCompositeChat("This is a simple message with some @2 color formatting @4 and http://links.to .")
+ :AddSuggestCommandPart("(Suggested command)", "cmd")
+ :AddRunCommandPart("(Run command)", "cmd")
+ :SetMessageType(mtInfo)
+ )
+ --]]
return true
end;
@@ -217,7 +229,7 @@ function TestBlockAreasString()
return
end
cFile:CreateFolder("schematics")
- local f = io.open("schematics/StringTest.schematic", "w")
+ local f = io.open("schematics/StringTest.schematic", "wb")
f:write(Data)
f:close()
@@ -230,7 +242,7 @@ function TestBlockAreasString()
BA2:Clear()
-- Load another area from a string in that file:
- f = io.open("schematics/StringTest.schematic", "r")
+ f = io.open("schematics/StringTest.schematic", "rb")
Data = f:read("*all")
if not(BA2:LoadFromSchematicString(Data)) then
LOG("Cannot load schematic from string")
@@ -241,6 +253,24 @@ end
+function TestStringBase64()
+ -- Create a binary string:
+ local s = ""
+ for i = 0, 255 do
+ s = s .. string.char(i)
+ end
+
+ -- Roundtrip through Base64:
+ local Base64 = Base64Encode(s)
+ local UnBase64 = Base64Decode(Base64)
+
+ assert(UnBase64 == s)
+end
+
+
+
+
+
function TestSQLiteBindings()
LOG("Testing SQLite bindings...");
diff --git a/MCServer/Plugins/DumpInfo/Init.lua b/MCServer/Plugins/DumpInfo/Init.lua
new file mode 100644
index 000000000..5d9c752b0
--- /dev/null
+++ b/MCServer/Plugins/DumpInfo/Init.lua
@@ -0,0 +1,49 @@
+function Initialize(a_Plugin)
+ a_Plugin:SetName("DumpInfo")
+ a_Plugin:SetVersion(1)
+
+ -- Check if the infodump file exists.
+ if (not cFile:Exists("Plugins/InfoDump.lua")) then
+ LOGWARN("[DumpInfo] InfoDump.lua was not found.")
+ return false
+ end
+
+ -- Add the webtab.
+ a_Plugin:AddWebTab("DumpPlugin", HandleDumpPluginRequest)
+ return true
+end
+
+
+
+
+
+function HandleDumpPluginRequest(a_Request)
+ local Content = ""
+
+ -- Check if it already was requested to dump a plugin.
+ if (a_Request.PostParams["DumpInfo"] ~= nil) then
+ local F = loadfile("Plugins/InfoDump.lua")
+ F("Plugins/" .. a_Request.PostParams["DumpInfo"])
+ end
+
+ Content = Content .. [[
+
+DumpInfo ]]
+
+ -- Loop through each plugin that is found.
+ for PluginName, k in pairs(cPluginManager:Get():GetAllPlugins()) do
+
+ -- Check if there is a file called 'Info.lua' or 'info.lua'
+ if (cFile:Exists("Plugins/" .. PluginName .. "/Info.lua")) then
+ Content = Content .. ""
+ Content = Content .. "" .. PluginName .. " "
+ Content = Content .. " "
+ Content = Content .. " "
+ end
+ end
+
+ Content = Content .. [[
+
]]
+
+ return Content
+end
diff --git a/MCServer/Plugins/InfoReg.lua b/MCServer/Plugins/InfoReg.lua
index 1cf68dbed..27e63aa5b 100644
--- a/MCServer/Plugins/InfoReg.lua
+++ b/MCServer/Plugins/InfoReg.lua
@@ -9,16 +9,30 @@
--- Lists all the subcommands that the player has permissions for
local function ListSubcommands(a_Player, a_Subcommands, a_CmdString)
- a_Player:SendMessage("The " .. a_CmdString .. " command requires another verb:");
+ if (a_Player == nil) then
+ LOGINFO("The " .. a_CmdString .. " command requires another verb:")
+ else
+ a_Player:SendMessage("The " .. a_CmdString .. " command requires another verb:")
+ end
+
+ -- Enum all the subcommands:
local Verbs = {};
for cmd, info in pairs(a_Subcommands) do
if (a_Player:HasPermission(info.Permission or "")) then
- table.insert(Verbs, a_CmdString .. " " .. cmd);
+ table.insert(Verbs, " " .. a_CmdString .. " " .. cmd);
end
end
table.sort(Verbs);
- for idx, verb in ipairs(Verbs) do
- a_Player:SendMessage(verb);
+
+ -- Send the list:
+ if (a_Player == nil) then
+ for idx, verb in ipairs(Verbs) do
+ LOGINFO(verb);
+ end
+ else
+ for idx, verb in ipairs(Verbs) do
+ a_Player:SendMessage(verb);
+ end
end
end
@@ -28,6 +42,7 @@ end
--- This is a generic command callback used for handling multicommands' parent commands
-- For example, if there are "/gal save" and "/gal load" commands, this callback handles the "/gal" command
+-- It is used for both console and in-game commands; the console version has a_Player set to nil
local function MultiCommandHandler(a_Split, a_Player, a_CmdString, a_CmdInfo, a_Level)
local Verb = a_Split[a_Level + 1];
if (Verb == nil) then
@@ -46,7 +61,11 @@ local function MultiCommandHandler(a_Split, a_Player, a_CmdString, a_CmdInfo, a_
if (a_Level > 1) then
-- This is a true subcommand, display the message and make MCS think the command was handled
-- Otherwise we get weird behavior: for "/cmd verb" we get "unknown command /cmd" although "/cmd" is valid
- a_Player:SendMessage("The " .. a_CmdString .. " command doesn't support verb " .. Verb);
+ if (a_Player == nil) then
+ LOGWARNING("The " .. a_CmdString .. " command doesn't support verb " .. Verb)
+ else
+ a_Player:SendMessage("The " .. a_CmdString .. " command doesn't support verb " .. Verb)
+ end
return true;
end
-- This is a top-level command, let MCS handle the unknown message
@@ -54,18 +73,20 @@ local function MultiCommandHandler(a_Split, a_Player, a_CmdString, a_CmdInfo, a_
end
-- Check the permission:
- if not(a_Player:HasPermission(Subcommand.Permission or "")) then
- a_Player:SendMessage("You don't have permission to execute this command");
- return true;
+ if (a_Player ~= nil) then
+ if not(a_Player:HasPermission(Subcommand.Permission or "")) then
+ a_Player:SendMessage("You don't have permission to execute this command");
+ return true;
+ end
end
- -- Check if the handler is valid:
+ -- If the handler is not valid, check the next sublevel:
if (Subcommand.Handler == nil) then
if (Subcommand.Subcommands == nil) then
LOG("Cannot find handler for command " .. a_CmdString .. " " .. Verb);
return false;
end
- ListSubcommands(a_Player, Subcommand.Subcommands, a_CmdString .. " " .. Verb);
+ MultiCommandHandler(a_Split, a_Player, a_CmdString .. " " .. Verb, Subcommand, a_Level + 1);
return true;
end
@@ -149,21 +170,27 @@ end
function RegisterPluginInfoConsoleCommands()
-- A sub-function that registers all subcommands of a single command, using the command's Subcommands table
-- The a_Prefix param already contains the space after the previous command
- local function RegisterSubcommands(a_Prefix, a_Subcommands)
+ local function RegisterSubcommands(a_Prefix, a_Subcommands, a_Level)
assert(a_Subcommands ~= nil);
for cmd, info in pairs(a_Subcommands) do
local CmdName = a_Prefix .. cmd;
- cPluginManager.BindConsoleCommand(cmd, info.Handler, info.HelpString or "");
+ local Handler = info.Handler
+ if (Handler == nil) then
+ Handler = function(a_Split)
+ return MultiCommandHandler(a_Split, nil, CmdName, info, a_Level);
+ end
+ end
+ cPluginManager.BindConsoleCommand(CmdName, Handler, info.HelpString or "");
-- Recursively register any subcommands:
if (info.Subcommands ~= nil) then
- RegisterSubcommands(a_Prefix .. cmd .. " ", info.Subcommands);
+ RegisterSubcommands(a_Prefix .. cmd .. " ", info.Subcommands, a_Level + 1);
end
end
end
-- Loop through all commands in the plugin info, register each:
- RegisterSubcommands("", g_PluginInfo.ConsoleCommands);
+ RegisterSubcommands("", g_PluginInfo.ConsoleCommands, 1);
end
diff --git a/SetFlags.cmake b/SetFlags.cmake
index b786da0d0..c5a3a0697 100644
--- a/SetFlags.cmake
+++ b/SetFlags.cmake
@@ -198,7 +198,7 @@ macro(set_exe_flags)
add_flags_cxx("-Wno-error=covered-switch-default -Wno-error=shadow")
add_flags_cxx("-Wno-error=exit-time-destructors -Wno-error=missing-variable-declarations")
add_flags_cxx("-Wno-error=global-constructors -Wno-implicit-fallthrough")
- add_flags_cxx("-Wno-error=unreachable-code")
+ add_flags_cxx("-Wno-weak-vtables -Wno-switch-enum -Wno-exit-time-destructors")
endif()
endif()
diff --git a/Tools/ProtoProxy/Connection.cpp b/Tools/ProtoProxy/Connection.cpp
index 46119ff42..f02b503f1 100644
--- a/Tools/ProtoProxy/Connection.cpp
+++ b/Tools/ProtoProxy/Connection.cpp
@@ -387,8 +387,6 @@ bool cConnection::RelayFromServer(void)
return CLIENTSEND(Buffer, res);
}
}
-
- return true;
}
@@ -425,8 +423,6 @@ bool cConnection::RelayFromClient(void)
return SERVERSEND(Buffer, res);
}
}
-
- return true;
}
diff --git a/Tools/ProtoProxy/Globals.h b/Tools/ProtoProxy/Globals.h
index 0724d3a52..e2f5aa860 100644
--- a/Tools/ProtoProxy/Globals.h
+++ b/Tools/ProtoProxy/Globals.h
@@ -22,6 +22,8 @@
#define ALIGN_8
#define ALIGN_16
+ #define FORMATSTRING(formatIndex, va_argsIndex)
+
#elif defined(__GNUC__)
// TODO: Can GCC explicitly mark classes as abstract (no instances can be created)?
@@ -38,7 +40,7 @@
// Some portability macros :)
#define stricmp strcasecmp
- #define FORMATSTRING(formatIndex,va_argsIndex)
+ #define FORMATSTRING(formatIndex, va_argsIndex)
#else
@@ -61,7 +63,7 @@
#define ALIGN_16
*/
- #define FORMATSTRING(formatIndex,va_argsIndex) __attribute__((format (printf, formatIndex, va_argsIndex)))
+ #define FORMATSTRING(formatIndex, va_argsIndex) __attribute__((format (printf, formatIndex, va_argsIndex)))
#endif
diff --git a/lib/tolua++/CMakeLists.txt b/lib/tolua++/CMakeLists.txt
index 5ec8ee822..e5c8ce3e8 100644
--- a/lib/tolua++/CMakeLists.txt
+++ b/lib/tolua++/CMakeLists.txt
@@ -5,6 +5,32 @@ project (tolua++)
include_directories ("${PROJECT_SOURCE_DIR}/../../src/")
include_directories ("${PROJECT_SOURCE_DIR}/include/")
include_directories ("${PROJECT_SOURCE_DIR}/../")
+include_directories ("${PROJECT_SOURCE_DIR}")
+
+find_program(XXD_EXECUTABLE xxd)
+
+if(NOT XXD_EXECUTABLE STREQUAL "XXD_EXECUTABLE-NOTFOUND")
+ add_custom_command(OUTPUT ${PROJECT_SOURCE_DIR}/src/bin/basic_lua.h
+ COMMAND ${XXD_EXECUTABLE} -i lua/basic.lua | sed 's/unsigned char/static const unsigned char/g' >basic_lua.h
+ WORKING_DIRECTORY ${PROJECT_SOURCE_DIR}/src/bin/
+ DEPENDS ${PROJECT_SOURCE_DIR}/src/bin/lua/basic.lua)
+ add_custom_command(OUTPUT ${PROJECT_SOURCE_DIR}/src/bin/enumerate_lua.h
+ COMMAND ${XXD_EXECUTABLE} -i lua/enumerate.lua | sed 's/unsigned char/static const unsigned char/g' >enumerate_lua.h
+ WORKING_DIRECTORY ${PROJECT_SOURCE_DIR}/src/bin/
+ DEPENDS ${PROJECT_SOURCE_DIR}/src/bin/lua/enumerate.lua)
+ add_custom_command(OUTPUT ${PROJECT_SOURCE_DIR}/src/bin/function_lua.h
+ COMMAND ${XXD_EXECUTABLE} -i lua/function.lua | sed 's/unsigned char/static const unsigned char/g' >function_lua.h
+ WORKING_DIRECTORY ${PROJECT_SOURCE_DIR}/src/bin/
+ DEPENDS ${PROJECT_SOURCE_DIR}/src/bin/lua/function.lua)
+ add_custom_command(OUTPUT ${PROJECT_SOURCE_DIR}/src/bin/declaration_lua.h
+ COMMAND ${XXD_EXECUTABLE} -i lua/declaration.lua | sed 's/unsigned char/static const unsigned char/g' >declaration_lua.h
+ WORKING_DIRECTORY ${PROJECT_SOURCE_DIR}/src/bin/
+ DEPENDS ${PROJECT_SOURCE_DIR}/src/bin/lua/declaration.lua)
+ set_property(SOURCE src/bin/toluabind.c APPEND PROPERTY OBJECT_DEPENDS ${PROJECT_SOURCE_DIR}/src/bin/enumerate_lua.h ${PROJECT_SOURCE_DIR}/src/bin/basic_lua.h ${PROJECT_SOURCE_DIR}/src/bin/function_lua.h ${PROJECT_SOURCE_DIR}/src/bin/declaration_lua.h)
+else()
+ message("xxd not found, changes to tolua scripts will be ignored")
+endif()
+
file(GLOB LIB_SOURCE
"src/lib/*.c"
@@ -14,6 +40,8 @@ file(GLOB BIN_SOURCE
"src/bin/*.c"
)
+
+
add_executable(tolua ${BIN_SOURCE})
add_library(tolualib ${LIB_SOURCE})
diff --git a/lib/tolua++/src/bin/basic_lua.h b/lib/tolua++/src/bin/basic_lua.h
new file mode 100644
index 000000000..effd79ee9
--- /dev/null
+++ b/lib/tolua++/src/bin/basic_lua.h
@@ -0,0 +1,760 @@
+static const unsigned char lua_basic_lua[] = {
+ 0x2d, 0x2d, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x3a, 0x20, 0x62, 0x61,
+ 0x73, 0x69, 0x63, 0x20, 0x75, 0x74, 0x69, 0x6c, 0x69, 0x74, 0x79, 0x20,
+ 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x57, 0x72, 0x69, 0x74, 0x74, 0x65, 0x6e, 0x20, 0x62, 0x79, 0x20,
+ 0x57, 0x61, 0x6c, 0x64, 0x65, 0x6d, 0x61, 0x72, 0x20, 0x43, 0x65, 0x6c,
+ 0x65, 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x54, 0x65, 0x43, 0x47, 0x72, 0x61,
+ 0x66, 0x2f, 0x50, 0x55, 0x43, 0x2d, 0x52, 0x69, 0x6f, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x4a, 0x75, 0x6c, 0x20, 0x31, 0x39, 0x39, 0x38, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x4c, 0x61, 0x73, 0x74, 0x20, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65,
+ 0x3a, 0x20, 0x41, 0x70, 0x72, 0x20, 0x32, 0x30, 0x30, 0x33, 0x0a, 0x2d,
+ 0x2d, 0x20, 0x24, 0x49, 0x64, 0x3a, 0x20, 0x24, 0x0a, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x54, 0x68, 0x69, 0x73, 0x20, 0x63, 0x6f, 0x64, 0x65, 0x20, 0x69,
+ 0x73, 0x20, 0x66, 0x72, 0x65, 0x65, 0x20, 0x73, 0x6f, 0x66, 0x74, 0x77,
+ 0x61, 0x72, 0x65, 0x3b, 0x20, 0x79, 0x6f, 0x75, 0x20, 0x63, 0x61, 0x6e,
+ 0x20, 0x72, 0x65, 0x64, 0x69, 0x73, 0x74, 0x72, 0x69, 0x62, 0x75, 0x74,
+ 0x65, 0x20, 0x69, 0x74, 0x20, 0x61, 0x6e, 0x64, 0x2f, 0x6f, 0x72, 0x20,
+ 0x6d, 0x6f, 0x64, 0x69, 0x66, 0x79, 0x20, 0x69, 0x74, 0x2e, 0x0a, 0x2d,
+ 0x2d, 0x20, 0x54, 0x68, 0x65, 0x20, 0x73, 0x6f, 0x66, 0x74, 0x77, 0x61,
+ 0x72, 0x65, 0x20, 0x70, 0x72, 0x6f, 0x76, 0x69, 0x64, 0x65, 0x64, 0x20,
+ 0x68, 0x65, 0x72, 0x65, 0x75, 0x6e, 0x64, 0x65, 0x72, 0x20, 0x69, 0x73,
+ 0x20, 0x6f, 0x6e, 0x20, 0x61, 0x6e, 0x20, 0x22, 0x61, 0x73, 0x20, 0x69,
+ 0x73, 0x22, 0x20, 0x62, 0x61, 0x73, 0x69, 0x73, 0x2c, 0x20, 0x61, 0x6e,
+ 0x64, 0x0a, 0x2d, 0x2d, 0x20, 0x74, 0x68, 0x65, 0x20, 0x61, 0x75, 0x74,
+ 0x68, 0x6f, 0x72, 0x20, 0x68, 0x61, 0x73, 0x20, 0x6e, 0x6f, 0x20, 0x6f,
+ 0x62, 0x6c, 0x69, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x74, 0x6f,
+ 0x20, 0x70, 0x72, 0x6f, 0x76, 0x69, 0x64, 0x65, 0x20, 0x6d, 0x61, 0x69,
+ 0x6e, 0x74, 0x65, 0x6e, 0x61, 0x6e, 0x63, 0x65, 0x2c, 0x20, 0x73, 0x75,
+ 0x70, 0x70, 0x6f, 0x72, 0x74, 0x2c, 0x20, 0x75, 0x70, 0x64, 0x61, 0x74,
+ 0x65, 0x73, 0x2c, 0x0a, 0x2d, 0x2d, 0x20, 0x65, 0x6e, 0x68, 0x61, 0x6e,
+ 0x63, 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x73, 0x2c, 0x20, 0x6f, 0x72, 0x20,
+ 0x6d, 0x6f, 0x64, 0x69, 0x66, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+ 0x73, 0x2e, 0x0a, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x42, 0x61, 0x73, 0x69,
+ 0x63, 0x20, 0x43, 0x20, 0x74, 0x79, 0x70, 0x65, 0x73, 0x20, 0x61, 0x6e,
+ 0x64, 0x20, 0x74, 0x68, 0x65, 0x69, 0x72, 0x20, 0x63, 0x6f, 0x72, 0x72,
+ 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x64, 0x69, 0x6e, 0x67, 0x20, 0x4c, 0x75,
+ 0x61, 0x20, 0x74, 0x79, 0x70, 0x65, 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x41,
+ 0x6c, 0x6c, 0x20, 0x6f, 0x63, 0x63, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63,
+ 0x65, 0x73, 0x20, 0x6f, 0x66, 0x20, 0x22, 0x63, 0x68, 0x61, 0x72, 0x2a,
+ 0x22, 0x20, 0x77, 0x69, 0x6c, 0x6c, 0x20, 0x62, 0x65, 0x20, 0x72, 0x65,
+ 0x70, 0x6c, 0x61, 0x63, 0x65, 0x64, 0x20, 0x62, 0x79, 0x20, 0x22, 0x5f,
+ 0x63, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x22, 0x2c, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x61, 0x6e, 0x64, 0x20, 0x61, 0x6c, 0x6c, 0x20, 0x6f, 0x63, 0x63,
+ 0x75, 0x72, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x73, 0x20, 0x6f, 0x66, 0x20,
+ 0x22, 0x76, 0x6f, 0x69, 0x64, 0x2a, 0x22, 0x20, 0x77, 0x69, 0x6c, 0x6c,
+ 0x20, 0x62, 0x65, 0x20, 0x72, 0x65, 0x70, 0x6c, 0x61, 0x63, 0x65, 0x64,
+ 0x20, 0x62, 0x79, 0x20, 0x22, 0x5f, 0x75, 0x73, 0x65, 0x72, 0x64, 0x61,
+ 0x74, 0x61, 0x22, 0x0a, 0x5f, 0x62, 0x61, 0x73, 0x69, 0x63, 0x20, 0x3d,
+ 0x20, 0x7b, 0x0a, 0x20, 0x5b, 0x27, 0x76, 0x6f, 0x69, 0x64, 0x27, 0x5d,
+ 0x20, 0x3d, 0x20, 0x27, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x63, 0x68,
+ 0x61, 0x72, 0x27, 0x5d, 0x20, 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62,
+ 0x65, 0x72, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x69, 0x6e, 0x74, 0x27,
+ 0x5d, 0x20, 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x27,
+ 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x73, 0x68, 0x6f, 0x72, 0x74, 0x27, 0x5d,
+ 0x20, 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x27, 0x2c,
+ 0x0a, 0x20, 0x5b, 0x27, 0x6c, 0x6f, 0x6e, 0x67, 0x27, 0x5d, 0x20, 0x3d,
+ 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x27, 0x2c, 0x0a, 0x20,
+ 0x5b, 0x27, 0x75, 0x6e, 0x73, 0x69, 0x67, 0x6e, 0x65, 0x64, 0x27, 0x5d,
+ 0x20, 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x27, 0x2c,
+ 0x0a, 0x20, 0x5b, 0x27, 0x66, 0x6c, 0x6f, 0x61, 0x74, 0x27, 0x5d, 0x20,
+ 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x27, 0x2c, 0x0a,
+ 0x20, 0x5b, 0x27, 0x64, 0x6f, 0x75, 0x62, 0x6c, 0x65, 0x27, 0x5d, 0x20,
+ 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x27, 0x2c, 0x0a,
+ 0x20, 0x5b, 0x27, 0x73, 0x69, 0x7a, 0x65, 0x5f, 0x74, 0x27, 0x5d, 0x20,
+ 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x27, 0x2c, 0x0a,
+ 0x20, 0x5b, 0x27, 0x5f, 0x63, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x27,
+ 0x5d, 0x20, 0x3d, 0x20, 0x27, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x27,
+ 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x5f, 0x75, 0x73, 0x65, 0x72, 0x64, 0x61,
+ 0x74, 0x61, 0x27, 0x5d, 0x20, 0x3d, 0x20, 0x27, 0x75, 0x73, 0x65, 0x72,
+ 0x64, 0x61, 0x74, 0x61, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x63, 0x68,
+ 0x61, 0x72, 0x2a, 0x27, 0x5d, 0x20, 0x3d, 0x20, 0x27, 0x73, 0x74, 0x72,
+ 0x69, 0x6e, 0x67, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x76, 0x6f, 0x69,
+ 0x64, 0x2a, 0x27, 0x5d, 0x20, 0x3d, 0x20, 0x27, 0x75, 0x73, 0x65, 0x72,
+ 0x64, 0x61, 0x74, 0x61, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x62, 0x6f,
+ 0x6f, 0x6c, 0x27, 0x5d, 0x20, 0x3d, 0x20, 0x27, 0x62, 0x6f, 0x6f, 0x6c,
+ 0x65, 0x61, 0x6e, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x6c, 0x75, 0x61,
+ 0x5f, 0x4f, 0x62, 0x6a, 0x65, 0x63, 0x74, 0x27, 0x5d, 0x20, 0x3d, 0x20,
+ 0x27, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27,
+ 0x4c, 0x55, 0x41, 0x5f, 0x56, 0x41, 0x4c, 0x55, 0x45, 0x27, 0x5d, 0x20,
+ 0x3d, 0x20, 0x27, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x27, 0x2c, 0x20, 0x20,
+ 0x20, 0x20, 0x2d, 0x2d, 0x20, 0x66, 0x6f, 0x72, 0x20, 0x63, 0x6f, 0x6d,
+ 0x70, 0x61, 0x74, 0x69, 0x62, 0x69, 0x6c, 0x69, 0x74, 0x79, 0x20, 0x77,
+ 0x69, 0x74, 0x68, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x20, 0x34, 0x2e,
+ 0x30, 0x0a, 0x20, 0x5b, 0x27, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x74, 0x61,
+ 0x74, 0x65, 0x2a, 0x27, 0x5d, 0x20, 0x3d, 0x20, 0x27, 0x73, 0x74, 0x61,
+ 0x74, 0x65, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x5f, 0x6c, 0x73, 0x74,
+ 0x61, 0x74, 0x65, 0x27, 0x5d, 0x20, 0x3d, 0x20, 0x27, 0x73, 0x74, 0x61,
+ 0x74, 0x65, 0x27, 0x2c, 0x0a, 0x20, 0x5b, 0x27, 0x6c, 0x75, 0x61, 0x5f,
+ 0x46, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x27, 0x5d, 0x20, 0x3d,
+ 0x20, 0x27, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x27, 0x2c, 0x0a, 0x7d, 0x0a,
+ 0x0a, 0x5f, 0x62, 0x61, 0x73, 0x69, 0x63, 0x5f, 0x63, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x3d, 0x20, 0x7b, 0x0a, 0x20, 0x6e, 0x75, 0x6d, 0x62, 0x65,
+ 0x72, 0x20, 0x3d, 0x20, 0x22, 0x6c, 0x75, 0x61, 0x5f, 0x4e, 0x75, 0x6d,
+ 0x62, 0x65, 0x72, 0x22, 0x2c, 0x0a, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e,
+ 0x67, 0x20, 0x3d, 0x20, 0x22, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x63,
+ 0x68, 0x61, 0x72, 0x2a, 0x22, 0x2c, 0x0a, 0x20, 0x75, 0x73, 0x65, 0x72,
+ 0x64, 0x61, 0x74, 0x61, 0x20, 0x3d, 0x20, 0x22, 0x76, 0x6f, 0x69, 0x64,
+ 0x2a, 0x22, 0x2c, 0x0a, 0x20, 0x62, 0x6f, 0x6f, 0x6c, 0x65, 0x61, 0x6e,
+ 0x20, 0x3d, 0x20, 0x22, 0x62, 0x6f, 0x6f, 0x6c, 0x22, 0x2c, 0x0a, 0x20,
+ 0x76, 0x61, 0x6c, 0x75, 0x65, 0x20, 0x3d, 0x20, 0x22, 0x69, 0x6e, 0x74,
+ 0x22, 0x2c, 0x0a, 0x20, 0x73, 0x74, 0x61, 0x74, 0x65, 0x20, 0x3d, 0x20,
+ 0x22, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x74, 0x61, 0x74, 0x65, 0x2a, 0x22,
+ 0x2c, 0x0a, 0x7d, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x66, 0x75, 0x6e, 0x63,
+ 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x20, 0x74, 0x68, 0x65, 0x20, 0x61, 0x72,
+ 0x65, 0x20, 0x75, 0x73, 0x65, 0x64, 0x20, 0x74, 0x6f, 0x20, 0x64, 0x6f,
+ 0x20, 0x61, 0x20, 0x27, 0x72, 0x61, 0x77, 0x20, 0x70, 0x75, 0x73, 0x68,
+ 0x27, 0x20, 0x6f, 0x66, 0x20, 0x62, 0x61, 0x73, 0x69, 0x63, 0x20, 0x74,
+ 0x79, 0x70, 0x65, 0x73, 0x0a, 0x5f, 0x62, 0x61, 0x73, 0x69, 0x63, 0x5f,
+ 0x72, 0x61, 0x77, 0x5f, 0x70, 0x75, 0x73, 0x68, 0x20, 0x3d, 0x20, 0x7b,
+ 0x7d, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x4c, 0x69, 0x73, 0x74, 0x20, 0x6f,
+ 0x66, 0x20, 0x75, 0x73, 0x65, 0x72, 0x20, 0x64, 0x65, 0x66, 0x69, 0x6e,
+ 0x65, 0x64, 0x20, 0x74, 0x79, 0x70, 0x65, 0x73, 0x0a, 0x2d, 0x2d, 0x20,
+ 0x45, 0x61, 0x63, 0x68, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x63, 0x6f,
+ 0x72, 0x72, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x64, 0x73, 0x20, 0x74, 0x6f,
+ 0x20, 0x61, 0x20, 0x76, 0x61, 0x72, 0x69, 0x61, 0x62, 0x6c, 0x65, 0x20,
+ 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x74, 0x68, 0x61, 0x74, 0x20, 0x73, 0x74,
+ 0x6f, 0x72, 0x65, 0x73, 0x20, 0x69, 0x74, 0x73, 0x20, 0x74, 0x61, 0x67,
+ 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x2e, 0x0a, 0x5f, 0x75, 0x73, 0x65,
+ 0x72, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x7b, 0x7d, 0x0a, 0x0a,
+ 0x2d, 0x2d, 0x20, 0x4c, 0x69, 0x73, 0x74, 0x20, 0x6f, 0x66, 0x20, 0x74,
+ 0x79, 0x70, 0x65, 0x73, 0x20, 0x74, 0x68, 0x61, 0x74, 0x20, 0x68, 0x61,
+ 0x76, 0x65, 0x20, 0x74, 0x6f, 0x20, 0x62, 0x65, 0x20, 0x63, 0x6f, 0x6c,
+ 0x6c, 0x65, 0x63, 0x74, 0x65, 0x64, 0x0a, 0x5f, 0x63, 0x6f, 0x6c, 0x6c,
+ 0x65, 0x63, 0x74, 0x20, 0x3d, 0x20, 0x7b, 0x7d, 0x0a, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x4c, 0x69, 0x73, 0x74, 0x20, 0x6f, 0x66, 0x20, 0x74, 0x79, 0x70,
+ 0x65, 0x73, 0x0a, 0x5f, 0x67, 0x6c, 0x6f, 0x62, 0x61, 0x6c, 0x5f, 0x74,
+ 0x79, 0x70, 0x65, 0x73, 0x20, 0x3d, 0x20, 0x7b, 0x6e, 0x3d, 0x30, 0x7d,
+ 0x0a, 0x5f, 0x67, 0x6c, 0x6f, 0x62, 0x61, 0x6c, 0x5f, 0x74, 0x79, 0x70,
+ 0x65, 0x73, 0x5f, 0x68, 0x61, 0x73, 0x68, 0x20, 0x3d, 0x20, 0x7b, 0x7d,
+ 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x6c, 0x69, 0x73, 0x74, 0x20, 0x6f, 0x66,
+ 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x65, 0x73, 0x0a, 0x5f, 0x67, 0x6c,
+ 0x6f, 0x62, 0x61, 0x6c, 0x5f, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x65, 0x73,
+ 0x20, 0x3d, 0x20, 0x7b, 0x7d, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x4c, 0x69,
+ 0x73, 0x74, 0x20, 0x6f, 0x66, 0x20, 0x65, 0x6e, 0x75, 0x6d, 0x20, 0x63,
+ 0x6f, 0x6e, 0x73, 0x74, 0x61, 0x6e, 0x74, 0x73, 0x0a, 0x5f, 0x67, 0x6c,
+ 0x6f, 0x62, 0x61, 0x6c, 0x5f, 0x65, 0x6e, 0x75, 0x6d, 0x73, 0x20, 0x3d,
+ 0x20, 0x7b, 0x7d, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x4c, 0x69, 0x73, 0x74,
+ 0x20, 0x6f, 0x66, 0x20, 0x61, 0x75, 0x74, 0x6f, 0x20, 0x72, 0x65, 0x6e,
+ 0x61, 0x6d, 0x69, 0x6e, 0x67, 0x0a, 0x5f, 0x72, 0x65, 0x6e, 0x61, 0x6d,
+ 0x69, 0x6e, 0x67, 0x20, 0x3d, 0x20, 0x7b, 0x7d, 0x0a, 0x0a, 0x5f, 0x65,
+ 0x6e, 0x75, 0x6d, 0x73, 0x20, 0x3d, 0x20, 0x7b, 0x7d, 0x0a, 0x66, 0x75,
+ 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x61, 0x70, 0x70, 0x65, 0x6e,
+ 0x64, 0x72, 0x65, 0x6e, 0x61, 0x6d, 0x69, 0x6e, 0x67, 0x20, 0x28, 0x73,
+ 0x29, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x62, 0x2c, 0x65,
+ 0x2c, 0x6f, 0x6c, 0x64, 0x2c, 0x6e, 0x65, 0x77, 0x20, 0x3d, 0x20, 0x73,
+ 0x74, 0x72, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x73, 0x2c, 0x22, 0x25, 0x73,
+ 0x2a, 0x28, 0x2e, 0x2d, 0x29, 0x25, 0x73, 0x2a, 0x40, 0x25, 0x73, 0x2a,
+ 0x28, 0x2e, 0x2d, 0x29, 0x25, 0x73, 0x2a, 0x24, 0x22, 0x29, 0x0a, 0x09,
+ 0x69, 0x66, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x62, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x09, 0x20, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x28, 0x22, 0x23,
+ 0x49, 0x6e, 0x76, 0x61, 0x6c, 0x69, 0x64, 0x20, 0x72, 0x65, 0x6e, 0x61,
+ 0x6d, 0x69, 0x6e, 0x67, 0x20, 0x73, 0x79, 0x6e, 0x74, 0x61, 0x78, 0x3b,
+ 0x20, 0x69, 0x74, 0x20, 0x73, 0x68, 0x6f, 0x75, 0x6c, 0x64, 0x20, 0x62,
+ 0x65, 0x20, 0x6f, 0x66, 0x20, 0x74, 0x68, 0x65, 0x20, 0x66, 0x6f, 0x72,
+ 0x6d, 0x3a, 0x20, 0x70, 0x61, 0x74, 0x74, 0x65, 0x72, 0x6e, 0x40, 0x70,
+ 0x61, 0x74, 0x74, 0x65, 0x72, 0x6e, 0x22, 0x29, 0x0a, 0x09, 0x65, 0x6e,
+ 0x64, 0x0a, 0x09, 0x74, 0x69, 0x6e, 0x73, 0x65, 0x72, 0x74, 0x28, 0x5f,
+ 0x72, 0x65, 0x6e, 0x61, 0x6d, 0x69, 0x6e, 0x67, 0x2c, 0x7b, 0x6f, 0x6c,
+ 0x64, 0x3d, 0x6f, 0x6c, 0x64, 0x2c, 0x20, 0x6e, 0x65, 0x77, 0x3d, 0x6e,
+ 0x65, 0x77, 0x7d, 0x29, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x66, 0x75,
+ 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x61, 0x70, 0x70, 0x6c, 0x79,
+ 0x72, 0x65, 0x6e, 0x61, 0x6d, 0x69, 0x6e, 0x67, 0x20, 0x28, 0x73, 0x29,
+ 0x0a, 0x09, 0x66, 0x6f, 0x72, 0x20, 0x69, 0x3d, 0x31, 0x2c, 0x67, 0x65,
+ 0x74, 0x6e, 0x28, 0x5f, 0x72, 0x65, 0x6e, 0x61, 0x6d, 0x69, 0x6e, 0x67,
+ 0x29, 0x20, 0x64, 0x6f, 0x0a, 0x09, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x6d, 0x2c, 0x6e, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28,
+ 0x73, 0x2c, 0x5f, 0x72, 0x65, 0x6e, 0x61, 0x6d, 0x69, 0x6e, 0x67, 0x5b,
+ 0x69, 0x5d, 0x2e, 0x6f, 0x6c, 0x64, 0x2c, 0x5f, 0x72, 0x65, 0x6e, 0x61,
+ 0x6d, 0x69, 0x6e, 0x67, 0x5b, 0x69, 0x5d, 0x2e, 0x6e, 0x65, 0x77, 0x29,
+ 0x0a, 0x09, 0x09, 0x69, 0x66, 0x20, 0x6e, 0x20, 0x7e, 0x3d, 0x20, 0x30,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x20, 0x72, 0x65, 0x74,
+ 0x75, 0x72, 0x6e, 0x20, 0x6d, 0x0a, 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a,
+ 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e,
+ 0x20, 0x6e, 0x69, 0x6c, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x45, 0x72, 0x72, 0x6f, 0x72, 0x20, 0x68, 0x61, 0x6e, 0x64, 0x6c,
+ 0x65, 0x72, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x20,
+ 0x28, 0x73, 0x2c, 0x66, 0x29, 0x0a, 0x69, 0x66, 0x20, 0x5f, 0x63, 0x75,
+ 0x72, 0x72, 0x5f, 0x63, 0x6f, 0x64, 0x65, 0x20, 0x74, 0x68, 0x65, 0x6e,
+ 0x0a, 0x09, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x22, 0x2a, 0x2a, 0x2a,
+ 0x63, 0x75, 0x72, 0x72, 0x20, 0x63, 0x6f, 0x64, 0x65, 0x20, 0x66, 0x6f,
+ 0x72, 0x20, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x20, 0x69, 0x73, 0x20, 0x22,
+ 0x2e, 0x2e, 0x74, 0x6f, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x28, 0x5f,
+ 0x63, 0x75, 0x72, 0x72, 0x5f, 0x63, 0x6f, 0x64, 0x65, 0x29, 0x29, 0x0a,
+ 0x09, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x64, 0x65, 0x62, 0x75, 0x67,
+ 0x2e, 0x74, 0x72, 0x61, 0x63, 0x65, 0x62, 0x61, 0x63, 0x6b, 0x28, 0x29,
+ 0x29, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x6f, 0x75, 0x74, 0x20, 0x3d, 0x20, 0x5f, 0x4f, 0x55, 0x54, 0x50,
+ 0x55, 0x54, 0x0a, 0x20, 0x5f, 0x4f, 0x55, 0x54, 0x50, 0x55, 0x54, 0x20,
+ 0x3d, 0x20, 0x5f, 0x53, 0x54, 0x44, 0x45, 0x52, 0x52, 0x0a, 0x20, 0x69,
+ 0x66, 0x20, 0x73, 0x74, 0x72, 0x73, 0x75, 0x62, 0x28, 0x73, 0x2c, 0x31,
+ 0x2c, 0x31, 0x29, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x23, 0x27, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x77, 0x72, 0x69, 0x74, 0x65, 0x28,
+ 0x22, 0x5c, 0x6e, 0x2a, 0x2a, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x3a,
+ 0x20, 0x22, 0x2e, 0x2e, 0x73, 0x74, 0x72, 0x73, 0x75, 0x62, 0x28, 0x73,
+ 0x2c, 0x32, 0x29, 0x2e, 0x2e, 0x22, 0x2e, 0x5c, 0x6e, 0x5c, 0x6e, 0x22,
+ 0x29, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x5f, 0x63, 0x75, 0x72, 0x72,
+ 0x5f, 0x63, 0x6f, 0x64, 0x65, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20,
+ 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x5f, 0x2c, 0x5f, 0x2c,
+ 0x73, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x66, 0x69, 0x6e, 0x64, 0x28,
+ 0x5f, 0x63, 0x75, 0x72, 0x72, 0x5f, 0x63, 0x6f, 0x64, 0x65, 0x2c, 0x22,
+ 0x5e, 0x25, 0x73, 0x2a, 0x28, 0x2e, 0x2d, 0x5c, 0x6e, 0x29, 0x22, 0x29,
+ 0x20, 0x2d, 0x2d, 0x20, 0x65, 0x78, 0x74, 0x72, 0x61, 0x63, 0x74, 0x20,
+ 0x66, 0x69, 0x72, 0x73, 0x74, 0x20, 0x6c, 0x69, 0x6e, 0x65, 0x0a, 0x20,
+ 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x3d, 0x3d, 0x6e, 0x69, 0x6c, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x20, 0x73, 0x20, 0x3d, 0x20, 0x5f, 0x63, 0x75,
+ 0x72, 0x72, 0x5f, 0x63, 0x6f, 0x64, 0x65, 0x20, 0x65, 0x6e, 0x64, 0x0a,
+ 0x20, 0x20, 0x20, 0x73, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28,
+ 0x73, 0x2c, 0x22, 0x5f, 0x75, 0x73, 0x65, 0x72, 0x64, 0x61, 0x74, 0x61,
+ 0x22, 0x2c, 0x22, 0x76, 0x6f, 0x69, 0x64, 0x2a, 0x22, 0x29, 0x20, 0x2d,
+ 0x2d, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x77, 0x69, 0x74,
+ 0x68, 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64, 0x2a, 0x27, 0x0a, 0x20, 0x20,
+ 0x20, 0x73, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28, 0x73, 0x2c,
+ 0x22, 0x5f, 0x63, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x22, 0x2c, 0x22,
+ 0x63, 0x68, 0x61, 0x72, 0x2a, 0x22, 0x29, 0x20, 0x20, 0x2d, 0x2d, 0x20,
+ 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x77, 0x69, 0x74, 0x68, 0x20,
+ 0x27, 0x63, 0x68, 0x61, 0x72, 0x2a, 0x27, 0x0a, 0x20, 0x20, 0x20, 0x73,
+ 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28, 0x73, 0x2c, 0x22, 0x5f,
+ 0x6c, 0x73, 0x74, 0x61, 0x74, 0x65, 0x22, 0x2c, 0x22, 0x6c, 0x75, 0x61,
+ 0x5f, 0x53, 0x74, 0x61, 0x74, 0x65, 0x2a, 0x22, 0x29, 0x20, 0x20, 0x2d,
+ 0x2d, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x77, 0x69, 0x74,
+ 0x68, 0x20, 0x27, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x74, 0x61, 0x74, 0x65,
+ 0x2a, 0x27, 0x0a, 0x20, 0x20, 0x20, 0x77, 0x72, 0x69, 0x74, 0x65, 0x28,
+ 0x22, 0x43, 0x6f, 0x64, 0x65, 0x20, 0x62, 0x65, 0x69, 0x6e, 0x67, 0x20,
+ 0x70, 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, 0x65, 0x64, 0x3a, 0x5c, 0x6e,
+ 0x22, 0x2e, 0x2e, 0x73, 0x2e, 0x2e, 0x22, 0x5c, 0x6e, 0x22, 0x29, 0x0a,
+ 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x0a,
+ 0x20, 0x69, 0x66, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x66, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x20, 0x66, 0x20, 0x3d, 0x20, 0x22, 0x28, 0x66, 0x20, 0x69,
+ 0x73, 0x20, 0x6e, 0x69, 0x6c, 0x29, 0x22, 0x20, 0x65, 0x6e, 0x64, 0x0a,
+ 0x20, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x22, 0x5c, 0x6e, 0x2a,
+ 0x2a, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x20, 0x69, 0x6e, 0x74, 0x65,
+ 0x72, 0x6e, 0x61, 0x6c, 0x20, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x3a, 0x20,
+ 0x22, 0x2e, 0x2e, 0x66, 0x2e, 0x2e, 0x73, 0x2e, 0x2e, 0x22, 0x2e, 0x5c,
+ 0x6e, 0x5c, 0x6e, 0x22, 0x29, 0x0a, 0x20, 0x20, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x5f, 0x4f, 0x55,
+ 0x54, 0x50, 0x55, 0x54, 0x20, 0x3d, 0x20, 0x6f, 0x75, 0x74, 0x0a, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x77, 0x61, 0x72, 0x6e, 0x69, 0x6e, 0x67, 0x20, 0x28, 0x6d, 0x73,
+ 0x67, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x66, 0x6c, 0x61, 0x67, 0x73,
+ 0x2e, 0x71, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x6f, 0x75, 0x74, 0x20, 0x3d, 0x20, 0x5f, 0x4f, 0x55, 0x54,
+ 0x50, 0x55, 0x54, 0x0a, 0x20, 0x5f, 0x4f, 0x55, 0x54, 0x50, 0x55, 0x54,
+ 0x20, 0x3d, 0x20, 0x5f, 0x53, 0x54, 0x44, 0x45, 0x52, 0x52, 0x0a, 0x20,
+ 0x77, 0x72, 0x69, 0x74, 0x65, 0x28, 0x22, 0x5c, 0x6e, 0x2a, 0x2a, 0x20,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x20, 0x77, 0x61, 0x72, 0x6e, 0x69, 0x6e,
+ 0x67, 0x3a, 0x20, 0x22, 0x2e, 0x2e, 0x6d, 0x73, 0x67, 0x2e, 0x2e, 0x22,
+ 0x2e, 0x5c, 0x6e, 0x5c, 0x6e, 0x22, 0x29, 0x0a, 0x20, 0x5f, 0x4f, 0x55,
+ 0x54, 0x50, 0x55, 0x54, 0x20, 0x3d, 0x20, 0x6f, 0x75, 0x74, 0x0a, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x72, 0x65, 0x67, 0x69, 0x73,
+ 0x74, 0x65, 0x72, 0x20, 0x61, 0x6e, 0x20, 0x75, 0x73, 0x65, 0x72, 0x20,
+ 0x64, 0x65, 0x66, 0x69, 0x6e, 0x65, 0x64, 0x20, 0x74, 0x79, 0x70, 0x65,
+ 0x3a, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x73, 0x20, 0x66, 0x75,
+ 0x6c, 0x6c, 0x20, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x66, 0x75, 0x6e, 0x63,
+ 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x72, 0x65, 0x67, 0x74, 0x79, 0x70, 0x65,
+ 0x20, 0x28, 0x74, 0x29, 0x0a, 0x09, 0x2d, 0x2d, 0x69, 0x66, 0x20, 0x69,
+ 0x73, 0x62, 0x61, 0x73, 0x69, 0x63, 0x28, 0x74, 0x29, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x09, 0x2d, 0x2d, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72,
+ 0x6e, 0x20, 0x74, 0x0a, 0x09, 0x2d, 0x2d, 0x65, 0x6e, 0x64, 0x0a, 0x09,
+ 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x66, 0x74, 0x20, 0x3d, 0x20, 0x66,
+ 0x69, 0x6e, 0x64, 0x74, 0x79, 0x70, 0x65, 0x28, 0x74, 0x29, 0x0a, 0x0a,
+ 0x09, 0x69, 0x66, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x5f, 0x75, 0x73, 0x65,
+ 0x72, 0x74, 0x79, 0x70, 0x65, 0x5b, 0x66, 0x74, 0x5d, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20,
+ 0x61, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x75, 0x73, 0x65, 0x72, 0x74, 0x79,
+ 0x70, 0x65, 0x28, 0x74, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09,
+ 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x66, 0x74, 0x0a, 0x65, 0x6e,
+ 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e,
+ 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x3a, 0x20,
+ 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x73, 0x20, 0x66, 0x75, 0x6c, 0x6c,
+ 0x20, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69,
+ 0x6f, 0x6e, 0x20, 0x74, 0x79, 0x70, 0x65, 0x76, 0x61, 0x72, 0x28, 0x74,
+ 0x79, 0x70, 0x65, 0x29, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x6f, 0x72, 0x20, 0x74,
+ 0x79, 0x70, 0x65, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64,
+ 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74,
+ 0x75, 0x72, 0x6e, 0x20, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x09, 0x65, 0x6c,
+ 0x73, 0x65, 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x66,
+ 0x74, 0x20, 0x3d, 0x20, 0x66, 0x69, 0x6e, 0x64, 0x74, 0x79, 0x70, 0x65,
+ 0x28, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x09, 0x09, 0x69, 0x66, 0x20,
+ 0x66, 0x74, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x09, 0x72,
+ 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x66, 0x74, 0x0a, 0x09, 0x09, 0x65,
+ 0x6e, 0x64, 0x0a, 0x09, 0x09, 0x5f, 0x75, 0x73, 0x65, 0x72, 0x74, 0x79,
+ 0x70, 0x65, 0x5b, 0x74, 0x79, 0x70, 0x65, 0x5d, 0x20, 0x3d, 0x20, 0x74,
+ 0x79, 0x70, 0x65, 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e,
+ 0x20, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x69, 0x73, 0x20, 0x65, 0x6e,
+ 0x75, 0x6d, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20,
+ 0x69, 0x73, 0x65, 0x6e, 0x75, 0x6d, 0x74, 0x79, 0x70, 0x65, 0x20, 0x28,
+ 0x74, 0x79, 0x70, 0x65, 0x29, 0x20, 0x0a, 0x20, 0x20, 0x72, 0x65, 0x74,
+ 0x75, 0x72, 0x6e, 0x20, 0x5f, 0x65, 0x6e, 0x75, 0x6d, 0x73, 0x5b, 0x74,
+ 0x79, 0x70, 0x65, 0x5d, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x63, 0x68, 0x65, 0x63, 0x6b, 0x20, 0x69, 0x66, 0x20, 0x62, 0x61,
+ 0x73, 0x69, 0x63, 0x20, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x69, 0x73, 0x62, 0x61, 0x73, 0x69,
+ 0x63, 0x20, 0x28, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x20, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62,
+ 0x28, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x27, 0x63, 0x6f, 0x6e, 0x73, 0x74,
+ 0x20, 0x27, 0x2c, 0x27, 0x27, 0x29, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x6d, 0x2c, 0x74, 0x20, 0x3d, 0x20, 0x61, 0x70, 0x70, 0x6c,
+ 0x79, 0x74, 0x79, 0x70, 0x65, 0x64, 0x65, 0x66, 0x28, 0x27, 0x27, 0x2c,
+ 0x20, 0x74, 0x29, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x62,
+ 0x20, 0x3d, 0x20, 0x5f, 0x62, 0x61, 0x73, 0x69, 0x63, 0x5b, 0x74, 0x5d,
+ 0x0a, 0x20, 0x69, 0x66, 0x20, 0x62, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x20, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x62, 0x2c, 0x5f,
+ 0x62, 0x61, 0x73, 0x69, 0x63, 0x5f, 0x63, 0x74, 0x79, 0x70, 0x65, 0x5b,
+ 0x62, 0x5d, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x72, 0x65, 0x74,
+ 0x75, 0x72, 0x6e, 0x20, 0x6e, 0x69, 0x6c, 0x0a, 0x65, 0x6e, 0x64, 0x0a,
+ 0x0a, 0x2d, 0x2d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x20, 0x73, 0x74,
+ 0x72, 0x69, 0x6e, 0x67, 0x20, 0x75, 0x73, 0x69, 0x6e, 0x67, 0x20, 0x61,
+ 0x20, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x20, 0x28, 0x73,
+ 0x2c, 0x74, 0x29, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6c,
+ 0x20, 0x3d, 0x20, 0x7b, 0x6e, 0x3d, 0x30, 0x7d, 0x0a, 0x20, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x66, 0x20, 0x3d, 0x20, 0x66, 0x75, 0x6e, 0x63,
+ 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x28, 0x73, 0x29, 0x0a, 0x20, 0x20, 0x6c,
+ 0x2e, 0x6e, 0x20, 0x3d, 0x20, 0x6c, 0x2e, 0x6e, 0x20, 0x2b, 0x20, 0x31,
+ 0x0a, 0x20, 0x20, 0x6c, 0x5b, 0x6c, 0x2e, 0x6e, 0x5d, 0x20, 0x3d, 0x20,
+ 0x73, 0x0a, 0x20, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x22,
+ 0x22, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x70, 0x20, 0x3d, 0x20, 0x22, 0x25, 0x73, 0x2a, 0x28, 0x2e,
+ 0x2d, 0x29, 0x25, 0x73, 0x2a, 0x22, 0x2e, 0x2e, 0x74, 0x2e, 0x2e, 0x22,
+ 0x25, 0x73, 0x2a, 0x22, 0x0a, 0x20, 0x73, 0x20, 0x3d, 0x20, 0x67, 0x73,
+ 0x75, 0x62, 0x28, 0x73, 0x2c, 0x22, 0x5e, 0x25, 0x73, 0x2b, 0x22, 0x2c,
+ 0x22, 0x22, 0x29, 0x0a, 0x20, 0x73, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75,
+ 0x62, 0x28, 0x73, 0x2c, 0x22, 0x25, 0x73, 0x2b, 0x24, 0x22, 0x2c, 0x22,
+ 0x22, 0x29, 0x0a, 0x20, 0x73, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62,
+ 0x28, 0x73, 0x2c, 0x70, 0x2c, 0x66, 0x29, 0x0a, 0x20, 0x6c, 0x2e, 0x6e,
+ 0x20, 0x3d, 0x20, 0x6c, 0x2e, 0x6e, 0x20, 0x2b, 0x20, 0x31, 0x0a, 0x20,
+ 0x6c, 0x5b, 0x6c, 0x2e, 0x6e, 0x5d, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75,
+ 0x62, 0x28, 0x73, 0x2c, 0x22, 0x28, 0x25, 0x73, 0x25, 0x73, 0x2a, 0x29,
+ 0x24, 0x22, 0x2c, 0x22, 0x22, 0x29, 0x0a, 0x20, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x20, 0x6c, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x73, 0x20, 0x61, 0x20, 0x73, 0x74,
+ 0x72, 0x69, 0x6e, 0x67, 0x20, 0x75, 0x73, 0x69, 0x6e, 0x67, 0x20, 0x61,
+ 0x20, 0x70, 0x61, 0x74, 0x74, 0x65, 0x72, 0x6e, 0x2c, 0x20, 0x63, 0x6f,
+ 0x6e, 0x73, 0x69, 0x64, 0x65, 0x72, 0x69, 0x6e, 0x67, 0x20, 0x74, 0x68,
+ 0x65, 0x20, 0x73, 0x70, 0x61, 0x63, 0x69, 0x61, 0x6c, 0x20, 0x63, 0x61,
+ 0x73, 0x65, 0x73, 0x20, 0x6f, 0x66, 0x20, 0x43, 0x20, 0x63, 0x6f, 0x64,
+ 0x65, 0x20, 0x28, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74, 0x65, 0x73,
+ 0x2c, 0x20, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x70,
+ 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72, 0x73, 0x2c, 0x20, 0x65,
+ 0x74, 0x63, 0x29, 0x0a, 0x2d, 0x2d, 0x20, 0x70, 0x61, 0x74, 0x74, 0x65,
+ 0x72, 0x6e, 0x20, 0x63, 0x61, 0x6e, 0x27, 0x74, 0x20, 0x63, 0x6f, 0x6e,
+ 0x74, 0x61, 0x69, 0x6e, 0x20, 0x74, 0x68, 0x65, 0x20, 0x27, 0x5e, 0x27,
+ 0x20, 0x28, 0x61, 0x73, 0x20, 0x75, 0x73, 0x65, 0x64, 0x20, 0x74, 0x6f,
+ 0x20, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x69, 0x66, 0x79, 0x20, 0x74, 0x68,
+ 0x65, 0x20, 0x62, 0x65, 0x67, 0x69, 0x6e, 0x69, 0x6e, 0x67, 0x20, 0x6f,
+ 0x66, 0x20, 0x74, 0x68, 0x65, 0x20, 0x6c, 0x69, 0x6e, 0x65, 0x29, 0x0a,
+ 0x2d, 0x2d, 0x20, 0x61, 0x6c, 0x73, 0x6f, 0x20, 0x73, 0x74, 0x72, 0x69,
+ 0x70, 0x73, 0x20, 0x77, 0x68, 0x69, 0x74, 0x65, 0x73, 0x70, 0x61, 0x63,
+ 0x65, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x73,
+ 0x70, 0x6c, 0x69, 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e,
+ 0x73, 0x28, 0x73, 0x2c, 0x20, 0x70, 0x61, 0x74, 0x29, 0x0a, 0x0a, 0x09,
+ 0x73, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67,
+ 0x73, 0x75, 0x62, 0x28, 0x73, 0x2c, 0x20, 0x22, 0x5e, 0x25, 0x73, 0x2a,
+ 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29, 0x0a, 0x09, 0x73, 0x20, 0x3d, 0x20,
+ 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28,
+ 0x73, 0x2c, 0x20, 0x22, 0x25, 0x73, 0x2a, 0x24, 0x22, 0x2c, 0x20, 0x22,
+ 0x22, 0x29, 0x0a, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74,
+ 0x6f, 0x6b, 0x65, 0x6e, 0x5f, 0x62, 0x65, 0x67, 0x69, 0x6e, 0x20, 0x3d,
+ 0x20, 0x31, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x6f,
+ 0x6b, 0x65, 0x6e, 0x5f, 0x65, 0x6e, 0x64, 0x20, 0x3d, 0x20, 0x31, 0x0a,
+ 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6f, 0x66, 0x73, 0x20, 0x3d,
+ 0x20, 0x31, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x72, 0x65,
+ 0x74, 0x20, 0x3d, 0x20, 0x7b, 0x6e, 0x3d, 0x30, 0x7d, 0x0a, 0x0a, 0x09,
+ 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x61, 0x64, 0x64,
+ 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x28, 0x6f, 0x66, 0x73, 0x29, 0x0a,
+ 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x20, 0x3d,
+ 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x73, 0x75, 0x62, 0x28,
+ 0x73, 0x2c, 0x20, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x5f, 0x62, 0x65, 0x67,
+ 0x69, 0x6e, 0x2c, 0x20, 0x6f, 0x66, 0x73, 0x29, 0x0a, 0x09, 0x09, 0x74,
+ 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73,
+ 0x75, 0x62, 0x28, 0x74, 0x2c, 0x20, 0x22, 0x5e, 0x25, 0x73, 0x2a, 0x22,
+ 0x2c, 0x20, 0x22, 0x22, 0x29, 0x0a, 0x09, 0x09, 0x74, 0x20, 0x3d, 0x20,
+ 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28,
+ 0x74, 0x2c, 0x20, 0x22, 0x25, 0x73, 0x2a, 0x24, 0x22, 0x2c, 0x20, 0x22,
+ 0x22, 0x29, 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74, 0x2e, 0x6e, 0x20, 0x3d,
+ 0x20, 0x72, 0x65, 0x74, 0x2e, 0x6e, 0x20, 0x2b, 0x20, 0x31, 0x0a, 0x09,
+ 0x09, 0x72, 0x65, 0x74, 0x5b, 0x72, 0x65, 0x74, 0x2e, 0x6e, 0x5d, 0x20,
+ 0x3d, 0x20, 0x74, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x77,
+ 0x68, 0x69, 0x6c, 0x65, 0x20, 0x6f, 0x66, 0x73, 0x20, 0x3c, 0x3d, 0x20,
+ 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x6c, 0x65, 0x6e, 0x28, 0x73,
+ 0x29, 0x20, 0x64, 0x6f, 0x0a, 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x73, 0x75, 0x62, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69,
+ 0x6e, 0x67, 0x2e, 0x73, 0x75, 0x62, 0x28, 0x73, 0x2c, 0x20, 0x6f, 0x66,
+ 0x73, 0x2c, 0x20, 0x2d, 0x31, 0x29, 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63,
+ 0x61, 0x6c, 0x20, 0x62, 0x2c, 0x65, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72,
+ 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x73, 0x75, 0x62,
+ 0x2c, 0x20, 0x22, 0x5e, 0x22, 0x2e, 0x2e, 0x70, 0x61, 0x74, 0x29, 0x0a,
+ 0x09, 0x09, 0x69, 0x66, 0x20, 0x62, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x09, 0x09, 0x09, 0x61, 0x64, 0x64, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e,
+ 0x28, 0x6f, 0x66, 0x73, 0x2d, 0x31, 0x29, 0x0a, 0x09, 0x09, 0x09, 0x6f,
+ 0x66, 0x73, 0x20, 0x3d, 0x20, 0x6f, 0x66, 0x73, 0x2b, 0x65, 0x0a, 0x09,
+ 0x09, 0x09, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x5f, 0x62, 0x65, 0x67, 0x69,
+ 0x6e, 0x20, 0x3d, 0x20, 0x6f, 0x66, 0x73, 0x0a, 0x09, 0x09, 0x65, 0x6c,
+ 0x73, 0x65, 0x0a, 0x09, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x63, 0x68, 0x61, 0x72, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e,
+ 0x67, 0x2e, 0x73, 0x75, 0x62, 0x28, 0x73, 0x2c, 0x20, 0x6f, 0x66, 0x73,
+ 0x2c, 0x20, 0x6f, 0x66, 0x73, 0x29, 0x0a, 0x09, 0x09, 0x09, 0x69, 0x66,
+ 0x20, 0x63, 0x68, 0x61, 0x72, 0x20, 0x3d, 0x3d, 0x20, 0x22, 0x28, 0x22,
+ 0x20, 0x6f, 0x72, 0x20, 0x63, 0x68, 0x61, 0x72, 0x20, 0x3d, 0x3d, 0x20,
+ 0x22, 0x3c, 0x22, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x0a, 0x09, 0x09,
+ 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x62, 0x6c, 0x6f, 0x63,
+ 0x6b, 0x0a, 0x09, 0x09, 0x09, 0x09, 0x69, 0x66, 0x20, 0x63, 0x68, 0x61,
+ 0x72, 0x20, 0x3d, 0x3d, 0x20, 0x22, 0x28, 0x22, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x20, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x20, 0x3d, 0x20, 0x22, 0x5e,
+ 0x25, 0x62, 0x28, 0x29, 0x22, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x09,
+ 0x09, 0x09, 0x69, 0x66, 0x20, 0x63, 0x68, 0x61, 0x72, 0x20, 0x3d, 0x3d,
+ 0x20, 0x22, 0x3c, 0x22, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x62, 0x6c,
+ 0x6f, 0x63, 0x6b, 0x20, 0x3d, 0x20, 0x22, 0x5e, 0x25, 0x62, 0x3c, 0x3e,
+ 0x22, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x09, 0x09, 0x09, 0x62,
+ 0x2c, 0x65, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e,
+ 0x66, 0x69, 0x6e, 0x64, 0x28, 0x73, 0x75, 0x62, 0x2c, 0x20, 0x62, 0x6c,
+ 0x6f, 0x63, 0x6b, 0x29, 0x0a, 0x09, 0x09, 0x09, 0x09, 0x69, 0x66, 0x20,
+ 0x6e, 0x6f, 0x74, 0x20, 0x62, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09,
+ 0x09, 0x09, 0x09, 0x09, 0x2d, 0x2d, 0x20, 0x75, 0x6e, 0x74, 0x65, 0x72,
+ 0x6d, 0x69, 0x6e, 0x61, 0x74, 0x65, 0x64, 0x20, 0x62, 0x6c, 0x6f, 0x63,
+ 0x6b, 0x3f, 0x0a, 0x09, 0x09, 0x09, 0x09, 0x09, 0x6f, 0x66, 0x73, 0x20,
+ 0x3d, 0x20, 0x6f, 0x66, 0x73, 0x2b, 0x31, 0x0a, 0x09, 0x09, 0x09, 0x09,
+ 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x09, 0x09, 0x09, 0x09, 0x6f, 0x66,
+ 0x73, 0x20, 0x3d, 0x20, 0x6f, 0x66, 0x73, 0x20, 0x2b, 0x20, 0x65, 0x0a,
+ 0x09, 0x09, 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x09, 0x09,
+ 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x09, 0x09, 0x09, 0x6f, 0x66, 0x73,
+ 0x20, 0x3d, 0x20, 0x6f, 0x66, 0x73, 0x2b, 0x31, 0x0a, 0x09, 0x09, 0x09,
+ 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09,
+ 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x61, 0x64, 0x64, 0x5f, 0x74, 0x6f, 0x6b,
+ 0x65, 0x6e, 0x28, 0x6f, 0x66, 0x73, 0x29, 0x0a, 0x09, 0x2d, 0x2d, 0x69,
+ 0x66, 0x20, 0x72, 0x65, 0x74, 0x2e, 0x6e, 0x20, 0x3d, 0x3d, 0x20, 0x30,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x0a, 0x09, 0x2d, 0x2d, 0x09, 0x72,
+ 0x65, 0x74, 0x2e, 0x6e, 0x3d, 0x31, 0x0a, 0x09, 0x2d, 0x2d, 0x09, 0x72,
+ 0x65, 0x74, 0x5b, 0x31, 0x5d, 0x20, 0x3d, 0x20, 0x22, 0x22, 0x0a, 0x09,
+ 0x2d, 0x2d, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x20, 0x72, 0x65, 0x74, 0x0a, 0x0a, 0x65, 0x6e, 0x64, 0x0a,
+ 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x65, 0x6e,
+ 0x61, 0x74, 0x65, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x73, 0x20,
+ 0x6f, 0x66, 0x20, 0x61, 0x20, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x0a, 0x66,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6f, 0x6e, 0x63,
+ 0x61, 0x74, 0x20, 0x28, 0x74, 0x2c, 0x66, 0x2c, 0x6c, 0x2c, 0x6a, 0x73,
+ 0x74, 0x72, 0x29, 0x0a, 0x09, 0x6a, 0x73, 0x74, 0x72, 0x20, 0x3d, 0x20,
+ 0x6a, 0x73, 0x74, 0x72, 0x20, 0x6f, 0x72, 0x20, 0x22, 0x20, 0x22, 0x0a,
+ 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x73, 0x20, 0x3d, 0x20, 0x27,
+ 0x27, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x69, 0x3d, 0x66,
+ 0x0a, 0x20, 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20, 0x69, 0x3c, 0x3d, 0x6c,
+ 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x73, 0x20, 0x3d, 0x20, 0x73, 0x2e,
+ 0x2e, 0x74, 0x5b, 0x69, 0x5d, 0x0a, 0x20, 0x20, 0x69, 0x20, 0x3d, 0x20,
+ 0x69, 0x2b, 0x31, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x69, 0x20, 0x3c,
+ 0x3d, 0x20, 0x6c, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x73, 0x20, 0x3d,
+ 0x20, 0x73, 0x2e, 0x2e, 0x6a, 0x73, 0x74, 0x72, 0x20, 0x65, 0x6e, 0x64,
+ 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72,
+ 0x6e, 0x20, 0x73, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20,
+ 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x65, 0x6e, 0x61, 0x74, 0x65, 0x20,
+ 0x61, 0x6c, 0x6c, 0x20, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65,
+ 0x72, 0x73, 0x2c, 0x20, 0x66, 0x6f, 0x6c, 0x6c, 0x6f, 0x77, 0x69, 0x6e,
+ 0x67, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x20, 0x72, 0x75, 0x6c,
+ 0x65, 0x73, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20,
+ 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x20,
+ 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c, 0x20, 0x2e, 0x2e, 0x2e, 0x29, 0x0a,
+ 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x69, 0x3d, 0x31, 0x0a, 0x20,
+ 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20, 0x69, 0x3c, 0x3d, 0x61, 0x72, 0x67,
+ 0x2e, 0x6e, 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x5f,
+ 0x63, 0x6f, 0x6e, 0x74, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x6e, 0x6f, 0x74,
+ 0x20, 0x73, 0x74, 0x72, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x5f, 0x63, 0x6f,
+ 0x6e, 0x74, 0x2c, 0x27, 0x5b, 0x25, 0x28, 0x2c, 0x22, 0x5d, 0x27, 0x29,
+ 0x20, 0x61, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x73, 0x74,
+ 0x72, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x61, 0x72, 0x67, 0x5b, 0x69, 0x5d,
+ 0x2c, 0x22, 0x5e, 0x5b, 0x25, 0x61, 0x5f, 0x7e, 0x5d, 0x22, 0x29, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x20, 0x20, 0x20, 0x6c, 0x69,
+ 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x6c, 0x69, 0x6e, 0x65, 0x20, 0x2e, 0x2e,
+ 0x20, 0x27, 0x20, 0x27, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20,
+ 0x20, 0x6c, 0x69, 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x6c, 0x69, 0x6e, 0x65,
+ 0x20, 0x2e, 0x2e, 0x20, 0x61, 0x72, 0x67, 0x5b, 0x69, 0x5d, 0x0a, 0x20,
+ 0x20, 0x69, 0x66, 0x20, 0x61, 0x72, 0x67, 0x5b, 0x69, 0x5d, 0x20, 0x7e,
+ 0x3d, 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20,
+ 0x20, 0x5f, 0x63, 0x6f, 0x6e, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72,
+ 0x73, 0x75, 0x62, 0x28, 0x61, 0x72, 0x67, 0x5b, 0x69, 0x5d, 0x2c, 0x2d,
+ 0x31, 0x2c, 0x2d, 0x31, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a,
+ 0x20, 0x20, 0x69, 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a, 0x20, 0x65,
+ 0x6e, 0x64, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x74, 0x72, 0x66, 0x69,
+ 0x6e, 0x64, 0x28, 0x61, 0x72, 0x67, 0x5b, 0x61, 0x72, 0x67, 0x2e, 0x6e,
+ 0x5d, 0x2c, 0x22, 0x5b, 0x25, 0x2f, 0x25, 0x29, 0x25, 0x3b, 0x25, 0x7b,
+ 0x25, 0x7d, 0x5d, 0x24, 0x22, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x20, 0x20, 0x5f, 0x63, 0x6f, 0x6e, 0x74, 0x3d, 0x6e, 0x69, 0x6c, 0x20,
+ 0x6c, 0x69, 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x6c, 0x69, 0x6e, 0x65, 0x20,
+ 0x2e, 0x2e, 0x20, 0x27, 0x5c, 0x6e, 0x27, 0x0a, 0x20, 0x65, 0x6e, 0x64,
+ 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x6c, 0x69, 0x6e,
+ 0x65, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x6f, 0x75,
+ 0x74, 0x70, 0x75, 0x74, 0x20, 0x6c, 0x69, 0x6e, 0x65, 0x0a, 0x66, 0x75,
+ 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75,
+ 0x74, 0x20, 0x28, 0x2e, 0x2e, 0x2e, 0x29, 0x0a, 0x20, 0x6c, 0x6f, 0x63,
+ 0x61, 0x6c, 0x20, 0x69, 0x3d, 0x31, 0x0a, 0x20, 0x77, 0x68, 0x69, 0x6c,
+ 0x65, 0x20, 0x69, 0x3c, 0x3d, 0x61, 0x72, 0x67, 0x2e, 0x6e, 0x20, 0x64,
+ 0x6f, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x5f, 0x63, 0x6f, 0x6e, 0x74,
+ 0x20, 0x61, 0x6e, 0x64, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x73, 0x74, 0x72,
+ 0x66, 0x69, 0x6e, 0x64, 0x28, 0x5f, 0x63, 0x6f, 0x6e, 0x74, 0x2c, 0x27,
+ 0x5b, 0x25, 0x28, 0x2c, 0x22, 0x5d, 0x27, 0x29, 0x20, 0x61, 0x6e, 0x64,
+ 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x73, 0x74, 0x72, 0x66, 0x69, 0x6e,
+ 0x64, 0x28, 0x61, 0x72, 0x67, 0x5b, 0x69, 0x5d, 0x2c, 0x22, 0x5e, 0x5b,
+ 0x25, 0x61, 0x5f, 0x7e, 0x5d, 0x22, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e,
+ 0x0a, 0x09, 0x20, 0x20, 0x20, 0x20, 0x77, 0x72, 0x69, 0x74, 0x65, 0x28,
+ 0x27, 0x20, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20,
+ 0x20, 0x77, 0x72, 0x69, 0x74, 0x65, 0x28, 0x61, 0x72, 0x67, 0x5b, 0x69,
+ 0x5d, 0x29, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x61, 0x72, 0x67, 0x5b,
+ 0x69, 0x5d, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x5f, 0x63, 0x6f, 0x6e, 0x74, 0x20, 0x3d,
+ 0x20, 0x73, 0x74, 0x72, 0x73, 0x75, 0x62, 0x28, 0x61, 0x72, 0x67, 0x5b,
+ 0x69, 0x5d, 0x2c, 0x2d, 0x31, 0x2c, 0x2d, 0x31, 0x29, 0x0a, 0x20, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x69, 0x20, 0x3d, 0x20, 0x69, 0x2b,
+ 0x31, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73,
+ 0x74, 0x72, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x61, 0x72, 0x67, 0x5b, 0x61,
+ 0x72, 0x67, 0x2e, 0x6e, 0x5d, 0x2c, 0x22, 0x5b, 0x25, 0x2f, 0x25, 0x29,
+ 0x25, 0x3b, 0x25, 0x7b, 0x25, 0x7d, 0x5d, 0x24, 0x22, 0x29, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x5f, 0x63, 0x6f, 0x6e, 0x74, 0x3d,
+ 0x6e, 0x69, 0x6c, 0x20, 0x77, 0x72, 0x69, 0x74, 0x65, 0x28, 0x27, 0x5c,
+ 0x6e, 0x27, 0x29, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x65, 0x6e, 0x64,
+ 0x0a, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x67,
+ 0x65, 0x74, 0x5f, 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x79, 0x5f,
+ 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x73, 0x28, 0x70, 0x74, 0x79, 0x70,
+ 0x65, 0x2c, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a, 0x0a, 0x09, 0x69,
+ 0x66, 0x20, 0x67, 0x65, 0x74, 0x5f, 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72,
+ 0x74, 0x79, 0x5f, 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x73, 0x5f, 0x68,
+ 0x6f, 0x6f, 0x6b, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x67, 0x65, 0x74, 0x5f,
+ 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x79, 0x5f, 0x6d, 0x65, 0x74,
+ 0x68, 0x6f, 0x64, 0x73, 0x5f, 0x68, 0x6f, 0x6f, 0x6b, 0x28, 0x70, 0x74,
+ 0x79, 0x70, 0x65, 0x2c, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20,
+ 0x67, 0x65, 0x74, 0x5f, 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x79,
+ 0x5f, 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x73, 0x5f, 0x68, 0x6f, 0x6f,
+ 0x6b, 0x28, 0x70, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x20, 0x6e, 0x61, 0x6d,
+ 0x65, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x69, 0x66,
+ 0x20, 0x70, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x3d, 0x20, 0x22, 0x64,
+ 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74, 0x22, 0x20, 0x74, 0x68, 0x65, 0x6e,
+ 0x20, 0x2d, 0x2d, 0x20, 0x67, 0x65, 0x74, 0x5f, 0x6e, 0x61, 0x6d, 0x65,
+ 0x2c, 0x20, 0x73, 0x65, 0x74, 0x5f, 0x6e, 0x61, 0x6d, 0x65, 0x0a, 0x09,
+ 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x22, 0x67, 0x65, 0x74,
+ 0x5f, 0x22, 0x2e, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x20, 0x22, 0x73,
+ 0x65, 0x74, 0x5f, 0x22, 0x2e, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x0a, 0x09,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x70, 0x74, 0x79,
+ 0x70, 0x65, 0x20, 0x3d, 0x3d, 0x20, 0x22, 0x71, 0x74, 0x22, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x20, 0x2d, 0x2d, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x2c,
+ 0x20, 0x73, 0x65, 0x74, 0x4e, 0x61, 0x6d, 0x65, 0x0a, 0x09, 0x09, 0x72,
+ 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x20,
+ 0x22, 0x73, 0x65, 0x74, 0x22, 0x2e, 0x2e, 0x73, 0x74, 0x72, 0x69, 0x6e,
+ 0x67, 0x2e, 0x75, 0x70, 0x70, 0x65, 0x72, 0x28, 0x73, 0x74, 0x72, 0x69,
+ 0x6e, 0x67, 0x2e, 0x73, 0x75, 0x62, 0x28, 0x6e, 0x61, 0x6d, 0x65, 0x2c,
+ 0x20, 0x31, 0x2c, 0x20, 0x31, 0x29, 0x29, 0x2e, 0x2e, 0x73, 0x74, 0x72,
+ 0x69, 0x6e, 0x67, 0x2e, 0x73, 0x75, 0x62, 0x28, 0x6e, 0x61, 0x6d, 0x65,
+ 0x2c, 0x20, 0x32, 0x2c, 0x20, 0x2d, 0x31, 0x29, 0x0a, 0x09, 0x65, 0x6e,
+ 0x64, 0x0a, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x70, 0x74, 0x79, 0x70, 0x65,
+ 0x20, 0x3d, 0x3d, 0x20, 0x22, 0x6f, 0x76, 0x65, 0x72, 0x6c, 0x6f, 0x61,
+ 0x64, 0x22, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x2d, 0x2d, 0x20, 0x6e,
+ 0x61, 0x6d, 0x65, 0x2c, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x0a, 0x09, 0x09,
+ 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x2c,
+ 0x6e, 0x61, 0x6d, 0x65, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09,
+ 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x6e, 0x69, 0x6c, 0x0a, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x2d, 0x2d, 0x2d, 0x2d, 0x2d, 0x2d,
+ 0x2d, 0x2d, 0x2d, 0x2d, 0x2d, 0x2d, 0x20, 0x74, 0x68, 0x65, 0x20, 0x68,
+ 0x6f, 0x6f, 0x6b, 0x73, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x61, 0x6c,
+ 0x6c, 0x65, 0x64, 0x20, 0x72, 0x69, 0x67, 0x68, 0x74, 0x20, 0x61, 0x66,
+ 0x74, 0x65, 0x72, 0x20, 0x70, 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, 0x69,
+ 0x6e, 0x67, 0x20, 0x74, 0x68, 0x65, 0x20, 0x24, 0x5b, 0x69, 0x63, 0x68,
+ 0x6c, 0x5d, 0x66, 0x69, 0x6c, 0x65, 0x20, 0x64, 0x69, 0x72, 0x65, 0x63,
+ 0x74, 0x69, 0x76, 0x65, 0x73, 0x2c, 0x0a, 0x2d, 0x2d, 0x20, 0x72, 0x69,
+ 0x67, 0x68, 0x74, 0x20, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x20, 0x70,
+ 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, 0x69, 0x6e, 0x67, 0x20, 0x61, 0x6e,
+ 0x79, 0x74, 0x68, 0x69, 0x6e, 0x67, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x0a,
+ 0x2d, 0x2d, 0x20, 0x74, 0x61, 0x6b, 0x65, 0x73, 0x20, 0x74, 0x68, 0x65,
+ 0x20, 0x70, 0x61, 0x63, 0x6b, 0x61, 0x67, 0x65, 0x20, 0x6f, 0x62, 0x6a,
+ 0x65, 0x63, 0x74, 0x20, 0x61, 0x73, 0x20, 0x74, 0x68, 0x65, 0x20, 0x70,
+ 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72, 0x0a, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x70, 0x72, 0x65, 0x70, 0x72, 0x6f,
+ 0x63, 0x65, 0x73, 0x73, 0x5f, 0x68, 0x6f, 0x6f, 0x6b, 0x28, 0x70, 0x29,
+ 0x0a, 0x09, 0x2d, 0x2d, 0x20, 0x70, 0x2e, 0x63, 0x6f, 0x64, 0x65, 0x20,
+ 0x68, 0x61, 0x73, 0x20, 0x61, 0x6c, 0x6c, 0x20, 0x74, 0x68, 0x65, 0x20,
+ 0x69, 0x6e, 0x70, 0x75, 0x74, 0x20, 0x63, 0x6f, 0x64, 0x65, 0x20, 0x66,
+ 0x72, 0x6f, 0x6d, 0x20, 0x74, 0x68, 0x65, 0x20, 0x70, 0x6b, 0x67, 0x0a,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x61, 0x6c,
+ 0x6c, 0x65, 0x64, 0x20, 0x66, 0x6f, 0x72, 0x20, 0x65, 0x76, 0x65, 0x72,
+ 0x79, 0x20, 0x24, 0x69, 0x66, 0x69, 0x6c, 0x65, 0x20, 0x64, 0x69, 0x72,
+ 0x65, 0x63, 0x74, 0x69, 0x76, 0x65, 0x0a, 0x2d, 0x2d, 0x20, 0x74, 0x61,
+ 0x6b, 0x65, 0x73, 0x20, 0x61, 0x20, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x20,
+ 0x77, 0x69, 0x74, 0x68, 0x20, 0x61, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e,
+ 0x67, 0x20, 0x63, 0x61, 0x6c, 0x6c, 0x65, 0x64, 0x20, 0x27, 0x63, 0x6f,
+ 0x64, 0x65, 0x27, 0x20, 0x69, 0x6e, 0x73, 0x69, 0x64, 0x65, 0x2c, 0x20,
+ 0x74, 0x68, 0x65, 0x20, 0x66, 0x69, 0x6c, 0x65, 0x6e, 0x61, 0x6d, 0x65,
+ 0x2c, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x61, 0x6e, 0x79, 0x20, 0x65, 0x78,
+ 0x74, 0x72, 0x61, 0x20, 0x61, 0x72, 0x67, 0x75, 0x6d, 0x65, 0x6e, 0x74,
+ 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x70, 0x61, 0x73, 0x73, 0x65, 0x64, 0x20,
+ 0x74, 0x6f, 0x20, 0x24, 0x69, 0x66, 0x69, 0x6c, 0x65, 0x2e, 0x20, 0x6e,
+ 0x6f, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x76, 0x61, 0x6c,
+ 0x75, 0x65, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20,
+ 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x5f, 0x66, 0x69, 0x6c, 0x65,
+ 0x5f, 0x68, 0x6f, 0x6f, 0x6b, 0x28, 0x74, 0x2c, 0x20, 0x66, 0x69, 0x6c,
+ 0x65, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x20, 0x2e, 0x2e, 0x2e, 0x29, 0x0a,
+ 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x61, 0x6c,
+ 0x6c, 0x65, 0x64, 0x20, 0x61, 0x66, 0x74, 0x65, 0x72, 0x20, 0x70, 0x72,
+ 0x6f, 0x63, 0x65, 0x73, 0x73, 0x69, 0x6e, 0x67, 0x20, 0x61, 0x6e, 0x79,
+ 0x74, 0x68, 0x69, 0x6e, 0x67, 0x20, 0x74, 0x68, 0x61, 0x74, 0x27, 0x73,
+ 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x63, 0x6f, 0x64, 0x65, 0x20, 0x28, 0x6c,
+ 0x69, 0x6b, 0x65, 0x20, 0x27, 0x24, 0x72, 0x65, 0x6e, 0x61, 0x6d, 0x69,
+ 0x6e, 0x67, 0x27, 0x2c, 0x20, 0x63, 0x6f, 0x6d, 0x6d, 0x65, 0x6e, 0x74,
+ 0x73, 0x2c, 0x20, 0x65, 0x74, 0x63, 0x29, 0x0a, 0x2d, 0x2d, 0x20, 0x61,
+ 0x6e, 0x64, 0x20, 0x72, 0x69, 0x67, 0x68, 0x74, 0x20, 0x62, 0x65, 0x66,
+ 0x6f, 0x72, 0x65, 0x20, 0x70, 0x61, 0x72, 0x73, 0x69, 0x6e, 0x67, 0x20,
+ 0x74, 0x68, 0x65, 0x20, 0x61, 0x63, 0x74, 0x75, 0x61, 0x6c, 0x20, 0x63,
+ 0x6f, 0x64, 0x65, 0x2e, 0x0a, 0x2d, 0x2d, 0x20, 0x74, 0x61, 0x6b, 0x65,
+ 0x73, 0x20, 0x74, 0x68, 0x65, 0x20, 0x50, 0x61, 0x63, 0x6b, 0x61, 0x67,
+ 0x65, 0x20, 0x6f, 0x62, 0x6a, 0x65, 0x63, 0x74, 0x20, 0x77, 0x69, 0x74,
+ 0x68, 0x20, 0x61, 0x6c, 0x6c, 0x20, 0x74, 0x68, 0x65, 0x20, 0x63, 0x6f,
+ 0x64, 0x65, 0x20, 0x6f, 0x6e, 0x20, 0x74, 0x68, 0x65, 0x20, 0x27, 0x63,
+ 0x6f, 0x64, 0x65, 0x27, 0x20, 0x6b, 0x65, 0x79, 0x2e, 0x20, 0x6e, 0x6f,
+ 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x76, 0x61, 0x6c, 0x75,
+ 0x65, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x70,
+ 0x72, 0x65, 0x70, 0x61, 0x72, 0x73, 0x65, 0x5f, 0x68, 0x6f, 0x6f, 0x6b,
+ 0x28, 0x70, 0x61, 0x63, 0x6b, 0x61, 0x67, 0x65, 0x29, 0x0a, 0x0a, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x61, 0x6c, 0x6c, 0x65,
+ 0x64, 0x20, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x20, 0x73, 0x74, 0x61,
+ 0x72, 0x74, 0x69, 0x6e, 0x67, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x70, 0x72,
+ 0x65, 0x5f, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x5f, 0x68, 0x6f, 0x6f,
+ 0x6b, 0x28, 0x70, 0x61, 0x63, 0x6b, 0x61, 0x67, 0x65, 0x29, 0x0a, 0x0a,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x61, 0x6c, 0x6c,
+ 0x65, 0x64, 0x20, 0x61, 0x66, 0x74, 0x65, 0x72, 0x20, 0x77, 0x72, 0x69,
+ 0x74, 0x69, 0x6e, 0x67, 0x20, 0x61, 0x6c, 0x6c, 0x20, 0x74, 0x68, 0x65,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x2e, 0x0a, 0x2d, 0x2d, 0x20,
+ 0x74, 0x61, 0x6b, 0x65, 0x73, 0x20, 0x74, 0x68, 0x65, 0x20, 0x50, 0x61,
+ 0x63, 0x6b, 0x61, 0x67, 0x65, 0x20, 0x6f, 0x62, 0x6a, 0x65, 0x63, 0x74,
+ 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x70, 0x6f,
+ 0x73, 0x74, 0x5f, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x5f, 0x68, 0x6f,
+ 0x6f, 0x6b, 0x28, 0x70, 0x61, 0x63, 0x6b, 0x61, 0x67, 0x65, 0x29, 0x0a,
+ 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x61,
+ 0x6c, 0x6c, 0x65, 0x64, 0x20, 0x66, 0x72, 0x6f, 0x6d, 0x20, 0x27, 0x67,
+ 0x65, 0x74, 0x5f, 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x79, 0x5f,
+ 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x73, 0x27, 0x20, 0x74, 0x6f, 0x20,
+ 0x67, 0x65, 0x74, 0x20, 0x74, 0x68, 0x65, 0x20, 0x6d, 0x65, 0x74, 0x68,
+ 0x6f, 0x64, 0x73, 0x20, 0x74, 0x6f, 0x20, 0x72, 0x65, 0x74, 0x72, 0x69,
+ 0x65, 0x76, 0x65, 0x20, 0x61, 0x20, 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72,
+ 0x74, 0x79, 0x0a, 0x2d, 0x2d, 0x20, 0x61, 0x63, 0x63, 0x6f, 0x72, 0x64,
+ 0x69, 0x6e, 0x67, 0x20, 0x74, 0x6f, 0x20, 0x69, 0x74, 0x73, 0x20, 0x74,
+ 0x79, 0x70, 0x65, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x67, 0x65, 0x74, 0x5f, 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74,
+ 0x79, 0x5f, 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x73, 0x5f, 0x68, 0x6f,
+ 0x6f, 0x6b, 0x28, 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x79, 0x5f,
+ 0x74, 0x79, 0x70, 0x65, 0x2c, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a,
+ 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x61, 0x6c,
+ 0x6c, 0x65, 0x64, 0x20, 0x66, 0x72, 0x6f, 0x6d, 0x20, 0x43, 0x6c, 0x61,
+ 0x73, 0x73, 0x43, 0x6f, 0x6e, 0x74, 0x61, 0x69, 0x6e, 0x65, 0x72, 0x3a,
+ 0x64, 0x6f, 0x70, 0x61, 0x72, 0x73, 0x65, 0x20, 0x77, 0x69, 0x74, 0x68,
+ 0x20, 0x74, 0x68, 0x65, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x20,
+ 0x62, 0x65, 0x69, 0x6e, 0x67, 0x20, 0x70, 0x61, 0x72, 0x73, 0x65, 0x64,
+ 0x0a, 0x2d, 0x2d, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x6e,
+ 0x69, 0x6c, 0x2c, 0x20, 0x6f, 0x72, 0x20, 0x61, 0x20, 0x73, 0x75, 0x62,
+ 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x20, 0x70, 0x61, 0x72, 0x73, 0x65, 0x72, 0x5f, 0x68,
+ 0x6f, 0x6f, 0x6b, 0x28, 0x73, 0x29, 0x0a, 0x0a, 0x09, 0x72, 0x65, 0x74,
+ 0x75, 0x72, 0x6e, 0x20, 0x6e, 0x69, 0x6c, 0x0a, 0x65, 0x6e, 0x64, 0x0a,
+ 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x61, 0x6c, 0x6c, 0x65, 0x64, 0x20, 0x66,
+ 0x72, 0x6f, 0x6d, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x46, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x73, 0x75, 0x70, 0x63, 0x6f, 0x64,
+ 0x65, 0x2c, 0x20, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x20, 0x74, 0x68,
+ 0x65, 0x20, 0x63, 0x61, 0x6c, 0x6c, 0x20, 0x74, 0x6f, 0x20, 0x74, 0x68,
+ 0x65, 0x20, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x69,
+ 0x73, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x0a, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x70, 0x72, 0x65, 0x5f, 0x63, 0x61,
+ 0x6c, 0x6c, 0x5f, 0x68, 0x6f, 0x6f, 0x6b, 0x28, 0x66, 0x29, 0x0a, 0x0a,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x61, 0x6c, 0x6c,
+ 0x65, 0x64, 0x20, 0x66, 0x72, 0x6f, 0x6d, 0x20, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x46, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x73, 0x75,
+ 0x70, 0x63, 0x6f, 0x64, 0x65, 0x2c, 0x20, 0x61, 0x66, 0x74, 0x65, 0x72,
+ 0x20, 0x74, 0x68, 0x65, 0x20, 0x63, 0x61, 0x6c, 0x6c, 0x20, 0x74, 0x6f,
+ 0x20, 0x74, 0x68, 0x65, 0x20, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f,
+ 0x6e, 0x20, 0x69, 0x73, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x0a,
+ 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x70, 0x6f, 0x73,
+ 0x74, 0x5f, 0x63, 0x61, 0x6c, 0x6c, 0x5f, 0x68, 0x6f, 0x6f, 0x6b, 0x28,
+ 0x66, 0x29, 0x0a, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20,
+ 0x63, 0x61, 0x6c, 0x6c, 0x65, 0x64, 0x20, 0x62, 0x65, 0x66, 0x6f, 0x72,
+ 0x65, 0x20, 0x74, 0x68, 0x65, 0x20, 0x72, 0x65, 0x67, 0x69, 0x73, 0x74,
+ 0x65, 0x72, 0x20, 0x63, 0x6f, 0x64, 0x65, 0x20, 0x69, 0x73, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69,
+ 0x6f, 0x6e, 0x20, 0x70, 0x72, 0x65, 0x5f, 0x72, 0x65, 0x67, 0x69, 0x73,
+ 0x74, 0x65, 0x72, 0x5f, 0x68, 0x6f, 0x6f, 0x6b, 0x28, 0x70, 0x61, 0x63,
+ 0x6b, 0x61, 0x67, 0x65, 0x29, 0x0a, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a,
+ 0x2d, 0x2d, 0x20, 0x63, 0x61, 0x6c, 0x6c, 0x65, 0x64, 0x20, 0x74, 0x6f,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x20, 0x61, 0x6e, 0x20, 0x65,
+ 0x72, 0x72, 0x6f, 0x72, 0x20, 0x6d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65,
+ 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x6f, 0x75,
+ 0x74, 0x70, 0x75, 0x74, 0x5f, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x68,
+ 0x6f, 0x6f, 0x6b, 0x28, 0x2e, 0x2e, 0x2e, 0x29, 0x0a, 0x09, 0x72, 0x65,
+ 0x74, 0x75, 0x72, 0x6e, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e,
+ 0x66, 0x6f, 0x72, 0x6d, 0x61, 0x74, 0x28, 0x2e, 0x2e, 0x2e, 0x29, 0x0a,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x75, 0x73, 0x74,
+ 0x6f, 0x6d, 0x20, 0x70, 0x75, 0x73, 0x68, 0x65, 0x72, 0x73, 0x0a, 0x0a,
+ 0x5f, 0x70, 0x75, 0x73, 0x68, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69,
+ 0x6f, 0x6e, 0x73, 0x20, 0x3d, 0x20, 0x7b, 0x7d, 0x0a, 0x5f, 0x69, 0x73,
+ 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x20, 0x3d,
+ 0x20, 0x7b, 0x7d, 0x0a, 0x5f, 0x65, 0x6e, 0x75, 0x6d, 0x73, 0x20, 0x3d,
+ 0x20, 0x7b, 0x7d, 0x0a, 0x5f, 0x74, 0x6f, 0x5f, 0x66, 0x75, 0x6e, 0x63,
+ 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x20, 0x3d, 0x20, 0x7b, 0x7d, 0x0a, 0x0a,
+ 0x5f, 0x62, 0x61, 0x73, 0x65, 0x5f, 0x70, 0x75, 0x73, 0x68, 0x5f, 0x66,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x20, 0x3d, 0x20, 0x7b,
+ 0x7d, 0x0a, 0x5f, 0x62, 0x61, 0x73, 0x65, 0x5f, 0x69, 0x73, 0x5f, 0x66,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x20, 0x3d, 0x20, 0x7b,
+ 0x7d, 0x0a, 0x5f, 0x62, 0x61, 0x73, 0x65, 0x5f, 0x74, 0x6f, 0x5f, 0x66,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x20, 0x3d, 0x20, 0x7b,
+ 0x7d, 0x0a, 0x0a, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68,
+ 0x5f, 0x62, 0x61, 0x73, 0x65, 0x28, 0x74, 0x2c, 0x20, 0x66, 0x75, 0x6e,
+ 0x63, 0x73, 0x29, 0x0a, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20, 0x3d, 0x20, 0x5f, 0x67, 0x6c, 0x6f,
+ 0x62, 0x61, 0x6c, 0x5f, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x65, 0x73, 0x5b,
+ 0x74, 0x5d, 0x0a, 0x0a, 0x09, 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20, 0x63,
+ 0x6c, 0x61, 0x73, 0x73, 0x20, 0x64, 0x6f, 0x0a, 0x09, 0x09, 0x69, 0x66,
+ 0x20, 0x66, 0x75, 0x6e, 0x63, 0x73, 0x5b, 0x63, 0x6c, 0x61, 0x73, 0x73,
+ 0x2e, 0x74, 0x79, 0x70, 0x65, 0x5d, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x09, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x66, 0x75,
+ 0x6e, 0x63, 0x73, 0x5b, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x2e, 0x74, 0x79,
+ 0x70, 0x65, 0x5d, 0x0a, 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x09,
+ 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20, 0x3d, 0x20, 0x5f, 0x67, 0x6c, 0x6f,
+ 0x62, 0x61, 0x6c, 0x5f, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x65, 0x73, 0x5b,
+ 0x63, 0x6c, 0x61, 0x73, 0x73, 0x2e, 0x62, 0x74, 0x79, 0x70, 0x65, 0x5d,
+ 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72,
+ 0x6e, 0x20, 0x6e, 0x69, 0x6c, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x66,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x67, 0x65, 0x74, 0x5f,
+ 0x70, 0x75, 0x73, 0x68, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f,
+ 0x6e, 0x28, 0x74, 0x29, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e,
+ 0x20, 0x5f, 0x70, 0x75, 0x73, 0x68, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x73, 0x5b, 0x74, 0x5d, 0x20, 0x6f, 0x72, 0x20, 0x73,
+ 0x65, 0x61, 0x72, 0x63, 0x68, 0x5f, 0x62, 0x61, 0x73, 0x65, 0x28, 0x74,
+ 0x2c, 0x20, 0x5f, 0x62, 0x61, 0x73, 0x65, 0x5f, 0x70, 0x75, 0x73, 0x68,
+ 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x29, 0x20,
+ 0x6f, 0x72, 0x20, 0x22, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x70, 0x75,
+ 0x73, 0x68, 0x75, 0x73, 0x65, 0x72, 0x74, 0x79, 0x70, 0x65, 0x22, 0x0a,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f,
+ 0x6e, 0x20, 0x67, 0x65, 0x74, 0x5f, 0x74, 0x6f, 0x5f, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x28, 0x74, 0x29, 0x0a, 0x09, 0x72, 0x65,
+ 0x74, 0x75, 0x72, 0x6e, 0x20, 0x5f, 0x74, 0x6f, 0x5f, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x5b, 0x74, 0x5d, 0x20, 0x6f, 0x72,
+ 0x20, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x5f, 0x62, 0x61, 0x73, 0x65,
+ 0x28, 0x74, 0x2c, 0x20, 0x5f, 0x62, 0x61, 0x73, 0x65, 0x5f, 0x74, 0x6f,
+ 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x29, 0x20,
+ 0x6f, 0x72, 0x20, 0x22, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x74, 0x6f,
+ 0x75, 0x73, 0x65, 0x72, 0x74, 0x79, 0x70, 0x65, 0x22, 0x0a, 0x65, 0x6e,
+ 0x64, 0x0a, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20,
+ 0x67, 0x65, 0x74, 0x5f, 0x69, 0x73, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x28, 0x74, 0x29, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x5f,
+ 0x65, 0x6e, 0x75, 0x6d, 0x73, 0x5b, 0x74, 0x5d, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x22,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x69, 0x73, 0x22, 0x20, 0x2e, 0x2e,
+ 0x20, 0x74, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x72, 0x65, 0x74,
+ 0x75, 0x72, 0x6e, 0x20, 0x5f, 0x69, 0x73, 0x5f, 0x66, 0x75, 0x6e, 0x63,
+ 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x5b, 0x74, 0x5d, 0x20, 0x6f, 0x72, 0x20,
+ 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x5f, 0x62, 0x61, 0x73, 0x65, 0x28,
+ 0x74, 0x2c, 0x20, 0x5f, 0x62, 0x61, 0x73, 0x65, 0x5f, 0x69, 0x73, 0x5f,
+ 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x29, 0x20, 0x6f,
+ 0x72, 0x20, 0x22, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x69, 0x73, 0x75,
+ 0x73, 0x65, 0x72, 0x74, 0x79, 0x70, 0x65, 0x22, 0x0a, 0x65, 0x6e, 0x64,
+ 0x0a
+};
+unsigned int lua_basic_lua_len = 9073;
diff --git a/lib/tolua++/src/bin/declaration_lua.h b/lib/tolua++/src/bin/declaration_lua.h
new file mode 100644
index 000000000..28deb4f60
--- /dev/null
+++ b/lib/tolua++/src/bin/declaration_lua.h
@@ -0,0 +1,1265 @@
+static const unsigned char lua_declaration_lua[] = {
+ 0x2d, 0x2d, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x3a, 0x20, 0x64, 0x65,
+ 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c,
+ 0x61, 0x73, 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x57, 0x72, 0x69, 0x74, 0x74,
+ 0x65, 0x6e, 0x20, 0x62, 0x79, 0x20, 0x57, 0x61, 0x6c, 0x64, 0x65, 0x6d,
+ 0x61, 0x72, 0x20, 0x43, 0x65, 0x6c, 0x65, 0x73, 0x0a, 0x2d, 0x2d, 0x20,
+ 0x54, 0x65, 0x43, 0x47, 0x72, 0x61, 0x66, 0x2f, 0x50, 0x55, 0x43, 0x2d,
+ 0x52, 0x69, 0x6f, 0x0a, 0x2d, 0x2d, 0x20, 0x4a, 0x75, 0x6c, 0x20, 0x31,
+ 0x39, 0x39, 0x38, 0x0a, 0x2d, 0x2d, 0x20, 0x24, 0x49, 0x64, 0x3a, 0x20,
+ 0x24, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x54, 0x68, 0x69, 0x73, 0x20, 0x63,
+ 0x6f, 0x64, 0x65, 0x20, 0x69, 0x73, 0x20, 0x66, 0x72, 0x65, 0x65, 0x20,
+ 0x73, 0x6f, 0x66, 0x74, 0x77, 0x61, 0x72, 0x65, 0x3b, 0x20, 0x79, 0x6f,
+ 0x75, 0x20, 0x63, 0x61, 0x6e, 0x20, 0x72, 0x65, 0x64, 0x69, 0x73, 0x74,
+ 0x72, 0x69, 0x62, 0x75, 0x74, 0x65, 0x20, 0x69, 0x74, 0x20, 0x61, 0x6e,
+ 0x64, 0x2f, 0x6f, 0x72, 0x20, 0x6d, 0x6f, 0x64, 0x69, 0x66, 0x79, 0x20,
+ 0x69, 0x74, 0x2e, 0x0a, 0x2d, 0x2d, 0x20, 0x54, 0x68, 0x65, 0x20, 0x73,
+ 0x6f, 0x66, 0x74, 0x77, 0x61, 0x72, 0x65, 0x20, 0x70, 0x72, 0x6f, 0x76,
+ 0x69, 0x64, 0x65, 0x64, 0x20, 0x68, 0x65, 0x72, 0x65, 0x75, 0x6e, 0x64,
+ 0x65, 0x72, 0x20, 0x69, 0x73, 0x20, 0x6f, 0x6e, 0x20, 0x61, 0x6e, 0x20,
+ 0x22, 0x61, 0x73, 0x20, 0x69, 0x73, 0x22, 0x20, 0x62, 0x61, 0x73, 0x69,
+ 0x73, 0x2c, 0x20, 0x61, 0x6e, 0x64, 0x0a, 0x2d, 0x2d, 0x20, 0x74, 0x68,
+ 0x65, 0x20, 0x61, 0x75, 0x74, 0x68, 0x6f, 0x72, 0x20, 0x68, 0x61, 0x73,
+ 0x20, 0x6e, 0x6f, 0x20, 0x6f, 0x62, 0x6c, 0x69, 0x67, 0x61, 0x74, 0x69,
+ 0x6f, 0x6e, 0x20, 0x74, 0x6f, 0x20, 0x70, 0x72, 0x6f, 0x76, 0x69, 0x64,
+ 0x65, 0x20, 0x6d, 0x61, 0x69, 0x6e, 0x74, 0x65, 0x6e, 0x61, 0x6e, 0x63,
+ 0x65, 0x2c, 0x20, 0x73, 0x75, 0x70, 0x70, 0x6f, 0x72, 0x74, 0x2c, 0x20,
+ 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x73, 0x2c, 0x0a, 0x2d, 0x2d, 0x20,
+ 0x65, 0x6e, 0x68, 0x61, 0x6e, 0x63, 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x73,
+ 0x2c, 0x20, 0x6f, 0x72, 0x20, 0x6d, 0x6f, 0x64, 0x69, 0x66, 0x69, 0x63,
+ 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x2e, 0x0a, 0x0a, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x52, 0x65,
+ 0x70, 0x72, 0x65, 0x73, 0x65, 0x6e, 0x74, 0x73, 0x20, 0x76, 0x61, 0x72,
+ 0x69, 0x61, 0x62, 0x6c, 0x65, 0x2c, 0x20, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x2c, 0x20, 0x6f, 0x72, 0x20, 0x61, 0x72, 0x67, 0x75,
+ 0x6d, 0x65, 0x6e, 0x74, 0x20, 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61,
+ 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x0a, 0x2d, 0x2d, 0x20, 0x53, 0x74, 0x6f,
+ 0x72, 0x65, 0x73, 0x20, 0x74, 0x68, 0x65, 0x20, 0x66, 0x6f, 0x6c, 0x6c,
+ 0x6f, 0x77, 0x69, 0x6e, 0x67, 0x20, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x73,
+ 0x3a, 0x0a, 0x2d, 0x2d, 0x20, 0x20, 0x6d, 0x6f, 0x64, 0x20, 0x20, 0x3d,
+ 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x6d, 0x6f, 0x64, 0x69, 0x66, 0x69,
+ 0x65, 0x72, 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x20, 0x74, 0x79, 0x70, 0x65,
+ 0x20, 0x3d, 0x20, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x2d, 0x2d, 0x20, 0x20,
+ 0x70, 0x74, 0x72, 0x20, 0x20, 0x3d, 0x20, 0x22, 0x2a, 0x22, 0x20, 0x6f,
+ 0x72, 0x20, 0x22, 0x26, 0x22, 0x2c, 0x20, 0x69, 0x66, 0x20, 0x72, 0x65,
+ 0x70, 0x72, 0x65, 0x73, 0x65, 0x6e, 0x74, 0x69, 0x6e, 0x67, 0x20, 0x61,
+ 0x20, 0x70, 0x6f, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x20, 0x6f, 0x72, 0x20,
+ 0x61, 0x20, 0x72, 0x65, 0x66, 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x0a,
+ 0x2d, 0x2d, 0x20, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x6e,
+ 0x61, 0x6d, 0x65, 0x0a, 0x2d, 0x2d, 0x20, 0x20, 0x64, 0x69, 0x6d, 0x20,
+ 0x20, 0x3d, 0x20, 0x64, 0x69, 0x6d, 0x65, 0x6e, 0x73, 0x69, 0x6f, 0x6e,
+ 0x2c, 0x20, 0x69, 0x66, 0x20, 0x61, 0x20, 0x76, 0x65, 0x63, 0x74, 0x6f,
+ 0x72, 0x0a, 0x2d, 0x2d, 0x20, 0x20, 0x64, 0x65, 0x66, 0x20, 0x20, 0x3d,
+ 0x20, 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74, 0x20, 0x76, 0x61, 0x6c,
+ 0x75, 0x65, 0x2c, 0x20, 0x69, 0x66, 0x20, 0x61, 0x6e, 0x79, 0x20, 0x28,
+ 0x6f, 0x6e, 0x6c, 0x79, 0x20, 0x66, 0x6f, 0x72, 0x20, 0x61, 0x72, 0x67,
+ 0x75, 0x6d, 0x65, 0x6e, 0x74, 0x73, 0x29, 0x0a, 0x2d, 0x2d, 0x20, 0x20,
+ 0x72, 0x65, 0x74, 0x20, 0x20, 0x3d, 0x20, 0x22, 0x2a, 0x22, 0x20, 0x6f,
+ 0x72, 0x20, 0x22, 0x26, 0x22, 0x2c, 0x20, 0x69, 0x66, 0x20, 0x76, 0x61,
+ 0x6c, 0x75, 0x65, 0x20, 0x69, 0x73, 0x20, 0x74, 0x6f, 0x20, 0x62, 0x65,
+ 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x65, 0x64, 0x20, 0x28, 0x6f,
+ 0x6e, 0x6c, 0x79, 0x20, 0x66, 0x6f, 0x72, 0x20, 0x61, 0x72, 0x67, 0x75,
+ 0x6d, 0x65, 0x6e, 0x74, 0x73, 0x29, 0x0a, 0x63, 0x6c, 0x61, 0x73, 0x73,
+ 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x20,
+ 0x3d, 0x20, 0x7b, 0x0a, 0x20, 0x6d, 0x6f, 0x64, 0x20, 0x3d, 0x20, 0x27,
+ 0x27, 0x2c, 0x0a, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x27,
+ 0x27, 0x2c, 0x0a, 0x20, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x20, 0x27, 0x27,
+ 0x2c, 0x0a, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x27, 0x27,
+ 0x2c, 0x0a, 0x20, 0x64, 0x69, 0x6d, 0x20, 0x3d, 0x20, 0x27, 0x27, 0x2c,
+ 0x0a, 0x20, 0x72, 0x65, 0x74, 0x20, 0x3d, 0x20, 0x27, 0x27, 0x2c, 0x0a,
+ 0x20, 0x64, 0x65, 0x66, 0x20, 0x3d, 0x20, 0x27, 0x27, 0x0a, 0x7d, 0x0a,
+ 0x63, 0x6c, 0x61, 0x73, 0x73, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61,
+ 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x5f, 0x5f, 0x69, 0x6e, 0x64, 0x65, 0x78,
+ 0x20, 0x3d, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x44, 0x65, 0x63, 0x6c,
+ 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x0a, 0x73, 0x65, 0x74, 0x6d,
+ 0x65, 0x74, 0x61, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x28, 0x63, 0x6c, 0x61,
+ 0x73, 0x73, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f,
+ 0x6e, 0x2c, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x46, 0x65, 0x61, 0x74, 0x75,
+ 0x72, 0x65, 0x29, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x43, 0x72, 0x65, 0x61,
+ 0x74, 0x65, 0x20, 0x61, 0x6e, 0x20, 0x75, 0x6e, 0x69, 0x71, 0x75, 0x65,
+ 0x20, 0x76, 0x61, 0x72, 0x69, 0x61, 0x62, 0x6c, 0x65, 0x20, 0x6e, 0x61,
+ 0x6d, 0x65, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20,
+ 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x5f, 0x76, 0x61, 0x72, 0x6e, 0x61,
+ 0x6d, 0x65, 0x20, 0x28, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x6e, 0x6f,
+ 0x74, 0x20, 0x5f, 0x76, 0x61, 0x72, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x5f, 0x76, 0x61, 0x72, 0x6e, 0x75,
+ 0x6d, 0x62, 0x65, 0x72, 0x20, 0x3d, 0x20, 0x30, 0x20, 0x65, 0x6e, 0x64,
+ 0x0a, 0x20, 0x5f, 0x76, 0x61, 0x72, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72,
+ 0x20, 0x3d, 0x20, 0x5f, 0x76, 0x61, 0x72, 0x6e, 0x75, 0x6d, 0x62, 0x65,
+ 0x72, 0x20, 0x2b, 0x20, 0x31, 0x0a, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72,
+ 0x6e, 0x20, 0x22, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x76, 0x61, 0x72,
+ 0x5f, 0x22, 0x2e, 0x2e, 0x5f, 0x76, 0x61, 0x72, 0x6e, 0x75, 0x6d, 0x62,
+ 0x65, 0x72, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x43,
+ 0x68, 0x65, 0x63, 0x6b, 0x20, 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61,
+ 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x49, 0x74, 0x20, 0x61, 0x6c, 0x73, 0x6f, 0x20, 0x69, 0x64, 0x65,
+ 0x6e, 0x74, 0x69, 0x66, 0x69, 0x65, 0x73, 0x20, 0x64, 0x65, 0x66, 0x61,
+ 0x75, 0x6c, 0x74, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x73, 0x0a, 0x66,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+ 0x3a, 0x63, 0x68, 0x65, 0x63, 0x6b, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x28,
+ 0x29, 0x0a, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x74, 0x72, 0x73, 0x75,
+ 0x62, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c,
+ 0x31, 0x2c, 0x31, 0x29, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x5b, 0x27, 0x20,
+ 0x61, 0x6e, 0x64, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x66, 0x69, 0x6e, 0x64,
+ 0x74, 0x79, 0x70, 0x65, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79,
+ 0x70, 0x65, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2e, 0x2e, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x0a, 0x20, 0x20, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x6d, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69,
+ 0x74, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x27,
+ 0x25, 0x73, 0x25, 0x73, 0x2a, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x6d, 0x5b,
+ 0x6d, 0x2e, 0x6e, 0x5d, 0x0a, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x6d, 0x6f, 0x64, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74,
+ 0x28, 0x6d, 0x2c, 0x31, 0x2c, 0x6d, 0x2e, 0x6e, 0x2d, 0x31, 0x29, 0x0a,
+ 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x28, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x27, 0x3d, 0x27,
+ 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x74, 0x2e, 0x6e, 0x3d, 0x3d, 0x32,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x74, 0x5b, 0x31, 0x5d,
+ 0x0a, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x65, 0x66, 0x20,
+ 0x3d, 0x20, 0x66, 0x69, 0x6e, 0x64, 0x5f, 0x65, 0x6e, 0x75, 0x6d, 0x5f,
+ 0x76, 0x61, 0x72, 0x28, 0x74, 0x5b, 0x74, 0x2e, 0x6e, 0x5d, 0x29, 0x0a,
+ 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x62, 0x2c, 0x65, 0x2c, 0x64, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72,
+ 0x66, 0x69, 0x6e, 0x64, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61,
+ 0x6d, 0x65, 0x2c, 0x22, 0x25, 0x5b, 0x28, 0x2e, 0x2d, 0x29, 0x25, 0x5d,
+ 0x22, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x62, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d,
+ 0x65, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x73, 0x75, 0x62, 0x28, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x31, 0x2c, 0x62,
+ 0x2d, 0x31, 0x29, 0x0a, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64,
+ 0x69, 0x6d, 0x20, 0x3d, 0x20, 0x66, 0x69, 0x6e, 0x64, 0x5f, 0x65, 0x6e,
+ 0x75, 0x6d, 0x5f, 0x76, 0x61, 0x72, 0x28, 0x64, 0x29, 0x0a, 0x20, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27,
+ 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79,
+ 0x70, 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64, 0x27,
+ 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61,
+ 0x6d, 0x65, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d,
+ 0x65, 0x20, 0x3d, 0x20, 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x5f, 0x76,
+ 0x61, 0x72, 0x6e, 0x61, 0x6d, 0x65, 0x28, 0x29, 0x0a, 0x20, 0x65, 0x6c,
+ 0x73, 0x65, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6b, 0x69,
+ 0x6e, 0x64, 0x3d, 0x3d, 0x27, 0x76, 0x61, 0x72, 0x27, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x74, 0x79, 0x70, 0x65, 0x3d, 0x3d, 0x27, 0x27, 0x20, 0x61, 0x6e,
+ 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x7e,
+ 0x3d, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2e, 0x2e, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x0a, 0x20, 0x20, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20,
+ 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x5f, 0x76, 0x61, 0x72, 0x6e, 0x61,
+ 0x6d, 0x65, 0x28, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x69,
+ 0x66, 0x20, 0x66, 0x69, 0x6e, 0x64, 0x74, 0x79, 0x70, 0x65, 0x28, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x3d, 0x3d, 0x27, 0x27, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x3d, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d,
+ 0x65, 0x0a, 0x20, 0x20, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2e, 0x2e, 0x27, 0x20, 0x27,
+ 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x63, 0x72, 0x65, 0x61, 0x74,
+ 0x65, 0x5f, 0x76, 0x61, 0x72, 0x6e, 0x61, 0x6d, 0x65, 0x28, 0x29, 0x0a,
+ 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a,
+ 0x20, 0x2d, 0x2d, 0x20, 0x61, 0x64, 0x6a, 0x75, 0x73, 0x74, 0x20, 0x74,
+ 0x79, 0x70, 0x65, 0x20, 0x6f, 0x66, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e,
+ 0x67, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74,
+ 0x79, 0x70, 0x65, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x63, 0x68, 0x61, 0x72,
+ 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64,
+ 0x69, 0x6d, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x09, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x3d, 0x20, 0x27, 0x63, 0x68, 0x61, 0x72, 0x2a, 0x27, 0x0a,
+ 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x6b, 0x69, 0x6e, 0x64, 0x20, 0x61, 0x6e, 0x64, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6b, 0x69, 0x6e, 0x64, 0x20, 0x3d, 0x3d,
+ 0x20, 0x27, 0x76, 0x61, 0x72, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x09, 0x09, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20,
+ 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75,
+ 0x62, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c,
+ 0x20, 0x22, 0x3a, 0x2e, 0x2a, 0x24, 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29,
+ 0x20, 0x2d, 0x2d, 0x20, 0x3f, 0x3f, 0x3f, 0x0a, 0x09, 0x65, 0x6e, 0x64,
+ 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x43, 0x68, 0x65,
+ 0x63, 0x6b, 0x20, 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69,
+ 0x6f, 0x6e, 0x20, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x2d, 0x2d, 0x20, 0x53,
+ 0x75, 0x62, 0x73, 0x74, 0x69, 0x74, 0x75, 0x74, 0x65, 0x73, 0x20, 0x74,
+ 0x79, 0x70, 0x65, 0x64, 0x65, 0x66, 0x27, 0x73, 0x2e, 0x0a, 0x66, 0x75,
+ 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73,
+ 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x3a,
+ 0x63, 0x68, 0x65, 0x63, 0x6b, 0x74, 0x79, 0x70, 0x65, 0x20, 0x28, 0x29,
+ 0x0a, 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65, 0x63, 0x6b, 0x20,
+ 0x69, 0x66, 0x20, 0x74, 0x68, 0x65, 0x72, 0x65, 0x20, 0x69, 0x73, 0x20,
+ 0x61, 0x20, 0x70, 0x6f, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x20, 0x74, 0x6f,
+ 0x20, 0x62, 0x61, 0x73, 0x69, 0x63, 0x20, 0x74, 0x79, 0x70, 0x65, 0x0a,
+ 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x62, 0x61, 0x73, 0x69, 0x63,
+ 0x20, 0x3d, 0x20, 0x69, 0x73, 0x62, 0x61, 0x73, 0x69, 0x63, 0x28, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x20, 0x69,
+ 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6b, 0x69, 0x6e, 0x64, 0x20,
+ 0x3d, 0x3d, 0x20, 0x27, 0x66, 0x75, 0x6e, 0x63, 0x27, 0x20, 0x61, 0x6e,
+ 0x64, 0x20, 0x62, 0x61, 0x73, 0x69, 0x63, 0x3d, 0x3d, 0x27, 0x6e, 0x75,
+ 0x6d, 0x62, 0x65, 0x72, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x74,
+ 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x2c, 0x20, 0x22, 0x25, 0x2a, 0x22,
+ 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x09, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x27, 0x5f, 0x75,
+ 0x73, 0x65, 0x72, 0x64, 0x61, 0x74, 0x61, 0x27, 0x0a, 0x20, 0x09, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x20, 0x22, 0x22,
+ 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x62, 0x61,
+ 0x73, 0x69, 0x63, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x70, 0x74, 0x72, 0x7e, 0x3d, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x72, 0x65, 0x74,
+ 0x20, 0x3d, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x0a,
+ 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x20, 0x3d,
+ 0x20, 0x6e, 0x69, 0x6c, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x69, 0x73,
+ 0x62, 0x61, 0x73, 0x69, 0x63, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74,
+ 0x79, 0x70, 0x65, 0x29, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d,
+ 0x62, 0x65, 0x72, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20,
+ 0x09, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e,
+ 0x5f, 0x75, 0x73, 0x65, 0x72, 0x64, 0x61, 0x74, 0x61, 0x20, 0x3d, 0x20,
+ 0x74, 0x72, 0x75, 0x65, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65,
+ 0x63, 0x6b, 0x20, 0x69, 0x66, 0x20, 0x74, 0x68, 0x65, 0x72, 0x65, 0x20,
+ 0x69, 0x73, 0x20, 0x61, 0x72, 0x72, 0x61, 0x79, 0x20, 0x74, 0x6f, 0x20,
+ 0x62, 0x65, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x65, 0x64, 0x0a,
+ 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d,
+ 0x7e, 0x3d, 0x27, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x72, 0x65, 0x74, 0x7e, 0x3d, 0x27, 0x27, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x28,
+ 0x27, 0x23, 0x69, 0x6e, 0x76, 0x61, 0x6c, 0x69, 0x64, 0x20, 0x70, 0x61,
+ 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72, 0x3a, 0x20, 0x63, 0x61, 0x6e,
+ 0x6e, 0x6f, 0x74, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x61,
+ 0x6e, 0x20, 0x61, 0x72, 0x72, 0x61, 0x79, 0x20, 0x6f, 0x66, 0x20, 0x76,
+ 0x61, 0x6c, 0x75, 0x65, 0x73, 0x27, 0x29, 0x0a, 0x20, 0x65, 0x6e, 0x64,
+ 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x72, 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65,
+ 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64, 0x2a, 0x27, 0x20, 0x61, 0x6e, 0x64,
+ 0x20, 0x27, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2a, 0x27, 0x0a, 0x20,
+ 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65,
+ 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x5f, 0x75, 0x73, 0x65, 0x72, 0x64, 0x61,
+ 0x74, 0x61, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x27, 0x76, 0x6f,
+ 0x69, 0x64, 0x2a, 0x27, 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x69, 0x66,
+ 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d,
+ 0x3d, 0x20, 0x27, 0x5f, 0x63, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x27,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74,
+ 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x27, 0x63, 0x68, 0x61, 0x72, 0x2a,
+ 0x27, 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x69, 0x66, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x3d, 0x20, 0x27,
+ 0x5f, 0x6c, 0x73, 0x74, 0x61, 0x74, 0x65, 0x27, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20,
+ 0x3d, 0x20, 0x27, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x74, 0x61, 0x74, 0x65,
+ 0x2a, 0x27, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x2d, 0x2d,
+ 0x20, 0x72, 0x65, 0x73, 0x6f, 0x6c, 0x76, 0x65, 0x20, 0x74, 0x79, 0x70,
+ 0x65, 0x73, 0x20, 0x69, 0x6e, 0x73, 0x69, 0x64, 0x65, 0x20, 0x74, 0x68,
+ 0x65, 0x20, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74, 0x65, 0x73, 0x0a,
+ 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x72, 0x65, 0x73,
+ 0x6f, 0x6c, 0x76, 0x65, 0x5f, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74,
+ 0x65, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x73, 0x28, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a,
+ 0x0a, 0x2d, 0x2d, 0x0a, 0x2d, 0x2d, 0x20, 0x2d, 0x2d, 0x20, 0x69, 0x66,
+ 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x69, 0x6e, 0x67, 0x20, 0x76,
+ 0x61, 0x6c, 0x75, 0x65, 0x2c, 0x20, 0x61, 0x75, 0x74, 0x6f, 0x6d, 0x61,
+ 0x74, 0x69, 0x63, 0x61, 0x6c, 0x6c, 0x79, 0x20, 0x73, 0x65, 0x74, 0x20,
+ 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74, 0x20, 0x76, 0x61, 0x6c, 0x75,
+ 0x65, 0x0a, 0x2d, 0x2d, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x72, 0x65, 0x74, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x61,
+ 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x65, 0x66, 0x20,
+ 0x3d, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x2d,
+ 0x2d, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x65, 0x66, 0x20,
+ 0x3d, 0x20, 0x27, 0x30, 0x27, 0x0a, 0x2d, 0x2d, 0x20, 0x65, 0x6e, 0x64,
+ 0x0a, 0x2d, 0x2d, 0x0a, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x66, 0x75,
+ 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x72, 0x65, 0x73, 0x6f, 0x6c,
+ 0x76, 0x65, 0x5f, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74, 0x65, 0x5f,
+ 0x74, 0x79, 0x70, 0x65, 0x73, 0x28, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a,
+ 0x0a, 0x09, 0x69, 0x66, 0x20, 0x69, 0x73, 0x62, 0x61, 0x73, 0x69, 0x63,
+ 0x28, 0x74, 0x79, 0x70, 0x65, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x74, 0x79, 0x70,
+ 0x65, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x62, 0x2c, 0x5f, 0x2c, 0x6d, 0x20, 0x3d, 0x20, 0x73, 0x74,
+ 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x74, 0x79,
+ 0x70, 0x65, 0x2c, 0x20, 0x22, 0x28, 0x25, 0x62, 0x3c, 0x3e, 0x29, 0x22,
+ 0x29, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x62, 0x20, 0x74, 0x68, 0x65, 0x6e,
+ 0x0a, 0x0a, 0x09, 0x09, 0x6d, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69,
+ 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x73, 0x28, 0x73,
+ 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x73, 0x75, 0x62, 0x28, 0x6d, 0x2c,
+ 0x20, 0x32, 0x2c, 0x20, 0x2d, 0x32, 0x29, 0x2c, 0x20, 0x22, 0x2c, 0x22,
+ 0x29, 0x0a, 0x09, 0x09, 0x66, 0x6f, 0x72, 0x20, 0x69, 0x3d, 0x31, 0x2c,
+ 0x20, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x2e, 0x67, 0x65, 0x74, 0x6e, 0x28,
+ 0x6d, 0x29, 0x20, 0x64, 0x6f, 0x0a, 0x09, 0x09, 0x09, 0x6d, 0x5b, 0x69,
+ 0x5d, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67,
+ 0x73, 0x75, 0x62, 0x28, 0x6d, 0x5b, 0x69, 0x5d, 0x2c, 0x22, 0x25, 0x73,
+ 0x2a, 0x28, 0x5b, 0x25, 0x2a, 0x26, 0x5d, 0x29, 0x22, 0x2c, 0x20, 0x22,
+ 0x25, 0x31, 0x22, 0x29, 0x0a, 0x09, 0x09, 0x09, 0x69, 0x66, 0x20, 0x6e,
+ 0x6f, 0x74, 0x20, 0x69, 0x73, 0x62, 0x61, 0x73, 0x69, 0x63, 0x28, 0x6d,
+ 0x5b, 0x69, 0x5d, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09,
+ 0x09, 0x09, 0x69, 0x66, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x69, 0x73, 0x65,
+ 0x6e, 0x75, 0x6d, 0x28, 0x6d, 0x5b, 0x69, 0x5d, 0x29, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x20, 0x5f, 0x2c, 0x20, 0x6d, 0x5b, 0x69, 0x5d, 0x20, 0x3d,
+ 0x20, 0x61, 0x70, 0x70, 0x6c, 0x79, 0x74, 0x79, 0x70, 0x65, 0x64, 0x65,
+ 0x66, 0x28, 0x22, 0x22, 0x2c, 0x20, 0x6d, 0x5b, 0x69, 0x5d, 0x29, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x09, 0x09, 0x09, 0x6d, 0x5b, 0x69, 0x5d,
+ 0x20, 0x3d, 0x20, 0x66, 0x69, 0x6e, 0x64, 0x74, 0x79, 0x70, 0x65, 0x28,
+ 0x6d, 0x5b, 0x69, 0x5d, 0x29, 0x20, 0x6f, 0x72, 0x20, 0x6d, 0x5b, 0x69,
+ 0x5d, 0x0a, 0x09, 0x09, 0x09, 0x09, 0x6d, 0x5b, 0x69, 0x5d, 0x20, 0x3d,
+ 0x20, 0x72, 0x65, 0x73, 0x6f, 0x6c, 0x76, 0x65, 0x5f, 0x74, 0x65, 0x6d,
+ 0x70, 0x6c, 0x61, 0x74, 0x65, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x73, 0x28,
+ 0x6d, 0x5b, 0x69, 0x5d, 0x29, 0x0a, 0x09, 0x09, 0x09, 0x65, 0x6e, 0x64,
+ 0x0a, 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x09, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x62, 0x2c, 0x69, 0x0a, 0x09, 0x09, 0x74, 0x79,
+ 0x70, 0x65, 0x2c, 0x62, 0x2c, 0x69, 0x20, 0x3d, 0x20, 0x62, 0x72, 0x65,
+ 0x61, 0x6b, 0x5f, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74, 0x65, 0x28,
+ 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x2d, 0x2d, 0x70, 0x72, 0x69, 0x6e,
+ 0x74, 0x28, 0x22, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x20, 0x69, 0x73,
+ 0x20, 0x22, 0x2c, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x28, 0x6d, 0x2c,
+ 0x20, 0x31, 0x2c, 0x20, 0x6d, 0x2e, 0x6e, 0x29, 0x29, 0x0a, 0x09, 0x09,
+ 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61,
+ 0x74, 0x65, 0x5f, 0x70, 0x61, 0x72, 0x74, 0x20, 0x3d, 0x20, 0x22, 0x3c,
+ 0x22, 0x2e, 0x2e, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x28, 0x6d, 0x2c,
+ 0x20, 0x31, 0x2c, 0x20, 0x6d, 0x2e, 0x6e, 0x2c, 0x20, 0x22, 0x2c, 0x22,
+ 0x29, 0x2e, 0x2e, 0x22, 0x3e, 0x22, 0x0a, 0x09, 0x09, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x3d, 0x20, 0x72, 0x65, 0x62, 0x75, 0x69, 0x6c, 0x64, 0x5f,
+ 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74, 0x65, 0x28, 0x74, 0x79, 0x70,
+ 0x65, 0x2c, 0x20, 0x62, 0x2c, 0x20, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61,
+ 0x74, 0x65, 0x5f, 0x70, 0x61, 0x72, 0x74, 0x29, 0x0a, 0x09, 0x09, 0x74,
+ 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67,
+ 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x20,
+ 0x22, 0x3e, 0x3e, 0x22, 0x2c, 0x20, 0x22, 0x3e, 0x20, 0x3e, 0x22, 0x29,
+ 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72,
+ 0x6e, 0x20, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a,
+ 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x62, 0x72, 0x65,
+ 0x61, 0x6b, 0x5f, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74, 0x65, 0x28,
+ 0x73, 0x29, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x62, 0x2c,
+ 0x65, 0x2c, 0x74, 0x69, 0x6d, 0x70, 0x6c, 0x20, 0x3d, 0x20, 0x73, 0x74,
+ 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x73, 0x2c,
+ 0x20, 0x22, 0x28, 0x25, 0x62, 0x3c, 0x3e, 0x29, 0x22, 0x29, 0x0a, 0x09,
+ 0x69, 0x66, 0x20, 0x74, 0x69, 0x6d, 0x70, 0x6c, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x09, 0x09, 0x73, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69,
+ 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x73, 0x2c, 0x20, 0x22,
+ 0x25, 0x62, 0x3c, 0x3e, 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29, 0x0a, 0x09,
+ 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x73, 0x2c, 0x20, 0x62,
+ 0x2c, 0x20, 0x74, 0x69, 0x6d, 0x70, 0x6c, 0x0a, 0x09, 0x65, 0x6c, 0x73,
+ 0x65, 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x73,
+ 0x2c, 0x20, 0x30, 0x2c, 0x20, 0x6e, 0x69, 0x6c, 0x0a, 0x09, 0x65, 0x6e,
+ 0x64, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x20, 0x72, 0x65, 0x62, 0x75, 0x69, 0x6c, 0x64, 0x5f,
+ 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74, 0x65, 0x28, 0x73, 0x2c, 0x20,
+ 0x62, 0x2c, 0x20, 0x74, 0x69, 0x6d, 0x70, 0x6c, 0x29, 0x0a, 0x0a, 0x09,
+ 0x69, 0x66, 0x20, 0x62, 0x20, 0x3d, 0x3d, 0x20, 0x30, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20,
+ 0x73, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x72, 0x65, 0x74,
+ 0x75, 0x72, 0x6e, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x73,
+ 0x75, 0x62, 0x28, 0x73, 0x2c, 0x20, 0x31, 0x2c, 0x20, 0x62, 0x2d, 0x31,
+ 0x29, 0x2e, 0x2e, 0x74, 0x69, 0x6d, 0x70, 0x6c, 0x2e, 0x2e, 0x73, 0x74,
+ 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x73, 0x75, 0x62, 0x28, 0x73, 0x2c, 0x20,
+ 0x62, 0x2c, 0x20, 0x2d, 0x31, 0x29, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a,
+ 0x2d, 0x2d, 0x20, 0x50, 0x72, 0x69, 0x6e, 0x74, 0x20, 0x6d, 0x65, 0x74,
+ 0x68, 0x6f, 0x64, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72,
+ 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x20,
+ 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2c, 0x63, 0x6c, 0x6f, 0x73, 0x65,
+ 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65,
+ 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61,
+ 0x74, 0x69, 0x6f, 0x6e, 0x7b, 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69,
+ 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20,
+ 0x6d, 0x6f, 0x64, 0x20, 0x20, 0x3d, 0x20, 0x27, 0x22, 0x2e, 0x2e, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x2e, 0x2e, 0x22, 0x27, 0x2c,
+ 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64,
+ 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20,
+ 0x3d, 0x20, 0x27, 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74,
+ 0x79, 0x70, 0x65, 0x2e, 0x2e, 0x22, 0x27, 0x2c, 0x22, 0x29, 0x0a, 0x20,
+ 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e,
+ 0x2e, 0x22, 0x20, 0x70, 0x74, 0x72, 0x20, 0x20, 0x3d, 0x20, 0x27, 0x22,
+ 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x2e, 0x2e,
+ 0x22, 0x27, 0x2c, 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74,
+ 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20, 0x6e, 0x61,
+ 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x27, 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2e, 0x2e, 0x22, 0x27, 0x2c, 0x22,
+ 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65,
+ 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20, 0x64, 0x69, 0x6d, 0x20, 0x20, 0x3d,
+ 0x20, 0x27, 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69,
+ 0x6d, 0x2e, 0x2e, 0x22, 0x27, 0x2c, 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72,
+ 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22,
+ 0x20, 0x64, 0x65, 0x66, 0x20, 0x20, 0x3d, 0x20, 0x27, 0x22, 0x2e, 0x2e,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x65, 0x66, 0x2e, 0x2e, 0x22, 0x27,
+ 0x2c, 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69,
+ 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20, 0x72, 0x65, 0x74, 0x20,
+ 0x20, 0x3d, 0x20, 0x27, 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x72, 0x65, 0x74, 0x2e, 0x2e, 0x22, 0x27, 0x2c, 0x22, 0x29, 0x0a, 0x20,
+ 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e,
+ 0x2e, 0x22, 0x7d, 0x22, 0x2e, 0x2e, 0x63, 0x6c, 0x6f, 0x73, 0x65, 0x29,
+ 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65,
+ 0x63, 0x6b, 0x20, 0x69, 0x66, 0x20, 0x61, 0x72, 0x72, 0x61, 0x79, 0x20,
+ 0x6f, 0x66, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x73, 0x20, 0x61, 0x72,
+ 0x65, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x65, 0x64, 0x20, 0x74,
+ 0x6f, 0x20, 0x4c, 0x75, 0x61, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69,
+ 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x44, 0x65, 0x63, 0x6c,
+ 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x72, 0x65, 0x71, 0x75,
+ 0x69, 0x72, 0x65, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f,
+ 0x6e, 0x20, 0x28, 0x74, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x63,
+ 0x6f, 0x6e, 0x73, 0x74, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x0a, 0x09, 0x20,
+ 0x20, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x20,
+ 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d,
+ 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x0a, 0x09,
+ 0x09, 0x09, 0x09, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x69, 0x73, 0x62, 0x61,
+ 0x73, 0x69, 0x63, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70,
+ 0x65, 0x29, 0x20, 0x61, 0x6e, 0x64, 0x0a, 0x09, 0x09, 0x09, 0x09, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x3d, 0x20,
+ 0x27, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x3a,
+ 0x63, 0x68, 0x65, 0x63, 0x6b, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63,
+ 0x5f, 0x61, 0x63, 0x63, 0x65, 0x73, 0x73, 0x28, 0x29, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74,
+ 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x22, 0x25, 0x73,
+ 0x2a, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x25, 0x73, 0x2b, 0x22, 0x2c, 0x22,
+ 0x22, 0x29, 0x0a, 0x09, 0x09, 0x74, 0x5b, 0x74, 0x79, 0x70, 0x65, 0x5d,
+ 0x20, 0x3d, 0x20, 0x22, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x63, 0x6f,
+ 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x5f, 0x22, 0x20, 0x2e, 0x2e, 0x20, 0x63,
+ 0x6c, 0x65, 0x61, 0x6e, 0x5f, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74,
+ 0x65, 0x28, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x09, 0x09, 0x72, 0x65,
+ 0x74, 0x75, 0x72, 0x6e, 0x20, 0x74, 0x72, 0x75, 0x65, 0x0a, 0x09, 0x65,
+ 0x6e, 0x64, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x66,
+ 0x61, 0x6c, 0x73, 0x65, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x65, 0x20, 0x74, 0x61, 0x67,
+ 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c,
+ 0x61, 0x73, 0x73, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69,
+ 0x6f, 0x6e, 0x3a, 0x64, 0x65, 0x63, 0x6c, 0x74, 0x79, 0x70, 0x65, 0x20,
+ 0x28, 0x29, 0x0a, 0x0a, 0x09, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79,
+ 0x70, 0x65, 0x20, 0x3d, 0x20, 0x74, 0x79, 0x70, 0x65, 0x76, 0x61, 0x72,
+ 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a,
+ 0x09, 0x69, 0x66, 0x20, 0x73, 0x74, 0x72, 0x66, 0x69, 0x6e, 0x64, 0x28,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x27, 0x63, 0x6f,
+ 0x6e, 0x73, 0x74, 0x27, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09,
+ 0x09, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d,
+ 0x20, 0x27, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x27, 0x2e, 0x2e, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x09, 0x09, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x20, 0x3d, 0x20, 0x67, 0x73,
+ 0x75, 0x62, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x2c,
+ 0x27, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x25, 0x73, 0x2a, 0x27, 0x2c, 0x27,
+ 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x65, 0x6e, 0x64, 0x0a,
+ 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x20,
+ 0x74, 0x79, 0x70, 0x65, 0x20, 0x63, 0x68, 0x65, 0x63, 0x6b, 0x69, 0x6e,
+ 0x67, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63,
+ 0x6c, 0x61, 0x73, 0x73, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74,
+ 0x69, 0x6f, 0x6e, 0x3a, 0x6f, 0x75, 0x74, 0x63, 0x68, 0x65, 0x63, 0x6b,
+ 0x74, 0x79, 0x70, 0x65, 0x20, 0x28, 0x6e, 0x61, 0x72, 0x67, 0x29, 0x0a,
+ 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x64, 0x65, 0x66, 0x0a, 0x20,
+ 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x69, 0x73,
+ 0x62, 0x61, 0x73, 0x69, 0x63, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74,
+ 0x79, 0x70, 0x65, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x64, 0x65, 0x66, 0x7e, 0x3d, 0x27, 0x27, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x64, 0x65, 0x66, 0x20, 0x3d, 0x20, 0x31,
+ 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x20, 0x20, 0x64, 0x65, 0x66,
+ 0x20, 0x3d, 0x20, 0x30, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x69,
+ 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x20, 0x7e,
+ 0x3d, 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x2d,
+ 0x2d, 0x69, 0x66, 0x20, 0x74, 0x3d, 0x3d, 0x27, 0x73, 0x74, 0x72, 0x69,
+ 0x6e, 0x67, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x2d, 0x2d,
+ 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x27, 0x74, 0x6f, 0x6c,
+ 0x75, 0x61, 0x5f, 0x69, 0x73, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x61,
+ 0x72, 0x72, 0x61, 0x79, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53,
+ 0x2c, 0x27, 0x2e, 0x2e, 0x6e, 0x61, 0x72, 0x67, 0x2e, 0x2e, 0x27, 0x2c,
+ 0x27, 0x2e, 0x2e, 0x64, 0x65, 0x66, 0x2e, 0x2e, 0x27, 0x2c, 0x26, 0x74,
+ 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65, 0x72, 0x72, 0x29, 0x27, 0x0a, 0x09,
+ 0x2d, 0x2d, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x20, 0x27, 0x21, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x69,
+ 0x73, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61,
+ 0x5f, 0x53, 0x2c, 0x27, 0x2e, 0x2e, 0x6e, 0x61, 0x72, 0x67, 0x2e, 0x2e,
+ 0x27, 0x2c, 0x30, 0x2c, 0x26, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65,
+ 0x72, 0x72, 0x29, 0x27, 0x0a, 0x20, 0x09, 0x2d, 0x2d, 0x65, 0x6e, 0x64,
+ 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x69, 0x66, 0x20, 0x69, 0x73, 0x65,
+ 0x6e, 0x75, 0x6d, 0x74, 0x79, 0x70, 0x65, 0x28, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x20, 0x7e, 0x3d, 0x20, 0x6e, 0x69,
+ 0x6c, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x09, 0x72, 0x65, 0x74,
+ 0x75, 0x72, 0x6e, 0x20, 0x27, 0x21, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x69, 0x73, 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79,
+ 0x70, 0x65, 0x2e, 0x2e, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x53, 0x2c, 0x27, 0x2e, 0x2e, 0x6e, 0x61, 0x72, 0x67, 0x2e, 0x2e, 0x27,
+ 0x2c, 0x27, 0x2e, 0x2e, 0x64, 0x65, 0x66, 0x2e, 0x2e, 0x27, 0x2c, 0x26,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65, 0x72, 0x72, 0x29, 0x27, 0x0a,
+ 0x20, 0x65, 0x6c, 0x73, 0x65, 0x69, 0x66, 0x20, 0x74, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x27,
+ 0x21, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x69, 0x73, 0x27, 0x2e, 0x2e,
+ 0x74, 0x2e, 0x2e, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53,
+ 0x2c, 0x27, 0x2e, 0x2e, 0x6e, 0x61, 0x72, 0x67, 0x2e, 0x2e, 0x27, 0x2c,
+ 0x27, 0x2e, 0x2e, 0x64, 0x65, 0x66, 0x2e, 0x2e, 0x27, 0x2c, 0x26, 0x74,
+ 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65, 0x72, 0x72, 0x29, 0x27, 0x0a, 0x20,
+ 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x69, 0x73, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x20, 0x3d, 0x20, 0x67,
+ 0x65, 0x74, 0x5f, 0x69, 0x73, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69,
+ 0x6f, 0x6e, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65,
+ 0x29, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x70, 0x74, 0x72, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x26, 0x27, 0x20, 0x6f,
+ 0x72, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x20, 0x3d,
+ 0x3d, 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20,
+ 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x27, 0x28, 0x74, 0x6f,
+ 0x6c, 0x75, 0x61, 0x5f, 0x69, 0x73, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x6e,
+ 0x69, 0x6c, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x27,
+ 0x2e, 0x2e, 0x6e, 0x61, 0x72, 0x67, 0x2e, 0x2e, 0x27, 0x2c, 0x26, 0x74,
+ 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65, 0x72, 0x72, 0x29, 0x20, 0x7c, 0x7c,
+ 0x20, 0x21, 0x27, 0x2e, 0x2e, 0x69, 0x73, 0x5f, 0x66, 0x75, 0x6e, 0x63,
+ 0x2e, 0x2e, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c,
+ 0x27, 0x2e, 0x2e, 0x6e, 0x61, 0x72, 0x67, 0x2e, 0x2e, 0x27, 0x2c, 0x22,
+ 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65,
+ 0x2e, 0x2e, 0x27, 0x22, 0x2c, 0x27, 0x2e, 0x2e, 0x64, 0x65, 0x66, 0x2e,
+ 0x2e, 0x27, 0x2c, 0x26, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65, 0x72,
+ 0x72, 0x29, 0x29, 0x27, 0x0a, 0x20, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x0a,
+ 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x27, 0x21, 0x27, 0x2e,
+ 0x2e, 0x69, 0x73, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x2e, 0x2e, 0x27, 0x28,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x27, 0x2e, 0x2e, 0x6e,
+ 0x61, 0x72, 0x67, 0x2e, 0x2e, 0x27, 0x2c, 0x22, 0x27, 0x2e, 0x2e, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2e, 0x2e, 0x27, 0x22,
+ 0x2c, 0x27, 0x2e, 0x2e, 0x64, 0x65, 0x66, 0x2e, 0x2e, 0x27, 0x2c, 0x26,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65, 0x72, 0x72, 0x29, 0x27, 0x0a,
+ 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72,
+ 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x62, 0x75, 0x69, 0x6c, 0x64, 0x64,
+ 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x28,
+ 0x6e, 0x61, 0x72, 0x67, 0x2c, 0x20, 0x63, 0x70, 0x6c, 0x75, 0x73, 0x70,
+ 0x6c, 0x75, 0x73, 0x29, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x61, 0x72, 0x72, 0x61, 0x79, 0x20, 0x3d, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x64, 0x69, 0x6d, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x61,
+ 0x6e, 0x64, 0x20, 0x74, 0x6f, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x28,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x29, 0x3d, 0x3d, 0x6e,
+ 0x69, 0x6c, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6c, 0x69,
+ 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x22, 0x22, 0x0a, 0x20, 0x6c, 0x6f, 0x63,
+ 0x61, 0x6c, 0x20, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x20, 0x27, 0x27, 0x0a,
+ 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6d, 0x6f, 0x64, 0x0a, 0x20,
+ 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d,
+ 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x20,
+ 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6e, 0x63, 0x74, 0x79, 0x70, 0x65,
+ 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x27, 0x63, 0x6f, 0x6e, 0x73, 0x74,
+ 0x25, 0x73, 0x2b, 0x27, 0x2c, 0x27, 0x27, 0x29, 0x0a, 0x20, 0x69, 0x66,
+ 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x20, 0x7e, 0x3d,
+ 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x74,
+ 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x27, 0x63, 0x6f,
+ 0x6e, 0x73, 0x74, 0x25, 0x73, 0x2b, 0x27, 0x2c, 0x27, 0x27, 0x29, 0x20,
+ 0x20, 0x2d, 0x2d, 0x20, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x6e, 0x61, 0x74,
+ 0x65, 0x73, 0x20, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x6d, 0x6f, 0x64,
+ 0x69, 0x66, 0x69, 0x65, 0x72, 0x20, 0x66, 0x6f, 0x72, 0x20, 0x61, 0x72,
+ 0x72, 0x61, 0x79, 0x73, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x69,
+ 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x7e, 0x3d,
+ 0x27, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x69,
+ 0x73, 0x62, 0x61, 0x73, 0x69, 0x63, 0x28, 0x74, 0x79, 0x70, 0x65, 0x29,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x20,
+ 0x27, 0x2a, 0x27, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x6c, 0x69, 0x6e,
+ 0x65, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x70, 0x61,
+ 0x72, 0x61, 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c, 0x22, 0x20, 0x22,
+ 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x74, 0x79,
+ 0x70, 0x65, 0x2c, 0x70, 0x74, 0x72, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20,
+ 0x61, 0x72, 0x72, 0x61, 0x79, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20,
+ 0x20, 0x6c, 0x69, 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63,
+ 0x61, 0x74, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65,
+ 0x2c, 0x27, 0x2a, 0x27, 0x29, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20,
+ 0x6c, 0x69, 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61,
+ 0x74, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a, 0x20,
+ 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x20,
+ 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20,
+ 0x20, 0x69, 0x66, 0x20, 0x74, 0x6f, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72,
+ 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x29, 0x7e, 0x3d,
+ 0x6e, 0x69, 0x6c, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20,
+ 0x6c, 0x69, 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61,
+ 0x74, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c,
+ 0x27, 0x5b, 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d,
+ 0x2c, 0x27, 0x5d, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6c, 0x73,
+ 0x65, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x63, 0x70, 0x6c, 0x75, 0x73, 0x70,
+ 0x6c, 0x75, 0x73, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x6c,
+ 0x69, 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74,
+ 0x70, 0x61, 0x72, 0x61, 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c, 0x27,
+ 0x20, 0x3d, 0x20, 0x4d, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6e, 0x65,
+ 0x77, 0x5f, 0x64, 0x69, 0x6d, 0x28, 0x27, 0x2c, 0x74, 0x79, 0x70, 0x65,
+ 0x2c, 0x70, 0x74, 0x72, 0x2c, 0x27, 0x2c, 0x20, 0x27, 0x2e, 0x2e, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x2e, 0x2e, 0x27, 0x29, 0x3b,
+ 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x09, 0x6c,
+ 0x69, 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74,
+ 0x70, 0x61, 0x72, 0x61, 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c, 0x27,
+ 0x20, 0x3d, 0x20, 0x28, 0x27, 0x2c, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x70,
+ 0x74, 0x72, 0x2c, 0x27, 0x2a, 0x29, 0x27, 0x2c, 0x0a, 0x09, 0x09, 0x27,
+ 0x6d, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x28, 0x28, 0x27, 0x2c, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x2c, 0x27, 0x29, 0x2a, 0x73, 0x69,
+ 0x7a, 0x65, 0x6f, 0x66, 0x28, 0x27, 0x2c, 0x74, 0x79, 0x70, 0x65, 0x2c,
+ 0x70, 0x74, 0x72, 0x2c, 0x27, 0x29, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x09,
+ 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x65,
+ 0x6c, 0x73, 0x65, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x74, 0x20, 0x3d, 0x20, 0x69, 0x73, 0x62, 0x61, 0x73, 0x69, 0x63, 0x28,
+ 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x20, 0x20, 0x6c, 0x69, 0x6e, 0x65,
+ 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x70, 0x61, 0x72,
+ 0x61, 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c, 0x27, 0x20, 0x3d, 0x20,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x74, 0x20, 0x3d, 0x3d,
+ 0x20, 0x27, 0x73, 0x74, 0x61, 0x74, 0x65, 0x27, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x09, 0x6c, 0x69, 0x6e, 0x65, 0x20, 0x3d, 0x20,
+ 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x28,
+ 0x6c, 0x69, 0x6e, 0x65, 0x2c, 0x20, 0x27, 0x74, 0x6f, 0x6c, 0x75, 0x61,
+ 0x5f, 0x53, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6c, 0x73, 0x65,
+ 0x0a, 0x20, 0x20, 0x09, 0x2d, 0x2d, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28,
+ 0x22, 0x74, 0x20, 0x69, 0x73, 0x20, 0x22, 0x2e, 0x2e, 0x74, 0x6f, 0x73,
+ 0x74, 0x72, 0x69, 0x6e, 0x67, 0x28, 0x74, 0x29, 0x2e, 0x2e, 0x22, 0x2c,
+ 0x20, 0x70, 0x74, 0x72, 0x20, 0x69, 0x73, 0x20, 0x22, 0x2e, 0x2e, 0x74,
+ 0x6f, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x28, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x70, 0x74, 0x72, 0x29, 0x29, 0x0a, 0x20, 0x20, 0x09, 0x69, 0x66,
+ 0x20, 0x74, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x6e, 0x75, 0x6d, 0x62, 0x65,
+ 0x72, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e,
+ 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x70, 0x74, 0x72, 0x2c, 0x20, 0x22, 0x25, 0x2a, 0x22, 0x29, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x09, 0x09, 0x74, 0x20, 0x3d, 0x20,
+ 0x27, 0x75, 0x73, 0x65, 0x72, 0x64, 0x61, 0x74, 0x61, 0x27, 0x0a, 0x20,
+ 0x20, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x6e, 0x6f,
+ 0x74, 0x20, 0x74, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x70, 0x74, 0x72, 0x3d,
+ 0x3d, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x6c, 0x69, 0x6e,
+ 0x65, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x70, 0x61,
+ 0x72, 0x61, 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c, 0x27, 0x2a, 0x27,
+ 0x29, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x6c, 0x69, 0x6e, 0x65, 0x20,
+ 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x70, 0x61, 0x72, 0x61,
+ 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c, 0x27, 0x28, 0x28, 0x27, 0x2c,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x74, 0x79, 0x70,
+ 0x65, 0x29, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x74,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x6c, 0x69, 0x6e, 0x65,
+ 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x70, 0x61, 0x72,
+ 0x61, 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c, 0x27, 0x2a, 0x27, 0x29,
+ 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x6c, 0x69, 0x6e, 0x65, 0x20,
+ 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x70, 0x61, 0x72, 0x61,
+ 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c, 0x27, 0x29, 0x20, 0x27, 0x29,
+ 0x0a, 0x09, 0x69, 0x66, 0x20, 0x69, 0x73, 0x65, 0x6e, 0x75, 0x6d, 0x28,
+ 0x6e, 0x63, 0x74, 0x79, 0x70, 0x65, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e,
+ 0x0a, 0x09, 0x09, 0x6c, 0x69, 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x63, 0x6f,
+ 0x6e, 0x63, 0x61, 0x74, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x28, 0x6c, 0x69,
+ 0x6e, 0x65, 0x2c, 0x27, 0x28, 0x69, 0x6e, 0x74, 0x29, 0x20, 0x27, 0x29,
+ 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x64, 0x65, 0x66, 0x20, 0x3d, 0x20, 0x30, 0x0a, 0x09, 0x69, 0x66,
+ 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x65, 0x66, 0x20, 0x7e, 0x3d,
+ 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x64,
+ 0x65, 0x66, 0x20, 0x3d, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x65,
+ 0x66, 0x0a, 0x09, 0x09, 0x69, 0x66, 0x20, 0x28, 0x70, 0x74, 0x72, 0x20,
+ 0x3d, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x6f, 0x72, 0x20, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x26, 0x27,
+ 0x29, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x74, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x09, 0x64, 0x65, 0x66, 0x20,
+ 0x3d, 0x20, 0x22, 0x28, 0x76, 0x6f, 0x69, 0x64, 0x2a, 0x29, 0x26, 0x28,
+ 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x22, 0x2e, 0x2e, 0x74, 0x79, 0x70,
+ 0x65, 0x2e, 0x2e, 0x22, 0x29, 0x22, 0x2e, 0x2e, 0x64, 0x65, 0x66, 0x0a,
+ 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09,
+ 0x69, 0x66, 0x20, 0x74, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09,
+ 0x6c, 0x69, 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61,
+ 0x74, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c,
+ 0x27, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x74, 0x6f, 0x27, 0x2e, 0x2e,
+ 0x74, 0x2c, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c,
+ 0x27, 0x2c, 0x6e, 0x61, 0x72, 0x67, 0x2c, 0x27, 0x2c, 0x27, 0x2c, 0x64,
+ 0x65, 0x66, 0x2c, 0x27, 0x29, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x09, 0x65,
+ 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x74, 0x6f, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x20, 0x3d, 0x20, 0x67, 0x65,
+ 0x74, 0x5f, 0x74, 0x6f, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f,
+ 0x6e, 0x28, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x09, 0x09, 0x6c, 0x69,
+ 0x6e, 0x65, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x70,
+ 0x61, 0x72, 0x61, 0x6d, 0x28, 0x6c, 0x69, 0x6e, 0x65, 0x2c, 0x74, 0x6f,
+ 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x2e, 0x2e, 0x27, 0x28, 0x74, 0x6f, 0x6c,
+ 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x27, 0x2c, 0x6e, 0x61, 0x72, 0x67, 0x2c,
+ 0x27, 0x2c, 0x27, 0x2c, 0x64, 0x65, 0x66, 0x2c, 0x27, 0x29, 0x29, 0x3b,
+ 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x65, 0x6e,
+ 0x64, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x20, 0x6c, 0x69, 0x6e, 0x65, 0x0a, 0x65, 0x6e, 0x64, 0x0a,
+ 0x0a, 0x2d, 0x2d, 0x20, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x65, 0x20,
+ 0x76, 0x61, 0x72, 0x69, 0x61, 0x62, 0x6c, 0x65, 0x0a, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x44,
+ 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x64,
+ 0x65, 0x63, 0x6c, 0x61, 0x72, 0x65, 0x20, 0x28, 0x6e, 0x61, 0x72, 0x67,
+ 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64,
+ 0x69, 0x6d, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x61, 0x6e, 0x64,
+ 0x20, 0x74, 0x6f, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x28, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x29, 0x3d, 0x3d, 0x6e, 0x69, 0x6c,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x23, 0x69, 0x66, 0x64, 0x65, 0x66, 0x20, 0x5f,
+ 0x5f, 0x63, 0x70, 0x6c, 0x75, 0x73, 0x70, 0x6c, 0x75, 0x73, 0x5c, 0x6e,
+ 0x27, 0x29, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x73, 0x65, 0x6c, 0x66, 0x3a, 0x62, 0x75, 0x69, 0x6c, 0x64, 0x64, 0x65,
+ 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x28, 0x6e, 0x61,
+ 0x72, 0x67, 0x2c, 0x74, 0x72, 0x75, 0x65, 0x29, 0x29, 0x0a, 0x09, 0x09,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x23, 0x65, 0x6c, 0x73,
+ 0x65, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x3a, 0x62, 0x75, 0x69, 0x6c,
+ 0x64, 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+ 0x28, 0x6e, 0x61, 0x72, 0x67, 0x2c, 0x66, 0x61, 0x6c, 0x73, 0x65, 0x29,
+ 0x29, 0x0a, 0x09, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27,
+ 0x23, 0x65, 0x6e, 0x64, 0x69, 0x66, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x09,
+ 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75,
+ 0x74, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x3a, 0x62, 0x75, 0x69, 0x6c, 0x64,
+ 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x28,
+ 0x6e, 0x61, 0x72, 0x67, 0x2c, 0x66, 0x61, 0x6c, 0x73, 0x65, 0x29, 0x29,
+ 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d,
+ 0x2d, 0x20, 0x47, 0x65, 0x74, 0x20, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65,
+ 0x74, 0x65, 0x72, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x0a, 0x66, 0x75,
+ 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73,
+ 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x3a,
+ 0x67, 0x65, 0x74, 0x61, 0x72, 0x72, 0x61, 0x79, 0x20, 0x28, 0x6e, 0x61,
+ 0x72, 0x67, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x64, 0x69, 0x6d, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x27, 0x63,
+ 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x27, 0x2c, 0x27, 0x27, 0x29, 0x0a, 0x20,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x7b,
+ 0x27, 0x29, 0x0a, 0x09, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x27, 0x23, 0x69, 0x66, 0x6e, 0x64, 0x65, 0x66, 0x20, 0x54, 0x4f, 0x4c,
+ 0x55, 0x41, 0x5f, 0x52, 0x45, 0x4c, 0x45, 0x41, 0x53, 0x45, 0x5c, 0x6e,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x64,
+ 0x65, 0x66, 0x3b, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x64, 0x65, 0x66, 0x7e, 0x3d, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e,
+ 0x20, 0x64, 0x65, 0x66, 0x3d, 0x31, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x20,
+ 0x64, 0x65, 0x66, 0x3d, 0x30, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x09,
+ 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x69, 0x73,
+ 0x62, 0x61, 0x73, 0x69, 0x63, 0x28, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a,
+ 0x09, 0x09, 0x69, 0x66, 0x20, 0x28, 0x74, 0x29, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x09, 0x09, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75,
+ 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x69, 0x66, 0x20, 0x28, 0x21, 0x74,
+ 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x69, 0x73, 0x27, 0x2e, 0x2e, 0x74, 0x2e,
+ 0x2e, 0x27, 0x61, 0x72, 0x72, 0x61, 0x79, 0x28, 0x74, 0x6f, 0x6c, 0x75,
+ 0x61, 0x5f, 0x53, 0x2c, 0x27, 0x2c, 0x6e, 0x61, 0x72, 0x67, 0x2c, 0x27,
+ 0x2c, 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x2c,
+ 0x27, 0x2c, 0x27, 0x2c, 0x64, 0x65, 0x66, 0x2c, 0x27, 0x2c, 0x26, 0x74,
+ 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65, 0x72, 0x72, 0x29, 0x29, 0x27, 0x29,
+ 0x0a, 0x09, 0x09, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x09, 0x20, 0x20,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20,
+ 0x69, 0x66, 0x20, 0x28, 0x21, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x69,
+ 0x73, 0x75, 0x73, 0x65, 0x72, 0x74, 0x79, 0x70, 0x65, 0x61, 0x72, 0x72,
+ 0x61, 0x79, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x27,
+ 0x2c, 0x6e, 0x61, 0x72, 0x67, 0x2c, 0x27, 0x2c, 0x22, 0x27, 0x2c, 0x74,
+ 0x79, 0x70, 0x65, 0x2c, 0x27, 0x22, 0x2c, 0x27, 0x2c, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x2c, 0x27, 0x2c, 0x27, 0x2c, 0x64, 0x65,
+ 0x66, 0x2c, 0x27, 0x2c, 0x26, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65,
+ 0x72, 0x72, 0x29, 0x29, 0x27, 0x29, 0x0a, 0x09, 0x09, 0x65, 0x6e, 0x64,
+ 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20,
+ 0x20, 0x20, 0x20, 0x67, 0x6f, 0x74, 0x6f, 0x20, 0x74, 0x6f, 0x6c, 0x75,
+ 0x61, 0x5f, 0x6c, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x3b, 0x27, 0x29, 0x0a,
+ 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20,
+ 0x20, 0x65, 0x6c, 0x73, 0x65, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x09, 0x20,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x23, 0x65, 0x6e, 0x64,
+ 0x69, 0x66, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74,
+ 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x7b, 0x27, 0x29, 0x0a,
+ 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20,
+ 0x20, 0x20, 0x69, 0x6e, 0x74, 0x20, 0x69, 0x3b, 0x27, 0x29, 0x0a, 0x20,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20,
+ 0x20, 0x66, 0x6f, 0x72, 0x28, 0x69, 0x3d, 0x30, 0x3b, 0x20, 0x69, 0x3c,
+ 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x2e,
+ 0x2e, 0x27, 0x3b, 0x69, 0x2b, 0x2b, 0x29, 0x27, 0x29, 0x0a, 0x20, 0x20,
+ 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x69, 0x73,
+ 0x62, 0x61, 0x73, 0x69, 0x63, 0x28, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a,
+ 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x70, 0x74, 0x72, 0x20,
+ 0x3d, 0x20, 0x27, 0x27, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x7e, 0x3d, 0x27, 0x27, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x20, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x20, 0x27, 0x2a,
+ 0x27, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x27, 0x2c, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2e, 0x2e, 0x27, 0x5b, 0x69, 0x5d,
+ 0x20, 0x3d, 0x20, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x6e,
+ 0x6f, 0x74, 0x20, 0x74, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x70, 0x74, 0x72,
+ 0x3d, 0x3d, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x6f, 0x75,
+ 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x2a, 0x27, 0x29, 0x20, 0x65, 0x6e,
+ 0x64, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27,
+ 0x28, 0x28, 0x27, 0x2c, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x20, 0x20,
+ 0x69, 0x66, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x74, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x27, 0x2a, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x29, 0x20, 0x27,
+ 0x29, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x64, 0x65,
+ 0x66, 0x20, 0x3d, 0x20, 0x30, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x65, 0x66, 0x20, 0x7e, 0x3d, 0x20, 0x27,
+ 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x64, 0x65, 0x66, 0x20, 0x3d,
+ 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64, 0x65, 0x66, 0x20, 0x65, 0x6e,
+ 0x64, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x74, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x27, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x74, 0x6f, 0x66, 0x69, 0x65,
+ 0x6c, 0x64, 0x27, 0x2e, 0x2e, 0x74, 0x2e, 0x2e, 0x27, 0x28, 0x74, 0x6f,
+ 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x27, 0x2c, 0x6e, 0x61, 0x72, 0x67,
+ 0x2c, 0x27, 0x2c, 0x69, 0x2b, 0x31, 0x2c, 0x27, 0x2c, 0x64, 0x65, 0x66,
+ 0x2c, 0x27, 0x29, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6c,
+ 0x73, 0x65, 0x0a, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x28, 0x27, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x74, 0x6f, 0x66, 0x69,
+ 0x65, 0x6c, 0x64, 0x75, 0x73, 0x65, 0x72, 0x74, 0x79, 0x70, 0x65, 0x28,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x27, 0x2c, 0x6e, 0x61,
+ 0x72, 0x67, 0x2c, 0x27, 0x2c, 0x69, 0x2b, 0x31, 0x2c, 0x27, 0x2c, 0x64,
+ 0x65, 0x66, 0x2c, 0x27, 0x29, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x28, 0x27, 0x20, 0x20, 0x20, 0x7d, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x7d, 0x27, 0x29,
+ 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d,
+ 0x2d, 0x20, 0x47, 0x65, 0x74, 0x20, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65,
+ 0x74, 0x65, 0x72, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x0a, 0x66, 0x75,
+ 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73,
+ 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x3a,
+ 0x73, 0x65, 0x74, 0x61, 0x72, 0x72, 0x61, 0x79, 0x20, 0x28, 0x6e, 0x61,
+ 0x72, 0x67, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x6e, 0x6f, 0x74, 0x20,
+ 0x73, 0x74, 0x72, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x27, 0x63, 0x6f, 0x6e, 0x73, 0x74,
+ 0x25, 0x73, 0x2b, 0x27, 0x29, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75,
+ 0x62, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2c,
+ 0x27, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x27, 0x2c, 0x27, 0x27, 0x29,
+ 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20,
+ 0x20, 0x7b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75,
+ 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x69, 0x6e, 0x74, 0x20, 0x69, 0x3b,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x27, 0x20, 0x20, 0x20, 0x66, 0x6f, 0x72, 0x28, 0x69, 0x3d, 0x30, 0x3b,
+ 0x20, 0x69, 0x3c, 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64,
+ 0x69, 0x6d, 0x2e, 0x2e, 0x27, 0x3b, 0x69, 0x2b, 0x2b, 0x29, 0x27, 0x29,
+ 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x2c, 0x63,
+ 0x74, 0x20, 0x3d, 0x20, 0x69, 0x73, 0x62, 0x61, 0x73, 0x69, 0x63, 0x28,
+ 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x74,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74,
+ 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x20, 0x74, 0x6f, 0x6c,
+ 0x75, 0x61, 0x5f, 0x70, 0x75, 0x73, 0x68, 0x66, 0x69, 0x65, 0x6c, 0x64,
+ 0x27, 0x2e, 0x2e, 0x74, 0x2e, 0x2e, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75,
+ 0x61, 0x5f, 0x53, 0x2c, 0x27, 0x2c, 0x6e, 0x61, 0x72, 0x67, 0x2c, 0x27,
+ 0x2c, 0x69, 0x2b, 0x31, 0x2c, 0x28, 0x27, 0x2c, 0x63, 0x74, 0x2c, 0x27,
+ 0x29, 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65,
+ 0x2c, 0x27, 0x5b, 0x69, 0x5d, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20,
+ 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x20, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x3d, 0x20, 0x27,
+ 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x7b,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x23, 0x69, 0x66, 0x64, 0x65, 0x66, 0x20, 0x5f,
+ 0x5f, 0x63, 0x70, 0x6c, 0x75, 0x73, 0x70, 0x6c, 0x75, 0x73, 0x5c, 0x6e,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x20, 0x76, 0x6f, 0x69, 0x64,
+ 0x2a, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6f, 0x62, 0x6a, 0x20,
+ 0x3d, 0x20, 0x4d, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6e, 0x65, 0x77,
+ 0x28, 0x28, 0x27, 0x2c, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x27, 0x29, 0x28,
+ 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c,
+ 0x27, 0x5b, 0x69, 0x5d, 0x29, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20,
+ 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20,
+ 0x20, 0x20, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x70, 0x75, 0x73,
+ 0x68, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x75, 0x73, 0x65, 0x72, 0x74, 0x79,
+ 0x70, 0x65, 0x5f, 0x61, 0x6e, 0x64, 0x5f, 0x74, 0x61, 0x6b, 0x65, 0x6f,
+ 0x77, 0x6e, 0x65, 0x72, 0x73, 0x68, 0x69, 0x70, 0x28, 0x74, 0x6f, 0x6c,
+ 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x27, 0x2c, 0x6e, 0x61, 0x72, 0x67, 0x2c,
+ 0x27, 0x2c, 0x69, 0x2b, 0x31, 0x2c, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x6f, 0x62, 0x6a, 0x2c, 0x22, 0x27, 0x2c, 0x74, 0x79, 0x70, 0x65, 0x2c,
+ 0x27, 0x22, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x23, 0x65, 0x6c, 0x73,
+ 0x65, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x20, 0x76,
+ 0x6f, 0x69, 0x64, 0x2a, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6f,
+ 0x62, 0x6a, 0x20, 0x3d, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x63,
+ 0x6f, 0x70, 0x79, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c,
+ 0x28, 0x76, 0x6f, 0x69, 0x64, 0x2a, 0x29, 0x26, 0x27, 0x2c, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x27, 0x5b, 0x69, 0x5d,
+ 0x2c, 0x73, 0x69, 0x7a, 0x65, 0x6f, 0x66, 0x28, 0x27, 0x2c, 0x74, 0x79,
+ 0x70, 0x65, 0x2c, 0x27, 0x29, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20,
+ 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20,
+ 0x20, 0x20, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x70, 0x75, 0x73,
+ 0x68, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x75, 0x73, 0x65, 0x72, 0x74, 0x79,
+ 0x70, 0x65, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x27,
+ 0x2c, 0x6e, 0x61, 0x72, 0x67, 0x2c, 0x27, 0x2c, 0x69, 0x2b, 0x31, 0x2c,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6f, 0x62, 0x6a, 0x2c, 0x22, 0x27,
+ 0x2c, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x27, 0x22, 0x29, 0x3b, 0x27, 0x29,
+ 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x28, 0x27, 0x23, 0x65, 0x6e, 0x64, 0x69, 0x66, 0x5c, 0x6e, 0x27, 0x29,
+ 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x28, 0x27, 0x20, 0x20, 0x20, 0x7d, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20,
+ 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74,
+ 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x74, 0x6f, 0x6c, 0x75,
+ 0x61, 0x5f, 0x70, 0x75, 0x73, 0x68, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x75,
+ 0x73, 0x65, 0x72, 0x74, 0x79, 0x70, 0x65, 0x28, 0x74, 0x6f, 0x6c, 0x75,
+ 0x61, 0x5f, 0x53, 0x2c, 0x27, 0x2c, 0x6e, 0x61, 0x72, 0x67, 0x2c, 0x27,
+ 0x2c, 0x69, 0x2b, 0x31, 0x2c, 0x28, 0x76, 0x6f, 0x69, 0x64, 0x2a, 0x29,
+ 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c,
+ 0x27, 0x5b, 0x69, 0x5d, 0x2c, 0x22, 0x27, 0x2c, 0x74, 0x79, 0x70, 0x65,
+ 0x2c, 0x27, 0x22, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x65,
+ 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x7d, 0x27, 0x29,
+ 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d,
+ 0x2d, 0x20, 0x46, 0x72, 0x65, 0x65, 0x20, 0x64, 0x79, 0x6e, 0x61, 0x6d,
+ 0x69, 0x63, 0x61, 0x6c, 0x6c, 0x79, 0x20, 0x61, 0x6c, 0x6c, 0x6f, 0x63,
+ 0x61, 0x74, 0x65, 0x64, 0x20, 0x61, 0x72, 0x72, 0x61, 0x79, 0x0a, 0x66,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+ 0x3a, 0x66, 0x72, 0x65, 0x65, 0x61, 0x72, 0x72, 0x61, 0x79, 0x20, 0x28,
+ 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x64,
+ 0x69, 0x6d, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x61, 0x6e, 0x64,
+ 0x20, 0x74, 0x6f, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x28, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x64, 0x69, 0x6d, 0x29, 0x3d, 0x3d, 0x6e, 0x69, 0x6c,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x23, 0x69, 0x66, 0x64, 0x65, 0x66, 0x20, 0x5f,
+ 0x5f, 0x63, 0x70, 0x6c, 0x75, 0x73, 0x70, 0x6c, 0x75, 0x73, 0x5c, 0x6e,
+ 0x27, 0x29, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x27, 0x20, 0x20, 0x4d, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x64, 0x65,
+ 0x6c, 0x65, 0x74, 0x65, 0x5f, 0x64, 0x69, 0x6d, 0x28, 0x27, 0x2c, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x27, 0x29, 0x3b,
+ 0x27, 0x29, 0x0a, 0x09, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x27, 0x23, 0x65, 0x6c, 0x73, 0x65, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x20,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x66,
+ 0x72, 0x65, 0x65, 0x28, 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e,
+ 0x61, 0x6d, 0x65, 0x2c, 0x27, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x09, 0x20,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x23, 0x65, 0x6e, 0x64,
+ 0x69, 0x66, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x50, 0x61, 0x73, 0x73,
+ 0x20, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72, 0x0a, 0x66,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+ 0x3a, 0x70, 0x61, 0x73, 0x73, 0x70, 0x61, 0x72, 0x20, 0x28, 0x29, 0x0a,
+ 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72,
+ 0x3d, 0x3d, 0x27, 0x26, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x6e, 0x6f,
+ 0x74, 0x20, 0x69, 0x73, 0x62, 0x61, 0x73, 0x69, 0x63, 0x28, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27,
+ 0x2a, 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d,
+ 0x65, 0x29, 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x69, 0x66, 0x20, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x72, 0x65, 0x74, 0x3d, 0x3d, 0x27, 0x2a, 0x27,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x26, 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65,
+ 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a, 0x20, 0x65, 0x6e,
+ 0x64, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x52, 0x65,
+ 0x74, 0x75, 0x72, 0x6e, 0x20, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74,
+ 0x65, 0x72, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x0a, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x44,
+ 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x72,
+ 0x65, 0x74, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x20, 0x28, 0x29, 0x0a, 0x20,
+ 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x72, 0x65, 0x74, 0x20,
+ 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20,
+ 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x2c, 0x63, 0x74, 0x20,
+ 0x3d, 0x20, 0x69, 0x73, 0x62, 0x61, 0x73, 0x69, 0x63, 0x28, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x20, 0x20, 0x69,
+ 0x66, 0x20, 0x74, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x74, 0x7e, 0x3d, 0x27,
+ 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x6f, 0x75,
+ 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x74, 0x6f, 0x6c,
+ 0x75, 0x61, 0x5f, 0x70, 0x75, 0x73, 0x68, 0x27, 0x2e, 0x2e, 0x74, 0x2e,
+ 0x2e, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x28,
+ 0x27, 0x2c, 0x63, 0x74, 0x2c, 0x27, 0x29, 0x27, 0x2e, 0x2e, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2e, 0x2e, 0x27, 0x29, 0x3b,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x20, 0x20,
+ 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x70, 0x75, 0x73, 0x68, 0x5f,
+ 0x66, 0x75, 0x6e, 0x63, 0x20, 0x3d, 0x20, 0x67, 0x65, 0x74, 0x5f, 0x70,
+ 0x75, 0x73, 0x68, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a,
+ 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20,
+ 0x20, 0x20, 0x27, 0x2c, 0x70, 0x75, 0x73, 0x68, 0x5f, 0x66, 0x75, 0x6e,
+ 0x63, 0x2c, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c,
+ 0x28, 0x76, 0x6f, 0x69, 0x64, 0x2a, 0x29, 0x27, 0x2e, 0x2e, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2e, 0x2e, 0x27, 0x2c, 0x22,
+ 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2c,
+ 0x27, 0x22, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64,
+ 0x0a, 0x20, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x31, 0x0a,
+ 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e,
+ 0x20, 0x30, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x49,
+ 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x61, 0x6c, 0x20, 0x63, 0x6f, 0x6e, 0x73,
+ 0x74, 0x72, 0x75, 0x63, 0x74, 0x6f, 0x72, 0x0a, 0x66, 0x75, 0x6e, 0x63,
+ 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x5f, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72,
+ 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x28, 0x74, 0x29, 0x0a, 0x0a, 0x20,
+ 0x73, 0x65, 0x74, 0x6d, 0x65, 0x74, 0x61, 0x74, 0x61, 0x62, 0x6c, 0x65,
+ 0x28, 0x74, 0x2c, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x44, 0x65, 0x63, 0x6c,
+ 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x29, 0x0a, 0x20, 0x74, 0x3a,
+ 0x62, 0x75, 0x69, 0x6c, 0x64, 0x6e, 0x61, 0x6d, 0x65, 0x73, 0x28, 0x29,
+ 0x0a, 0x20, 0x74, 0x3a, 0x63, 0x68, 0x65, 0x63, 0x6b, 0x6e, 0x61, 0x6d,
+ 0x65, 0x28, 0x29, 0x0a, 0x20, 0x74, 0x3a, 0x63, 0x68, 0x65, 0x63, 0x6b,
+ 0x74, 0x79, 0x70, 0x65, 0x28, 0x29, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x66, 0x74, 0x20, 0x3d, 0x20, 0x66, 0x69, 0x6e, 0x64, 0x74,
+ 0x79, 0x70, 0x65, 0x28, 0x74, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x20,
+ 0x6f, 0x72, 0x20, 0x74, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x20, 0x69,
+ 0x66, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x69, 0x73, 0x65, 0x6e, 0x75, 0x6d,
+ 0x28, 0x66, 0x74, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x74,
+ 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x20, 0x74, 0x2e, 0x74, 0x79, 0x70, 0x65,
+ 0x20, 0x3d, 0x20, 0x61, 0x70, 0x70, 0x6c, 0x79, 0x74, 0x79, 0x70, 0x65,
+ 0x64, 0x65, 0x66, 0x28, 0x74, 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x20, 0x66,
+ 0x74, 0x29, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x69, 0x66,
+ 0x20, 0x74, 0x2e, 0x6b, 0x69, 0x6e, 0x64, 0x3d, 0x3d, 0x22, 0x76, 0x61,
+ 0x72, 0x22, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x28, 0x73, 0x74, 0x72, 0x69,
+ 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x74, 0x2e, 0x6d, 0x6f,
+ 0x64, 0x2c, 0x20, 0x22, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x70, 0x72,
+ 0x6f, 0x70, 0x65, 0x72, 0x74, 0x79, 0x25, 0x73, 0x22, 0x29, 0x20, 0x6f,
+ 0x72, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e,
+ 0x64, 0x28, 0x74, 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x20, 0x22, 0x74, 0x6f,
+ 0x6c, 0x75, 0x61, 0x5f, 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x79,
+ 0x24, 0x22, 0x29, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x09,
+ 0x74, 0x2e, 0x6d, 0x6f, 0x64, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69,
+ 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x74, 0x2e, 0x6d, 0x6f,
+ 0x64, 0x2c, 0x20, 0x22, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x70, 0x72,
+ 0x6f, 0x70, 0x65, 0x72, 0x74, 0x79, 0x22, 0x2c, 0x20, 0x22, 0x74, 0x6f,
+ 0x6c, 0x75, 0x61, 0x5f, 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x79,
+ 0x5f, 0x5f, 0x22, 0x2e, 0x2e, 0x67, 0x65, 0x74, 0x5f, 0x70, 0x72, 0x6f,
+ 0x70, 0x65, 0x72, 0x74, 0x79, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x28, 0x29,
+ 0x29, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x72, 0x65, 0x74,
+ 0x75, 0x72, 0x6e, 0x20, 0x74, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d,
+ 0x2d, 0x20, 0x43, 0x6f, 0x6e, 0x73, 0x74, 0x72, 0x75, 0x63, 0x74, 0x6f,
+ 0x72, 0x0a, 0x2d, 0x2d, 0x20, 0x45, 0x78, 0x70, 0x65, 0x63, 0x74, 0x73,
+ 0x20, 0x74, 0x68, 0x65, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x20,
+ 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e,
+ 0x0a, 0x2d, 0x2d, 0x20, 0x54, 0x68, 0x65, 0x20, 0x6b, 0x69, 0x6e, 0x64,
+ 0x20, 0x6f, 0x66, 0x20, 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74,
+ 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x61, 0x6e, 0x20, 0x62, 0x65, 0x20, 0x22,
+ 0x76, 0x61, 0x72, 0x22, 0x20, 0x6f, 0x72, 0x20, 0x22, 0x66, 0x75, 0x6e,
+ 0x63, 0x22, 0x2e, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x28, 0x73, 0x2c, 0x6b, 0x69, 0x6e, 0x64, 0x2c, 0x69, 0x73, 0x5f,
+ 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72, 0x29, 0x0a, 0x0a,
+ 0x20, 0x2d, 0x2d, 0x20, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x6e, 0x61, 0x74,
+ 0x65, 0x20, 0x73, 0x70, 0x61, 0x63, 0x65, 0x73, 0x20, 0x69, 0x66, 0x20,
+ 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74, 0x20, 0x76, 0x61, 0x6c, 0x75,
+ 0x65, 0x20, 0x69, 0x73, 0x20, 0x70, 0x72, 0x6f, 0x76, 0x69, 0x64, 0x65,
+ 0x64, 0x0a, 0x20, 0x73, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28,
+ 0x73, 0x2c, 0x22, 0x25, 0x73, 0x2a, 0x3d, 0x25, 0x73, 0x2a, 0x22, 0x2c,
+ 0x22, 0x3d, 0x22, 0x29, 0x0a, 0x20, 0x73, 0x20, 0x3d, 0x20, 0x67, 0x73,
+ 0x75, 0x62, 0x28, 0x73, 0x2c, 0x20, 0x22, 0x25, 0x73, 0x2a, 0x3c, 0x22,
+ 0x2c, 0x20, 0x22, 0x3c, 0x22, 0x29, 0x0a, 0x0a, 0x20, 0x6c, 0x6f, 0x63,
+ 0x61, 0x6c, 0x20, 0x64, 0x65, 0x66, 0x62, 0x2c, 0x74, 0x6d, 0x70, 0x64,
+ 0x65, 0x66, 0x0a, 0x20, 0x64, 0x65, 0x66, 0x62, 0x2c, 0x5f, 0x2c, 0x74,
+ 0x6d, 0x70, 0x64, 0x65, 0x66, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69,
+ 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x73, 0x2c, 0x20, 0x22,
+ 0x28, 0x3d, 0x2e, 0x2a, 0x29, 0x24, 0x22, 0x29, 0x0a, 0x20, 0x69, 0x66,
+ 0x20, 0x64, 0x65, 0x66, 0x62, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20,
+ 0x09, 0x73, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e,
+ 0x67, 0x73, 0x75, 0x62, 0x28, 0x73, 0x2c, 0x20, 0x22, 0x3d, 0x2e, 0x2a,
+ 0x24, 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29, 0x0a, 0x20, 0x65, 0x6c, 0x73,
+ 0x65, 0x0a, 0x20, 0x09, 0x74, 0x6d, 0x70, 0x64, 0x65, 0x66, 0x20, 0x3d,
+ 0x20, 0x27, 0x27, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x69, 0x66,
+ 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x20, 0x3d, 0x3d, 0x20, 0x22, 0x76, 0x61,
+ 0x72, 0x22, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x2d, 0x2d,
+ 0x20, 0x63, 0x68, 0x65, 0x63, 0x6b, 0x20, 0x74, 0x68, 0x65, 0x20, 0x66,
+ 0x6f, 0x72, 0x6d, 0x3a, 0x20, 0x76, 0x6f, 0x69, 0x64, 0x0a, 0x20, 0x20,
+ 0x69, 0x66, 0x20, 0x73, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x27, 0x20, 0x6f,
+ 0x72, 0x20, 0x73, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64,
+ 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x72, 0x65,
+ 0x74, 0x75, 0x72, 0x6e, 0x20, 0x5f, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72,
+ 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x7b, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d,
+ 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64, 0x27, 0x2c, 0x20, 0x6b, 0x69, 0x6e,
+ 0x64, 0x20, 0x3d, 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x2c, 0x20, 0x69, 0x73,
+ 0x5f, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72, 0x20, 0x3d,
+ 0x20, 0x69, 0x73, 0x5f, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65,
+ 0x72, 0x7d, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x65, 0x6e,
+ 0x64, 0x0a, 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65, 0x63, 0x6b,
+ 0x20, 0x74, 0x68, 0x65, 0x20, 0x66, 0x6f, 0x72, 0x6d, 0x3a, 0x20, 0x6d,
+ 0x6f, 0x64, 0x20, 0x74, 0x79, 0x70, 0x65, 0x2a, 0x26, 0x20, 0x6e, 0x61,
+ 0x6d, 0x65, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x20,
+ 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f,
+ 0x6b, 0x65, 0x6e, 0x73, 0x28, 0x73, 0x2c, 0x27, 0x25, 0x2a, 0x25, 0x73,
+ 0x2a, 0x26, 0x27, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x74, 0x2e, 0x6e,
+ 0x20, 0x3d, 0x3d, 0x20, 0x32, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20,
+ 0x20, 0x69, 0x66, 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x20, 0x3d, 0x3d, 0x20,
+ 0x27, 0x66, 0x75, 0x6e, 0x63, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x20, 0x20, 0x20, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x28, 0x22, 0x23, 0x69,
+ 0x6e, 0x76, 0x61, 0x6c, 0x69, 0x64, 0x20, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x74,
+ 0x79, 0x70, 0x65, 0x3a, 0x20, 0x22, 0x2e, 0x2e, 0x73, 0x29, 0x0a, 0x20,
+ 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x2d, 0x2d, 0x6c, 0x6f, 0x63,
+ 0x61, 0x6c, 0x20, 0x6d, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74,
+ 0x28, 0x74, 0x5b, 0x31, 0x5d, 0x2c, 0x27, 0x25, 0x73, 0x25, 0x73, 0x2a,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6d,
+ 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x5f, 0x63, 0x5f, 0x74,
+ 0x6f, 0x6b, 0x65, 0x6e, 0x73, 0x28, 0x74, 0x5b, 0x31, 0x5d, 0x2c, 0x27,
+ 0x25, 0x73, 0x2b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x20, 0x5f, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74,
+ 0x69, 0x6f, 0x6e, 0x7b, 0x0a, 0x20, 0x20, 0x20, 0x6e, 0x61, 0x6d, 0x65,
+ 0x20, 0x3d, 0x20, 0x74, 0x5b, 0x32, 0x5d, 0x2e, 0x2e, 0x74, 0x6d, 0x70,
+ 0x64, 0x65, 0x66, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x70, 0x74, 0x72, 0x20,
+ 0x3d, 0x20, 0x27, 0x2a, 0x27, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x72, 0x65,
+ 0x74, 0x20, 0x3d, 0x20, 0x27, 0x26, 0x27, 0x2c, 0x0a, 0x20, 0x20, 0x20,
+ 0x2d, 0x2d, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x72, 0x65, 0x62,
+ 0x75, 0x69, 0x6c, 0x64, 0x5f, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74,
+ 0x65, 0x28, 0x6d, 0x5b, 0x6d, 0x2e, 0x6e, 0x5d, 0x2c, 0x20, 0x74, 0x62,
+ 0x2c, 0x20, 0x74, 0x69, 0x6d, 0x70, 0x6c, 0x29, 0x2c, 0x0a, 0x20, 0x20,
+ 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x6d, 0x5b, 0x6d, 0x2e,
+ 0x6e, 0x5d, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x6d, 0x6f, 0x64, 0x20, 0x3d,
+ 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x28, 0x6d, 0x2c, 0x31, 0x2c,
+ 0x6d, 0x2e, 0x6e, 0x2d, 0x31, 0x29, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x69,
+ 0x73, 0x5f, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72, 0x20,
+ 0x3d, 0x20, 0x69, 0x73, 0x5f, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74,
+ 0x65, 0x72, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x20,
+ 0x3d, 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x7d, 0x0a, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65,
+ 0x63, 0x6b, 0x20, 0x74, 0x68, 0x65, 0x20, 0x66, 0x6f, 0x72, 0x6d, 0x3a,
+ 0x20, 0x6d, 0x6f, 0x64, 0x20, 0x74, 0x79, 0x70, 0x65, 0x2a, 0x2a, 0x20,
+ 0x6e, 0x61, 0x6d, 0x65, 0x0a, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x70,
+ 0x6c, 0x69, 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x73,
+ 0x28, 0x73, 0x2c, 0x27, 0x25, 0x2a, 0x25, 0x73, 0x2a, 0x25, 0x2a, 0x27,
+ 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x74, 0x2e, 0x6e, 0x20, 0x3d, 0x3d,
+ 0x20, 0x32, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x69, 0x66,
+ 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x66, 0x75,
+ 0x6e, 0x63, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20,
+ 0x65, 0x72, 0x72, 0x6f, 0x72, 0x28, 0x22, 0x23, 0x69, 0x6e, 0x76, 0x61,
+ 0x6c, 0x69, 0x64, 0x20, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x74, 0x79, 0x70, 0x65,
+ 0x3a, 0x20, 0x22, 0x2e, 0x2e, 0x73, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6e,
+ 0x64, 0x0a, 0x20, 0x20, 0x2d, 0x2d, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x6d, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x28, 0x74, 0x5b,
+ 0x31, 0x5d, 0x2c, 0x27, 0x25, 0x73, 0x25, 0x73, 0x2a, 0x27, 0x29, 0x0a,
+ 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6d, 0x20, 0x3d, 0x20,
+ 0x73, 0x70, 0x6c, 0x69, 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f, 0x6b, 0x65,
+ 0x6e, 0x73, 0x28, 0x74, 0x5b, 0x31, 0x5d, 0x2c, 0x27, 0x25, 0x73, 0x2b,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20,
+ 0x5f, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+ 0x7b, 0x0a, 0x20, 0x20, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20,
+ 0x74, 0x5b, 0x32, 0x5d, 0x2e, 0x2e, 0x74, 0x6d, 0x70, 0x64, 0x65, 0x66,
+ 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x20, 0x27,
+ 0x2a, 0x27, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x72, 0x65, 0x74, 0x20, 0x3d,
+ 0x20, 0x27, 0x2a, 0x27, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x2d, 0x2d, 0x74,
+ 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x72, 0x65, 0x62, 0x75, 0x69, 0x6c,
+ 0x64, 0x5f, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74, 0x65, 0x28, 0x6d,
+ 0x5b, 0x6d, 0x2e, 0x6e, 0x5d, 0x2c, 0x20, 0x74, 0x62, 0x2c, 0x20, 0x74,
+ 0x69, 0x6d, 0x70, 0x6c, 0x29, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x74, 0x79,
+ 0x70, 0x65, 0x20, 0x3d, 0x20, 0x6d, 0x5b, 0x6d, 0x2e, 0x6e, 0x5d, 0x2c,
+ 0x0a, 0x20, 0x20, 0x20, 0x6d, 0x6f, 0x64, 0x20, 0x3d, 0x20, 0x63, 0x6f,
+ 0x6e, 0x63, 0x61, 0x74, 0x28, 0x6d, 0x2c, 0x31, 0x2c, 0x6d, 0x2e, 0x6e,
+ 0x2d, 0x31, 0x29, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x69, 0x73, 0x5f, 0x70,
+ 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72, 0x20, 0x3d, 0x20, 0x69,
+ 0x73, 0x5f, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72, 0x2c,
+ 0x0a, 0x20, 0x20, 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x20, 0x3d, 0x20, 0x6b,
+ 0x69, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x7d, 0x0a, 0x20, 0x65, 0x6e, 0x64,
+ 0x0a, 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65, 0x63, 0x6b, 0x20,
+ 0x74, 0x68, 0x65, 0x20, 0x66, 0x6f, 0x72, 0x6d, 0x3a, 0x20, 0x6d, 0x6f,
+ 0x64, 0x20, 0x74, 0x79, 0x70, 0x65, 0x26, 0x20, 0x6e, 0x61, 0x6d, 0x65,
+ 0x0a, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x5f,
+ 0x63, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x73, 0x28, 0x73, 0x2c, 0x27,
+ 0x26, 0x27, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x74, 0x2e, 0x6e, 0x20,
+ 0x3d, 0x3d, 0x20, 0x32, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20,
+ 0x2d, 0x2d, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6d, 0x20, 0x3d, 0x20,
+ 0x73, 0x70, 0x6c, 0x69, 0x74, 0x28, 0x74, 0x5b, 0x31, 0x5d, 0x2c, 0x27,
+ 0x25, 0x73, 0x25, 0x73, 0x2a, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x6d, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69,
+ 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x73, 0x28, 0x74,
+ 0x5b, 0x31, 0x5d, 0x2c, 0x27, 0x25, 0x73, 0x2b, 0x27, 0x29, 0x0a, 0x20,
+ 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x5f, 0x44, 0x65, 0x63,
+ 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x7b, 0x0a, 0x20, 0x20,
+ 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x74, 0x5b, 0x32, 0x5d,
+ 0x2e, 0x2e, 0x74, 0x6d, 0x70, 0x64, 0x65, 0x66, 0x2c, 0x0a, 0x20, 0x20,
+ 0x20, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x20, 0x27, 0x26, 0x27, 0x2c, 0x0a,
+ 0x20, 0x20, 0x20, 0x2d, 0x2d, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20,
+ 0x72, 0x65, 0x62, 0x75, 0x69, 0x6c, 0x64, 0x5f, 0x74, 0x65, 0x6d, 0x70,
+ 0x6c, 0x61, 0x74, 0x65, 0x28, 0x6d, 0x5b, 0x6d, 0x2e, 0x6e, 0x5d, 0x2c,
+ 0x20, 0x74, 0x62, 0x2c, 0x20, 0x74, 0x69, 0x6d, 0x70, 0x6c, 0x29, 0x2c,
+ 0x0a, 0x20, 0x20, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x6d,
+ 0x5b, 0x6d, 0x2e, 0x6e, 0x5d, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x6d, 0x6f,
+ 0x64, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x28, 0x6d,
+ 0x2c, 0x31, 0x2c, 0x6d, 0x2e, 0x6e, 0x2d, 0x31, 0x29, 0x2c, 0x0a, 0x20,
+ 0x20, 0x20, 0x69, 0x73, 0x5f, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74,
+ 0x65, 0x72, 0x20, 0x3d, 0x20, 0x69, 0x73, 0x5f, 0x70, 0x61, 0x72, 0x61,
+ 0x6d, 0x65, 0x74, 0x65, 0x72, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x6b, 0x69,
+ 0x6e, 0x64, 0x20, 0x3d, 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x0a, 0x20, 0x20,
+ 0x7d, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x2d, 0x2d, 0x20,
+ 0x63, 0x68, 0x65, 0x63, 0x6b, 0x20, 0x74, 0x68, 0x65, 0x20, 0x66, 0x6f,
+ 0x72, 0x6d, 0x3a, 0x20, 0x6d, 0x6f, 0x64, 0x20, 0x74, 0x79, 0x70, 0x65,
+ 0x2a, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x73, 0x31, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28,
+ 0x73, 0x2c, 0x22, 0x28, 0x25, 0x62, 0x5c, 0x5b, 0x5c, 0x5d, 0x29, 0x22,
+ 0x2c, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x28, 0x6e,
+ 0x29, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x67, 0x73, 0x75,
+ 0x62, 0x28, 0x6e, 0x2c, 0x27, 0x25, 0x2a, 0x27, 0x2c, 0x27, 0x5c, 0x31,
+ 0x27, 0x29, 0x20, 0x65, 0x6e, 0x64, 0x29, 0x0a, 0x20, 0x74, 0x20, 0x3d,
+ 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f, 0x6b,
+ 0x65, 0x6e, 0x73, 0x28, 0x73, 0x31, 0x2c, 0x27, 0x25, 0x2a, 0x27, 0x29,
+ 0x0a, 0x20, 0x69, 0x66, 0x20, 0x74, 0x2e, 0x6e, 0x20, 0x3d, 0x3d, 0x20,
+ 0x32, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x74, 0x5b, 0x32,
+ 0x5d, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28, 0x74, 0x5b, 0x32,
+ 0x5d, 0x2c, 0x27, 0x5c, 0x31, 0x27, 0x2c, 0x27, 0x25, 0x2a, 0x27, 0x29,
+ 0x20, 0x2d, 0x2d, 0x20, 0x72, 0x65, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x20,
+ 0x2a, 0x20, 0x69, 0x6e, 0x20, 0x64, 0x69, 0x6d, 0x65, 0x6e, 0x73, 0x69,
+ 0x6f, 0x6e, 0x20, 0x65, 0x78, 0x70, 0x72, 0x65, 0x73, 0x73, 0x69, 0x6f,
+ 0x6e, 0x0a, 0x20, 0x20, 0x2d, 0x2d, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x6d, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x28, 0x74, 0x5b,
+ 0x31, 0x5d, 0x2c, 0x27, 0x25, 0x73, 0x25, 0x73, 0x2a, 0x27, 0x29, 0x0a,
+ 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6d, 0x20, 0x3d, 0x20,
+ 0x73, 0x70, 0x6c, 0x69, 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f, 0x6b, 0x65,
+ 0x6e, 0x73, 0x28, 0x74, 0x5b, 0x31, 0x5d, 0x2c, 0x27, 0x25, 0x73, 0x2b,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20,
+ 0x5f, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+ 0x7b, 0x0a, 0x20, 0x20, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20,
+ 0x74, 0x5b, 0x32, 0x5d, 0x2e, 0x2e, 0x74, 0x6d, 0x70, 0x64, 0x65, 0x66,
+ 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x20, 0x27,
+ 0x2a, 0x27, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20,
+ 0x3d, 0x20, 0x6d, 0x5b, 0x6d, 0x2e, 0x6e, 0x5d, 0x2c, 0x0a, 0x20, 0x20,
+ 0x20, 0x2d, 0x2d, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x72, 0x65,
+ 0x62, 0x75, 0x69, 0x6c, 0x64, 0x5f, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61,
+ 0x74, 0x65, 0x28, 0x6d, 0x5b, 0x6d, 0x2e, 0x6e, 0x5d, 0x2c, 0x20, 0x74,
+ 0x62, 0x2c, 0x20, 0x74, 0x69, 0x6d, 0x70, 0x6c, 0x29, 0x2c, 0x0a, 0x20,
+ 0x20, 0x20, 0x6d, 0x6f, 0x64, 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63,
+ 0x61, 0x74, 0x28, 0x6d, 0x2c, 0x31, 0x2c, 0x6d, 0x2e, 0x6e, 0x2d, 0x31,
+ 0x29, 0x20, 0x20, 0x20, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x69, 0x73, 0x5f,
+ 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72, 0x20, 0x3d, 0x20,
+ 0x69, 0x73, 0x5f, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72,
+ 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x20, 0x3d, 0x20,
+ 0x6b, 0x69, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x7d, 0x0a, 0x20, 0x65, 0x6e,
+ 0x64, 0x0a, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x20,
+ 0x3d, 0x3d, 0x20, 0x27, 0x76, 0x61, 0x72, 0x27, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65, 0x63, 0x6b,
+ 0x20, 0x74, 0x68, 0x65, 0x20, 0x66, 0x6f, 0x72, 0x6d, 0x3a, 0x20, 0x6d,
+ 0x6f, 0x64, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x6e, 0x61, 0x6d, 0x65,
+ 0x0a, 0x20, 0x20, 0x2d, 0x2d, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c,
+ 0x69, 0x74, 0x28, 0x73, 0x2c, 0x27, 0x25, 0x73, 0x25, 0x73, 0x2a, 0x27,
+ 0x29, 0x0a, 0x20, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69,
+ 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x73, 0x28, 0x73,
+ 0x2c, 0x27, 0x25, 0x73, 0x2b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x76, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x66,
+ 0x69, 0x6e, 0x64, 0x74, 0x79, 0x70, 0x65, 0x28, 0x74, 0x5b, 0x74, 0x2e,
+ 0x6e, 0x5d, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x76, 0x20, 0x3d,
+ 0x20, 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x5f, 0x76, 0x61, 0x72, 0x6e,
+ 0x61, 0x6d, 0x65, 0x28, 0x29, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x20, 0x76,
+ 0x20, 0x3d, 0x20, 0x74, 0x5b, 0x74, 0x2e, 0x6e, 0x5d, 0x3b, 0x20, 0x74,
+ 0x2e, 0x6e, 0x20, 0x3d, 0x20, 0x74, 0x2e, 0x6e, 0x2d, 0x31, 0x20, 0x65,
+ 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20,
+ 0x5f, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e,
+ 0x7b, 0x0a, 0x20, 0x20, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20,
+ 0x76, 0x2e, 0x2e, 0x74, 0x6d, 0x70, 0x64, 0x65, 0x66, 0x2c, 0x0a, 0x20,
+ 0x20, 0x20, 0x2d, 0x2d, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x72,
+ 0x65, 0x62, 0x75, 0x69, 0x6c, 0x64, 0x5f, 0x74, 0x65, 0x6d, 0x70, 0x6c,
+ 0x61, 0x74, 0x65, 0x28, 0x74, 0x5b, 0x74, 0x2e, 0x6e, 0x5d, 0x2c, 0x20,
+ 0x74, 0x62, 0x2c, 0x20, 0x74, 0x69, 0x6d, 0x70, 0x6c, 0x29, 0x2c, 0x0a,
+ 0x20, 0x20, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x74, 0x5b,
+ 0x74, 0x2e, 0x6e, 0x5d, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x6d, 0x6f, 0x64,
+ 0x20, 0x3d, 0x20, 0x63, 0x6f, 0x6e, 0x63, 0x61, 0x74, 0x28, 0x74, 0x2c,
+ 0x31, 0x2c, 0x74, 0x2e, 0x6e, 0x2d, 0x31, 0x29, 0x2c, 0x0a, 0x20, 0x20,
+ 0x20, 0x69, 0x73, 0x5f, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65,
+ 0x72, 0x20, 0x3d, 0x20, 0x69, 0x73, 0x5f, 0x70, 0x61, 0x72, 0x61, 0x6d,
+ 0x65, 0x74, 0x65, 0x72, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x6b, 0x69, 0x6e,
+ 0x64, 0x20, 0x3d, 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x7d,
+ 0x0a, 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x20, 0x2d, 0x2d, 0x20, 0x6b,
+ 0x69, 0x6e, 0x64, 0x20, 0x3d, 0x3d, 0x20, 0x22, 0x66, 0x75, 0x6e, 0x63,
+ 0x22, 0x0a, 0x0a, 0x20, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65, 0x63,
+ 0x6b, 0x20, 0x74, 0x68, 0x65, 0x20, 0x66, 0x6f, 0x72, 0x6d, 0x3a, 0x20,
+ 0x6d, 0x6f, 0x64, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x6e, 0x61, 0x6d,
+ 0x65, 0x0a, 0x20, 0x20, 0x2d, 0x2d, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x70,
+ 0x6c, 0x69, 0x74, 0x28, 0x73, 0x2c, 0x27, 0x25, 0x73, 0x25, 0x73, 0x2a,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c,
+ 0x69, 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x73, 0x28,
+ 0x73, 0x2c, 0x27, 0x25, 0x73, 0x2b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x6c,
+ 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x76, 0x20, 0x3d, 0x20, 0x74, 0x5b, 0x74,
+ 0x2e, 0x6e, 0x5d, 0x20, 0x20, 0x2d, 0x2d, 0x20, 0x6c, 0x61, 0x73, 0x74,
+ 0x20, 0x77, 0x6f, 0x72, 0x64, 0x20, 0x69, 0x73, 0x20, 0x74, 0x68, 0x65,
+ 0x20, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x6e, 0x61,
+ 0x6d, 0x65, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74,
+ 0x70, 0x2c, 0x6d, 0x64, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x74, 0x2e,
+ 0x6e, 0x3e, 0x31, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20,
+ 0x74, 0x70, 0x20, 0x3d, 0x20, 0x74, 0x5b, 0x74, 0x2e, 0x6e, 0x2d, 0x31,
+ 0x5d, 0x0a, 0x20, 0x20, 0x20, 0x6d, 0x64, 0x20, 0x3d, 0x20, 0x63, 0x6f,
+ 0x6e, 0x63, 0x61, 0x74, 0x28, 0x74, 0x2c, 0x31, 0x2c, 0x74, 0x2e, 0x6e,
+ 0x2d, 0x32, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20,
+ 0x2d, 0x2d, 0x69, 0x66, 0x20, 0x74, 0x70, 0x20, 0x74, 0x68, 0x65, 0x6e,
+ 0x20, 0x74, 0x70, 0x20, 0x3d, 0x20, 0x72, 0x65, 0x62, 0x75, 0x69, 0x6c,
+ 0x64, 0x5f, 0x74, 0x65, 0x6d, 0x70, 0x6c, 0x61, 0x74, 0x65, 0x28, 0x74,
+ 0x70, 0x2c, 0x20, 0x74, 0x62, 0x2c, 0x20, 0x74, 0x69, 0x6d, 0x70, 0x6c,
+ 0x29, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x20, 0x5f, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74,
+ 0x69, 0x6f, 0x6e, 0x7b, 0x0a, 0x20, 0x20, 0x20, 0x6e, 0x61, 0x6d, 0x65,
+ 0x20, 0x3d, 0x20, 0x76, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x3d, 0x20, 0x74, 0x70, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x6d,
+ 0x6f, 0x64, 0x20, 0x3d, 0x20, 0x6d, 0x64, 0x2c, 0x0a, 0x20, 0x20, 0x20,
+ 0x69, 0x73, 0x5f, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72,
+ 0x20, 0x3d, 0x20, 0x69, 0x73, 0x5f, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65,
+ 0x74, 0x65, 0x72, 0x2c, 0x0a, 0x20, 0x20, 0x20, 0x6b, 0x69, 0x6e, 0x64,
+ 0x20, 0x3d, 0x20, 0x6b, 0x69, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x7d, 0x0a,
+ 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a
+};
+unsigned int lua_declaration_lua_len = 15143;
diff --git a/lib/tolua++/src/bin/enumerate_lua.h b/lib/tolua++/src/bin/enumerate_lua.h
new file mode 100644
index 000000000..d23c9624a
--- /dev/null
+++ b/lib/tolua++/src/bin/enumerate_lua.h
@@ -0,0 +1,295 @@
+static const unsigned char lua_enumerate_lua[] = {
+ 0x2d, 0x2d, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x3a, 0x20, 0x65, 0x6e,
+ 0x75, 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x20, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x57, 0x72, 0x69, 0x74, 0x74, 0x65, 0x6e,
+ 0x20, 0x62, 0x79, 0x20, 0x57, 0x61, 0x6c, 0x64, 0x65, 0x6d, 0x61, 0x72,
+ 0x20, 0x43, 0x65, 0x6c, 0x65, 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x54, 0x65,
+ 0x43, 0x47, 0x72, 0x61, 0x66, 0x2f, 0x50, 0x55, 0x43, 0x2d, 0x52, 0x69,
+ 0x6f, 0x0a, 0x2d, 0x2d, 0x20, 0x4a, 0x75, 0x6c, 0x20, 0x31, 0x39, 0x39,
+ 0x38, 0x0a, 0x2d, 0x2d, 0x20, 0x24, 0x49, 0x64, 0x3a, 0x20, 0x65, 0x6e,
+ 0x75, 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x2e, 0x6c, 0x75, 0x61, 0x2c,
+ 0x76, 0x20, 0x31, 0x2e, 0x33, 0x20, 0x32, 0x30, 0x30, 0x30, 0x2f, 0x30,
+ 0x31, 0x2f, 0x32, 0x34, 0x20, 0x32, 0x30, 0x3a, 0x34, 0x31, 0x3a, 0x31,
+ 0x35, 0x20, 0x63, 0x65, 0x6c, 0x65, 0x73, 0x20, 0x45, 0x78, 0x70, 0x20,
+ 0x24, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x54, 0x68, 0x69, 0x73, 0x20, 0x63,
+ 0x6f, 0x64, 0x65, 0x20, 0x69, 0x73, 0x20, 0x66, 0x72, 0x65, 0x65, 0x20,
+ 0x73, 0x6f, 0x66, 0x74, 0x77, 0x61, 0x72, 0x65, 0x3b, 0x20, 0x79, 0x6f,
+ 0x75, 0x20, 0x63, 0x61, 0x6e, 0x20, 0x72, 0x65, 0x64, 0x69, 0x73, 0x74,
+ 0x72, 0x69, 0x62, 0x75, 0x74, 0x65, 0x20, 0x69, 0x74, 0x20, 0x61, 0x6e,
+ 0x64, 0x2f, 0x6f, 0x72, 0x20, 0x6d, 0x6f, 0x64, 0x69, 0x66, 0x79, 0x20,
+ 0x69, 0x74, 0x2e, 0x0a, 0x2d, 0x2d, 0x20, 0x54, 0x68, 0x65, 0x20, 0x73,
+ 0x6f, 0x66, 0x74, 0x77, 0x61, 0x72, 0x65, 0x20, 0x70, 0x72, 0x6f, 0x76,
+ 0x69, 0x64, 0x65, 0x64, 0x20, 0x68, 0x65, 0x72, 0x65, 0x75, 0x6e, 0x64,
+ 0x65, 0x72, 0x20, 0x69, 0x73, 0x20, 0x6f, 0x6e, 0x20, 0x61, 0x6e, 0x20,
+ 0x22, 0x61, 0x73, 0x20, 0x69, 0x73, 0x22, 0x20, 0x62, 0x61, 0x73, 0x69,
+ 0x73, 0x2c, 0x20, 0x61, 0x6e, 0x64, 0x0a, 0x2d, 0x2d, 0x20, 0x74, 0x68,
+ 0x65, 0x20, 0x61, 0x75, 0x74, 0x68, 0x6f, 0x72, 0x20, 0x68, 0x61, 0x73,
+ 0x20, 0x6e, 0x6f, 0x20, 0x6f, 0x62, 0x6c, 0x69, 0x67, 0x61, 0x74, 0x69,
+ 0x6f, 0x6e, 0x20, 0x74, 0x6f, 0x20, 0x70, 0x72, 0x6f, 0x76, 0x69, 0x64,
+ 0x65, 0x20, 0x6d, 0x61, 0x69, 0x6e, 0x74, 0x65, 0x6e, 0x61, 0x6e, 0x63,
+ 0x65, 0x2c, 0x20, 0x73, 0x75, 0x70, 0x70, 0x6f, 0x72, 0x74, 0x2c, 0x20,
+ 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x73, 0x2c, 0x0a, 0x2d, 0x2d, 0x20,
+ 0x65, 0x6e, 0x68, 0x61, 0x6e, 0x63, 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x73,
+ 0x2c, 0x20, 0x6f, 0x72, 0x20, 0x6d, 0x6f, 0x64, 0x69, 0x66, 0x69, 0x63,
+ 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x2e, 0x0a, 0x0a, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x45, 0x6e, 0x75, 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x20, 0x63,
+ 0x6c, 0x61, 0x73, 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x52, 0x65, 0x70, 0x72,
+ 0x65, 0x73, 0x65, 0x6e, 0x74, 0x73, 0x20, 0x65, 0x6e, 0x75, 0x6d, 0x65,
+ 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x0a, 0x2d, 0x2d, 0x20, 0x54, 0x68,
+ 0x65, 0x20, 0x66, 0x6f, 0x6c, 0x6c, 0x6f, 0x77, 0x69, 0x6e, 0x67, 0x20,
+ 0x66, 0x69, 0x65, 0x6c, 0x64, 0x73, 0x20, 0x61, 0x72, 0x65, 0x20, 0x73,
+ 0x74, 0x6f, 0x72, 0x65, 0x64, 0x3a, 0x0a, 0x2d, 0x2d, 0x20, 0x20, 0x20,
+ 0x20, 0x7b, 0x69, 0x7d, 0x20, 0x3d, 0x20, 0x6c, 0x69, 0x73, 0x74, 0x20,
+ 0x6f, 0x66, 0x20, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x61, 0x6e, 0x74, 0x20,
+ 0x6e, 0x61, 0x6d, 0x65, 0x73, 0x0a, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x45,
+ 0x6e, 0x75, 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x20, 0x3d, 0x20, 0x7b,
+ 0x0a, 0x7d, 0x0a, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x45, 0x6e, 0x75, 0x6d,
+ 0x65, 0x72, 0x61, 0x74, 0x65, 0x2e, 0x5f, 0x5f, 0x69, 0x6e, 0x64, 0x65,
+ 0x78, 0x20, 0x3d, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x45, 0x6e, 0x75,
+ 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x0a, 0x73, 0x65, 0x74, 0x6d, 0x65,
+ 0x74, 0x61, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x28, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x45, 0x6e, 0x75, 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x2c, 0x63,
+ 0x6c, 0x61, 0x73, 0x73, 0x46, 0x65, 0x61, 0x74, 0x75, 0x72, 0x65, 0x29,
+ 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x72, 0x65, 0x67, 0x69, 0x73, 0x74, 0x65,
+ 0x72, 0x20, 0x65, 0x6e, 0x75, 0x6d, 0x65, 0x72, 0x61, 0x74, 0x69, 0x6f,
+ 0x6e, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63,
+ 0x6c, 0x61, 0x73, 0x73, 0x45, 0x6e, 0x75, 0x6d, 0x65, 0x72, 0x61, 0x74,
+ 0x65, 0x3a, 0x72, 0x65, 0x67, 0x69, 0x73, 0x74, 0x65, 0x72, 0x20, 0x28,
+ 0x70, 0x72, 0x65, 0x29, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x6e, 0x6f, 0x74,
+ 0x20, 0x73, 0x65, 0x6c, 0x66, 0x3a, 0x63, 0x68, 0x65, 0x63, 0x6b, 0x5f,
+ 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x61, 0x63, 0x63, 0x65, 0x73,
+ 0x73, 0x28, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x72,
+ 0x65, 0x74, 0x75, 0x72, 0x6e, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x20,
+ 0x70, 0x72, 0x65, 0x20, 0x3d, 0x20, 0x70, 0x72, 0x65, 0x20, 0x6f, 0x72,
+ 0x20, 0x27, 0x27, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6e,
+ 0x73, 0x70, 0x61, 0x63, 0x65, 0x20, 0x3d, 0x20, 0x67, 0x65, 0x74, 0x6e,
+ 0x61, 0x6d, 0x65, 0x73, 0x70, 0x61, 0x63, 0x65, 0x28, 0x63, 0x6c, 0x61,
+ 0x73, 0x73, 0x43, 0x6f, 0x6e, 0x74, 0x61, 0x69, 0x6e, 0x65, 0x72, 0x2e,
+ 0x63, 0x75, 0x72, 0x72, 0x29, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x69, 0x3d, 0x31, 0x0a, 0x20, 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x5b, 0x69, 0x5d, 0x20, 0x64, 0x6f, 0x0a, 0x20,
+ 0x09, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6c, 0x6e, 0x61,
+ 0x6d, 0x65, 0x73, 0x5b, 0x69, 0x5d, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x6c, 0x6e, 0x61, 0x6d, 0x65, 0x73, 0x5b, 0x69,
+ 0x5d, 0x20, 0x7e, 0x3d, 0x20, 0x22, 0x22, 0x20, 0x74, 0x68, 0x65, 0x6e,
+ 0x0a, 0x09, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x70, 0x72, 0x65, 0x2e, 0x2e, 0x27, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x61, 0x6e, 0x74, 0x28, 0x74, 0x6f, 0x6c,
+ 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x22, 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x6c, 0x6e, 0x61, 0x6d, 0x65, 0x73, 0x5b, 0x69, 0x5d, 0x2e,
+ 0x2e, 0x27, 0x22, 0x2c, 0x27, 0x2e, 0x2e, 0x6e, 0x73, 0x70, 0x61, 0x63,
+ 0x65, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x5b, 0x69, 0x5d, 0x2e, 0x2e,
+ 0x27, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x20,
+ 0x20, 0x69, 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a, 0x20, 0x65, 0x6e,
+ 0x64, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x50, 0x72,
+ 0x69, 0x6e, 0x74, 0x20, 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x0a, 0x66,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x45, 0x6e, 0x75, 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x3a, 0x70,
+ 0x72, 0x69, 0x6e, 0x74, 0x20, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2c,
+ 0x63, 0x6c, 0x6f, 0x73, 0x65, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e,
+ 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x45, 0x6e,
+ 0x75, 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x7b, 0x22, 0x29, 0x0a, 0x20,
+ 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e,
+ 0x2e, 0x22, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x22, 0x2e,
+ 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a,
+ 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x69, 0x3d, 0x31, 0x0a, 0x20,
+ 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x5b, 0x69,
+ 0x5d, 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74,
+ 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20, 0x27, 0x22,
+ 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x5b, 0x69, 0x5d, 0x2e, 0x2e, 0x22,
+ 0x27, 0x28, 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6c, 0x6e,
+ 0x61, 0x6d, 0x65, 0x73, 0x5b, 0x69, 0x5d, 0x2e, 0x2e, 0x22, 0x29, 0x2c,
+ 0x22, 0x29, 0x0a, 0x20, 0x20, 0x69, 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31,
+ 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74,
+ 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x7d, 0x22, 0x2e,
+ 0x2e, 0x63, 0x6c, 0x6f, 0x73, 0x65, 0x29, 0x0a, 0x65, 0x6e, 0x64, 0x0a,
+ 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x65, 0x6d,
+ 0x69, 0x74, 0x65, 0x6e, 0x75, 0x6d, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x74,
+ 0x79, 0x70, 0x65, 0x28, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x22, 0x69, 0x6e, 0x74, 0x20, 0x74,
+ 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x69, 0x73, 0x22, 0x20, 0x2e, 0x2e, 0x20,
+ 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28,
+ 0x74, 0x79, 0x70, 0x65, 0x2c, 0x22, 0x3a, 0x3a, 0x22, 0x2c, 0x22, 0x5f,
+ 0x22, 0x29, 0x20, 0x2e, 0x2e, 0x20, 0x22, 0x20, 0x28, 0x6c, 0x75, 0x61,
+ 0x5f, 0x53, 0x74, 0x61, 0x74, 0x65, 0x2a, 0x20, 0x4c, 0x2c, 0x20, 0x69,
+ 0x6e, 0x74, 0x20, 0x6c, 0x6f, 0x2c, 0x20, 0x69, 0x6e, 0x74, 0x20, 0x64,
+ 0x65, 0x66, 0x2c, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x45, 0x72,
+ 0x72, 0x6f, 0x72, 0x2a, 0x20, 0x65, 0x72, 0x72, 0x29, 0x3b, 0x22, 0x29,
+ 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x5f, 0x67, 0x6c, 0x6f, 0x62, 0x61,
+ 0x6c, 0x5f, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x5f, 0x65, 0x6e, 0x75,
+ 0x6d, 0x73, 0x20, 0x3d, 0x20, 0x7b, 0x7d, 0x0a, 0x0a, 0x2d, 0x2d, 0x20,
+ 0x77, 0x72, 0x69, 0x74, 0x65, 0x20, 0x73, 0x75, 0x70, 0x70, 0x6f, 0x72,
+ 0x74, 0x20, 0x63, 0x6f, 0x64, 0x65, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x45, 0x6e, 0x75,
+ 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x3a, 0x73, 0x75, 0x70, 0x63, 0x6f,
+ 0x64, 0x65, 0x20, 0x28, 0x29, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x5f, 0x67,
+ 0x6c, 0x6f, 0x62, 0x61, 0x6c, 0x5f, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x5f, 0x65, 0x6e, 0x75, 0x6d, 0x73, 0x5b, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x6e, 0x61, 0x6d, 0x65, 0x5d, 0x20, 0x3d, 0x3d, 0x20, 0x6e, 0x69, 0x6c,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x5f, 0x67, 0x6c, 0x6f,
+ 0x62, 0x61, 0x6c, 0x5f, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x5f, 0x65,
+ 0x6e, 0x75, 0x6d, 0x73, 0x5b, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61,
+ 0x6d, 0x65, 0x5d, 0x20, 0x3d, 0x20, 0x31, 0x0a, 0x09, 0x09, 0x6f, 0x75,
+ 0x74, 0x70, 0x75, 0x74, 0x28, 0x22, 0x69, 0x6e, 0x74, 0x20, 0x74, 0x6f,
+ 0x6c, 0x75, 0x61, 0x5f, 0x69, 0x73, 0x22, 0x20, 0x2e, 0x2e, 0x20, 0x73,
+ 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x22, 0x3a, 0x3a,
+ 0x22, 0x2c, 0x22, 0x5f, 0x22, 0x29, 0x20, 0x2e, 0x2e, 0x20, 0x22, 0x20,
+ 0x28, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x74, 0x61, 0x74, 0x65, 0x2a, 0x20,
+ 0x4c, 0x2c, 0x20, 0x69, 0x6e, 0x74, 0x20, 0x6c, 0x6f, 0x2c, 0x20, 0x69,
+ 0x6e, 0x74, 0x20, 0x64, 0x65, 0x66, 0x2c, 0x20, 0x74, 0x6f, 0x6c, 0x75,
+ 0x61, 0x5f, 0x45, 0x72, 0x72, 0x6f, 0x72, 0x2a, 0x20, 0x65, 0x72, 0x72,
+ 0x29, 0x22, 0x29, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x28, 0x22, 0x7b, 0x22, 0x29, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x22, 0x69, 0x66, 0x20, 0x28, 0x21, 0x74, 0x6f, 0x6c,
+ 0x75, 0x61, 0x5f, 0x69, 0x73, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x28,
+ 0x4c, 0x2c, 0x6c, 0x6f, 0x2c, 0x64, 0x65, 0x66, 0x2c, 0x65, 0x72, 0x72,
+ 0x29, 0x29, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x30, 0x3b,
+ 0x22, 0x29, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x22, 0x6c, 0x75, 0x61, 0x5f, 0x4e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x20,
+ 0x76, 0x61, 0x6c, 0x20, 0x3d, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x74, 0x6f, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x28, 0x4c, 0x2c, 0x6c,
+ 0x6f, 0x2c, 0x64, 0x65, 0x66, 0x29, 0x3b, 0x22, 0x29, 0x0a, 0x09, 0x09,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x22, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x20, 0x76, 0x61, 0x6c, 0x20, 0x3e, 0x3d, 0x20, 0x22, 0x20,
+ 0x2e, 0x2e, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x69, 0x6e, 0x20,
+ 0x2e, 0x2e, 0x20, 0x22, 0x2e, 0x30, 0x20, 0x26, 0x26, 0x20, 0x76, 0x61,
+ 0x6c, 0x20, 0x3c, 0x3d, 0x20, 0x22, 0x20, 0x2e, 0x2e, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x6d, 0x61, 0x78, 0x20, 0x2e, 0x2e, 0x20, 0x22, 0x2e, 0x30,
+ 0x3b, 0x22, 0x29, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x28, 0x22, 0x7d, 0x22, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x49, 0x6e, 0x74, 0x65, 0x72,
+ 0x6e, 0x61, 0x6c, 0x20, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x72, 0x75, 0x63,
+ 0x74, 0x6f, 0x72, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x5f, 0x45, 0x6e, 0x75, 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x20,
+ 0x28, 0x74, 0x2c, 0x76, 0x61, 0x72, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a,
+ 0x20, 0x73, 0x65, 0x74, 0x6d, 0x65, 0x74, 0x61, 0x74, 0x61, 0x62, 0x6c,
+ 0x65, 0x28, 0x74, 0x2c, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x45, 0x6e, 0x75,
+ 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x29, 0x0a, 0x20, 0x61, 0x70, 0x70,
+ 0x65, 0x6e, 0x64, 0x28, 0x74, 0x29, 0x0a, 0x20, 0x61, 0x70, 0x70, 0x65,
+ 0x6e, 0x64, 0x65, 0x6e, 0x75, 0x6d, 0x28, 0x74, 0x29, 0x0a, 0x09, 0x20,
+ 0x69, 0x66, 0x20, 0x76, 0x61, 0x72, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x61,
+ 0x6e, 0x64, 0x20, 0x76, 0x61, 0x72, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x7e,
+ 0x3d, 0x20, 0x22, 0x22, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09,
+ 0x69, 0x66, 0x20, 0x74, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x7e, 0x3d,
+ 0x20, 0x22, 0x22, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x09,
+ 0x56, 0x61, 0x72, 0x69, 0x61, 0x62, 0x6c, 0x65, 0x28, 0x74, 0x2e, 0x6e,
+ 0x61, 0x6d, 0x65, 0x2e, 0x2e, 0x22, 0x20, 0x22, 0x2e, 0x2e, 0x76, 0x61,
+ 0x72, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a, 0x09, 0x09, 0x65, 0x6c, 0x73,
+ 0x65, 0x0a, 0x09, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6e,
+ 0x73, 0x20, 0x3d, 0x20, 0x67, 0x65, 0x74, 0x63, 0x75, 0x72, 0x72, 0x6e,
+ 0x61, 0x6d, 0x65, 0x73, 0x70, 0x61, 0x63, 0x65, 0x28, 0x29, 0x0a, 0x09,
+ 0x09, 0x09, 0x77, 0x61, 0x72, 0x6e, 0x69, 0x6e, 0x67, 0x28, 0x22, 0x56,
+ 0x61, 0x72, 0x69, 0x61, 0x62, 0x6c, 0x65, 0x20, 0x22, 0x2e, 0x2e, 0x6e,
+ 0x73, 0x2e, 0x2e, 0x76, 0x61, 0x72, 0x6e, 0x61, 0x6d, 0x65, 0x2e, 0x2e,
+ 0x22, 0x20, 0x6f, 0x66, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3c, 0x61,
+ 0x6e, 0x6f, 0x6e, 0x79, 0x6d, 0x6f, 0x75, 0x73, 0x20, 0x65, 0x6e, 0x75,
+ 0x6d, 0x3e, 0x20, 0x69, 0x73, 0x20, 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72,
+ 0x65, 0x64, 0x20, 0x61, 0x73, 0x20, 0x72, 0x65, 0x61, 0x64, 0x2d, 0x6f,
+ 0x6e, 0x6c, 0x79, 0x22, 0x29, 0x0a, 0x09, 0x09, 0x09, 0x56, 0x61, 0x72,
+ 0x69, 0x61, 0x62, 0x6c, 0x65, 0x28, 0x22, 0x74, 0x6f, 0x6c, 0x75, 0x61,
+ 0x5f, 0x72, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x20, 0x69, 0x6e,
+ 0x74, 0x20, 0x22, 0x2e, 0x2e, 0x76, 0x61, 0x72, 0x6e, 0x61, 0x6d, 0x65,
+ 0x29, 0x0a, 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x65, 0x6e, 0x64,
+ 0x0a, 0x09, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x70, 0x61, 0x72,
+ 0x65, 0x6e, 0x74, 0x20, 0x3d, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x43,
+ 0x6f, 0x6e, 0x74, 0x61, 0x69, 0x6e, 0x65, 0x72, 0x2e, 0x63, 0x75, 0x72,
+ 0x72, 0x0a, 0x09, 0x20, 0x69, 0x66, 0x20, 0x70, 0x61, 0x72, 0x65, 0x6e,
+ 0x74, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x74, 0x2e, 0x61,
+ 0x63, 0x63, 0x65, 0x73, 0x73, 0x20, 0x3d, 0x20, 0x70, 0x61, 0x72, 0x65,
+ 0x6e, 0x74, 0x2e, 0x63, 0x75, 0x72, 0x72, 0x5f, 0x6d, 0x65, 0x6d, 0x62,
+ 0x65, 0x72, 0x5f, 0x61, 0x63, 0x63, 0x65, 0x73, 0x73, 0x0a, 0x09, 0x09,
+ 0x74, 0x2e, 0x67, 0x6c, 0x6f, 0x62, 0x61, 0x6c, 0x5f, 0x61, 0x63, 0x63,
+ 0x65, 0x73, 0x73, 0x20, 0x3d, 0x20, 0x74, 0x3a, 0x63, 0x68, 0x65, 0x63,
+ 0x6b, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x61, 0x63, 0x63,
+ 0x65, 0x73, 0x73, 0x28, 0x29, 0x0a, 0x09, 0x20, 0x65, 0x6e, 0x64, 0x0a,
+ 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x74, 0x0a, 0x65, 0x6e,
+ 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x43, 0x6f, 0x6e, 0x73, 0x74, 0x72,
+ 0x75, 0x63, 0x74, 0x6f, 0x72, 0x0a, 0x2d, 0x2d, 0x20, 0x45, 0x78, 0x70,
+ 0x65, 0x63, 0x74, 0x73, 0x20, 0x61, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e,
+ 0x67, 0x20, 0x72, 0x65, 0x70, 0x72, 0x65, 0x73, 0x65, 0x6e, 0x74, 0x69,
+ 0x6e, 0x67, 0x20, 0x74, 0x68, 0x65, 0x20, 0x65, 0x6e, 0x75, 0x6d, 0x65,
+ 0x72, 0x61, 0x74, 0x65, 0x20, 0x62, 0x6f, 0x64, 0x79, 0x0a, 0x66, 0x75,
+ 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x45, 0x6e, 0x75, 0x6d, 0x65,
+ 0x72, 0x61, 0x74, 0x65, 0x20, 0x28, 0x6e, 0x2c, 0x62, 0x2c, 0x76, 0x61,
+ 0x72, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a, 0x09, 0x62, 0x20, 0x3d, 0x20,
+ 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28,
+ 0x62, 0x2c, 0x20, 0x22, 0x2c, 0x5b, 0x25, 0x73, 0x5c, 0x6e, 0x5d, 0x2a,
+ 0x7d, 0x22, 0x2c, 0x20, 0x22, 0x5c, 0x6e, 0x7d, 0x22, 0x29, 0x20, 0x2d,
+ 0x2d, 0x20, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x6e, 0x61, 0x74, 0x65, 0x20,
+ 0x6c, 0x61, 0x73, 0x74, 0x20, 0x27, 0x2c, 0x27, 0x0a, 0x09, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69,
+ 0x74, 0x28, 0x73, 0x74, 0x72, 0x73, 0x75, 0x62, 0x28, 0x62, 0x2c, 0x32,
+ 0x2c, 0x2d, 0x32, 0x29, 0x2c, 0x27, 0x2c, 0x27, 0x29, 0x20, 0x2d, 0x2d,
+ 0x20, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x6e, 0x61, 0x74, 0x65, 0x20, 0x62,
+ 0x72, 0x61, 0x63, 0x65, 0x73, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x69, 0x20, 0x3d, 0x20, 0x31, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x65, 0x20, 0x3d, 0x20, 0x7b, 0x6e, 0x3d, 0x30, 0x7d, 0x0a,
+ 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65,
+ 0x20, 0x3d, 0x20, 0x30, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x6d, 0x69, 0x6e, 0x20, 0x3d, 0x20, 0x30, 0x0a, 0x09, 0x6c, 0x6f, 0x63,
+ 0x61, 0x6c, 0x20, 0x6d, 0x61, 0x78, 0x20, 0x3d, 0x20, 0x30, 0x0a, 0x09,
+ 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20, 0x74, 0x5b, 0x69, 0x5d, 0x20, 0x64,
+ 0x6f, 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x74,
+ 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x28, 0x74, 0x5b, 0x69,
+ 0x5d, 0x2c, 0x27, 0x3d, 0x27, 0x29, 0x20, 0x20, 0x2d, 0x2d, 0x20, 0x64,
+ 0x69, 0x73, 0x63, 0x61, 0x72, 0x64, 0x20, 0x69, 0x6e, 0x69, 0x74, 0x69,
+ 0x61, 0x6c, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x0a, 0x09, 0x09, 0x65,
+ 0x2e, 0x6e, 0x20, 0x3d, 0x20, 0x65, 0x2e, 0x6e, 0x20, 0x2b, 0x20, 0x31,
+ 0x0a, 0x09, 0x09, 0x65, 0x5b, 0x65, 0x2e, 0x6e, 0x5d, 0x20, 0x3d, 0x20,
+ 0x74, 0x74, 0x5b, 0x31, 0x5d, 0x0a, 0x09, 0x09, 0x74, 0x74, 0x5b, 0x32,
+ 0x5d, 0x20, 0x3d, 0x20, 0x74, 0x6f, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72,
+ 0x28, 0x74, 0x74, 0x5b, 0x32, 0x5d, 0x29, 0x0a, 0x09, 0x09, 0x69, 0x66,
+ 0x20, 0x74, 0x74, 0x5b, 0x32, 0x5d, 0x20, 0x3d, 0x3d, 0x20, 0x6e, 0x69,
+ 0x6c, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x09, 0x74, 0x74,
+ 0x5b, 0x32, 0x5d, 0x20, 0x3d, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x0a,
+ 0x09, 0x09, 0x65, 0x6e, 0x64, 0x20, 0x0a, 0x20, 0x20, 0x09, 0x09, 0x76,
+ 0x61, 0x6c, 0x75, 0x65, 0x20, 0x3d, 0x20, 0x74, 0x74, 0x5b, 0x32, 0x5d,
+ 0x20, 0x2b, 0x20, 0x31, 0x20, 0x2d, 0x2d, 0x20, 0x61, 0x64, 0x76, 0x61,
+ 0x6e, 0x63, 0x65, 0x20, 0x74, 0x68, 0x65, 0x20, 0x73, 0x65, 0x6c, 0x65,
+ 0x63, 0x74, 0x65, 0x64, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x0a, 0x09,
+ 0x09, 0x69, 0x66, 0x20, 0x74, 0x74, 0x5b, 0x32, 0x5d, 0x20, 0x3e, 0x20,
+ 0x6d, 0x61, 0x78, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x09,
+ 0x6d, 0x61, 0x78, 0x20, 0x3d, 0x20, 0x74, 0x74, 0x5b, 0x32, 0x5d, 0x0a,
+ 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x09, 0x69, 0x66, 0x20, 0x74,
+ 0x74, 0x5b, 0x32, 0x5d, 0x20, 0x3c, 0x20, 0x6d, 0x69, 0x6e, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x09, 0x6d, 0x69, 0x6e, 0x20, 0x3d,
+ 0x20, 0x74, 0x74, 0x5b, 0x32, 0x5d, 0x0a, 0x09, 0x09, 0x65, 0x6e, 0x64,
+ 0x0a, 0x09, 0x09, 0x69, 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a, 0x09,
+ 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x2d, 0x2d, 0x20, 0x73, 0x65, 0x74, 0x20,
+ 0x6c, 0x75, 0x61, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x73, 0x0a, 0x09, 0x69,
+ 0x20, 0x20, 0x3d, 0x20, 0x31, 0x0a, 0x09, 0x65, 0x2e, 0x6c, 0x6e, 0x61,
+ 0x6d, 0x65, 0x73, 0x20, 0x3d, 0x20, 0x7b, 0x7d, 0x0a, 0x09, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x6e, 0x73, 0x20, 0x3d, 0x20, 0x67, 0x65, 0x74,
+ 0x63, 0x75, 0x72, 0x72, 0x6e, 0x61, 0x6d, 0x65, 0x73, 0x70, 0x61, 0x63,
+ 0x65, 0x28, 0x29, 0x0a, 0x09, 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20, 0x65,
+ 0x5b, 0x69, 0x5d, 0x20, 0x64, 0x6f, 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63,
+ 0x61, 0x6c, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74,
+ 0x28, 0x65, 0x5b, 0x69, 0x5d, 0x2c, 0x27, 0x40, 0x27, 0x29, 0x0a, 0x09,
+ 0x09, 0x65, 0x5b, 0x69, 0x5d, 0x20, 0x3d, 0x20, 0x74, 0x5b, 0x31, 0x5d,
+ 0x0a, 0x09, 0x09, 0x69, 0x66, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x74, 0x5b,
+ 0x32, 0x5d, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x09, 0x74,
+ 0x5b, 0x32, 0x5d, 0x20, 0x3d, 0x20, 0x61, 0x70, 0x70, 0x6c, 0x79, 0x72,
+ 0x65, 0x6e, 0x61, 0x6d, 0x69, 0x6e, 0x67, 0x28, 0x74, 0x5b, 0x31, 0x5d,
+ 0x29, 0x0a, 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x09, 0x65, 0x2e,
+ 0x6c, 0x6e, 0x61, 0x6d, 0x65, 0x73, 0x5b, 0x69, 0x5d, 0x20, 0x3d, 0x20,
+ 0x74, 0x5b, 0x32, 0x5d, 0x20, 0x6f, 0x72, 0x20, 0x74, 0x5b, 0x31, 0x5d,
+ 0x0a, 0x09, 0x09, 0x5f, 0x67, 0x6c, 0x6f, 0x62, 0x61, 0x6c, 0x5f, 0x65,
+ 0x6e, 0x75, 0x6d, 0x73, 0x5b, 0x20, 0x6e, 0x73, 0x2e, 0x2e, 0x65, 0x5b,
+ 0x69, 0x5d, 0x20, 0x5d, 0x20, 0x3d, 0x20, 0x28, 0x6e, 0x73, 0x2e, 0x2e,
+ 0x65, 0x5b, 0x69, 0x5d, 0x29, 0x0a, 0x09, 0x09, 0x69, 0x20, 0x3d, 0x20,
+ 0x69, 0x2b, 0x31, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x65, 0x2e,
+ 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x6e, 0x0a, 0x09, 0x65, 0x2e,
+ 0x6d, 0x69, 0x6e, 0x20, 0x3d, 0x20, 0x6d, 0x69, 0x6e, 0x0a, 0x09, 0x65,
+ 0x2e, 0x6d, 0x61, 0x78, 0x20, 0x3d, 0x20, 0x6d, 0x61, 0x78, 0x0a, 0x09,
+ 0x69, 0x66, 0x20, 0x6e, 0x20, 0x7e, 0x3d, 0x20, 0x22, 0x22, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x5f, 0x65, 0x6e, 0x75, 0x6d, 0x73,
+ 0x5b, 0x6e, 0x5d, 0x20, 0x3d, 0x20, 0x74, 0x72, 0x75, 0x65, 0x0a, 0x09,
+ 0x09, 0x54, 0x79, 0x70, 0x65, 0x64, 0x65, 0x66, 0x28, 0x22, 0x69, 0x6e,
+ 0x74, 0x20, 0x22, 0x2e, 0x2e, 0x6e, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64,
+ 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x5f, 0x45, 0x6e,
+ 0x75, 0x6d, 0x65, 0x72, 0x61, 0x74, 0x65, 0x28, 0x65, 0x2c, 0x20, 0x76,
+ 0x61, 0x72, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a, 0x65, 0x6e, 0x64, 0x0a,
+ 0x0a
+};
+unsigned int lua_enumerate_lua_len = 3493;
diff --git a/lib/tolua++/src/bin/function_lua.h b/lib/tolua++/src/bin/function_lua.h
new file mode 100644
index 000000000..bcb0bfca2
--- /dev/null
+++ b/lib/tolua++/src/bin/function_lua.h
@@ -0,0 +1,1210 @@
+static const unsigned char lua_function_lua[] = {
+ 0x2d, 0x2d, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x3a, 0x20, 0x66, 0x75,
+ 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73,
+ 0x0a, 0x2d, 0x2d, 0x20, 0x57, 0x72, 0x69, 0x74, 0x74, 0x65, 0x6e, 0x20,
+ 0x62, 0x79, 0x20, 0x57, 0x61, 0x6c, 0x64, 0x65, 0x6d, 0x61, 0x72, 0x20,
+ 0x43, 0x65, 0x6c, 0x65, 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x54, 0x65, 0x43,
+ 0x47, 0x72, 0x61, 0x66, 0x2f, 0x50, 0x55, 0x43, 0x2d, 0x52, 0x69, 0x6f,
+ 0x0a, 0x2d, 0x2d, 0x20, 0x4a, 0x75, 0x6c, 0x20, 0x31, 0x39, 0x39, 0x38,
+ 0x0a, 0x2d, 0x2d, 0x20, 0x24, 0x49, 0x64, 0x3a, 0x20, 0x24, 0x0a, 0x0a,
+ 0x2d, 0x2d, 0x20, 0x54, 0x68, 0x69, 0x73, 0x20, 0x63, 0x6f, 0x64, 0x65,
+ 0x20, 0x69, 0x73, 0x20, 0x66, 0x72, 0x65, 0x65, 0x20, 0x73, 0x6f, 0x66,
+ 0x74, 0x77, 0x61, 0x72, 0x65, 0x3b, 0x20, 0x79, 0x6f, 0x75, 0x20, 0x63,
+ 0x61, 0x6e, 0x20, 0x72, 0x65, 0x64, 0x69, 0x73, 0x74, 0x72, 0x69, 0x62,
+ 0x75, 0x74, 0x65, 0x20, 0x69, 0x74, 0x20, 0x61, 0x6e, 0x64, 0x2f, 0x6f,
+ 0x72, 0x20, 0x6d, 0x6f, 0x64, 0x69, 0x66, 0x79, 0x20, 0x69, 0x74, 0x2e,
+ 0x0a, 0x2d, 0x2d, 0x20, 0x54, 0x68, 0x65, 0x20, 0x73, 0x6f, 0x66, 0x74,
+ 0x77, 0x61, 0x72, 0x65, 0x20, 0x70, 0x72, 0x6f, 0x76, 0x69, 0x64, 0x65,
+ 0x64, 0x20, 0x68, 0x65, 0x72, 0x65, 0x75, 0x6e, 0x64, 0x65, 0x72, 0x20,
+ 0x69, 0x73, 0x20, 0x6f, 0x6e, 0x20, 0x61, 0x6e, 0x20, 0x22, 0x61, 0x73,
+ 0x20, 0x69, 0x73, 0x22, 0x20, 0x62, 0x61, 0x73, 0x69, 0x73, 0x2c, 0x20,
+ 0x61, 0x6e, 0x64, 0x0a, 0x2d, 0x2d, 0x20, 0x74, 0x68, 0x65, 0x20, 0x61,
+ 0x75, 0x74, 0x68, 0x6f, 0x72, 0x20, 0x68, 0x61, 0x73, 0x20, 0x6e, 0x6f,
+ 0x20, 0x6f, 0x62, 0x6c, 0x69, 0x67, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x20,
+ 0x74, 0x6f, 0x20, 0x70, 0x72, 0x6f, 0x76, 0x69, 0x64, 0x65, 0x20, 0x6d,
+ 0x61, 0x69, 0x6e, 0x74, 0x65, 0x6e, 0x61, 0x6e, 0x63, 0x65, 0x2c, 0x20,
+ 0x73, 0x75, 0x70, 0x70, 0x6f, 0x72, 0x74, 0x2c, 0x20, 0x75, 0x70, 0x64,
+ 0x61, 0x74, 0x65, 0x73, 0x2c, 0x0a, 0x2d, 0x2d, 0x20, 0x65, 0x6e, 0x68,
+ 0x61, 0x6e, 0x63, 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x73, 0x2c, 0x20, 0x6f,
+ 0x72, 0x20, 0x6d, 0x6f, 0x64, 0x69, 0x66, 0x69, 0x63, 0x61, 0x74, 0x69,
+ 0x6f, 0x6e, 0x73, 0x2e, 0x0a, 0x0a, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x46,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x52, 0x65, 0x70, 0x72, 0x65, 0x73, 0x65,
+ 0x6e, 0x74, 0x73, 0x20, 0x61, 0x20, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69,
+ 0x6f, 0x6e, 0x20, 0x6f, 0x72, 0x20, 0x61, 0x20, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x20, 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x2e, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x54, 0x68, 0x65, 0x20, 0x66, 0x6f, 0x6c, 0x6c, 0x6f, 0x77, 0x69,
+ 0x6e, 0x67, 0x20, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x73, 0x20, 0x61, 0x72,
+ 0x65, 0x20, 0x73, 0x74, 0x6f, 0x72, 0x65, 0x64, 0x3a, 0x0a, 0x2d, 0x2d,
+ 0x20, 0x20, 0x6d, 0x6f, 0x64, 0x20, 0x20, 0x3d, 0x20, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x6d, 0x6f, 0x64, 0x69, 0x66, 0x69, 0x65, 0x72, 0x73, 0x0a,
+ 0x2d, 0x2d, 0x20, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x74,
+ 0x79, 0x70, 0x65, 0x0a, 0x2d, 0x2d, 0x20, 0x20, 0x70, 0x74, 0x72, 0x20,
+ 0x20, 0x3d, 0x20, 0x22, 0x2a, 0x22, 0x20, 0x6f, 0x72, 0x20, 0x22, 0x26,
+ 0x22, 0x2c, 0x20, 0x69, 0x66, 0x20, 0x72, 0x65, 0x70, 0x72, 0x65, 0x73,
+ 0x65, 0x6e, 0x74, 0x69, 0x6e, 0x67, 0x20, 0x61, 0x20, 0x70, 0x6f, 0x69,
+ 0x6e, 0x74, 0x65, 0x72, 0x20, 0x6f, 0x72, 0x20, 0x61, 0x20, 0x72, 0x65,
+ 0x66, 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x0a, 0x2d, 0x2d, 0x20, 0x20,
+ 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x0a,
+ 0x2d, 0x2d, 0x20, 0x20, 0x6c, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20,
+ 0x6c, 0x75, 0x61, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x0a, 0x2d, 0x2d, 0x20,
+ 0x20, 0x61, 0x72, 0x67, 0x73, 0x20, 0x20, 0x3d, 0x20, 0x6c, 0x69, 0x73,
+ 0x74, 0x20, 0x6f, 0x66, 0x20, 0x61, 0x72, 0x67, 0x75, 0x6d, 0x65, 0x6e,
+ 0x74, 0x20, 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f,
+ 0x6e, 0x73, 0x0a, 0x2d, 0x2d, 0x20, 0x20, 0x63, 0x6f, 0x6e, 0x73, 0x74,
+ 0x20, 0x3d, 0x20, 0x69, 0x66, 0x20, 0x69, 0x74, 0x20, 0x69, 0x73, 0x20,
+ 0x61, 0x20, 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x20, 0x72, 0x65, 0x63,
+ 0x65, 0x69, 0x76, 0x69, 0x6e, 0x67, 0x20, 0x61, 0x20, 0x63, 0x6f, 0x6e,
+ 0x73, 0x74, 0x20, 0x22, 0x74, 0x68, 0x69, 0x73, 0x22, 0x2e, 0x0a, 0x63,
+ 0x6c, 0x61, 0x73, 0x73, 0x46, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x3d, 0x20, 0x7b, 0x0a, 0x20, 0x6d, 0x6f, 0x64, 0x20, 0x3d, 0x20,
+ 0x27, 0x27, 0x2c, 0x0a, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20,
+ 0x27, 0x27, 0x2c, 0x0a, 0x20, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x20, 0x27,
+ 0x27, 0x2c, 0x0a, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x27,
+ 0x27, 0x2c, 0x0a, 0x20, 0x61, 0x72, 0x67, 0x73, 0x20, 0x3d, 0x20, 0x7b,
+ 0x6e, 0x3d, 0x30, 0x7d, 0x2c, 0x0a, 0x20, 0x63, 0x6f, 0x6e, 0x73, 0x74,
+ 0x20, 0x3d, 0x20, 0x27, 0x27, 0x2c, 0x0a, 0x7d, 0x0a, 0x63, 0x6c, 0x61,
+ 0x73, 0x73, 0x46, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x5f,
+ 0x5f, 0x69, 0x6e, 0x64, 0x65, 0x78, 0x20, 0x3d, 0x20, 0x63, 0x6c, 0x61,
+ 0x73, 0x73, 0x46, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x0a, 0x73,
+ 0x65, 0x74, 0x6d, 0x65, 0x74, 0x61, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x28,
+ 0x63, 0x6c, 0x61, 0x73, 0x73, 0x46, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f,
+ 0x6e, 0x2c, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x46, 0x65, 0x61, 0x74, 0x75,
+ 0x72, 0x65, 0x29, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x64, 0x65, 0x63, 0x6c,
+ 0x61, 0x72, 0x65, 0x20, 0x74, 0x61, 0x67, 0x73, 0x0a, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x46,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x64, 0x65, 0x63, 0x6c,
+ 0x74, 0x79, 0x70, 0x65, 0x20, 0x28, 0x29, 0x0a, 0x20, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x74, 0x79, 0x70,
+ 0x65, 0x76, 0x61, 0x72, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79,
+ 0x70, 0x65, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x74, 0x72, 0x66,
+ 0x69, 0x6e, 0x64, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64,
+ 0x2c, 0x27, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x27, 0x29, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79,
+ 0x70, 0x65, 0x20, 0x3d, 0x20, 0x27, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20,
+ 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65,
+ 0x0a, 0x09, 0x09, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x20,
+ 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x6d, 0x6f, 0x64, 0x2c, 0x27, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x27, 0x2c,
+ 0x27, 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x69, 0x3d, 0x31, 0x0a, 0x20, 0x77, 0x68, 0x69,
+ 0x6c, 0x65, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73,
+ 0x5b, 0x69, 0x5d, 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x3a, 0x64, 0x65,
+ 0x63, 0x6c, 0x74, 0x79, 0x70, 0x65, 0x28, 0x29, 0x0a, 0x20, 0x20, 0x69,
+ 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x57, 0x72, 0x69,
+ 0x74, 0x65, 0x20, 0x62, 0x69, 0x6e, 0x64, 0x69, 0x6e, 0x67, 0x20, 0x66,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x0a, 0x2d, 0x2d, 0x20, 0x4f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x73, 0x20, 0x43, 0x2f, 0x43, 0x2b, 0x2b,
+ 0x20, 0x62, 0x69, 0x6e, 0x64, 0x69, 0x6e, 0x67, 0x20, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x46, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x73, 0x75, 0x70, 0x63, 0x6f, 0x64,
+ 0x65, 0x20, 0x28, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x5f, 0x63, 0x6f, 0x6e,
+ 0x73, 0x74, 0x72, 0x75, 0x63, 0x74, 0x6f, 0x72, 0x29, 0x0a, 0x20, 0x6c,
+ 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6f, 0x76, 0x65, 0x72, 0x6c, 0x6f, 0x61,
+ 0x64, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x73, 0x75, 0x62, 0x28, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x63, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x2d, 0x32,
+ 0x2c, 0x2d, 0x31, 0x29, 0x20, 0x2d, 0x20, 0x31, 0x20, 0x20, 0x2d, 0x2d,
+ 0x20, 0x69, 0x6e, 0x64, 0x69, 0x63, 0x61, 0x74, 0x65, 0x20, 0x6f, 0x76,
+ 0x65, 0x72, 0x6c, 0x6f, 0x61, 0x64, 0x65, 0x64, 0x20, 0x66, 0x75, 0x6e,
+ 0x63, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6e, 0x72, 0x65,
+ 0x74, 0x20, 0x3d, 0x20, 0x30, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20, 0x2d,
+ 0x2d, 0x20, 0x6e, 0x75, 0x6d, 0x62, 0x65, 0x72, 0x20, 0x6f, 0x66, 0x20,
+ 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x65, 0x64, 0x20, 0x76, 0x61, 0x6c,
+ 0x75, 0x65, 0x73, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x63,
+ 0x6c, 0x61, 0x73, 0x73, 0x20, 0x3d, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x3a,
+ 0x69, 0x6e, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x28, 0x29, 0x0a, 0x20, 0x6c,
+ 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x5f, 0x2c, 0x5f, 0x2c, 0x73, 0x74, 0x61,
+ 0x74, 0x69, 0x63, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x66, 0x69, 0x6e,
+ 0x64, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x27,
+ 0x5e, 0x25, 0x73, 0x2a, 0x28, 0x73, 0x74, 0x61, 0x74, 0x69, 0x63, 0x29,
+ 0x27, 0x29, 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x70, 0x72, 0x6f, 0x74, 0x6f,
+ 0x74, 0x79, 0x70, 0x65, 0x73, 0x20, 0x66, 0x6f, 0x72, 0x20, 0x65, 0x6e,
+ 0x75, 0x6d, 0x20, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73,
+ 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72,
+ 0x67, 0x73, 0x5b, 0x31, 0x5d, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x7e,
+ 0x3d, 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64, 0x27, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x69, 0x3d,
+ 0x31, 0x0a, 0x20, 0x20, 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x20, 0x64,
+ 0x6f, 0x0a, 0x20, 0x20, 0x20, 0x69, 0x66, 0x20, 0x69, 0x73, 0x65, 0x6e,
+ 0x75, 0x6d, 0x74, 0x79, 0x70, 0x65, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x2e, 0x74, 0x79, 0x70, 0x65,
+ 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20,
+ 0x65, 0x6d, 0x69, 0x74, 0x65, 0x6e, 0x75, 0x6d, 0x70, 0x72, 0x6f, 0x74,
+ 0x6f, 0x74, 0x79, 0x70, 0x65, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61,
+ 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29,
+ 0x0a, 0x20, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x20, 0x69,
+ 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64,
+ 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x63, 0x6c,
+ 0x61, 0x73, 0x73, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x0a, 0x20, 0x09,
+ 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65,
+ 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x6e, 0x65, 0x77, 0x27, 0x20, 0x61, 0x6e,
+ 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x61, 0x72, 0x65, 0x6e,
+ 0x74, 0x2e, 0x66, 0x6c, 0x61, 0x67, 0x73, 0x2e, 0x70, 0x75, 0x72, 0x65,
+ 0x5f, 0x76, 0x69, 0x72, 0x74, 0x75, 0x61, 0x6c, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x09, 0x09, 0x2d, 0x2d, 0x20, 0x6e, 0x6f, 0x20, 0x63,
+ 0x6f, 0x6e, 0x73, 0x74, 0x72, 0x75, 0x63, 0x74, 0x6f, 0x72, 0x20, 0x66,
+ 0x6f, 0x72, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x65, 0x73, 0x20, 0x77,
+ 0x69, 0x74, 0x68, 0x20, 0x70, 0x75, 0x72, 0x65, 0x20, 0x76, 0x69, 0x72,
+ 0x74, 0x75, 0x61, 0x6c, 0x20, 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x73,
+ 0x0a, 0x20, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x0a, 0x20,
+ 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x09, 0x69, 0x66, 0x20, 0x6c,
+ 0x6f, 0x63, 0x61, 0x6c, 0x5f, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x72, 0x75,
+ 0x63, 0x74, 0x6f, 0x72, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x22, 0x2f, 0x2a, 0x20, 0x6d,
+ 0x65, 0x74, 0x68, 0x6f, 0x64, 0x3a, 0x20, 0x6e, 0x65, 0x77, 0x5f, 0x6c,
+ 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6f, 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x20, 0x22, 0x2c, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x2c, 0x22, 0x20,
+ 0x2a, 0x2f, 0x22, 0x29, 0x0a, 0x09, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x09,
+ 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x22, 0x2f, 0x2a, 0x20,
+ 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x3a, 0x22, 0x2c, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x22, 0x20, 0x6f, 0x66, 0x20,
+ 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20, 0x22, 0x2c, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x2c, 0x22, 0x20, 0x2a, 0x2f, 0x22, 0x29, 0x0a, 0x09, 0x65, 0x6e,
+ 0x64, 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x20, 0x20, 0x6f, 0x75,
+ 0x74, 0x70, 0x75, 0x74, 0x28, 0x22, 0x2f, 0x2a, 0x20, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x22, 0x2c, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x22, 0x20, 0x2a, 0x2f, 0x22, 0x29,
+ 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x6c,
+ 0x6f, 0x63, 0x61, 0x6c, 0x5f, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x72, 0x75,
+ 0x63, 0x74, 0x6f, 0x72, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x22, 0x23, 0x69, 0x66, 0x6e,
+ 0x64, 0x65, 0x66, 0x20, 0x54, 0x4f, 0x4c, 0x55, 0x41, 0x5f, 0x44, 0x49,
+ 0x53, 0x41, 0x42, 0x4c, 0x45, 0x5f, 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x63, 0x6e, 0x61, 0x6d, 0x65, 0x2e, 0x2e, 0x22, 0x5f, 0x6c,
+ 0x6f, 0x63, 0x61, 0x6c, 0x22, 0x29, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74,
+ 0x70, 0x75, 0x74, 0x28, 0x22, 0x5c, 0x6e, 0x73, 0x74, 0x61, 0x74, 0x69,
+ 0x63, 0x20, 0x69, 0x6e, 0x74, 0x22, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x63, 0x6e, 0x61, 0x6d, 0x65, 0x2e, 0x2e, 0x22, 0x5f, 0x6c, 0x6f, 0x63,
+ 0x61, 0x6c, 0x22, 0x2c, 0x22, 0x28, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x74,
+ 0x61, 0x74, 0x65, 0x2a, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53,
+ 0x29, 0x22, 0x29, 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x20, 0x20,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x22, 0x23, 0x69, 0x66, 0x6e,
+ 0x64, 0x65, 0x66, 0x20, 0x54, 0x4f, 0x4c, 0x55, 0x41, 0x5f, 0x44, 0x49,
+ 0x53, 0x41, 0x42, 0x4c, 0x45, 0x5f, 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x63, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a, 0x20, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x22, 0x5c, 0x6e, 0x73, 0x74, 0x61,
+ 0x74, 0x69, 0x63, 0x20, 0x69, 0x6e, 0x74, 0x22, 0x2c, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x63, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x22, 0x28, 0x6c, 0x75,
+ 0x61, 0x5f, 0x53, 0x74, 0x61, 0x74, 0x65, 0x2a, 0x20, 0x74, 0x6f, 0x6c,
+ 0x75, 0x61, 0x5f, 0x53, 0x29, 0x22, 0x29, 0x0a, 0x20, 0x65, 0x6e, 0x64,
+ 0x0a, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x22, 0x7b, 0x22,
+ 0x29, 0x0a, 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65, 0x63, 0x6b,
+ 0x20, 0x74, 0x79, 0x70, 0x65, 0x73, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x6f,
+ 0x76, 0x65, 0x72, 0x6c, 0x6f, 0x61, 0x64, 0x20, 0x3c, 0x20, 0x30, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75,
+ 0x74, 0x28, 0x27, 0x23, 0x69, 0x66, 0x6e, 0x64, 0x65, 0x66, 0x20, 0x54,
+ 0x4f, 0x4c, 0x55, 0x41, 0x5f, 0x52, 0x45, 0x4c, 0x45, 0x41, 0x53, 0x45,
+ 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x74, 0x6f, 0x6c, 0x75,
+ 0x61, 0x5f, 0x45, 0x72, 0x72, 0x6f, 0x72, 0x20, 0x74, 0x6f, 0x6c, 0x75,
+ 0x61, 0x5f, 0x65, 0x72, 0x72, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x6f, 0x75,
+ 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x69, 0x66, 0x20, 0x28, 0x5c,
+ 0x6e, 0x27, 0x29, 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65, 0x63,
+ 0x6b, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x6e, 0x61, 0x72, 0x67, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x63,
+ 0x6c, 0x61, 0x73, 0x73, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x6e, 0x61,
+ 0x72, 0x67, 0x3d, 0x32, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x20, 0x6e, 0x61,
+ 0x72, 0x67, 0x3d, 0x31, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x69, 0x66,
+ 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x66, 0x75, 0x6e, 0x63,
+ 0x20, 0x3d, 0x20, 0x67, 0x65, 0x74, 0x5f, 0x69, 0x73, 0x5f, 0x66, 0x75,
+ 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x70, 0x61, 0x72, 0x65, 0x6e, 0x74, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29,
+ 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x3d, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x61, 0x72,
+ 0x65, 0x6e, 0x74, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x09, 0x09, 0x69,
+ 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x3d,
+ 0x3d, 0x27, 0x6e, 0x65, 0x77, 0x27, 0x20, 0x6f, 0x72, 0x20, 0x73, 0x74,
+ 0x61, 0x74, 0x69, 0x63, 0x7e, 0x3d, 0x6e, 0x69, 0x6c, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x09, 0x66, 0x75, 0x6e, 0x63, 0x20, 0x3d,
+ 0x20, 0x27, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x69, 0x73, 0x75, 0x73,
+ 0x65, 0x72, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x27, 0x0a, 0x09, 0x09, 0x09,
+ 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x70, 0x61, 0x72, 0x65, 0x6e, 0x74, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x0a,
+ 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x09, 0x69, 0x66, 0x20, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x7e, 0x3d,
+ 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x09,
+ 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x22, 0x63, 0x6f, 0x6e, 0x73,
+ 0x74, 0x20, 0x22, 0x2e, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x0a, 0x09, 0x09,
+ 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x28, 0x27, 0x20, 0x20, 0x20, 0x20, 0x20, 0x21, 0x27, 0x2e, 0x2e, 0x66,
+ 0x75, 0x6e, 0x63, 0x2e, 0x2e, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61,
+ 0x5f, 0x53, 0x2c, 0x31, 0x2c, 0x22, 0x27, 0x2e, 0x2e, 0x74, 0x79, 0x70,
+ 0x65, 0x2e, 0x2e, 0x27, 0x22, 0x2c, 0x30, 0x2c, 0x26, 0x74, 0x6f, 0x6c,
+ 0x75, 0x61, 0x5f, 0x65, 0x72, 0x72, 0x29, 0x20, 0x7c, 0x7c, 0x5c, 0x6e,
+ 0x27, 0x29, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x2d, 0x2d, 0x20,
+ 0x63, 0x68, 0x65, 0x63, 0x6b, 0x20, 0x61, 0x72, 0x67, 0x73, 0x0a, 0x20,
+ 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73,
+ 0x5b, 0x31, 0x5d, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x7e, 0x3d, 0x20,
+ 0x27, 0x76, 0x6f, 0x69, 0x64, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x69, 0x3d, 0x31, 0x0a,
+ 0x20, 0x20, 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x20, 0x64, 0x6f, 0x0a,
+ 0x20, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x62, 0x74, 0x79,
+ 0x70, 0x65, 0x20, 0x3d, 0x20, 0x69, 0x73, 0x62, 0x61, 0x73, 0x69, 0x63,
+ 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69,
+ 0x5d, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x69,
+ 0x66, 0x20, 0x62, 0x74, 0x79, 0x70, 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27,
+ 0x76, 0x61, 0x6c, 0x75, 0x65, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x62,
+ 0x74, 0x79, 0x70, 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x73, 0x74, 0x61,
+ 0x74, 0x65, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20,
+ 0x20, 0x20, 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72,
+ 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x3a, 0x6f, 0x75, 0x74, 0x63, 0x68, 0x65,
+ 0x63, 0x6b, 0x74, 0x79, 0x70, 0x65, 0x28, 0x6e, 0x61, 0x72, 0x67, 0x29,
+ 0x2e, 0x2e, 0x27, 0x20, 0x7c, 0x7c, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x20,
+ 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x20, 0x69, 0x66, 0x20,
+ 0x62, 0x74, 0x79, 0x70, 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x73, 0x74,
+ 0x61, 0x74, 0x65, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20,
+ 0x20, 0x20, 0x6e, 0x61, 0x72, 0x67, 0x20, 0x3d, 0x20, 0x6e, 0x61, 0x72,
+ 0x67, 0x2b, 0x31, 0x0a, 0x20, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20,
+ 0x20, 0x20, 0x69, 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a, 0x20, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x2d, 0x2d,
+ 0x20, 0x63, 0x68, 0x65, 0x63, 0x6b, 0x20, 0x65, 0x6e, 0x64, 0x20, 0x6f,
+ 0x66, 0x20, 0x6c, 0x69, 0x73, 0x74, 0x0a, 0x20, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x20, 0x20, 0x21, 0x74, 0x6f,
+ 0x6c, 0x75, 0x61, 0x5f, 0x69, 0x73, 0x6e, 0x6f, 0x6f, 0x62, 0x6a, 0x28,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x27, 0x2e, 0x2e, 0x6e,
+ 0x61, 0x72, 0x67, 0x2e, 0x2e, 0x27, 0x2c, 0x26, 0x74, 0x6f, 0x6c, 0x75,
+ 0x61, 0x5f, 0x65, 0x72, 0x72, 0x29, 0x5c, 0x6e, 0x20, 0x29, 0x27, 0x29,
+ 0x0a, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20,
+ 0x67, 0x6f, 0x74, 0x6f, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6c,
+ 0x65, 0x72, 0x72, 0x6f, 0x72, 0x3b, 0x27, 0x29, 0x0a, 0x0a, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x65, 0x6c, 0x73, 0x65,
+ 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x6f, 0x76, 0x65,
+ 0x72, 0x6c, 0x6f, 0x61, 0x64, 0x20, 0x3c, 0x20, 0x30, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x27, 0x23, 0x65, 0x6e, 0x64, 0x69, 0x66, 0x5c, 0x6e, 0x27, 0x29, 0x0a,
+ 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x28, 0x27, 0x20, 0x7b, 0x27, 0x29, 0x0a, 0x0a, 0x20, 0x2d, 0x2d, 0x20,
+ 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x65, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2c, 0x20, 0x69, 0x66, 0x20, 0x74, 0x68, 0x65, 0x20, 0x63, 0x61, 0x73,
+ 0x65, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6e, 0x61, 0x72,
+ 0x67, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x20, 0x6e, 0x61, 0x72, 0x67, 0x3d, 0x32, 0x20,
+ 0x65, 0x6c, 0x73, 0x65, 0x20, 0x6e, 0x61, 0x72, 0x67, 0x3d, 0x31, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e,
+ 0x61, 0x6d, 0x65, 0x7e, 0x3d, 0x27, 0x6e, 0x65, 0x77, 0x27, 0x20, 0x61,
+ 0x6e, 0x64, 0x20, 0x73, 0x74, 0x61, 0x74, 0x69, 0x63, 0x3d, 0x3d, 0x6e,
+ 0x69, 0x6c, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x6f, 0x75,
+ 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x27, 0x2c, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x2c, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x70, 0x61, 0x72, 0x65, 0x6e, 0x74, 0x2e, 0x74, 0x79, 0x70, 0x65,
+ 0x2c, 0x27, 0x2a, 0x27, 0x2c, 0x27, 0x73, 0x65, 0x6c, 0x66, 0x20, 0x3d,
+ 0x20, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x28, 0x27, 0x28, 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x63, 0x6f,
+ 0x6e, 0x73, 0x74, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x61, 0x72,
+ 0x65, 0x6e, 0x74, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x27, 0x2a, 0x29,
+ 0x20, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x74, 0x6f, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x20, 0x3d, 0x20, 0x67, 0x65,
+ 0x74, 0x5f, 0x74, 0x6f, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f,
+ 0x6e, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x61, 0x72, 0x65, 0x6e,
+ 0x74, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x20, 0x20, 0x6f, 0x75,
+ 0x74, 0x70, 0x75, 0x74, 0x28, 0x74, 0x6f, 0x5f, 0x66, 0x75, 0x6e, 0x63,
+ 0x2c, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x31,
+ 0x2c, 0x30, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65,
+ 0x69, 0x66, 0x20, 0x73, 0x74, 0x61, 0x74, 0x69, 0x63, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x5f, 0x2c, 0x5f, 0x2c, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x66,
+ 0x69, 0x6e, 0x64, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64,
+ 0x2c, 0x27, 0x5e, 0x25, 0x73, 0x2a, 0x73, 0x74, 0x61, 0x74, 0x69, 0x63,
+ 0x25, 0x73, 0x25, 0x73, 0x2a, 0x28, 0x2e, 0x2a, 0x29, 0x27, 0x29, 0x0a,
+ 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x64, 0x65, 0x63,
+ 0x6c, 0x61, 0x72, 0x65, 0x20, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74,
+ 0x65, 0x72, 0x73, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x31, 0x5d, 0x2e, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64, 0x27, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x69, 0x3d, 0x31, 0x0a, 0x20, 0x20, 0x77, 0x68, 0x69, 0x6c, 0x65,
+ 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69,
+ 0x5d, 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x3a, 0x64, 0x65, 0x63,
+ 0x6c, 0x61, 0x72, 0x65, 0x28, 0x6e, 0x61, 0x72, 0x67, 0x29, 0x0a, 0x20,
+ 0x20, 0x20, 0x69, 0x66, 0x20, 0x69, 0x73, 0x62, 0x61, 0x73, 0x69, 0x63,
+ 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69,
+ 0x5d, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x20, 0x7e, 0x3d, 0x20, 0x22,
+ 0x73, 0x74, 0x61, 0x74, 0x65, 0x22, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x09, 0x20, 0x20, 0x20, 0x6e, 0x61, 0x72, 0x67, 0x20, 0x3d, 0x20, 0x6e,
+ 0x61, 0x72, 0x67, 0x2b, 0x31, 0x0a, 0x20, 0x20, 0x20, 0x65, 0x6e, 0x64,
+ 0x0a, 0x20, 0x20, 0x20, 0x69, 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a,
+ 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a,
+ 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65, 0x63, 0x6b, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73,
+ 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61,
+ 0x6d, 0x65, 0x7e, 0x3d, 0x27, 0x6e, 0x65, 0x77, 0x27, 0x20, 0x61, 0x6e,
+ 0x64, 0x20, 0x73, 0x74, 0x61, 0x74, 0x69, 0x63, 0x3d, 0x3d, 0x6e, 0x69,
+ 0x6c, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x6f, 0x75, 0x74,
+ 0x70, 0x75, 0x74, 0x28, 0x27, 0x23, 0x69, 0x66, 0x6e, 0x64, 0x65, 0x66,
+ 0x20, 0x54, 0x4f, 0x4c, 0x55, 0x41, 0x5f, 0x52, 0x45, 0x4c, 0x45, 0x41,
+ 0x53, 0x45, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x09, 0x20, 0x6f, 0x75, 0x74,
+ 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x69, 0x66, 0x20, 0x28, 0x21,
+ 0x73, 0x65, 0x6c, 0x66, 0x29, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x65, 0x72, 0x72, 0x6f, 0x72, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x53, 0x2c, 0x22, 0x27, 0x2e, 0x2e, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x5f, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x68, 0x6f, 0x6f, 0x6b, 0x28,
+ 0x22, 0x69, 0x6e, 0x76, 0x61, 0x6c, 0x69, 0x64, 0x20, 0x5c, 0x27, 0x73,
+ 0x65, 0x6c, 0x66, 0x5c, 0x27, 0x20, 0x69, 0x6e, 0x20, 0x66, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x5c, 0x27, 0x25, 0x73, 0x5c, 0x27,
+ 0x22, 0x2c, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65,
+ 0x29, 0x2e, 0x2e, 0x27, 0x22, 0x2c, 0x20, 0x4e, 0x55, 0x4c, 0x4c, 0x29,
+ 0x3b, 0x27, 0x29, 0x3b, 0x0a, 0x09, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75,
+ 0x74, 0x28, 0x27, 0x23, 0x65, 0x6e, 0x64, 0x69, 0x66, 0x5c, 0x6e, 0x27,
+ 0x29, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x2d, 0x2d, 0x20,
+ 0x67, 0x65, 0x74, 0x20, 0x61, 0x72, 0x72, 0x61, 0x79, 0x20, 0x65, 0x6c,
+ 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x73,
+ 0x0a, 0x20, 0x69, 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x20, 0x6e, 0x61, 0x72, 0x67, 0x3d, 0x32, 0x20, 0x65,
+ 0x6c, 0x73, 0x65, 0x20, 0x6e, 0x61, 0x72, 0x67, 0x3d, 0x31, 0x20, 0x65,
+ 0x6e, 0x64, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x61, 0x72, 0x67, 0x73, 0x5b, 0x31, 0x5d, 0x2e, 0x74, 0x79, 0x70, 0x65,
+ 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64, 0x27, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x69, 0x3d, 0x31, 0x0a, 0x20, 0x20, 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d,
+ 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x3a, 0x67, 0x65, 0x74, 0x61,
+ 0x72, 0x72, 0x61, 0x79, 0x28, 0x6e, 0x61, 0x72, 0x67, 0x29, 0x0a, 0x20,
+ 0x20, 0x20, 0x6e, 0x61, 0x72, 0x67, 0x20, 0x3d, 0x20, 0x6e, 0x61, 0x72,
+ 0x67, 0x2b, 0x31, 0x0a, 0x20, 0x20, 0x20, 0x69, 0x20, 0x3d, 0x20, 0x69,
+ 0x2b, 0x31, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x65, 0x6e,
+ 0x64, 0x0a, 0x0a, 0x20, 0x70, 0x72, 0x65, 0x5f, 0x63, 0x61, 0x6c, 0x6c,
+ 0x5f, 0x68, 0x6f, 0x6f, 0x6b, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x29, 0x0a,
+ 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6f, 0x75, 0x74, 0x20,
+ 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e,
+ 0x64, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x20,
+ 0x22, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6f, 0x75, 0x74, 0x73, 0x69,
+ 0x64, 0x65, 0x22, 0x29, 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x61, 0x6c,
+ 0x6c, 0x20, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x0a, 0x20,
+ 0x69, 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20, 0x61, 0x6e, 0x64,
+ 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x3d, 0x3d,
+ 0x27, 0x64, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x27, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27,
+ 0x20, 0x20, 0x4d, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x64, 0x65, 0x6c,
+ 0x65, 0x74, 0x65, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x29, 0x3b, 0x27, 0x29,
+ 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x69, 0x66, 0x20, 0x63, 0x6c, 0x61,
+ 0x73, 0x73, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x6f, 0x70, 0x65,
+ 0x72, 0x61, 0x74, 0x6f, 0x72, 0x26, 0x5b, 0x5d, 0x27, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x66, 0x6c, 0x61, 0x67,
+ 0x73, 0x5b, 0x27, 0x31, 0x27, 0x5d, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20,
+ 0x2d, 0x2d, 0x20, 0x66, 0x6f, 0x72, 0x20, 0x63, 0x6f, 0x6d, 0x70, 0x61,
+ 0x74, 0x69, 0x62, 0x69, 0x6c, 0x69, 0x74, 0x79, 0x20, 0x77, 0x69, 0x74,
+ 0x68, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x35, 0x20, 0x3f, 0x0a, 0x09,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2d, 0x3e, 0x6f, 0x70, 0x65, 0x72, 0x61, 0x74, 0x6f, 0x72,
+ 0x5b, 0x5d, 0x28, 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72,
+ 0x67, 0x73, 0x5b, 0x31, 0x5d, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x27,
+ 0x2d, 0x31, 0x29, 0x20, 0x3d, 0x20, 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x32, 0x5d, 0x2e, 0x6e, 0x61, 0x6d,
+ 0x65, 0x2c, 0x27, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6c, 0x73,
+ 0x65, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x28, 0x27, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2d, 0x3e, 0x6f, 0x70,
+ 0x65, 0x72, 0x61, 0x74, 0x6f, 0x72, 0x5b, 0x5d, 0x28, 0x27, 0x2c, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x31, 0x5d, 0x2e,
+ 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x27, 0x29, 0x20, 0x3d, 0x20, 0x27, 0x2c,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x32, 0x5d,
+ 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x27, 0x3b, 0x27, 0x29, 0x0a, 0x20,
+ 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x20,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x7b,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20,
+ 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64, 0x27, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79,
+ 0x70, 0x65, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x2c,
+ 0x27, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x72, 0x65, 0x74, 0x20, 0x3d,
+ 0x20, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75,
+ 0x74, 0x28, 0x27, 0x28, 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d,
+ 0x6f, 0x64, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65,
+ 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x2c, 0x27, 0x29,
+ 0x20, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x20,
+ 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x69,
+ 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20, 0x61, 0x6e, 0x64, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x3d, 0x3d, 0x27,
+ 0x6e, 0x65, 0x77, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x4d, 0x74, 0x6f,
+ 0x6c, 0x75, 0x61, 0x5f, 0x6e, 0x65, 0x77, 0x28, 0x28, 0x27, 0x2c, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x27, 0x29, 0x28,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x69, 0x66, 0x20,
+ 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x74,
+ 0x61, 0x74, 0x69, 0x63, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x69,
+ 0x66, 0x20, 0x6f, 0x75, 0x74, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09,
+ 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x27, 0x28, 0x27, 0x29, 0x0a, 0x09,
+ 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75,
+ 0x74, 0x28, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x2e, 0x2e, 0x27, 0x3a, 0x3a,
+ 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65,
+ 0x2c, 0x27, 0x28, 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x20,
+ 0x20, 0x65, 0x6c, 0x73, 0x65, 0x69, 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73,
+ 0x73, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x6f,
+ 0x75, 0x74, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x6f, 0x75,
+ 0x74, 0x70, 0x75, 0x74, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61,
+ 0x6d, 0x65, 0x2c, 0x27, 0x28, 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6c, 0x73,
+ 0x65, 0x0a, 0x09, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x63, 0x61, 0x73, 0x74, 0x5f, 0x6f, 0x70, 0x65, 0x72, 0x61, 0x74,
+ 0x6f, 0x72, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x20, 0x09,
+ 0x2d, 0x2d, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x73, 0x74,
+ 0x61, 0x74, 0x69, 0x63, 0x5f, 0x63, 0x61, 0x73, 0x74, 0x3c, 0x27, 0x2c,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x70, 0x74, 0x72, 0x2c, 0x27, 0x20, 0x3e, 0x28, 0x2a, 0x73, 0x65, 0x6c,
+ 0x66, 0x27, 0x29, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74,
+ 0x28, 0x27, 0x73, 0x65, 0x6c, 0x66, 0x2d, 0x3e, 0x6f, 0x70, 0x65, 0x72,
+ 0x61, 0x74, 0x6f, 0x72, 0x20, 0x27, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x6d, 0x6f, 0x64, 0x2c, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70,
+ 0x65, 0x2c, 0x27, 0x28, 0x27, 0x29, 0x0a, 0x09, 0x20, 0x20, 0x65, 0x6c,
+ 0x73, 0x65, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x27, 0x73, 0x65, 0x6c, 0x66, 0x2d, 0x3e, 0x27, 0x2e, 0x2e, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x27, 0x28, 0x27, 0x29,
+ 0x0a, 0x09, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x65, 0x6e, 0x64,
+ 0x0a, 0x20, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x20, 0x20, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e,
+ 0x61, 0x6d, 0x65, 0x2c, 0x27, 0x28, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x6f, 0x75, 0x74,
+ 0x20, 0x61, 0x6e, 0x64, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x73, 0x74, 0x61,
+ 0x74, 0x69, 0x63, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x09,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x73, 0x65, 0x6c, 0x66,
+ 0x27, 0x29, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x61, 0x72, 0x67, 0x73, 0x5b, 0x31, 0x5d, 0x20, 0x61, 0x6e, 0x64, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x31, 0x5d,
+ 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75,
+ 0x74, 0x28, 0x27, 0x2c, 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a,
+ 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x2d, 0x2d, 0x20, 0x77,
+ 0x72, 0x69, 0x74, 0x65, 0x20, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74,
+ 0x65, 0x72, 0x73, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x69, 0x3d, 0x31, 0x0a, 0x20, 0x20, 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d,
+ 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x3a, 0x70, 0x61, 0x73, 0x73,
+ 0x70, 0x61, 0x72, 0x28, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x69, 0x20, 0x3d,
+ 0x20, 0x69, 0x2b, 0x31, 0x0a, 0x20, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74,
+ 0x70, 0x75, 0x74, 0x28, 0x27, 0x2c, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20,
+ 0x20, 0x69, 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20, 0x61, 0x6e,
+ 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20,
+ 0x3d, 0x3d, 0x20, 0x27, 0x6f, 0x70, 0x65, 0x72, 0x61, 0x74, 0x6f, 0x72,
+ 0x5b, 0x5d, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x66, 0x6c, 0x61, 0x67,
+ 0x73, 0x5b, 0x27, 0x31, 0x27, 0x5d, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x2d, 0x31, 0x29,
+ 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x09,
+ 0x69, 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20, 0x61, 0x6e, 0x64,
+ 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x3d, 0x3d,
+ 0x27, 0x6e, 0x65, 0x77, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09,
+ 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x29, 0x29, 0x3b,
+ 0x27, 0x29, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x6c, 0x6f, 0x73, 0x65, 0x20,
+ 0x4d, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6e, 0x65, 0x77, 0x28, 0x0a,
+ 0x09, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6e,
+ 0x64, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x20, 0x2d,
+ 0x2d, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x76, 0x61, 0x6c,
+ 0x75, 0x65, 0x73, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x27,
+ 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79,
+ 0x70, 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64, 0x27,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x6e, 0x72, 0x65,
+ 0x74, 0x20, 0x3d, 0x20, 0x6e, 0x72, 0x65, 0x74, 0x20, 0x2b, 0x20, 0x31,
+ 0x0a, 0x20, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x2c,
+ 0x63, 0x74, 0x20, 0x3d, 0x20, 0x69, 0x73, 0x62, 0x61, 0x73, 0x69, 0x63,
+ 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a,
+ 0x20, 0x20, 0x20, 0x69, 0x66, 0x20, 0x74, 0x20, 0x61, 0x6e, 0x64, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x7e, 0x3d,
+ 0x20, 0x22, 0x6e, 0x65, 0x77, 0x22, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x20, 0x20, 0x20, 0x09, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x63, 0x61, 0x73, 0x74, 0x5f, 0x6f, 0x70, 0x65, 0x72, 0x61, 0x74, 0x6f,
+ 0x72, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x5f, 0x62, 0x61, 0x73, 0x69, 0x63,
+ 0x5f, 0x72, 0x61, 0x77, 0x5f, 0x70, 0x75, 0x73, 0x68, 0x5b, 0x74, 0x5d,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x27, 0x2c, 0x5f, 0x62, 0x61,
+ 0x73, 0x69, 0x63, 0x5f, 0x72, 0x61, 0x77, 0x5f, 0x70, 0x75, 0x73, 0x68,
+ 0x5b, 0x74, 0x5d, 0x2c, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x53, 0x2c, 0x28, 0x27, 0x2c, 0x63, 0x74, 0x2c, 0x27, 0x29, 0x74, 0x6f,
+ 0x6c, 0x75, 0x61, 0x5f, 0x72, 0x65, 0x74, 0x29, 0x3b, 0x27, 0x29, 0x0a,
+ 0x20, 0x20, 0x20, 0x09, 0x65, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x20, 0x20,
+ 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20,
+ 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x70, 0x75, 0x73, 0x68, 0x27,
+ 0x2e, 0x2e, 0x74, 0x2e, 0x2e, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61,
+ 0x5f, 0x53, 0x2c, 0x28, 0x27, 0x2c, 0x63, 0x74, 0x2c, 0x27, 0x29, 0x74,
+ 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x72, 0x65, 0x74, 0x29, 0x3b, 0x27, 0x29,
+ 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x20, 0x65, 0x6c, 0x73,
+ 0x65, 0x0a, 0x09, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x74, 0x79, 0x70, 0x65, 0x0a, 0x09, 0x6e, 0x65, 0x77, 0x5f, 0x74, 0x20,
+ 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75,
+ 0x62, 0x28, 0x74, 0x2c, 0x20, 0x22, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x25,
+ 0x73, 0x2b, 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29, 0x0a, 0x09, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x6f, 0x77, 0x6e, 0x65, 0x64, 0x20, 0x3d, 0x20,
+ 0x66, 0x61, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x73, 0x74,
+ 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x6d, 0x6f, 0x64, 0x2c, 0x20, 0x22, 0x74, 0x6f, 0x6c,
+ 0x75, 0x61, 0x5f, 0x6f, 0x77, 0x6e, 0x65, 0x64, 0x22, 0x29, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x6f, 0x77, 0x6e, 0x65, 0x64, 0x20,
+ 0x3d, 0x20, 0x74, 0x72, 0x75, 0x65, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a,
+ 0x20, 0x20, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x70, 0x75,
+ 0x73, 0x68, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x20, 0x3d, 0x20, 0x67, 0x65,
+ 0x74, 0x5f, 0x70, 0x75, 0x73, 0x68, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x28, 0x74, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x69,
+ 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x20, 0x3d,
+ 0x3d, 0x20, 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20,
+ 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20,
+ 0x20, 0x20, 0x7b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x23, 0x69, 0x66, 0x64, 0x65,
+ 0x66, 0x20, 0x5f, 0x5f, 0x63, 0x70, 0x6c, 0x75, 0x73, 0x70, 0x6c, 0x75,
+ 0x73, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x20, 0x76,
+ 0x6f, 0x69, 0x64, 0x2a, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6f,
+ 0x62, 0x6a, 0x20, 0x3d, 0x20, 0x4d, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x6e, 0x65, 0x77, 0x28, 0x28, 0x27, 0x2c, 0x6e, 0x65, 0x77, 0x5f, 0x74,
+ 0x2c, 0x27, 0x29, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x72, 0x65,
+ 0x74, 0x29, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x20,
+ 0x27, 0x2c, 0x70, 0x75, 0x73, 0x68, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x2c,
+ 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x74, 0x6f,
+ 0x6c, 0x75, 0x61, 0x5f, 0x6f, 0x62, 0x6a, 0x2c, 0x22, 0x27, 0x2c, 0x74,
+ 0x2c, 0x27, 0x22, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20,
+ 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x72, 0x65, 0x67, 0x69, 0x73,
+ 0x74, 0x65, 0x72, 0x5f, 0x67, 0x63, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61,
+ 0x5f, 0x53, 0x2c, 0x6c, 0x75, 0x61, 0x5f, 0x67, 0x65, 0x74, 0x74, 0x6f,
+ 0x70, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x29, 0x29, 0x3b,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x23, 0x65, 0x6c, 0x73, 0x65, 0x5c, 0x6e, 0x27,
+ 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75,
+ 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x20, 0x76, 0x6f, 0x69, 0x64, 0x2a,
+ 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6f, 0x62, 0x6a, 0x20, 0x3d,
+ 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x63, 0x6f, 0x70, 0x79, 0x28,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x28, 0x76, 0x6f, 0x69,
+ 0x64, 0x2a, 0x29, 0x26, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x72, 0x65,
+ 0x74, 0x2c, 0x73, 0x69, 0x7a, 0x65, 0x6f, 0x66, 0x28, 0x27, 0x2c, 0x74,
+ 0x2c, 0x27, 0x29, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20,
+ 0x20, 0x27, 0x2c, 0x70, 0x75, 0x73, 0x68, 0x5f, 0x66, 0x75, 0x6e, 0x63,
+ 0x2c, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x74,
+ 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6f, 0x62, 0x6a, 0x2c, 0x22, 0x27, 0x2c,
+ 0x74, 0x2c, 0x27, 0x22, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20,
+ 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20,
+ 0x20, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x72, 0x65, 0x67, 0x69,
+ 0x73, 0x74, 0x65, 0x72, 0x5f, 0x67, 0x63, 0x28, 0x74, 0x6f, 0x6c, 0x75,
+ 0x61, 0x5f, 0x53, 0x2c, 0x6c, 0x75, 0x61, 0x5f, 0x67, 0x65, 0x74, 0x74,
+ 0x6f, 0x70, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x29, 0x29,
+ 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74,
+ 0x70, 0x75, 0x74, 0x28, 0x27, 0x23, 0x65, 0x6e, 0x64, 0x69, 0x66, 0x5c,
+ 0x6e, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x6f, 0x75, 0x74,
+ 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x7d, 0x27, 0x29, 0x0a,
+ 0x20, 0x20, 0x20, 0x20, 0x65, 0x6c, 0x73, 0x65, 0x69, 0x66, 0x20, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x20, 0x3d, 0x3d, 0x20, 0x27,
+ 0x26, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x20,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20,
+ 0x27, 0x2c, 0x70, 0x75, 0x73, 0x68, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x2c,
+ 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x28, 0x76,
+ 0x6f, 0x69, 0x64, 0x2a, 0x29, 0x26, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x72, 0x65, 0x74, 0x2c, 0x22, 0x27, 0x2c, 0x74, 0x2c, 0x27, 0x22, 0x29,
+ 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x65, 0x6c, 0x73, 0x65,
+ 0x0a, 0x09, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20,
+ 0x20, 0x20, 0x27, 0x2c, 0x70, 0x75, 0x73, 0x68, 0x5f, 0x66, 0x75, 0x6e,
+ 0x63, 0x2c, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c,
+ 0x28, 0x76, 0x6f, 0x69, 0x64, 0x2a, 0x29, 0x74, 0x6f, 0x6c, 0x75, 0x61,
+ 0x5f, 0x72, 0x65, 0x74, 0x2c, 0x22, 0x27, 0x2c, 0x74, 0x2c, 0x27, 0x22,
+ 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x09, 0x20, 0x69, 0x66, 0x20, 0x6f, 0x77,
+ 0x6e, 0x65, 0x64, 0x20, 0x6f, 0x72, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x5f, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x72, 0x75, 0x63, 0x74, 0x6f, 0x72,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x20, 0x20,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x20, 0x20, 0x20,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x72, 0x65, 0x67, 0x69, 0x73, 0x74,
+ 0x65, 0x72, 0x5f, 0x67, 0x63, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x53, 0x2c, 0x6c, 0x75, 0x61, 0x5f, 0x67, 0x65, 0x74, 0x74, 0x6f, 0x70,
+ 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x29, 0x29, 0x3b, 0x27,
+ 0x29, 0x0a, 0x09, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x20, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20,
+ 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x69, 0x3d, 0x31, 0x0a, 0x20, 0x20, 0x77, 0x68, 0x69, 0x6c, 0x65,
+ 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69,
+ 0x5d, 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x20, 0x6e, 0x72, 0x65, 0x74,
+ 0x20, 0x3d, 0x20, 0x6e, 0x72, 0x65, 0x74, 0x20, 0x2b, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x3a, 0x72,
+ 0x65, 0x74, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x28, 0x29, 0x0a, 0x20, 0x20,
+ 0x20, 0x69, 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a, 0x20, 0x20, 0x65,
+ 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x27, 0x20, 0x20, 0x7d, 0x27, 0x29, 0x0a, 0x0a, 0x20, 0x20, 0x2d, 0x2d,
+ 0x20, 0x73, 0x65, 0x74, 0x20, 0x61, 0x72, 0x72, 0x61, 0x79, 0x20, 0x65,
+ 0x6c, 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65,
+ 0x73, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x20, 0x6e, 0x61, 0x72, 0x67, 0x3d, 0x32,
+ 0x20, 0x65, 0x6c, 0x73, 0x65, 0x20, 0x6e, 0x61, 0x72, 0x67, 0x3d, 0x31,
+ 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65,
+ 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x31, 0x5d, 0x2e, 0x74,
+ 0x79, 0x70, 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64,
+ 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x69, 0x3d, 0x31, 0x0a, 0x20, 0x20, 0x20, 0x77,
+ 0x68, 0x69, 0x6c, 0x65, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72,
+ 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x20,
+ 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69,
+ 0x5d, 0x3a, 0x73, 0x65, 0x74, 0x61, 0x72, 0x72, 0x61, 0x79, 0x28, 0x6e,
+ 0x61, 0x72, 0x67, 0x29, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x6e, 0x61, 0x72,
+ 0x67, 0x20, 0x3d, 0x20, 0x6e, 0x61, 0x72, 0x67, 0x2b, 0x31, 0x0a, 0x20,
+ 0x20, 0x20, 0x20, 0x69, 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a, 0x20,
+ 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a,
+ 0x0a, 0x20, 0x20, 0x2d, 0x2d, 0x20, 0x66, 0x72, 0x65, 0x65, 0x20, 0x64,
+ 0x79, 0x6e, 0x61, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x6c, 0x79, 0x20, 0x61,
+ 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x65, 0x64, 0x20, 0x61, 0x72, 0x72,
+ 0x61, 0x79, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x31, 0x5d, 0x2e, 0x74, 0x79, 0x70,
+ 0x65, 0x20, 0x7e, 0x3d, 0x20, 0x27, 0x76, 0x6f, 0x69, 0x64, 0x27, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x69, 0x3d, 0x31, 0x0a, 0x20, 0x20, 0x20, 0x77, 0x68, 0x69,
+ 0x6c, 0x65, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73,
+ 0x5b, 0x69, 0x5d, 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x20, 0x20, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x3a,
+ 0x66, 0x72, 0x65, 0x65, 0x61, 0x72, 0x72, 0x61, 0x79, 0x28, 0x29, 0x0a,
+ 0x20, 0x20, 0x20, 0x20, 0x69, 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a,
+ 0x20, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64,
+ 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x70, 0x6f, 0x73, 0x74,
+ 0x5f, 0x63, 0x61, 0x6c, 0x6c, 0x5f, 0x68, 0x6f, 0x6f, 0x6b, 0x28, 0x73,
+ 0x65, 0x6c, 0x66, 0x29, 0x0a, 0x0a, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75,
+ 0x74, 0x28, 0x27, 0x20, 0x7d, 0x27, 0x29, 0x0a, 0x20, 0x6f, 0x75, 0x74,
+ 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e,
+ 0x20, 0x27, 0x2e, 0x2e, 0x6e, 0x72, 0x65, 0x74, 0x2e, 0x2e, 0x27, 0x3b,
+ 0x27, 0x29, 0x0a, 0x0a, 0x20, 0x2d, 0x2d, 0x20, 0x63, 0x61, 0x6c, 0x6c,
+ 0x20, 0x6f, 0x76, 0x65, 0x72, 0x6c, 0x6f, 0x61, 0x64, 0x65, 0x64, 0x20,
+ 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x6f, 0x72, 0x20,
+ 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x20, 0x65, 0x72, 0x72,
+ 0x6f, 0x72, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x6f, 0x76, 0x65, 0x72, 0x6c,
+ 0x6f, 0x61, 0x64, 0x20, 0x3c, 0x20, 0x30, 0x20, 0x74, 0x68, 0x65, 0x6e,
+ 0x0a, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27,
+ 0x23, 0x69, 0x66, 0x6e, 0x64, 0x65, 0x66, 0x20, 0x54, 0x4f, 0x4c, 0x55,
+ 0x41, 0x5f, 0x52, 0x45, 0x4c, 0x45, 0x41, 0x53, 0x45, 0x5c, 0x6e, 0x27,
+ 0x29, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6c, 0x65, 0x72, 0x72, 0x6f, 0x72,
+ 0x3a, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65,
+ 0x72, 0x72, 0x6f, 0x72, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53,
+ 0x2c, 0x22, 0x27, 0x2e, 0x2e, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x5f,
+ 0x65, 0x72, 0x72, 0x6f, 0x72, 0x5f, 0x68, 0x6f, 0x6f, 0x6b, 0x28, 0x22,
+ 0x23, 0x66, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x20, 0x69, 0x6e, 0x20, 0x66,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x5c, 0x27, 0x25, 0x73,
+ 0x5c, 0x27, 0x2e, 0x22, 0x2c, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6c,
+ 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x2e, 0x2e, 0x27, 0x22, 0x2c, 0x26, 0x74,
+ 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x65, 0x72, 0x72, 0x29, 0x3b, 0x27, 0x29,
+ 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20,
+ 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x30, 0x3b, 0x27, 0x29, 0x0a,
+ 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x23, 0x65,
+ 0x6e, 0x64, 0x69, 0x66, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6c,
+ 0x73, 0x65, 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x5f,
+ 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x3d, 0x20, 0x22, 0x22, 0x0a, 0x09,
+ 0x09, 0x69, 0x66, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x5f, 0x63, 0x6f,
+ 0x6e, 0x73, 0x74, 0x72, 0x75, 0x63, 0x74, 0x6f, 0x72, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x09, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x3d, 0x20, 0x22, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x22, 0x0a,
+ 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x09, 0x6f, 0x75, 0x74, 0x70,
+ 0x75, 0x74, 0x28, 0x27, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x6c, 0x65,
+ 0x72, 0x72, 0x6f, 0x72, 0x3a, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x09, 0x09,
+ 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x72, 0x65, 0x74,
+ 0x75, 0x72, 0x6e, 0x20, 0x27, 0x2e, 0x2e, 0x73, 0x74, 0x72, 0x73, 0x75,
+ 0x62, 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x63, 0x6e, 0x61, 0x6d, 0x65,
+ 0x2c, 0x31, 0x2c, 0x2d, 0x33, 0x29, 0x2e, 0x2e, 0x66, 0x6f, 0x72, 0x6d,
+ 0x61, 0x74, 0x28, 0x22, 0x25, 0x30, 0x32, 0x64, 0x22, 0x2c, 0x6f, 0x76,
+ 0x65, 0x72, 0x6c, 0x6f, 0x61, 0x64, 0x29, 0x2e, 0x2e, 0x5f, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x2e, 0x2e, 0x27, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61,
+ 0x5f, 0x53, 0x29, 0x3b, 0x27, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a,
+ 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x7d, 0x27, 0x29,
+ 0x0a, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x23, 0x65,
+ 0x6e, 0x64, 0x69, 0x66, 0x20, 0x2f, 0x2f, 0x23, 0x69, 0x66, 0x6e, 0x64,
+ 0x65, 0x66, 0x20, 0x54, 0x4f, 0x4c, 0x55, 0x41, 0x5f, 0x44, 0x49, 0x53,
+ 0x41, 0x42, 0x4c, 0x45, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x20, 0x6f, 0x75,
+ 0x74, 0x70, 0x75, 0x74, 0x28, 0x27, 0x5c, 0x6e, 0x27, 0x29, 0x0a, 0x0a,
+ 0x09, 0x2d, 0x2d, 0x20, 0x72, 0x65, 0x63, 0x75, 0x72, 0x73, 0x69, 0x76,
+ 0x65, 0x20, 0x63, 0x61, 0x6c, 0x6c, 0x20, 0x74, 0x6f, 0x20, 0x77, 0x72,
+ 0x69, 0x74, 0x65, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x63, 0x6f,
+ 0x6e, 0x73, 0x74, 0x72, 0x75, 0x63, 0x74, 0x6f, 0x72, 0x0a, 0x09, 0x69,
+ 0x66, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x20, 0x61, 0x6e, 0x64, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x3d, 0x3d, 0x27,
+ 0x6e, 0x65, 0x77, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x6e, 0x6f, 0x74,
+ 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x5f, 0x63, 0x6f, 0x6e, 0x73, 0x74,
+ 0x72, 0x75, 0x63, 0x74, 0x6f, 0x72, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x0a, 0x09, 0x09, 0x73, 0x65, 0x6c, 0x66, 0x3a, 0x73, 0x75, 0x70, 0x63,
+ 0x6f, 0x64, 0x65, 0x28, 0x31, 0x29, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a,
+ 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x72, 0x65,
+ 0x67, 0x69, 0x73, 0x74, 0x65, 0x72, 0x20, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x46, 0x75, 0x6e, 0x63, 0x74, 0x69,
+ 0x6f, 0x6e, 0x3a, 0x72, 0x65, 0x67, 0x69, 0x73, 0x74, 0x65, 0x72, 0x20,
+ 0x28, 0x70, 0x72, 0x65, 0x29, 0x0a, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x6e,
+ 0x6f, 0x74, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x3a, 0x63, 0x68, 0x65, 0x63,
+ 0x6b, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x61, 0x63, 0x63,
+ 0x65, 0x73, 0x73, 0x28, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09,
+ 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x0a, 0x09, 0x65, 0x6e, 0x64,
+ 0x0a, 0x0a, 0x20, 0x09, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e,
+ 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x6e, 0x65, 0x77,
+ 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70,
+ 0x61, 0x72, 0x65, 0x6e, 0x74, 0x2e, 0x66, 0x6c, 0x61, 0x67, 0x73, 0x2e,
+ 0x70, 0x75, 0x72, 0x65, 0x5f, 0x76, 0x69, 0x72, 0x74, 0x75, 0x61, 0x6c,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x09, 0x09, 0x2d, 0x2d, 0x20,
+ 0x6e, 0x6f, 0x20, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x72, 0x75, 0x63, 0x74,
+ 0x6f, 0x72, 0x20, 0x66, 0x6f, 0x72, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73,
+ 0x65, 0x73, 0x20, 0x77, 0x69, 0x74, 0x68, 0x20, 0x70, 0x75, 0x72, 0x65,
+ 0x20, 0x76, 0x69, 0x72, 0x74, 0x75, 0x61, 0x6c, 0x20, 0x6d, 0x65, 0x74,
+ 0x68, 0x6f, 0x64, 0x73, 0x0a, 0x20, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x0a, 0x20, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x70, 0x72, 0x65, 0x2e, 0x2e, 0x27,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69,
+ 0x6f, 0x6e, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x22,
+ 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6c, 0x6e, 0x61, 0x6d,
+ 0x65, 0x2e, 0x2e, 0x27, 0x22, 0x2c, 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x63, 0x6e, 0x61, 0x6d, 0x65, 0x2e, 0x2e, 0x27, 0x29, 0x3b,
+ 0x27, 0x29, 0x0a, 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x6e, 0x65,
+ 0x77, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x20, 0x20, 0x6f,
+ 0x75, 0x74, 0x70, 0x75, 0x74, 0x28, 0x70, 0x72, 0x65, 0x2e, 0x2e, 0x27,
+ 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69,
+ 0x6f, 0x6e, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x22,
+ 0x6e, 0x65, 0x77, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x22, 0x2c, 0x27,
+ 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x63, 0x6e, 0x61, 0x6d, 0x65,
+ 0x2e, 0x2e, 0x27, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x29, 0x3b, 0x27,
+ 0x29, 0x0a, 0x09, 0x20, 0x20, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x28,
+ 0x70, 0x72, 0x65, 0x2e, 0x2e, 0x27, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x28, 0x74, 0x6f, 0x6c,
+ 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x22, 0x2e, 0x63, 0x61, 0x6c, 0x6c, 0x22,
+ 0x2c, 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x63, 0x6e, 0x61,
+ 0x6d, 0x65, 0x2e, 0x2e, 0x27, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x29,
+ 0x3b, 0x27, 0x29, 0x0a, 0x09, 0x20, 0x20, 0x2d, 0x2d, 0x6f, 0x75, 0x74,
+ 0x70, 0x75, 0x74, 0x28, 0x27, 0x20, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x73, 0x65, 0x74, 0x5f, 0x63, 0x61, 0x6c, 0x6c, 0x5f, 0x65, 0x76, 0x65,
+ 0x6e, 0x74, 0x28, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f, 0x53, 0x2c, 0x27,
+ 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x63, 0x6e, 0x61, 0x6d, 0x65,
+ 0x2e, 0x2e, 0x27, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x2c, 0x20, 0x22,
+ 0x27, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x61, 0x72, 0x65,
+ 0x6e, 0x74, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2e, 0x2e, 0x27, 0x22, 0x29,
+ 0x3b, 0x27, 0x29, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x65, 0x6e,
+ 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x50, 0x72, 0x69, 0x6e, 0x74, 0x20,
+ 0x6d, 0x65, 0x74, 0x68, 0x6f, 0x64, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x46, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x20,
+ 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2c, 0x63, 0x6c, 0x6f, 0x73, 0x65,
+ 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65,
+ 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x46, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f,
+ 0x6e, 0x7b, 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28,
+ 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20, 0x6d, 0x6f, 0x64,
+ 0x20, 0x20, 0x3d, 0x20, 0x27, 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x6d, 0x6f, 0x64, 0x2e, 0x2e, 0x22, 0x27, 0x2c, 0x22, 0x29, 0x0a,
+ 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74,
+ 0x2e, 0x2e, 0x22, 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x27,
+ 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65,
+ 0x2e, 0x2e, 0x22, 0x27, 0x2c, 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69,
+ 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20,
+ 0x70, 0x74, 0x72, 0x20, 0x20, 0x3d, 0x20, 0x27, 0x22, 0x2e, 0x2e, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x2e, 0x2e, 0x22, 0x27, 0x2c,
+ 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64,
+ 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x20,
+ 0x3d, 0x20, 0x27, 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6e,
+ 0x61, 0x6d, 0x65, 0x2e, 0x2e, 0x22, 0x27, 0x2c, 0x22, 0x29, 0x0a, 0x20,
+ 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e,
+ 0x2e, 0x22, 0x20, 0x6c, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x27,
+ 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x6c, 0x6e, 0x61, 0x6d,
+ 0x65, 0x2e, 0x2e, 0x22, 0x27, 0x2c, 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72,
+ 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22,
+ 0x20, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x3d, 0x20, 0x27, 0x22, 0x2e,
+ 0x2e, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x2e,
+ 0x2e, 0x22, 0x27, 0x2c, 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e,
+ 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20, 0x63,
+ 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x27, 0x22, 0x2e, 0x2e, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x63, 0x6e, 0x61, 0x6d, 0x65, 0x2e, 0x2e, 0x22,
+ 0x27, 0x2c, 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28,
+ 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20, 0x6c, 0x6e, 0x61,
+ 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x27, 0x22, 0x2e, 0x2e, 0x73, 0x65, 0x6c,
+ 0x66, 0x2e, 0x6c, 0x6e, 0x61, 0x6d, 0x65, 0x2e, 0x2e, 0x22, 0x27, 0x2c,
+ 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64,
+ 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20, 0x61, 0x72, 0x67, 0x73, 0x20,
+ 0x3d, 0x20, 0x7b, 0x22, 0x29, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x69, 0x3d, 0x31, 0x0a, 0x20, 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d,
+ 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61,
+ 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x3a, 0x70, 0x72, 0x69, 0x6e, 0x74,
+ 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x20, 0x20, 0x22,
+ 0x2c, 0x22, 0x2c, 0x22, 0x29, 0x0a, 0x20, 0x20, 0x69, 0x20, 0x3d, 0x20,
+ 0x69, 0x2b, 0x31, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x70, 0x72,
+ 0x69, 0x6e, 0x74, 0x28, 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22,
+ 0x20, 0x7d, 0x22, 0x29, 0x0a, 0x20, 0x70, 0x72, 0x69, 0x6e, 0x74, 0x28,
+ 0x69, 0x64, 0x65, 0x6e, 0x74, 0x2e, 0x2e, 0x22, 0x7d, 0x22, 0x2e, 0x2e,
+ 0x63, 0x6c, 0x6f, 0x73, 0x65, 0x29, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a,
+ 0x2d, 0x2d, 0x20, 0x63, 0x68, 0x65, 0x63, 0x6b, 0x20, 0x69, 0x66, 0x20,
+ 0x69, 0x74, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x73, 0x20, 0x61,
+ 0x6e, 0x20, 0x6f, 0x62, 0x6a, 0x65, 0x63, 0x74, 0x20, 0x62, 0x79, 0x20,
+ 0x76, 0x61, 0x6c, 0x75, 0x65, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69,
+ 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x46, 0x75, 0x6e, 0x63,
+ 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x72, 0x65, 0x71, 0x75, 0x69, 0x72, 0x65,
+ 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x28,
+ 0x74, 0x29, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x72, 0x20,
+ 0x3d, 0x20, 0x66, 0x61, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x69, 0x66, 0x20,
+ 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x20, 0x7e, 0x3d,
+ 0x20, 0x27, 0x27, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x6e, 0x6f, 0x74, 0x20,
+ 0x69, 0x73, 0x62, 0x61, 0x73, 0x69, 0x63, 0x28, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x74, 0x79, 0x70, 0x65, 0x29, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x74, 0x72, 0x3d, 0x3d, 0x27, 0x27, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x74, 0x79, 0x70, 0x65, 0x20, 0x3d, 0x20, 0x67, 0x73, 0x75, 0x62,
+ 0x28, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x74, 0x79, 0x70, 0x65, 0x2c, 0x22,
+ 0x25, 0x73, 0x2a, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x25, 0x73, 0x2b, 0x22,
+ 0x2c, 0x22, 0x22, 0x29, 0x0a, 0x09, 0x20, 0x74, 0x5b, 0x74, 0x79, 0x70,
+ 0x65, 0x5d, 0x20, 0x3d, 0x20, 0x22, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x5f,
+ 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x5f, 0x22, 0x20, 0x2e, 0x2e,
+ 0x20, 0x63, 0x6c, 0x65, 0x61, 0x6e, 0x5f, 0x74, 0x65, 0x6d, 0x70, 0x6c,
+ 0x61, 0x74, 0x65, 0x28, 0x74, 0x79, 0x70, 0x65, 0x29, 0x0a, 0x09, 0x20,
+ 0x72, 0x20, 0x3d, 0x20, 0x74, 0x72, 0x75, 0x65, 0x0a, 0x09, 0x65, 0x6e,
+ 0x64, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x69, 0x3d, 0x31,
+ 0x0a, 0x09, 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20, 0x73, 0x65, 0x6c, 0x66,
+ 0x2e, 0x61, 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x20, 0x64, 0x6f, 0x0a,
+ 0x09, 0x09, 0x72, 0x20, 0x3d, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x61,
+ 0x72, 0x67, 0x73, 0x5b, 0x69, 0x5d, 0x3a, 0x72, 0x65, 0x71, 0x75, 0x69,
+ 0x72, 0x65, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x28, 0x74, 0x29, 0x20, 0x6f, 0x72, 0x20, 0x72, 0x0a, 0x09, 0x09, 0x69,
+ 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a,
+ 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x72, 0x0a, 0x65, 0x6e,
+ 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x64, 0x65, 0x74, 0x65, 0x72, 0x6d,
+ 0x69, 0x6e, 0x65, 0x20, 0x6c, 0x75, 0x61, 0x20, 0x66, 0x75, 0x6e, 0x63,
+ 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x6f, 0x76,
+ 0x65, 0x72, 0x6c, 0x6f, 0x61, 0x64, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74,
+ 0x69, 0x6f, 0x6e, 0x20, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x46, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x3a, 0x6f, 0x76, 0x65, 0x72, 0x6c, 0x6f,
+ 0x61, 0x64, 0x20, 0x28, 0x29, 0x0a, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72,
+ 0x6e, 0x20, 0x73, 0x65, 0x6c, 0x66, 0x2e, 0x70, 0x61, 0x72, 0x65, 0x6e,
+ 0x74, 0x3a, 0x6f, 0x76, 0x65, 0x72, 0x6c, 0x6f, 0x61, 0x64, 0x28, 0x73,
+ 0x65, 0x6c, 0x66, 0x2e, 0x6c, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f,
+ 0x6e, 0x20, 0x70, 0x61, 0x72, 0x61, 0x6d, 0x5f, 0x6f, 0x62, 0x6a, 0x65,
+ 0x63, 0x74, 0x28, 0x70, 0x61, 0x72, 0x29, 0x20, 0x2d, 0x2d, 0x20, 0x72,
+ 0x65, 0x74, 0x75, 0x72, 0x6e, 0x73, 0x20, 0x74, 0x72, 0x75, 0x65, 0x20,
+ 0x69, 0x66, 0x20, 0x74, 0x68, 0x65, 0x20, 0x70, 0x61, 0x72, 0x61, 0x6d,
+ 0x65, 0x74, 0x65, 0x72, 0x20, 0x68, 0x61, 0x73, 0x20, 0x61, 0x6e, 0x20,
+ 0x6f, 0x62, 0x6a, 0x65, 0x63, 0x74, 0x20, 0x61, 0x73, 0x20, 0x69, 0x74,
+ 0x73, 0x20, 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74, 0x20, 0x76, 0x61,
+ 0x6c, 0x75, 0x65, 0x0a, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x6e, 0x6f, 0x74,
+ 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64,
+ 0x28, 0x70, 0x61, 0x72, 0x2c, 0x20, 0x27, 0x3d, 0x27, 0x29, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x66,
+ 0x61, 0x6c, 0x73, 0x65, 0x20, 0x65, 0x6e, 0x64, 0x20, 0x2d, 0x2d, 0x20,
+ 0x69, 0x74, 0x20, 0x68, 0x61, 0x73, 0x20, 0x6e, 0x6f, 0x20, 0x64, 0x65,
+ 0x66, 0x61, 0x75, 0x6c, 0x74, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x0a,
+ 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x5f, 0x2c, 0x5f, 0x2c,
+ 0x64, 0x65, 0x66, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67,
+ 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x70, 0x61, 0x72, 0x2c, 0x20, 0x22,
+ 0x3d, 0x28, 0x2e, 0x2a, 0x29, 0x24, 0x22, 0x29, 0x0a, 0x0a, 0x09, 0x69,
+ 0x66, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e,
+ 0x64, 0x28, 0x70, 0x61, 0x72, 0x2c, 0x20, 0x22, 0x7c, 0x22, 0x29, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x20, 0x2d, 0x2d, 0x20, 0x61, 0x20, 0x6c, 0x69,
+ 0x73, 0x74, 0x20, 0x6f, 0x66, 0x20, 0x66, 0x6c, 0x61, 0x67, 0x73, 0x0a,
+ 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x74, 0x72,
+ 0x75, 0x65, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x69, 0x66,
+ 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64,
+ 0x28, 0x70, 0x61, 0x72, 0x2c, 0x20, 0x22, 0x25, 0x2a, 0x22, 0x29, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x20, 0x2d, 0x2d, 0x20, 0x69, 0x74, 0x27, 0x73,
+ 0x20, 0x61, 0x20, 0x70, 0x6f, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x20, 0x77,
+ 0x69, 0x74, 0x68, 0x20, 0x61, 0x20, 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c,
+ 0x74, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x0a, 0x0a, 0x09, 0x09, 0x69,
+ 0x66, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e,
+ 0x64, 0x28, 0x70, 0x61, 0x72, 0x2c, 0x20, 0x27, 0x3d, 0x25, 0x73, 0x2a,
+ 0x6e, 0x65, 0x77, 0x27, 0x29, 0x20, 0x6f, 0x72, 0x20, 0x73, 0x74, 0x72,
+ 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x70, 0x61, 0x72,
+ 0x2c, 0x20, 0x22, 0x25, 0x28, 0x22, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e,
+ 0x20, 0x2d, 0x2d, 0x20, 0x69, 0x74, 0x27, 0x73, 0x20, 0x61, 0x20, 0x70,
+ 0x6f, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x20, 0x77, 0x69, 0x74, 0x68, 0x20,
+ 0x61, 0x6e, 0x20, 0x69, 0x6e, 0x73, 0x74, 0x61, 0x6e, 0x63, 0x65, 0x20,
+ 0x61, 0x73, 0x20, 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74, 0x20, 0x70,
+ 0x61, 0x72, 0x61, 0x6d, 0x65, 0x74, 0x65, 0x72, 0x2e, 0x2e, 0x20, 0x69,
+ 0x73, 0x20, 0x74, 0x68, 0x61, 0x74, 0x20, 0x76, 0x61, 0x6c, 0x69, 0x64,
+ 0x3f, 0x0a, 0x09, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20,
+ 0x74, 0x72, 0x75, 0x65, 0x0a, 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09,
+ 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x66, 0x61, 0x6c, 0x73,
+ 0x65, 0x20, 0x2d, 0x2d, 0x20, 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74,
+ 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x20, 0x69, 0x73, 0x20, 0x27, 0x4e,
+ 0x55, 0x4c, 0x4c, 0x27, 0x20, 0x6f, 0x72, 0x20, 0x73, 0x6f, 0x6d, 0x65,
+ 0x74, 0x68, 0x69, 0x6e, 0x67, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a,
+ 0x0a, 0x09, 0x69, 0x66, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e,
+ 0x66, 0x69, 0x6e, 0x64, 0x28, 0x70, 0x61, 0x72, 0x2c, 0x20, 0x22, 0x5b,
+ 0x25, 0x28, 0x26, 0x5d, 0x22, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a,
+ 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x74, 0x72, 0x75,
+ 0x65, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x20, 0x2d, 0x2d, 0x20, 0x64, 0x65,
+ 0x66, 0x61, 0x75, 0x6c, 0x74, 0x20, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x20,
+ 0x69, 0x73, 0x20, 0x61, 0x20, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x72, 0x75,
+ 0x63, 0x74, 0x6f, 0x72, 0x20, 0x63, 0x61, 0x6c, 0x6c, 0x20, 0x28, 0x6d,
+ 0x6f, 0x73, 0x74, 0x20, 0x6c, 0x69, 0x6b, 0x65, 0x6c, 0x79, 0x20, 0x66,
+ 0x6f, 0x72, 0x20, 0x61, 0x20, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x72,
+ 0x65, 0x66, 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x29, 0x0a, 0x0a, 0x09,
+ 0x2d, 0x2d, 0x69, 0x66, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e,
+ 0x66, 0x69, 0x6e, 0x64, 0x28, 0x70, 0x61, 0x72, 0x2c, 0x20, 0x22, 0x26,
+ 0x22, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x0a, 0x09, 0x2d, 0x2d,
+ 0x09, 0x69, 0x66, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66,
+ 0x69, 0x6e, 0x64, 0x28, 0x64, 0x65, 0x66, 0x2c, 0x20, 0x22, 0x3a, 0x22,
+ 0x29, 0x20, 0x6f, 0x72, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e,
+ 0x66, 0x69, 0x6e, 0x64, 0x28, 0x64, 0x65, 0x66, 0x2c, 0x20, 0x22, 0x5e,
+ 0x25, 0x73, 0x2a, 0x6e, 0x65, 0x77, 0x25, 0x73, 0x2b, 0x22, 0x29, 0x20,
+ 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x0a, 0x09, 0x2d, 0x2d, 0x09, 0x09, 0x2d,
+ 0x2d, 0x20, 0x69, 0x74, 0x27, 0x73, 0x20, 0x61, 0x20, 0x72, 0x65, 0x66,
+ 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x20, 0x77, 0x69, 0x74, 0x68, 0x20,
+ 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74, 0x20, 0x74, 0x6f, 0x20, 0x73,
+ 0x6f, 0x6d, 0x65, 0x74, 0x68, 0x69, 0x6e, 0x67, 0x20, 0x6c, 0x69, 0x6b,
+ 0x65, 0x20, 0x43, 0x6c, 0x61, 0x73, 0x73, 0x3a, 0x3a, 0x6d, 0x65, 0x6d,
+ 0x62, 0x65, 0x72, 0x2c, 0x20, 0x6f, 0x72, 0x20, 0x27, 0x6e, 0x65, 0x77,
+ 0x20, 0x43, 0x6c, 0x61, 0x73, 0x73, 0x27, 0x0a, 0x09, 0x2d, 0x2d, 0x09,
+ 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x74, 0x72, 0x75, 0x65,
+ 0x0a, 0x09, 0x2d, 0x2d, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x2d, 0x2d,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e,
+ 0x20, 0x66, 0x61, 0x6c, 0x73, 0x65, 0x20, 0x2d, 0x2d, 0x20, 0x3f, 0x0a,
+ 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f,
+ 0x6e, 0x20, 0x73, 0x74, 0x72, 0x69, 0x70, 0x5f, 0x6c, 0x61, 0x73, 0x74,
+ 0x5f, 0x61, 0x72, 0x67, 0x28, 0x61, 0x6c, 0x6c, 0x5f, 0x61, 0x72, 0x67,
+ 0x73, 0x2c, 0x20, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x61, 0x72, 0x67, 0x29,
+ 0x20, 0x2d, 0x2d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x70, 0x73, 0x20, 0x74,
+ 0x68, 0x65, 0x20, 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74, 0x20, 0x76,
+ 0x61, 0x6c, 0x75, 0x65, 0x20, 0x66, 0x72, 0x6f, 0x6d, 0x20, 0x74, 0x68,
+ 0x65, 0x20, 0x6c, 0x61, 0x73, 0x74, 0x20, 0x61, 0x72, 0x67, 0x75, 0x6d,
+ 0x65, 0x6e, 0x74, 0x0a, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20,
+ 0x5f, 0x2c, 0x5f, 0x2c, 0x73, 0x5f, 0x61, 0x72, 0x67, 0x20, 0x3d, 0x20,
+ 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28,
+ 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x61, 0x72, 0x67, 0x2c, 0x20, 0x22, 0x5e,
+ 0x28, 0x5b, 0x5e, 0x3d, 0x5d, 0x2b, 0x29, 0x22, 0x29, 0x0a, 0x09, 0x6c,
+ 0x61, 0x73, 0x74, 0x5f, 0x61, 0x72, 0x67, 0x20, 0x3d, 0x20, 0x73, 0x74,
+ 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x6c, 0x61,
+ 0x73, 0x74, 0x5f, 0x61, 0x72, 0x67, 0x2c, 0x20, 0x22, 0x28, 0x5b, 0x25,
+ 0x25, 0x25, 0x28, 0x25, 0x29, 0x5d, 0x29, 0x22, 0x2c, 0x20, 0x22, 0x25,
+ 0x25, 0x25, 0x31, 0x22, 0x29, 0x3b, 0x0a, 0x09, 0x61, 0x6c, 0x6c, 0x5f,
+ 0x61, 0x72, 0x67, 0x73, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e,
+ 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x61, 0x6c, 0x6c, 0x5f, 0x61,
+ 0x72, 0x67, 0x73, 0x2c, 0x20, 0x22, 0x25, 0x73, 0x2a, 0x2c, 0x25, 0x73,
+ 0x2a, 0x22, 0x2e, 0x2e, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x61, 0x72, 0x67,
+ 0x2e, 0x2e, 0x22, 0x25, 0x73, 0x2a, 0x25, 0x29, 0x25, 0x73, 0x2a, 0x24,
+ 0x22, 0x2c, 0x20, 0x22, 0x29, 0x22, 0x29, 0x0a, 0x09, 0x72, 0x65, 0x74,
+ 0x75, 0x72, 0x6e, 0x20, 0x61, 0x6c, 0x6c, 0x5f, 0x61, 0x72, 0x67, 0x73,
+ 0x2c, 0x20, 0x73, 0x5f, 0x61, 0x72, 0x67, 0x0a, 0x65, 0x6e, 0x64, 0x0a,
+ 0x0a, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x49, 0x6e, 0x74, 0x65, 0x72, 0x6e,
+ 0x61, 0x6c, 0x20, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x72, 0x75, 0x63, 0x74,
+ 0x6f, 0x72, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20,
+ 0x5f, 0x46, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x28, 0x74,
+ 0x29, 0x0a, 0x20, 0x73, 0x65, 0x74, 0x6d, 0x65, 0x74, 0x61, 0x74, 0x61,
+ 0x62, 0x6c, 0x65, 0x28, 0x74, 0x2c, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x46,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x29, 0x0a, 0x0a, 0x20, 0x69,
+ 0x66, 0x20, 0x74, 0x2e, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x7e, 0x3d,
+ 0x20, 0x27, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x27, 0x20, 0x61, 0x6e, 0x64,
+ 0x20, 0x74, 0x2e, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x7e, 0x3d, 0x20,
+ 0x27, 0x27, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x65, 0x72,
+ 0x72, 0x6f, 0x72, 0x28, 0x22, 0x23, 0x69, 0x6e, 0x76, 0x61, 0x6c, 0x69,
+ 0x64, 0x20, 0x27, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x27, 0x20, 0x73, 0x70,
+ 0x65, 0x63, 0x69, 0x66, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x22,
+ 0x29, 0x0a, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x61, 0x70, 0x70,
+ 0x65, 0x6e, 0x64, 0x28, 0x74, 0x29, 0x0a, 0x20, 0x69, 0x66, 0x20, 0x74,
+ 0x3a, 0x69, 0x6e, 0x63, 0x6c, 0x61, 0x73, 0x73, 0x28, 0x29, 0x20, 0x74,
+ 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x2d, 0x2d, 0x70, 0x72, 0x69, 0x6e, 0x74,
+ 0x20, 0x28, 0x27, 0x74, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x69, 0x73,
+ 0x20, 0x27, 0x2e, 0x2e, 0x74, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2e, 0x2e,
+ 0x27, 0x2c, 0x20, 0x70, 0x61, 0x72, 0x65, 0x6e, 0x74, 0x2e, 0x6e, 0x61,
+ 0x6d, 0x65, 0x20, 0x69, 0x73, 0x20, 0x27, 0x2e, 0x2e, 0x74, 0x2e, 0x70,
+ 0x61, 0x72, 0x65, 0x6e, 0x74, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x29, 0x0a,
+ 0x20, 0x20, 0x69, 0x66, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e,
+ 0x67, 0x73, 0x75, 0x62, 0x28, 0x74, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c,
+ 0x20, 0x22, 0x25, 0x62, 0x3c, 0x3e, 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29,
+ 0x20, 0x3d, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67,
+ 0x73, 0x75, 0x62, 0x28, 0x74, 0x2e, 0x70, 0x61, 0x72, 0x65, 0x6e, 0x74,
+ 0x2e, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x61, 0x6c, 0x5f, 0x6e, 0x61,
+ 0x6d, 0x65, 0x20, 0x6f, 0x72, 0x20, 0x74, 0x2e, 0x70, 0x61, 0x72, 0x65,
+ 0x6e, 0x74, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c, 0x20, 0x22, 0x25, 0x62,
+ 0x3c, 0x3e, 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29, 0x20, 0x74, 0x68, 0x65,
+ 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x74, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x20,
+ 0x3d, 0x20, 0x27, 0x6e, 0x65, 0x77, 0x27, 0x0a, 0x20, 0x20, 0x20, 0x74,
+ 0x2e, 0x6c, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x27, 0x6e, 0x65,
+ 0x77, 0x27, 0x0a, 0x20, 0x20, 0x20, 0x74, 0x2e, 0x70, 0x61, 0x72, 0x65,
+ 0x6e, 0x74, 0x2e, 0x5f, 0x6e, 0x65, 0x77, 0x20, 0x3d, 0x20, 0x74, 0x72,
+ 0x75, 0x65, 0x0a, 0x20, 0x20, 0x20, 0x74, 0x2e, 0x74, 0x79, 0x70, 0x65,
+ 0x20, 0x3d, 0x20, 0x74, 0x2e, 0x70, 0x61, 0x72, 0x65, 0x6e, 0x74, 0x2e,
+ 0x6e, 0x61, 0x6d, 0x65, 0x0a, 0x20, 0x20, 0x20, 0x74, 0x2e, 0x70, 0x74,
+ 0x72, 0x20, 0x3d, 0x20, 0x27, 0x2a, 0x27, 0x0a, 0x20, 0x20, 0x65, 0x6c,
+ 0x73, 0x65, 0x69, 0x66, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e,
+ 0x67, 0x73, 0x75, 0x62, 0x28, 0x74, 0x2e, 0x6e, 0x61, 0x6d, 0x65, 0x2c,
+ 0x20, 0x22, 0x25, 0x62, 0x3c, 0x3e, 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29,
+ 0x20, 0x3d, 0x3d, 0x20, 0x27, 0x7e, 0x27, 0x2e, 0x2e, 0x73, 0x74, 0x72,
+ 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x74, 0x2e, 0x70,
+ 0x61, 0x72, 0x65, 0x6e, 0x74, 0x2e, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e,
+ 0x61, 0x6c, 0x5f, 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x6f, 0x72, 0x20, 0x74,
+ 0x2e, 0x70, 0x61, 0x72, 0x65, 0x6e, 0x74, 0x2e, 0x6e, 0x61, 0x6d, 0x65,
+ 0x2c, 0x20, 0x22, 0x25, 0x62, 0x3c, 0x3e, 0x22, 0x2c, 0x20, 0x22, 0x22,
+ 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x20, 0x20, 0x20, 0x74, 0x2e,
+ 0x6e, 0x61, 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x27, 0x64, 0x65, 0x6c, 0x65,
+ 0x74, 0x65, 0x27, 0x0a, 0x20, 0x20, 0x20, 0x74, 0x2e, 0x6c, 0x6e, 0x61,
+ 0x6d, 0x65, 0x20, 0x3d, 0x20, 0x27, 0x64, 0x65, 0x6c, 0x65, 0x74, 0x65,
+ 0x27, 0x0a, 0x20, 0x20, 0x20, 0x74, 0x2e, 0x70, 0x61, 0x72, 0x65, 0x6e,
+ 0x74, 0x2e, 0x5f, 0x64, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x20, 0x3d, 0x20,
+ 0x74, 0x72, 0x75, 0x65, 0x0a, 0x20, 0x20, 0x65, 0x6e, 0x64, 0x0a, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x74, 0x2e, 0x63, 0x6e, 0x61, 0x6d, 0x65,
+ 0x20, 0x3d, 0x20, 0x74, 0x3a, 0x63, 0x66, 0x75, 0x6e, 0x63, 0x6e, 0x61,
+ 0x6d, 0x65, 0x28, 0x22, 0x74, 0x6f, 0x6c, 0x75, 0x61, 0x22, 0x29, 0x2e,
+ 0x2e, 0x74, 0x3a, 0x6f, 0x76, 0x65, 0x72, 0x6c, 0x6f, 0x61, 0x64, 0x28,
+ 0x74, 0x29, 0x0a, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x74,
+ 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x2d, 0x2d, 0x20, 0x43, 0x6f, 0x6e,
+ 0x73, 0x74, 0x72, 0x75, 0x63, 0x74, 0x6f, 0x72, 0x0a, 0x2d, 0x2d, 0x20,
+ 0x45, 0x78, 0x70, 0x65, 0x63, 0x74, 0x73, 0x20, 0x74, 0x68, 0x72, 0x65,
+ 0x65, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x73, 0x3a, 0x20, 0x6f,
+ 0x6e, 0x65, 0x20, 0x72, 0x65, 0x70, 0x72, 0x65, 0x73, 0x65, 0x6e, 0x74,
+ 0x69, 0x6e, 0x67, 0x20, 0x74, 0x68, 0x65, 0x20, 0x66, 0x75, 0x6e, 0x63,
+ 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x64, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61,
+ 0x74, 0x69, 0x6f, 0x6e, 0x2c, 0x0a, 0x2d, 0x2d, 0x20, 0x61, 0x6e, 0x6f,
+ 0x74, 0x68, 0x65, 0x72, 0x20, 0x72, 0x65, 0x70, 0x72, 0x65, 0x73, 0x65,
+ 0x6e, 0x74, 0x69, 0x6e, 0x67, 0x20, 0x74, 0x68, 0x65, 0x20, 0x61, 0x72,
+ 0x67, 0x75, 0x6d, 0x65, 0x6e, 0x74, 0x20, 0x6c, 0x69, 0x73, 0x74, 0x2c,
+ 0x20, 0x61, 0x6e, 0x64, 0x20, 0x74, 0x68, 0x65, 0x20, 0x74, 0x68, 0x69,
+ 0x72, 0x64, 0x20, 0x72, 0x65, 0x70, 0x72, 0x65, 0x73, 0x65, 0x6e, 0x74,
+ 0x69, 0x6e, 0x67, 0x0a, 0x2d, 0x2d, 0x20, 0x74, 0x68, 0x65, 0x20, 0x22,
+ 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x22, 0x20, 0x6f, 0x72, 0x20, 0x65, 0x6d,
+ 0x70, 0x74, 0x79, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x0a,
+ 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x46, 0x75, 0x6e,
+ 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x28, 0x64, 0x2c, 0x61, 0x2c, 0x63,
+ 0x29, 0x0a, 0x20, 0x2d, 0x2d, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74,
+ 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x28, 0x73, 0x74, 0x72,
+ 0x73, 0x75, 0x62, 0x28, 0x61, 0x2c, 0x32, 0x2c, 0x2d, 0x32, 0x29, 0x2c,
+ 0x27, 0x2c, 0x27, 0x29, 0x20, 0x2d, 0x2d, 0x20, 0x65, 0x6c, 0x69, 0x6d,
+ 0x69, 0x6e, 0x61, 0x74, 0x65, 0x20, 0x62, 0x72, 0x61, 0x63, 0x65, 0x73,
+ 0x0a, 0x20, 0x2d, 0x2d, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x20,
+ 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69, 0x74, 0x5f, 0x70, 0x61, 0x72, 0x61,
+ 0x6d, 0x73, 0x28, 0x73, 0x74, 0x72, 0x73, 0x75, 0x62, 0x28, 0x61, 0x2c,
+ 0x32, 0x2c, 0x2d, 0x32, 0x29, 0x29, 0x0a, 0x0a, 0x09, 0x69, 0x66, 0x20,
+ 0x6e, 0x6f, 0x74, 0x20, 0x66, 0x6c, 0x61, 0x67, 0x73, 0x5b, 0x27, 0x57,
+ 0x27, 0x5d, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e,
+ 0x67, 0x2e, 0x66, 0x69, 0x6e, 0x64, 0x28, 0x61, 0x2c, 0x20, 0x22, 0x25,
+ 0x2e, 0x25, 0x2e, 0x25, 0x2e, 0x25, 0x73, 0x2a, 0x25, 0x29, 0x22, 0x29,
+ 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x0a, 0x09, 0x09, 0x77, 0x61, 0x72,
+ 0x6e, 0x69, 0x6e, 0x67, 0x28, 0x22, 0x46, 0x75, 0x6e, 0x63, 0x74, 0x69,
+ 0x6f, 0x6e, 0x73, 0x20, 0x77, 0x69, 0x74, 0x68, 0x20, 0x76, 0x61, 0x72,
+ 0x69, 0x61, 0x62, 0x6c, 0x65, 0x20, 0x61, 0x72, 0x67, 0x75, 0x6d, 0x65,
+ 0x6e, 0x74, 0x73, 0x20, 0x28, 0x60, 0x2e, 0x2e, 0x2e, 0x27, 0x29, 0x20,
+ 0x61, 0x72, 0x65, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x73, 0x75, 0x70, 0x70,
+ 0x6f, 0x72, 0x74, 0x65, 0x64, 0x2e, 0x20, 0x49, 0x67, 0x6e, 0x6f, 0x72,
+ 0x69, 0x6e, 0x67, 0x20, 0x22, 0x2e, 0x2e, 0x64, 0x2e, 0x2e, 0x61, 0x2e,
+ 0x2e, 0x63, 0x29, 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e,
+ 0x20, 0x6e, 0x69, 0x6c, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x0a,
+ 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x69, 0x3d, 0x31, 0x0a, 0x20,
+ 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6c, 0x20, 0x3d, 0x20, 0x7b, 0x6e,
+ 0x3d, 0x30, 0x7d, 0x0a, 0x0a, 0x20, 0x09, 0x61, 0x20, 0x3d, 0x20, 0x73,
+ 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x61,
+ 0x2c, 0x20, 0x22, 0x25, 0x73, 0x2a, 0x28, 0x5b, 0x25, 0x28, 0x25, 0x29,
+ 0x5d, 0x29, 0x25, 0x73, 0x2a, 0x22, 0x2c, 0x20, 0x22, 0x25, 0x31, 0x22,
+ 0x29, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x2c, 0x73,
+ 0x74, 0x72, 0x69, 0x70, 0x2c, 0x6c, 0x61, 0x73, 0x74, 0x20, 0x3d, 0x20,
+ 0x73, 0x74, 0x72, 0x69, 0x70, 0x5f, 0x70, 0x61, 0x72, 0x73, 0x28, 0x73,
+ 0x74, 0x72, 0x73, 0x75, 0x62, 0x28, 0x61, 0x2c, 0x32, 0x2c, 0x2d, 0x32,
+ 0x29, 0x29, 0x3b, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x73, 0x74, 0x72, 0x69,
+ 0x70, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x2d, 0x2d, 0x6c,
+ 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6e, 0x73, 0x20, 0x3d, 0x20, 0x73, 0x74,
+ 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x73, 0x75, 0x62, 0x28, 0x73, 0x74, 0x72,
+ 0x73, 0x75, 0x62, 0x28, 0x61, 0x2c, 0x31, 0x2c, 0x2d, 0x32, 0x29, 0x2c,
+ 0x20, 0x31, 0x2c, 0x20, 0x2d, 0x28, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67,
+ 0x2e, 0x6c, 0x65, 0x6e, 0x28, 0x6c, 0x61, 0x73, 0x74, 0x29, 0x2b, 0x31,
+ 0x29, 0x29, 0x0a, 0x09, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6e,
+ 0x73, 0x20, 0x3d, 0x20, 0x6a, 0x6f, 0x69, 0x6e, 0x28, 0x74, 0x2c, 0x20,
+ 0x22, 0x2c, 0x22, 0x2c, 0x20, 0x31, 0x2c, 0x20, 0x6c, 0x61, 0x73, 0x74,
+ 0x2d, 0x31, 0x29, 0x0a, 0x0a, 0x09, 0x09, 0x6e, 0x73, 0x20, 0x3d, 0x20,
+ 0x22, 0x28, 0x22, 0x2e, 0x2e, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e,
+ 0x67, 0x73, 0x75, 0x62, 0x28, 0x6e, 0x73, 0x2c, 0x20, 0x22, 0x25, 0x73,
+ 0x2a, 0x2c, 0x25, 0x73, 0x2a, 0x24, 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29,
+ 0x2e, 0x2e, 0x27, 0x29, 0x27, 0x0a, 0x09, 0x09, 0x2d, 0x2d, 0x6e, 0x73,
+ 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x70, 0x5f, 0x64, 0x65, 0x66,
+ 0x61, 0x75, 0x6c, 0x74, 0x73, 0x28, 0x6e, 0x73, 0x29, 0x0a, 0x0a, 0x09,
+ 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x66, 0x20, 0x3d, 0x20, 0x46,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x28, 0x64, 0x2c, 0x20, 0x6e,
+ 0x73, 0x2c, 0x20, 0x63, 0x29, 0x0a, 0x09, 0x09, 0x66, 0x6f, 0x72, 0x20,
+ 0x69, 0x3d, 0x31, 0x2c, 0x6c, 0x61, 0x73, 0x74, 0x20, 0x64, 0x6f, 0x0a,
+ 0x09, 0x09, 0x09, 0x74, 0x5b, 0x69, 0x5d, 0x20, 0x3d, 0x20, 0x73, 0x74,
+ 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x74, 0x5b,
+ 0x69, 0x5d, 0x2c, 0x20, 0x22, 0x3d, 0x2e, 0x2a, 0x24, 0x22, 0x2c, 0x20,
+ 0x22, 0x22, 0x29, 0x0a, 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x20, 0x77, 0x68, 0x69, 0x6c, 0x65, 0x20, 0x74,
+ 0x5b, 0x69, 0x5d, 0x20, 0x64, 0x6f, 0x0a, 0x20, 0x20, 0x6c, 0x2e, 0x6e,
+ 0x20, 0x3d, 0x20, 0x6c, 0x2e, 0x6e, 0x2b, 0x31, 0x0a, 0x20, 0x20, 0x6c,
+ 0x5b, 0x6c, 0x2e, 0x6e, 0x5d, 0x20, 0x3d, 0x20, 0x44, 0x65, 0x63, 0x6c,
+ 0x61, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x28, 0x74, 0x5b, 0x69, 0x5d,
+ 0x2c, 0x27, 0x76, 0x61, 0x72, 0x27, 0x2c, 0x74, 0x72, 0x75, 0x65, 0x29,
+ 0x0a, 0x20, 0x20, 0x69, 0x20, 0x3d, 0x20, 0x69, 0x2b, 0x31, 0x0a, 0x20,
+ 0x65, 0x6e, 0x64, 0x0a, 0x20, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x66,
+ 0x20, 0x3d, 0x20, 0x44, 0x65, 0x63, 0x6c, 0x61, 0x72, 0x61, 0x74, 0x69,
+ 0x6f, 0x6e, 0x28, 0x64, 0x2c, 0x27, 0x66, 0x75, 0x6e, 0x63, 0x27, 0x29,
+ 0x0a, 0x20, 0x66, 0x2e, 0x61, 0x72, 0x67, 0x73, 0x20, 0x3d, 0x20, 0x6c,
+ 0x0a, 0x20, 0x66, 0x2e, 0x63, 0x6f, 0x6e, 0x73, 0x74, 0x20, 0x3d, 0x20,
+ 0x63, 0x0a, 0x20, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x5f, 0x46,
+ 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x28, 0x66, 0x29, 0x0a, 0x65,
+ 0x6e, 0x64, 0x0a, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e,
+ 0x20, 0x6a, 0x6f, 0x69, 0x6e, 0x28, 0x74, 0x2c, 0x20, 0x73, 0x65, 0x70,
+ 0x2c, 0x20, 0x66, 0x69, 0x72, 0x73, 0x74, 0x2c, 0x20, 0x6c, 0x61, 0x73,
+ 0x74, 0x29, 0x0a, 0x0a, 0x09, 0x66, 0x69, 0x72, 0x73, 0x74, 0x20, 0x3d,
+ 0x20, 0x66, 0x69, 0x72, 0x73, 0x74, 0x20, 0x6f, 0x72, 0x20, 0x31, 0x0a,
+ 0x09, 0x6c, 0x61, 0x73, 0x74, 0x20, 0x3d, 0x20, 0x6c, 0x61, 0x73, 0x74,
+ 0x20, 0x6f, 0x72, 0x20, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x2e, 0x67, 0x65,
+ 0x74, 0x6e, 0x28, 0x74, 0x29, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c,
+ 0x20, 0x6c, 0x73, 0x65, 0x70, 0x20, 0x3d, 0x20, 0x22, 0x22, 0x0a, 0x09,
+ 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x72, 0x65, 0x74, 0x20, 0x3d, 0x20,
+ 0x22, 0x22, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x6c, 0x6f,
+ 0x6f, 0x70, 0x20, 0x3d, 0x20, 0x66, 0x61, 0x6c, 0x73, 0x65, 0x0a, 0x09,
+ 0x66, 0x6f, 0x72, 0x20, 0x69, 0x20, 0x3d, 0x20, 0x66, 0x69, 0x72, 0x73,
+ 0x74, 0x2c, 0x6c, 0x61, 0x73, 0x74, 0x20, 0x64, 0x6f, 0x0a, 0x0a, 0x09,
+ 0x09, 0x72, 0x65, 0x74, 0x20, 0x3d, 0x20, 0x72, 0x65, 0x74, 0x2e, 0x2e,
+ 0x6c, 0x73, 0x65, 0x70, 0x2e, 0x2e, 0x74, 0x5b, 0x69, 0x5d, 0x0a, 0x09,
+ 0x09, 0x6c, 0x73, 0x65, 0x70, 0x20, 0x3d, 0x20, 0x73, 0x65, 0x70, 0x0a,
+ 0x09, 0x09, 0x6c, 0x6f, 0x6f, 0x70, 0x20, 0x3d, 0x20, 0x74, 0x72, 0x75,
+ 0x65, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x69, 0x66, 0x20, 0x6e,
+ 0x6f, 0x74, 0x20, 0x6c, 0x6f, 0x6f, 0x70, 0x20, 0x74, 0x68, 0x65, 0x6e,
+ 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x22, 0x22,
+ 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x20, 0x72, 0x65, 0x74, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a,
+ 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x73, 0x74, 0x72,
+ 0x69, 0x70, 0x5f, 0x70, 0x61, 0x72, 0x73, 0x28, 0x73, 0x29, 0x0a, 0x0a,
+ 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x73,
+ 0x70, 0x6c, 0x69, 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e,
+ 0x73, 0x28, 0x73, 0x2c, 0x20, 0x27, 0x2c, 0x27, 0x29, 0x0a, 0x09, 0x6c,
+ 0x6f, 0x63, 0x61, 0x6c, 0x20, 0x73, 0x74, 0x72, 0x69, 0x70, 0x20, 0x3d,
+ 0x20, 0x66, 0x61, 0x6c, 0x73, 0x65, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x6c, 0x61, 0x73, 0x74, 0x0a, 0x0a, 0x09, 0x66, 0x6f, 0x72,
+ 0x20, 0x69, 0x3d, 0x74, 0x2e, 0x6e, 0x2c, 0x31, 0x2c, 0x2d, 0x31, 0x20,
+ 0x64, 0x6f, 0x0a, 0x0a, 0x09, 0x09, 0x69, 0x66, 0x20, 0x6e, 0x6f, 0x74,
+ 0x20, 0x73, 0x74, 0x72, 0x69, 0x70, 0x20, 0x61, 0x6e, 0x64, 0x20, 0x70,
+ 0x61, 0x72, 0x61, 0x6d, 0x5f, 0x6f, 0x62, 0x6a, 0x65, 0x63, 0x74, 0x28,
+ 0x74, 0x5b, 0x69, 0x5d, 0x29, 0x20, 0x74, 0x68, 0x65, 0x6e, 0x0a, 0x09,
+ 0x09, 0x09, 0x6c, 0x61, 0x73, 0x74, 0x20, 0x3d, 0x20, 0x69, 0x0a, 0x09,
+ 0x09, 0x09, 0x73, 0x74, 0x72, 0x69, 0x70, 0x20, 0x3d, 0x20, 0x74, 0x72,
+ 0x75, 0x65, 0x0a, 0x09, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x09, 0x2d,
+ 0x2d, 0x69, 0x66, 0x20, 0x73, 0x74, 0x72, 0x69, 0x70, 0x20, 0x74, 0x68,
+ 0x65, 0x6e, 0x0a, 0x09, 0x09, 0x2d, 0x2d, 0x09, 0x74, 0x5b, 0x69, 0x5d,
+ 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73,
+ 0x75, 0x62, 0x28, 0x74, 0x5b, 0x69, 0x5d, 0x2c, 0x20, 0x22, 0x3d, 0x2e,
+ 0x2a, 0x24, 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29, 0x0a, 0x09, 0x09, 0x2d,
+ 0x2d, 0x65, 0x6e, 0x64, 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09,
+ 0x72, 0x65, 0x74, 0x75, 0x72, 0x6e, 0x20, 0x74, 0x2c, 0x73, 0x74, 0x72,
+ 0x69, 0x70, 0x2c, 0x6c, 0x61, 0x73, 0x74, 0x0a, 0x0a, 0x65, 0x6e, 0x64,
+ 0x0a, 0x0a, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x20, 0x73,
+ 0x74, 0x72, 0x69, 0x70, 0x5f, 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74,
+ 0x73, 0x28, 0x73, 0x29, 0x0a, 0x0a, 0x09, 0x73, 0x20, 0x3d, 0x20, 0x73,
+ 0x74, 0x72, 0x69, 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x73,
+ 0x2c, 0x20, 0x22, 0x5e, 0x25, 0x28, 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29,
+ 0x0a, 0x09, 0x73, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67,
+ 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x73, 0x2c, 0x20, 0x22, 0x25, 0x29,
+ 0x24, 0x22, 0x2c, 0x20, 0x22, 0x22, 0x29, 0x0a, 0x0a, 0x09, 0x6c, 0x6f,
+ 0x63, 0x61, 0x6c, 0x20, 0x74, 0x20, 0x3d, 0x20, 0x73, 0x70, 0x6c, 0x69,
+ 0x74, 0x5f, 0x63, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x73, 0x28, 0x73,
+ 0x2c, 0x20, 0x22, 0x2c, 0x22, 0x29, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61,
+ 0x6c, 0x20, 0x73, 0x65, 0x70, 0x2c, 0x20, 0x72, 0x65, 0x74, 0x20, 0x3d,
+ 0x20, 0x22, 0x22, 0x2c, 0x22, 0x22, 0x0a, 0x09, 0x66, 0x6f, 0x72, 0x20,
+ 0x69, 0x3d, 0x31, 0x2c, 0x74, 0x2e, 0x6e, 0x20, 0x64, 0x6f, 0x0a, 0x09,
+ 0x09, 0x74, 0x5b, 0x69, 0x5d, 0x20, 0x3d, 0x20, 0x73, 0x74, 0x72, 0x69,
+ 0x6e, 0x67, 0x2e, 0x67, 0x73, 0x75, 0x62, 0x28, 0x74, 0x5b, 0x69, 0x5d,
+ 0x2c, 0x20, 0x22, 0x3d, 0x2e, 0x2a, 0x24, 0x22, 0x2c, 0x20, 0x22, 0x22,
+ 0x29, 0x0a, 0x09, 0x09, 0x72, 0x65, 0x74, 0x20, 0x3d, 0x20, 0x72, 0x65,
+ 0x74, 0x2e, 0x2e, 0x73, 0x65, 0x70, 0x2e, 0x2e, 0x74, 0x5b, 0x69, 0x5d,
+ 0x0a, 0x09, 0x09, 0x73, 0x65, 0x70, 0x20, 0x3d, 0x20, 0x22, 0x2c, 0x22,
+ 0x0a, 0x09, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x09, 0x72, 0x65, 0x74, 0x75,
+ 0x72, 0x6e, 0x20, 0x22, 0x28, 0x22, 0x2e, 0x2e, 0x72, 0x65, 0x74, 0x2e,
+ 0x2e, 0x22, 0x29, 0x22, 0x0a, 0x65, 0x6e, 0x64, 0x0a, 0x0a, 0x0a
+};
+unsigned int lua_function_lua_len = 14483;
diff --git a/lib/tolua++/src/bin/lua/basic.lua b/lib/tolua++/src/bin/lua/basic.lua
index f651f1fe6..4bff5276b 100644
--- a/lib/tolua++/src/bin/lua/basic.lua
+++ b/lib/tolua++/src/bin/lua/basic.lua
@@ -23,6 +23,7 @@ _basic = {
['unsigned'] = 'number',
['float'] = 'number',
['double'] = 'number',
+ ['size_t'] = 'number',
['_cstring'] = 'string',
['_userdata'] = 'userdata',
['char*'] = 'string',
@@ -66,6 +67,8 @@ _global_enums = {}
-- List of auto renaming
_renaming = {}
+
+_enums = {}
function appendrenaming (s)
local b,e,old,new = strfind(s,"%s*(.-)%s*@%s*(.-)%s*$")
if not b then
@@ -145,6 +148,11 @@ function typevar(type)
end
end
+-- is enum
+function isenumtype (type)
+ return _enums[type]
+end
+
-- check if basic type
function isbasic (type)
local t = gsub(type,'const ','')
@@ -382,6 +390,7 @@ end
_push_functions = {}
_is_functions = {}
+_enums = {}
_to_functions = {}
_base_push_functions = {}
@@ -410,5 +419,8 @@ function get_to_function(t)
end
function get_is_function(t)
+ if _enums[t] then
+ return "tolua_is" .. t
+ end
return _is_functions[t] or search_base(t, _base_is_functions) or "tolua_isusertype"
end
diff --git a/lib/tolua++/src/bin/lua/declaration.lua b/lib/tolua++/src/bin/lua/declaration.lua
index 73bbe910e..26ceeba22 100644
--- a/lib/tolua++/src/bin/lua/declaration.lua
+++ b/lib/tolua++/src/bin/lua/declaration.lua
@@ -227,6 +227,8 @@ function classDeclaration:outchecktype (narg)
--else
return '!tolua_istable(tolua_S,'..narg..',0,&tolua_err)'
--end
+ elseif isenumtype(self.type) ~= nil then
+ return '!tolua_is'..self.type..'(tolua_S,'..narg..','..def..',&tolua_err)'
elseif t then
return '!tolua_is'..t..'(tolua_S,'..narg..','..def..',&tolua_err)'
else
diff --git a/lib/tolua++/src/bin/lua/enumerate.lua b/lib/tolua++/src/bin/lua/enumerate.lua
index 99fe74629..09b22a094 100644
--- a/lib/tolua++/src/bin/lua/enumerate.lua
+++ b/lib/tolua++/src/bin/lua/enumerate.lua
@@ -48,6 +48,25 @@ function classEnumerate:print (ident,close)
print(ident.."}"..close)
end
+function emitenumprototype(type)
+ output("int tolua_is" .. string.gsub(type,"::","_") .. " (lua_State* L, int lo, int def, tolua_Error* err);")
+end
+
+_global_output_enums = {}
+
+-- write support code
+function classEnumerate:supcode ()
+ if _global_output_enums[self.name] == nil then
+ _global_output_enums[self.name] = 1
+ output("int tolua_is" .. string.gsub(self.name,"::","_") .. " (lua_State* L, int lo, int def, tolua_Error* err)")
+ output("{")
+ output("if (!tolua_isnumber(L,lo,def,err)) return 0;")
+ output("lua_Number val = tolua_tonumber(L,lo,def);")
+ output("return val >= " .. self.min .. ".0 && val <= " ..self.max .. ".0;")
+ output("}")
+ end
+end
+
-- Internal constructor
function _Enumerate (t,varname)
setmetatable(t,classEnumerate)
@@ -67,40 +86,57 @@ function _Enumerate (t,varname)
t.access = parent.curr_member_access
t.global_access = t:check_public_access()
end
-return t
+ return t
end
-- Constructor
-- Expects a string representing the enumerate body
function Enumerate (n,b,varname)
b = string.gsub(b, ",[%s\n]*}", "\n}") -- eliminate last ','
- local t = split(strsub(b,2,-2),',') -- eliminate braces
- local i = 1
- local e = {n=0}
- while t[i] do
- local tt = split(t[i],'=') -- discard initial value
- e.n = e.n + 1
- e[e.n] = tt[1]
- i = i+1
- end
- -- set lua names
- i = 1
- e.lnames = {}
- local ns = getcurrnamespace()
- while e[i] do
- local t = split(e[i],'@')
- e[i] = t[1]
- if not t[2] then
- t[2] = applyrenaming(t[1])
+ local t = split(strsub(b,2,-2),',') -- eliminate braces
+ local i = 1
+ local e = {n=0}
+ local value = 0
+ local min = 0
+ local max = 0
+ while t[i] do
+ local tt = split(t[i],'=') -- discard initial value
+ e.n = e.n + 1
+ e[e.n] = tt[1]
+ tt[2] = tonumber(tt[2])
+ if tt[2] == nil then
+ tt[2] = value
+ end
+ value = tt[2] + 1 -- advance the selected value
+ if tt[2] > max then
+ max = tt[2]
end
- e.lnames[i] = t[2] or t[1]
- _global_enums[ ns..e[i] ] = (ns..e[i])
- i = i+1
- end
+ if tt[2] < min then
+ min = tt[2]
+ end
+ i = i+1
+ end
+ -- set lua names
+ i = 1
+ e.lnames = {}
+ local ns = getcurrnamespace()
+ while e[i] do
+ local t = split(e[i],'@')
+ e[i] = t[1]
+ if not t[2] then
+ t[2] = applyrenaming(t[1])
+ end
+ e.lnames[i] = t[2] or t[1]
+ _global_enums[ ns..e[i] ] = (ns..e[i])
+ i = i+1
+ end
e.name = n
+ e.min = min
+ e.max = max
if n ~= "" then
+ _enums[n] = true
Typedef("int "..n)
end
- return _Enumerate(e, varname)
+ return _Enumerate(e, varname)
end
diff --git a/lib/tolua++/src/bin/lua/function.lua b/lib/tolua++/src/bin/lua/function.lua
index 2358e9ff7..3b6b53c5e 100644
--- a/lib/tolua++/src/bin/lua/function.lua
+++ b/lib/tolua++/src/bin/lua/function.lua
@@ -50,11 +50,20 @@ end
-- Write binding function
-- Outputs C/C++ binding function.
function classFunction:supcode (local_constructor)
-
local overload = strsub(self.cname,-2,-1) - 1 -- indicate overloaded func
local nret = 0 -- number of returned values
local class = self:inclass()
local _,_,static = strfind(self.mod,'^%s*(static)')
+ -- prototypes for enum functions
+ if self.args[1].type ~= 'void' then
+ local i=1
+ while self.args[i] do
+ if isenumtype(self.args[i].type) then
+ emitenumprototype(self.args[i].type)
+ end
+ i = i+1
+ end
+ end
if class then
if self.name == 'new' and self.parent.flags.pure_virtual then
diff --git a/lib/tolua++/src/bin/toluabind.c b/lib/tolua++/src/bin/toluabind.c
index bf71cf158..06b371f70 100644
--- a/lib/tolua++/src/bin/toluabind.c
+++ b/lib/tolua++/src/bin/toluabind.c
@@ -384,603 +384,8 @@ TOLUA_API int tolua_tolua_open (lua_State* tolua_S)
{ /* begin embedded lua code */
int top = lua_gettop(tolua_S);
- static unsigned char B[] = {
- 45, 45, 32,116,111,108,117, 97, 58, 32, 98, 97,115,105, 99,
- 32,117,116,105,108,105,116,121, 32,102,117,110, 99,116,105,
- 111,110,115, 10, 45, 45, 32, 87,114,105,116,116,101,110, 32,
- 98,121, 32, 87, 97,108,100,101,109, 97,114, 32, 67,101,108,
- 101,115, 10, 45, 45, 32, 84,101, 67, 71,114, 97,102, 47, 80,
- 85, 67, 45, 82,105,111, 10, 45, 45, 32, 74,117,108, 32, 49,
- 57, 57, 56, 10, 45, 45, 32, 76, 97,115,116, 32,117,112,100,
- 97,116,101, 58, 32, 65,112,114, 32, 50, 48, 48, 51, 10, 45,
- 45, 32, 36, 73,100, 58, 32, 36, 10, 10, 45, 45, 32, 84,104,
- 105,115, 32, 99,111,100,101, 32,105,115, 32,102,114,101,101,
- 32,115,111,102,116,119, 97,114,101, 59, 32,121,111,117, 32,
- 99, 97,110, 32,114,101,100,105,115,116,114,105, 98,117,116,
- 101, 32,105,116, 32, 97,110,100, 47,111,114, 32,109,111,100,
- 105,102,121, 32,105,116, 46, 10, 45, 45, 32, 84,104,101, 32,
- 115,111,102,116,119, 97,114,101, 32,112,114,111,118,105,100,
- 101,100, 32,104,101,114,101,117,110,100,101,114, 32,105,115,
- 32,111,110, 32, 97,110, 32, 34, 97,115, 32,105,115, 34, 32,
- 98, 97,115,105,115, 44, 32, 97,110,100, 10, 45, 45, 32,116,
- 104,101, 32, 97,117,116,104,111,114, 32,104, 97,115, 32,110,
- 111, 32,111, 98,108,105,103, 97,116,105,111,110, 32,116,111,
- 32,112,114,111,118,105,100,101, 32,109, 97,105,110,116,101,
- 110, 97,110, 99,101, 44, 32,115,117,112,112,111,114,116, 44,
- 32,117,112,100, 97,116,101,115, 44, 10, 45, 45, 32,101,110,
- 104, 97,110, 99,101,109,101,110,116,115, 44, 32,111,114, 32,
- 109,111,100,105,102,105, 99, 97,116,105,111,110,115, 46, 10,
- 10, 10, 45, 45, 32, 66, 97,115,105, 99, 32, 67, 32,116,121,
- 112,101,115, 32, 97,110,100, 32,116,104,101,105,114, 32, 99,
- 111,114,114,101,115,112,111,110,100,105,110,103, 32, 76,117,
- 97, 32,116,121,112,101,115, 10, 45, 45, 32, 65,108,108, 32,
- 111, 99, 99,117,114,114,101,110, 99,101,115, 32,111,102, 32,
- 34, 99,104, 97,114, 42, 34, 32,119,105,108,108, 32, 98,101,
- 32,114,101,112,108, 97, 99,101,100, 32, 98,121, 32, 34, 95,
- 99,115,116,114,105,110,103, 34, 44, 10, 45, 45, 32, 97,110,
- 100, 32, 97,108,108, 32,111, 99, 99,117,114,114,101,110, 99,
- 101,115, 32,111,102, 32, 34,118,111,105,100, 42, 34, 32,119,
- 105,108,108, 32, 98,101, 32,114,101,112,108, 97, 99,101,100,
- 32, 98,121, 32, 34, 95,117,115,101,114,100, 97,116, 97, 34,
- 10, 95, 98, 97,115,105, 99, 32, 61, 32,123, 10, 32, 91, 39,
- 118,111,105,100, 39, 93, 32, 61, 32, 39, 39, 44, 10, 32, 91,
- 39, 99,104, 97,114, 39, 93, 32, 61, 32, 39,110,117,109, 98,
- 101,114, 39, 44, 10, 32, 91, 39,105,110,116, 39, 93, 32, 61,
- 32, 39,110,117,109, 98,101,114, 39, 44, 10, 32, 91, 39,115,
- 104,111,114,116, 39, 93, 32, 61, 32, 39,110,117,109, 98,101,
- 114, 39, 44, 10, 32, 91, 39,108,111,110,103, 39, 93, 32, 61,
- 32, 39,110,117,109, 98,101,114, 39, 44, 10, 32, 91, 39,117,
- 110,115,105,103,110,101,100, 39, 93, 32, 61, 32, 39,110,117,
- 109, 98,101,114, 39, 44, 10, 32, 91, 39,102,108,111, 97,116,
- 39, 93, 32, 61, 32, 39,110,117,109, 98,101,114, 39, 44, 10,
- 32, 91, 39,100,111,117, 98,108,101, 39, 93, 32, 61, 32, 39,
- 110,117,109, 98,101,114, 39, 44, 10, 32, 91, 39, 95, 99,115,
- 116,114,105,110,103, 39, 93, 32, 61, 32, 39,115,116,114,105,
- 110,103, 39, 44, 10, 32, 91, 39, 95,117,115,101,114,100, 97,
- 116, 97, 39, 93, 32, 61, 32, 39,117,115,101,114,100, 97,116,
- 97, 39, 44, 10, 32, 91, 39, 99,104, 97,114, 42, 39, 93, 32,
- 61, 32, 39,115,116,114,105,110,103, 39, 44, 10, 32, 91, 39,
- 118,111,105,100, 42, 39, 93, 32, 61, 32, 39,117,115,101,114,
- 100, 97,116, 97, 39, 44, 10, 32, 91, 39, 98,111,111,108, 39,
- 93, 32, 61, 32, 39, 98,111,111,108,101, 97,110, 39, 44, 10,
- 32, 91, 39,108,117, 97, 95, 79, 98,106,101, 99,116, 39, 93,
- 32, 61, 32, 39,118, 97,108,117,101, 39, 44, 10, 32, 91, 39,
- 76, 85, 65, 95, 86, 65, 76, 85, 69, 39, 93, 32, 61, 32, 39,
- 118, 97,108,117,101, 39, 44, 32, 32, 32, 32, 45, 45, 32,102,
- 111,114, 32, 99,111,109,112, 97,116,105, 98,105,108,105,116,
- 121, 32,119,105,116,104, 32,116,111,108,117, 97, 32, 52, 46,
- 48, 10, 32, 91, 39,108,117, 97, 95, 83,116, 97,116,101, 42,
- 39, 93, 32, 61, 32, 39,115,116, 97,116,101, 39, 44, 10, 32,
- 91, 39, 95,108,115,116, 97,116,101, 39, 93, 32, 61, 32, 39,
- 115,116, 97,116,101, 39, 44, 10, 32, 91, 39,108,117, 97, 95,
- 70,117,110, 99,116,105,111,110, 39, 93, 32, 61, 32, 39,118,
- 97,108,117,101, 39, 44, 10,125, 10, 10, 95, 98, 97,115,105,
- 99, 95, 99,116,121,112,101, 32, 61, 32,123, 10, 32,110,117,
- 109, 98,101,114, 32, 61, 32, 34,108,117, 97, 95, 78,117,109,
- 98,101,114, 34, 44, 10, 32,115,116,114,105,110,103, 32, 61,
- 32, 34, 99,111,110,115,116, 32, 99,104, 97,114, 42, 34, 44,
- 10, 32,117,115,101,114,100, 97,116, 97, 32, 61, 32, 34,118,
- 111,105,100, 42, 34, 44, 10, 32, 98,111,111,108,101, 97,110,
- 32, 61, 32, 34, 98,111,111,108, 34, 44, 10, 32,118, 97,108,
- 117,101, 32, 61, 32, 34,105,110,116, 34, 44, 10, 32,115,116,
- 97,116,101, 32, 61, 32, 34,108,117, 97, 95, 83,116, 97,116,
- 101, 42, 34, 44, 10,125, 10, 10, 45, 45, 32,102,117,110, 99,
- 116,105,111,110,115, 32,116,104,101, 32, 97,114,101, 32,117,
- 115,101,100, 32,116,111, 32,100,111, 32, 97, 32, 39,114, 97,
- 119, 32,112,117,115,104, 39, 32,111,102, 32, 98, 97,115,105,
- 99, 32,116,121,112,101,115, 10, 95, 98, 97,115,105, 99, 95,
- 114, 97,119, 95,112,117,115,104, 32, 61, 32,123,125, 10, 10,
- 45, 45, 32, 76,105,115,116, 32,111,102, 32,117,115,101,114,
- 32,100,101,102,105,110,101,100, 32,116,121,112,101,115, 10,
- 45, 45, 32, 69, 97, 99,104, 32,116,121,112,101, 32, 99,111,
- 114,114,101,115,112,111,110,100,115, 32,116,111, 32, 97, 32,
- 118, 97,114,105, 97, 98,108,101, 32,110, 97,109,101, 32,116,
- 104, 97,116, 32,115,116,111,114,101,115, 32,105,116,115, 32,
- 116, 97,103, 32,118, 97,108,117,101, 46, 10, 95,117,115,101,
- 114,116,121,112,101, 32, 61, 32,123,125, 10, 10, 45, 45, 32,
- 76,105,115,116, 32,111,102, 32,116,121,112,101,115, 32,116,
- 104, 97,116, 32,104, 97,118,101, 32,116,111, 32, 98,101, 32,
- 99,111,108,108,101, 99,116,101,100, 10, 95, 99,111,108,108,
- 101, 99,116, 32, 61, 32,123,125, 10, 10, 45, 45, 32, 76,105,
- 115,116, 32,111,102, 32,116,121,112,101,115, 10, 95,103,108,
- 111, 98, 97,108, 95,116,121,112,101,115, 32, 61, 32,123,110,
- 61, 48,125, 10, 95,103,108,111, 98, 97,108, 95,116,121,112,
- 101,115, 95,104, 97,115,104, 32, 61, 32,123,125, 10, 10, 45,
- 45, 32,108,105,115,116, 32,111,102, 32, 99,108, 97,115,115,
- 101,115, 10, 95,103,108,111, 98, 97,108, 95, 99,108, 97,115,
- 115,101,115, 32, 61, 32,123,125, 10, 10, 45, 45, 32, 76,105,
- 115,116, 32,111,102, 32,101,110,117,109, 32, 99,111,110,115,
- 116, 97,110,116,115, 10, 95,103,108,111, 98, 97,108, 95,101,
- 110,117,109,115, 32, 61, 32,123,125, 10, 10, 45, 45, 32, 76,
- 105,115,116, 32,111,102, 32, 97,117,116,111, 32,114,101,110,
- 97,109,105,110,103, 10, 95,114,101,110, 97,109,105,110,103,
- 32, 61, 32,123,125, 10,102,117,110, 99,116,105,111,110, 32,
- 97,112,112,101,110,100,114,101,110, 97,109,105,110,103, 32,
- 40,115, 41, 10, 32,108,111, 99, 97,108, 32, 98, 44,101, 44,
- 111,108,100, 44,110,101,119, 32, 61, 32,115,116,114,102,105,
- 110,100, 40,115, 44, 34, 37,115, 42, 40, 46, 45, 41, 37,115,
- 42, 64, 37,115, 42, 40, 46, 45, 41, 37,115, 42, 36, 34, 41,
- 10, 9,105,102, 32,110,111,116, 32, 98, 32,116,104,101,110,
- 10, 9, 32,101,114,114,111,114, 40, 34, 35, 73,110,118, 97,
- 108,105,100, 32,114,101,110, 97,109,105,110,103, 32,115,121,
- 110,116, 97,120, 59, 32,105,116, 32,115,104,111,117,108,100,
- 32, 98,101, 32,111,102, 32,116,104,101, 32,102,111,114,109,
- 58, 32,112, 97,116,116,101,114,110, 64,112, 97,116,116,101,
- 114,110, 34, 41, 10, 9,101,110,100, 10, 9,116,105,110,115,
- 101,114,116, 40, 95,114,101,110, 97,109,105,110,103, 44,123,
- 111,108,100, 61,111,108,100, 44, 32,110,101,119, 61,110,101,
- 119,125, 41, 10,101,110,100, 10, 10,102,117,110, 99,116,105,
- 111,110, 32, 97,112,112,108,121,114,101,110, 97,109,105,110,
- 103, 32, 40,115, 41, 10, 9,102,111,114, 32,105, 61, 49, 44,
- 103,101,116,110, 40, 95,114,101,110, 97,109,105,110,103, 41,
- 32,100,111, 10, 9, 32,108,111, 99, 97,108, 32,109, 44,110,
- 32, 61, 32,103,115,117, 98, 40,115, 44, 95,114,101,110, 97,
- 109,105,110,103, 91,105, 93, 46,111,108,100, 44, 95,114,101,
- 110, 97,109,105,110,103, 91,105, 93, 46,110,101,119, 41, 10,
- 9, 9,105,102, 32,110, 32,126, 61, 32, 48, 32,116,104,101,
- 110, 10, 9, 9, 32,114,101,116,117,114,110, 32,109, 10, 9,
- 9,101,110,100, 10, 9,101,110,100, 10, 9,114,101,116,117,
- 114,110, 32,110,105,108, 10,101,110,100, 10, 10, 45, 45, 32,
- 69,114,114,111,114, 32,104, 97,110,100,108,101,114, 10,102,
- 117,110, 99,116,105,111,110, 32,116,111,108,117, 97, 95,101,
- 114,114,111,114, 32, 40,115, 44,102, 41, 10,105,102, 32, 95,
- 99,117,114,114, 95, 99,111,100,101, 32,116,104,101,110, 10,
- 9,112,114,105,110,116, 40, 34, 42, 42, 42, 99,117,114,114,
- 32, 99,111,100,101, 32,102,111,114, 32,101,114,114,111,114,
- 32,105,115, 32, 34, 46, 46,116,111,115,116,114,105,110,103,
- 40, 95, 99,117,114,114, 95, 99,111,100,101, 41, 41, 10, 9,
- 112,114,105,110,116, 40,100,101, 98,117,103, 46,116,114, 97,
- 99,101, 98, 97, 99,107, 40, 41, 41, 10,101,110,100, 10, 32,
- 108,111, 99, 97,108, 32,111,117,116, 32, 61, 32, 95, 79, 85,
- 84, 80, 85, 84, 10, 32, 95, 79, 85, 84, 80, 85, 84, 32, 61,
- 32, 95, 83, 84, 68, 69, 82, 82, 10, 32,105,102, 32,115,116,
- 114,115,117, 98, 40,115, 44, 49, 44, 49, 41, 32, 61, 61, 32,
- 39, 35, 39, 32,116,104,101,110, 10, 32, 32,119,114,105,116,
- 101, 40, 34, 92,110, 42, 42, 32,116,111,108,117, 97, 58, 32,
- 34, 46, 46,115,116,114,115,117, 98, 40,115, 44, 50, 41, 46,
- 46, 34, 46, 92,110, 92,110, 34, 41, 10, 32, 32,105,102, 32,
- 95, 99,117,114,114, 95, 99,111,100,101, 32,116,104,101,110,
- 10, 32, 32, 32,108,111, 99, 97,108, 32, 95, 44, 95, 44,115,
- 32, 61, 32,115,116,114,102,105,110,100, 40, 95, 99,117,114,
- 114, 95, 99,111,100,101, 44, 34, 94, 37,115, 42, 40, 46, 45,
- 92,110, 41, 34, 41, 32, 45, 45, 32,101,120,116,114, 97, 99,
- 116, 32,102,105,114,115,116, 32,108,105,110,101, 10, 32, 32,
- 32,105,102, 32,115, 61, 61,110,105,108, 32,116,104,101,110,
- 32,115, 32, 61, 32, 95, 99,117,114,114, 95, 99,111,100,101,
- 32,101,110,100, 10, 32, 32, 32,115, 32, 61, 32,103,115,117,
- 98, 40,115, 44, 34, 95,117,115,101,114,100, 97,116, 97, 34,
- 44, 34,118,111,105,100, 42, 34, 41, 32, 45, 45, 32,114,101,
- 116,117,114,110, 32,119,105,116,104, 32, 39,118,111,105,100,
- 42, 39, 10, 32, 32, 32,115, 32, 61, 32,103,115,117, 98, 40,
- 115, 44, 34, 95, 99,115,116,114,105,110,103, 34, 44, 34, 99,
- 104, 97,114, 42, 34, 41, 32, 32, 45, 45, 32,114,101,116,117,
- 114,110, 32,119,105,116,104, 32, 39, 99,104, 97,114, 42, 39,
- 10, 32, 32, 32,115, 32, 61, 32,103,115,117, 98, 40,115, 44,
- 34, 95,108,115,116, 97,116,101, 34, 44, 34,108,117, 97, 95,
- 83,116, 97,116,101, 42, 34, 41, 32, 32, 45, 45, 32,114,101,
- 116,117,114,110, 32,119,105,116,104, 32, 39,108,117, 97, 95,
- 83,116, 97,116,101, 42, 39, 10, 32, 32, 32,119,114,105,116,
- 101, 40, 34, 67,111,100,101, 32, 98,101,105,110,103, 32,112,
- 114,111, 99,101,115,115,101,100, 58, 92,110, 34, 46, 46,115,
- 46, 46, 34, 92,110, 34, 41, 10, 32, 32,101,110,100, 10, 32,
- 101,108,115,101, 10, 32,105,102, 32,110,111,116, 32,102, 32,
- 116,104,101,110, 32,102, 32, 61, 32, 34, 40,102, 32,105,115,
- 32,110,105,108, 41, 34, 32,101,110,100, 10, 32, 32,112,114,
- 105,110,116, 40, 34, 92,110, 42, 42, 32,116,111,108,117, 97,
- 32,105,110,116,101,114,110, 97,108, 32,101,114,114,111,114,
- 58, 32, 34, 46, 46,102, 46, 46,115, 46, 46, 34, 46, 92,110,
- 92,110, 34, 41, 10, 32, 32,114,101,116,117,114,110, 10, 32,
- 101,110,100, 10, 32, 95, 79, 85, 84, 80, 85, 84, 32, 61, 32,
- 111,117,116, 10,101,110,100, 10, 10,102,117,110, 99,116,105,
- 111,110, 32,119, 97,114,110,105,110,103, 32, 40,109,115,103,
- 41, 10, 32,105,102, 32,102,108, 97,103,115, 46,113, 32,116,
- 104,101,110, 32,114,101,116,117,114,110, 32,101,110,100, 10,
- 32,108,111, 99, 97,108, 32,111,117,116, 32, 61, 32, 95, 79,
- 85, 84, 80, 85, 84, 10, 32, 95, 79, 85, 84, 80, 85, 84, 32,
- 61, 32, 95, 83, 84, 68, 69, 82, 82, 10, 32,119,114,105,116,
- 101, 40, 34, 92,110, 42, 42, 32,116,111,108,117, 97, 32,119,
- 97,114,110,105,110,103, 58, 32, 34, 46, 46,109,115,103, 46,
- 46, 34, 46, 92,110, 92,110, 34, 41, 10, 32, 95, 79, 85, 84,
- 80, 85, 84, 32, 61, 32,111,117,116, 10,101,110,100, 10, 10,
- 45, 45, 32,114,101,103,105,115,116,101,114, 32, 97,110, 32,
- 117,115,101,114, 32,100,101,102,105,110,101,100, 32,116,121,
- 112,101, 58, 32,114,101,116,117,114,110,115, 32,102,117,108,
- 108, 32,116,121,112,101, 10,102,117,110, 99,116,105,111,110,
- 32,114,101,103,116,121,112,101, 32, 40,116, 41, 10, 9, 45,
- 45,105,102, 32,105,115, 98, 97,115,105, 99, 40,116, 41, 32,
- 116,104,101,110, 10, 9, 45, 45, 9,114,101,116,117,114,110,
- 32,116, 10, 9, 45, 45,101,110,100, 10, 9,108,111, 99, 97,
- 108, 32,102,116, 32, 61, 32,102,105,110,100,116,121,112,101,
- 40,116, 41, 10, 10, 9,105,102, 32,110,111,116, 32, 95,117,
- 115,101,114,116,121,112,101, 91,102,116, 93, 32,116,104,101,
- 110, 10, 9, 9,114,101,116,117,114,110, 32, 97,112,112,101,
- 110,100,117,115,101,114,116,121,112,101, 40,116, 41, 10, 9,
- 101,110,100, 10, 9,114,101,116,117,114,110, 32,102,116, 10,
- 101,110,100, 10, 10, 45, 45, 32,114,101,116,117,114,110, 32,
- 116,121,112,101, 32,110, 97,109,101, 58, 32,114,101,116,117,
- 114,110,115, 32,102,117,108,108, 32,116,121,112,101, 10,102,
- 117,110, 99,116,105,111,110, 32,116,121,112,101,118, 97,114,
- 40,116,121,112,101, 41, 10, 9,105,102, 32,116,121,112,101,
- 32, 61, 61, 32, 39, 39, 32,111,114, 32,116,121,112,101, 32,
- 61, 61, 32, 39,118,111,105,100, 39, 32,116,104,101,110, 10,
- 9, 9,114,101,116,117,114,110, 32,116,121,112,101, 10, 9,
- 101,108,115,101, 10, 9, 9,108,111, 99, 97,108, 32,102,116,
- 32, 61, 32,102,105,110,100,116,121,112,101, 40,116,121,112,
- 101, 41, 10, 9, 9,105,102, 32,102,116, 32,116,104,101,110,
- 10, 9, 9, 9,114,101,116,117,114,110, 32,102,116, 10, 9,
- 9,101,110,100, 10, 9, 9, 95,117,115,101,114,116,121,112,
- 101, 91,116,121,112,101, 93, 32, 61, 32,116,121,112,101, 10,
- 9, 9,114,101,116,117,114,110, 32,116,121,112,101, 10, 9,
- 101,110,100, 10,101,110,100, 10, 10, 45, 45, 32, 99,104,101,
- 99,107, 32,105,102, 32, 98, 97,115,105, 99, 32,116,121,112,
- 101, 10,102,117,110, 99,116,105,111,110, 32,105,115, 98, 97,
- 115,105, 99, 32, 40,116,121,112,101, 41, 10, 32,108,111, 99,
- 97,108, 32,116, 32, 61, 32,103,115,117, 98, 40,116,121,112,
- 101, 44, 39, 99,111,110,115,116, 32, 39, 44, 39, 39, 41, 10,
- 32,108,111, 99, 97,108, 32,109, 44,116, 32, 61, 32, 97,112,
- 112,108,121,116,121,112,101,100,101,102, 40, 39, 39, 44, 32,
- 116, 41, 10, 32,108,111, 99, 97,108, 32, 98, 32, 61, 32, 95,
- 98, 97,115,105, 99, 91,116, 93, 10, 32,105,102, 32, 98, 32,
- 116,104,101,110, 10, 32, 32,114,101,116,117,114,110, 32, 98,
- 44, 95, 98, 97,115,105, 99, 95, 99,116,121,112,101, 91, 98,
- 93, 10, 32,101,110,100, 10, 32,114,101,116,117,114,110, 32,
- 110,105,108, 10,101,110,100, 10, 10, 45, 45, 32,115,112,108,
- 105,116, 32,115,116,114,105,110,103, 32,117,115,105,110,103,
- 32, 97, 32,116,111,107,101,110, 10,102,117,110, 99,116,105,
- 111,110, 32,115,112,108,105,116, 32, 40,115, 44,116, 41, 10,
- 32,108,111, 99, 97,108, 32,108, 32, 61, 32,123,110, 61, 48,
- 125, 10, 32,108,111, 99, 97,108, 32,102, 32, 61, 32,102,117,
- 110, 99,116,105,111,110, 32, 40,115, 41, 10, 32, 32,108, 46,
- 110, 32, 61, 32,108, 46,110, 32, 43, 32, 49, 10, 32, 32,108,
- 91,108, 46,110, 93, 32, 61, 32,115, 10, 32, 32,114,101,116,
- 117,114,110, 32, 34, 34, 10, 32,101,110,100, 10, 32,108,111,
- 99, 97,108, 32,112, 32, 61, 32, 34, 37,115, 42, 40, 46, 45,
- 41, 37,115, 42, 34, 46, 46,116, 46, 46, 34, 37,115, 42, 34,
- 10, 32,115, 32, 61, 32,103,115,117, 98, 40,115, 44, 34, 94,
- 37,115, 43, 34, 44, 34, 34, 41, 10, 32,115, 32, 61, 32,103,
- 115,117, 98, 40,115, 44, 34, 37,115, 43, 36, 34, 44, 34, 34,
- 41, 10, 32,115, 32, 61, 32,103,115,117, 98, 40,115, 44,112,
- 44,102, 41, 10, 32,108, 46,110, 32, 61, 32,108, 46,110, 32,
- 43, 32, 49, 10, 32,108, 91,108, 46,110, 93, 32, 61, 32,103,
- 115,117, 98, 40,115, 44, 34, 40, 37,115, 37,115, 42, 41, 36,
- 34, 44, 34, 34, 41, 10, 32,114,101,116,117,114,110, 32,108,
- 10,101,110,100, 10, 10, 45, 45, 32,115,112,108,105,116,115,
- 32, 97, 32,115,116,114,105,110,103, 32,117,115,105,110,103,
- 32, 97, 32,112, 97,116,116,101,114,110, 44, 32, 99,111,110,
- 115,105,100,101,114,105,110,103, 32,116,104,101, 32,115,112,
- 97, 99,105, 97,108, 32, 99, 97,115,101,115, 32,111,102, 32,
- 67, 32, 99,111,100,101, 32, 40,116,101,109,112,108, 97,116,
- 101,115, 44, 32,102,117,110, 99,116,105,111,110, 32,112, 97,
- 114, 97,109,101,116,101,114,115, 44, 32,101,116, 99, 41, 10,
- 45, 45, 32,112, 97,116,116,101,114,110, 32, 99, 97,110, 39,
- 116, 32, 99,111,110,116, 97,105,110, 32,116,104,101, 32, 39,
- 94, 39, 32, 40, 97,115, 32,117,115,101,100, 32,116,111, 32,
- 105,100,101,110,116,105,102,121, 32,116,104,101, 32, 98,101,
- 103,105,110,105,110,103, 32,111,102, 32,116,104,101, 32,108,
- 105,110,101, 41, 10, 45, 45, 32, 97,108,115,111, 32,115,116,
- 114,105,112,115, 32,119,104,105,116,101,115,112, 97, 99,101,
- 10,102,117,110, 99,116,105,111,110, 32,115,112,108,105,116,
- 95, 99, 95,116,111,107,101,110,115, 40,115, 44, 32,112, 97,
- 116, 41, 10, 10, 9,115, 32, 61, 32,115,116,114,105,110,103,
- 46,103,115,117, 98, 40,115, 44, 32, 34, 94, 37,115, 42, 34,
- 44, 32, 34, 34, 41, 10, 9,115, 32, 61, 32,115,116,114,105,
- 110,103, 46,103,115,117, 98, 40,115, 44, 32, 34, 37,115, 42,
- 36, 34, 44, 32, 34, 34, 41, 10, 10, 9,108,111, 99, 97,108,
- 32,116,111,107,101,110, 95, 98,101,103,105,110, 32, 61, 32,
- 49, 10, 9,108,111, 99, 97,108, 32,116,111,107,101,110, 95,
- 101,110,100, 32, 61, 32, 49, 10, 9,108,111, 99, 97,108, 32,
- 111,102,115, 32, 61, 32, 49, 10, 9,108,111, 99, 97,108, 32,
- 114,101,116, 32, 61, 32,123,110, 61, 48,125, 10, 10, 9,102,
- 117,110, 99,116,105,111,110, 32, 97,100,100, 95,116,111,107,
- 101,110, 40,111,102,115, 41, 10, 10, 9, 9,108,111, 99, 97,
- 108, 32,116, 32, 61, 32,115,116,114,105,110,103, 46,115,117,
- 98, 40,115, 44, 32,116,111,107,101,110, 95, 98,101,103,105,
- 110, 44, 32,111,102,115, 41, 10, 9, 9,116, 32, 61, 32,115,
- 116,114,105,110,103, 46,103,115,117, 98, 40,116, 44, 32, 34,
- 94, 37,115, 42, 34, 44, 32, 34, 34, 41, 10, 9, 9,116, 32,
- 61, 32,115,116,114,105,110,103, 46,103,115,117, 98, 40,116,
- 44, 32, 34, 37,115, 42, 36, 34, 44, 32, 34, 34, 41, 10, 9,
- 9,114,101,116, 46,110, 32, 61, 32,114,101,116, 46,110, 32,
- 43, 32, 49, 10, 9, 9,114,101,116, 91,114,101,116, 46,110,
- 93, 32, 61, 32,116, 10, 9,101,110,100, 10, 10, 9,119,104,
- 105,108,101, 32,111,102,115, 32, 60, 61, 32,115,116,114,105,
- 110,103, 46,108,101,110, 40,115, 41, 32,100,111, 10, 10, 9,
- 9,108,111, 99, 97,108, 32,115,117, 98, 32, 61, 32,115,116,
- 114,105,110,103, 46,115,117, 98, 40,115, 44, 32,111,102,115,
- 44, 32, 45, 49, 41, 10, 9, 9,108,111, 99, 97,108, 32, 98,
- 44,101, 32, 61, 32,115,116,114,105,110,103, 46,102,105,110,
- 100, 40,115,117, 98, 44, 32, 34, 94, 34, 46, 46,112, 97,116,
- 41, 10, 9, 9,105,102, 32, 98, 32,116,104,101,110, 10, 9,
- 9, 9, 97,100,100, 95,116,111,107,101,110, 40,111,102,115,
- 45, 49, 41, 10, 9, 9, 9,111,102,115, 32, 61, 32,111,102,
- 115, 43,101, 10, 9, 9, 9,116,111,107,101,110, 95, 98,101,
- 103,105,110, 32, 61, 32,111,102,115, 10, 9, 9,101,108,115,
- 101, 10, 9, 9, 9,108,111, 99, 97,108, 32, 99,104, 97,114,
- 32, 61, 32,115,116,114,105,110,103, 46,115,117, 98, 40,115,
- 44, 32,111,102,115, 44, 32,111,102,115, 41, 10, 9, 9, 9,
- 105,102, 32, 99,104, 97,114, 32, 61, 61, 32, 34, 40, 34, 32,
- 111,114, 32, 99,104, 97,114, 32, 61, 61, 32, 34, 60, 34, 32,
- 116,104,101,110, 10, 10, 9, 9, 9, 9,108,111, 99, 97,108,
- 32, 98,108,111, 99,107, 10, 9, 9, 9, 9,105,102, 32, 99,
- 104, 97,114, 32, 61, 61, 32, 34, 40, 34, 32,116,104,101,110,
- 32, 98,108,111, 99,107, 32, 61, 32, 34, 94, 37, 98, 40, 41,
- 34, 32,101,110,100, 10, 9, 9, 9, 9,105,102, 32, 99,104,
- 97,114, 32, 61, 61, 32, 34, 60, 34, 32,116,104,101,110, 32,
- 98,108,111, 99,107, 32, 61, 32, 34, 94, 37, 98, 60, 62, 34,
- 32,101,110,100, 10, 10, 9, 9, 9, 9, 98, 44,101, 32, 61,
- 32,115,116,114,105,110,103, 46,102,105,110,100, 40,115,117,
- 98, 44, 32, 98,108,111, 99,107, 41, 10, 9, 9, 9, 9,105,
- 102, 32,110,111,116, 32, 98, 32,116,104,101,110, 10, 9, 9,
- 9, 9, 9, 45, 45, 32,117,110,116,101,114,109,105,110, 97,
- 116,101,100, 32, 98,108,111, 99,107, 63, 10, 9, 9, 9, 9,
- 9,111,102,115, 32, 61, 32,111,102,115, 43, 49, 10, 9, 9,
- 9, 9,101,108,115,101, 10, 9, 9, 9, 9, 9,111,102,115,
- 32, 61, 32,111,102,115, 32, 43, 32,101, 10, 9, 9, 9, 9,
- 101,110,100, 10, 10, 9, 9, 9,101,108,115,101, 10, 9, 9,
- 9, 9,111,102,115, 32, 61, 32,111,102,115, 43, 49, 10, 9,
- 9, 9,101,110,100, 10, 9, 9,101,110,100, 10, 10, 9,101,
- 110,100, 10, 9, 97,100,100, 95,116,111,107,101,110, 40,111,
- 102,115, 41, 10, 9, 45, 45,105,102, 32,114,101,116, 46,110,
- 32, 61, 61, 32, 48, 32,116,104,101,110, 10, 10, 9, 45, 45,
- 9,114,101,116, 46,110, 61, 49, 10, 9, 45, 45, 9,114,101,
- 116, 91, 49, 93, 32, 61, 32, 34, 34, 10, 9, 45, 45,101,110,
- 100, 10, 10, 9,114,101,116,117,114,110, 32,114,101,116, 10,
- 10,101,110,100, 10, 10, 45, 45, 32, 99,111,110, 99, 97,116,
- 101,110, 97,116,101, 32,115,116,114,105,110,103,115, 32,111,
- 102, 32, 97, 32,116, 97, 98,108,101, 10,102,117,110, 99,116,
- 105,111,110, 32, 99,111,110, 99, 97,116, 32, 40,116, 44,102,
- 44,108, 44,106,115,116,114, 41, 10, 9,106,115,116,114, 32,
- 61, 32,106,115,116,114, 32,111,114, 32, 34, 32, 34, 10, 32,
- 108,111, 99, 97,108, 32,115, 32, 61, 32, 39, 39, 10, 32,108,
- 111, 99, 97,108, 32,105, 61,102, 10, 32,119,104,105,108,101,
- 32,105, 60, 61,108, 32,100,111, 10, 32, 32,115, 32, 61, 32,
- 115, 46, 46,116, 91,105, 93, 10, 32, 32,105, 32, 61, 32,105,
- 43, 49, 10, 32, 32,105,102, 32,105, 32, 60, 61, 32,108, 32,
- 116,104,101,110, 32,115, 32, 61, 32,115, 46, 46,106,115,116,
- 114, 32,101,110,100, 10, 32,101,110,100, 10, 32,114,101,116,
- 117,114,110, 32,115, 10,101,110,100, 10, 10, 45, 45, 32, 99,
- 111,110, 99, 97,116,101,110, 97,116,101, 32, 97,108,108, 32,
- 112, 97,114, 97,109,101,116,101,114,115, 44, 32,102,111,108,
- 108,111,119,105,110,103, 32,111,117,116,112,117,116, 32,114,
- 117,108,101,115, 10,102,117,110, 99,116,105,111,110, 32, 99,
- 111,110, 99, 97,116,112, 97,114, 97,109, 32, 40,108,105,110,
- 101, 44, 32, 46, 46, 46, 41, 10, 32,108,111, 99, 97,108, 32,
- 105, 61, 49, 10, 32,119,104,105,108,101, 32,105, 60, 61, 97,
- 114,103, 46,110, 32,100,111, 10, 32, 32,105,102, 32, 95, 99,
- 111,110,116, 32, 97,110,100, 32,110,111,116, 32,115,116,114,
- 102,105,110,100, 40, 95, 99,111,110,116, 44, 39, 91, 37, 40,
- 44, 34, 93, 39, 41, 32, 97,110,100, 10, 32, 32, 32, 32, 32,
- 115,116,114,102,105,110,100, 40, 97,114,103, 91,105, 93, 44,
- 34, 94, 91, 37, 97, 95,126, 93, 34, 41, 32,116,104,101,110,
- 10, 9, 32, 32, 32, 32,108,105,110,101, 32, 61, 32,108,105,
- 110,101, 32, 46, 46, 32, 39, 32, 39, 10, 32, 32,101,110,100,
- 10, 32, 32,108,105,110,101, 32, 61, 32,108,105,110,101, 32,
- 46, 46, 32, 97,114,103, 91,105, 93, 10, 32, 32,105,102, 32,
- 97,114,103, 91,105, 93, 32,126, 61, 32, 39, 39, 32,116,104,
- 101,110, 10, 32, 32, 32, 95, 99,111,110,116, 32, 61, 32,115,
- 116,114,115,117, 98, 40, 97,114,103, 91,105, 93, 44, 45, 49,
- 44, 45, 49, 41, 10, 32, 32,101,110,100, 10, 32, 32,105, 32,
- 61, 32,105, 43, 49, 10, 32,101,110,100, 10, 32,105,102, 32,
- 115,116,114,102,105,110,100, 40, 97,114,103, 91, 97,114,103,
- 46,110, 93, 44, 34, 91, 37, 47, 37, 41, 37, 59, 37,123, 37,
- 125, 93, 36, 34, 41, 32,116,104,101,110, 10, 32, 32, 95, 99,
- 111,110,116, 61,110,105,108, 32,108,105,110,101, 32, 61, 32,
- 108,105,110,101, 32, 46, 46, 32, 39, 92,110, 39, 10, 32,101,
- 110,100, 10, 9,114,101,116,117,114,110, 32,108,105,110,101,
- 10,101,110,100, 10, 10, 45, 45, 32,111,117,116,112,117,116,
- 32,108,105,110,101, 10,102,117,110, 99,116,105,111,110, 32,
- 111,117,116,112,117,116, 32, 40, 46, 46, 46, 41, 10, 32,108,
- 111, 99, 97,108, 32,105, 61, 49, 10, 32,119,104,105,108,101,
- 32,105, 60, 61, 97,114,103, 46,110, 32,100,111, 10, 32, 32,
- 105,102, 32, 95, 99,111,110,116, 32, 97,110,100, 32,110,111,
- 116, 32,115,116,114,102,105,110,100, 40, 95, 99,111,110,116,
- 44, 39, 91, 37, 40, 44, 34, 93, 39, 41, 32, 97,110,100, 10,
- 32, 32, 32, 32, 32,115,116,114,102,105,110,100, 40, 97,114,
- 103, 91,105, 93, 44, 34, 94, 91, 37, 97, 95,126, 93, 34, 41,
- 32,116,104,101,110, 10, 9, 32, 32, 32, 32,119,114,105,116,
- 101, 40, 39, 32, 39, 41, 10, 32, 32,101,110,100, 10, 32, 32,
- 119,114,105,116,101, 40, 97,114,103, 91,105, 93, 41, 10, 32,
- 32,105,102, 32, 97,114,103, 91,105, 93, 32,126, 61, 32, 39,
- 39, 32,116,104,101,110, 10, 32, 32, 32, 95, 99,111,110,116,
- 32, 61, 32,115,116,114,115,117, 98, 40, 97,114,103, 91,105,
- 93, 44, 45, 49, 44, 45, 49, 41, 10, 32, 32,101,110,100, 10,
- 32, 32,105, 32, 61, 32,105, 43, 49, 10, 32,101,110,100, 10,
- 32,105,102, 32,115,116,114,102,105,110,100, 40, 97,114,103,
- 91, 97,114,103, 46,110, 93, 44, 34, 91, 37, 47, 37, 41, 37,
- 59, 37,123, 37,125, 93, 36, 34, 41, 32,116,104,101,110, 10,
- 32, 32, 95, 99,111,110,116, 61,110,105,108, 32,119,114,105,
- 116,101, 40, 39, 92,110, 39, 41, 10, 32,101,110,100, 10,101,
- 110,100, 10, 10,102,117,110, 99,116,105,111,110, 32,103,101,
- 116, 95,112,114,111,112,101,114,116,121, 95,109,101,116,104,
- 111,100,115, 40,112,116,121,112,101, 44, 32,110, 97,109,101,
- 41, 10, 10, 9,105,102, 32,103,101,116, 95,112,114,111,112,
- 101,114,116,121, 95,109,101,116,104,111,100,115, 95,104,111,
- 111,107, 32, 97,110,100, 32,103,101,116, 95,112,114,111,112,
- 101,114,116,121, 95,109,101,116,104,111,100,115, 95,104,111,
- 111,107, 40,112,116,121,112,101, 44,110, 97,109,101, 41, 32,
- 116,104,101,110, 10, 9, 9,114,101,116,117,114,110, 32,103,
- 101,116, 95,112,114,111,112,101,114,116,121, 95,109,101,116,
- 104,111,100,115, 95,104,111,111,107, 40,112,116,121,112,101,
- 44, 32,110, 97,109,101, 41, 10, 9,101,110,100, 10, 10, 9,
- 105,102, 32,112,116,121,112,101, 32, 61, 61, 32, 34,100,101,
- 102, 97,117,108,116, 34, 32,116,104,101,110, 32, 45, 45, 32,
- 103,101,116, 95,110, 97,109,101, 44, 32,115,101,116, 95,110,
- 97,109,101, 10, 9, 9,114,101,116,117,114,110, 32, 34,103,
- 101,116, 95, 34, 46, 46,110, 97,109,101, 44, 32, 34,115,101,
- 116, 95, 34, 46, 46,110, 97,109,101, 10, 9,101,110,100, 10,
- 10, 9,105,102, 32,112,116,121,112,101, 32, 61, 61, 32, 34,
- 113,116, 34, 32,116,104,101,110, 32, 45, 45, 32,110, 97,109,
- 101, 44, 32,115,101,116, 78, 97,109,101, 10, 9, 9,114,101,
- 116,117,114,110, 32,110, 97,109,101, 44, 32, 34,115,101,116,
- 34, 46, 46,115,116,114,105,110,103, 46,117,112,112,101,114,
- 40,115,116,114,105,110,103, 46,115,117, 98, 40,110, 97,109,
- 101, 44, 32, 49, 44, 32, 49, 41, 41, 46, 46,115,116,114,105,
- 110,103, 46,115,117, 98, 40,110, 97,109,101, 44, 32, 50, 44,
- 32, 45, 49, 41, 10, 9,101,110,100, 10, 10, 9,105,102, 32,
- 112,116,121,112,101, 32, 61, 61, 32, 34,111,118,101,114,108,
- 111, 97,100, 34, 32,116,104,101,110, 32, 45, 45, 32,110, 97,
- 109,101, 44, 32,110, 97,109,101, 10, 9, 9,114,101,116,117,
- 114,110, 32,110, 97,109,101, 44,110, 97,109,101, 10, 9,101,
- 110,100, 10, 10, 9,114,101,116,117,114,110, 32,110,105,108,
- 10,101,110,100, 10, 10, 45, 45, 45, 45, 45, 45, 45, 45, 45,
- 45, 45, 45, 45, 45, 32,116,104,101, 32,104,111,111,107,115,
- 10, 10, 45, 45, 32, 99, 97,108,108,101,100, 32,114,105,103,
- 104,116, 32, 97,102,116,101,114, 32,112,114,111, 99,101,115,
- 115,105,110,103, 32,116,104,101, 32, 36, 91,105, 99,104,108,
- 93,102,105,108,101, 32,100,105,114,101, 99,116,105,118,101,
- 115, 44, 10, 45, 45, 32,114,105,103,104,116, 32, 98,101,102,
- 111,114,101, 32,112,114,111, 99,101,115,115,105,110,103, 32,
- 97,110,121,116,104,105,110,103, 32,101,108,115,101, 10, 45,
- 45, 32,116, 97,107,101,115, 32,116,104,101, 32,112, 97, 99,
- 107, 97,103,101, 32,111, 98,106,101, 99,116, 32, 97,115, 32,
- 116,104,101, 32,112, 97,114, 97,109,101,116,101,114, 10,102,
- 117,110, 99,116,105,111,110, 32,112,114,101,112,114,111, 99,
- 101,115,115, 95,104,111,111,107, 40,112, 41, 10, 9, 45, 45,
- 32,112, 46, 99,111,100,101, 32,104, 97,115, 32, 97,108,108,
- 32,116,104,101, 32,105,110,112,117,116, 32, 99,111,100,101,
- 32,102,114,111,109, 32,116,104,101, 32,112,107,103, 10,101,
- 110,100, 10, 10, 10, 45, 45, 32, 99, 97,108,108,101,100, 32,
- 102,111,114, 32,101,118,101,114,121, 32, 36,105,102,105,108,
- 101, 32,100,105,114,101, 99,116,105,118,101, 10, 45, 45, 32,
- 116, 97,107,101,115, 32, 97, 32,116, 97, 98,108,101, 32,119,
- 105,116,104, 32, 97, 32,115,116,114,105,110,103, 32, 99, 97,
- 108,108,101,100, 32, 39, 99,111,100,101, 39, 32,105,110,115,
- 105,100,101, 44, 32,116,104,101, 32,102,105,108,101,110, 97,
- 109,101, 44, 32, 97,110,100, 32, 97,110,121, 32,101,120,116,
- 114, 97, 32, 97,114,103,117,109,101,110,116,115, 10, 45, 45,
- 32,112, 97,115,115,101,100, 32,116,111, 32, 36,105,102,105,
- 108,101, 46, 32,110,111, 32,114,101,116,117,114,110, 32,118,
- 97,108,117,101, 10,102,117,110, 99,116,105,111,110, 32,105,
- 110, 99,108,117,100,101, 95,102,105,108,101, 95,104,111,111,
- 107, 40,116, 44, 32,102,105,108,101,110, 97,109,101, 44, 32,
- 46, 46, 46, 41, 10, 10,101,110,100, 10, 10, 45, 45, 32, 99,
- 97,108,108,101,100, 32, 97,102,116,101,114, 32,112,114,111,
- 99,101,115,115,105,110,103, 32, 97,110,121,116,104,105,110,
- 103, 32,116,104, 97,116, 39,115, 32,110,111,116, 32, 99,111,
- 100,101, 32, 40,108,105,107,101, 32, 39, 36,114,101,110, 97,
- 109,105,110,103, 39, 44, 32, 99,111,109,109,101,110,116,115,
- 44, 32,101,116, 99, 41, 10, 45, 45, 32, 97,110,100, 32,114,
- 105,103,104,116, 32, 98,101,102,111,114,101, 32,112, 97,114,
- 115,105,110,103, 32,116,104,101, 32, 97, 99,116,117, 97,108,
- 32, 99,111,100,101, 46, 10, 45, 45, 32,116, 97,107,101,115,
- 32,116,104,101, 32, 80, 97, 99,107, 97,103,101, 32,111, 98,
- 106,101, 99,116, 32,119,105,116,104, 32, 97,108,108, 32,116,
- 104,101, 32, 99,111,100,101, 32,111,110, 32,116,104,101, 32,
- 39, 99,111,100,101, 39, 32,107,101,121, 46, 32,110,111, 32,
- 114,101,116,117,114,110, 32,118, 97,108,117,101, 10,102,117,
- 110, 99,116,105,111,110, 32,112,114,101,112, 97,114,115,101,
- 95,104,111,111,107, 40,112, 97, 99,107, 97,103,101, 41, 10,
- 10,101,110,100, 10, 10, 45, 45, 32, 99, 97,108,108,101,100,
- 32, 98,101,102,111,114,101, 32,115,116, 97,114,116,105,110,
- 103, 32,111,117,116,112,117,116, 10,102,117,110, 99,116,105,
- 111,110, 32,112,114,101, 95,111,117,116,112,117,116, 95,104,
- 111,111,107, 40,112, 97, 99,107, 97,103,101, 41, 10, 10,101,
- 110,100, 10, 10, 45, 45, 32, 99, 97,108,108,101,100, 32, 97,
- 102,116,101,114, 32,119,114,105,116,105,110,103, 32, 97,108,
- 108, 32,116,104,101, 32,111,117,116,112,117,116, 46, 10, 45,
- 45, 32,116, 97,107,101,115, 32,116,104,101, 32, 80, 97, 99,
- 107, 97,103,101, 32,111, 98,106,101, 99,116, 10,102,117,110,
- 99,116,105,111,110, 32,112,111,115,116, 95,111,117,116,112,
- 117,116, 95,104,111,111,107, 40,112, 97, 99,107, 97,103,101,
- 41, 10, 10,101,110,100, 10, 10, 10, 45, 45, 32, 99, 97,108,
- 108,101,100, 32,102,114,111,109, 32, 39,103,101,116, 95,112,
- 114,111,112,101,114,116,121, 95,109,101,116,104,111,100,115,
- 39, 32,116,111, 32,103,101,116, 32,116,104,101, 32,109,101,
- 116,104,111,100,115, 32,116,111, 32,114,101,116,114,105,101,
- 118,101, 32, 97, 32,112,114,111,112,101,114,116,121, 10, 45,
- 45, 32, 97, 99, 99,111,114,100,105,110,103, 32,116,111, 32,
- 105,116,115, 32,116,121,112,101, 10,102,117,110, 99,116,105,
- 111,110, 32,103,101,116, 95,112,114,111,112,101,114,116,121,
- 95,109,101,116,104,111,100,115, 95,104,111,111,107, 40,112,
- 114,111,112,101,114,116,121, 95,116,121,112,101, 44, 32,110,
- 97,109,101, 41, 10, 10,101,110,100, 10, 10, 45, 45, 32, 99,
- 97,108,108,101,100, 32,102,114,111,109, 32, 67,108, 97,115,
- 115, 67,111,110,116, 97,105,110,101,114, 58,100,111,112, 97,
- 114,115,101, 32,119,105,116,104, 32,116,104,101, 32,115,116,
- 114,105,110,103, 32, 98,101,105,110,103, 32,112, 97,114,115,
- 101,100, 10, 45, 45, 32,114,101,116,117,114,110, 32,110,105,
- 108, 44, 32,111,114, 32, 97, 32,115,117, 98,115,116,114,105,
- 110,103, 10,102,117,110, 99,116,105,111,110, 32,112, 97,114,
- 115,101,114, 95,104,111,111,107, 40,115, 41, 10, 10, 9,114,
- 101,116,117,114,110, 32,110,105,108, 10,101,110,100, 10, 10,
- 45, 45, 32, 99, 97,108,108,101,100, 32,102,114,111,109, 32,
- 99,108, 97,115,115, 70,117,110, 99,116,105,111,110, 58,115,
- 117,112, 99,111,100,101, 44, 32, 98,101,102,111,114,101, 32,
- 116,104,101, 32, 99, 97,108,108, 32,116,111, 32,116,104,101,
- 32,102,117,110, 99,116,105,111,110, 32,105,115, 32,111,117,
- 116,112,117,116, 10,102,117,110, 99,116,105,111,110, 32,112,
- 114,101, 95, 99, 97,108,108, 95,104,111,111,107, 40,102, 41,
- 10, 10,101,110,100, 10, 10, 45, 45, 32, 99, 97,108,108,101,
- 100, 32,102,114,111,109, 32, 99,108, 97,115,115, 70,117,110,
- 99,116,105,111,110, 58,115,117,112, 99,111,100,101, 44, 32,
- 97,102,116,101,114, 32,116,104,101, 32, 99, 97,108,108, 32,
- 116,111, 32,116,104,101, 32,102,117,110, 99,116,105,111,110,
- 32,105,115, 32,111,117,116,112,117,116, 10,102,117,110, 99,
- 116,105,111,110, 32,112,111,115,116, 95, 99, 97,108,108, 95,
- 104,111,111,107, 40,102, 41, 10, 10,101,110,100, 10, 10, 45,
- 45, 32, 99, 97,108,108,101,100, 32, 98,101,102,111,114,101,
- 32,116,104,101, 32,114,101,103,105,115,116,101,114, 32, 99,
- 111,100,101, 32,105,115, 32,111,117,116,112,117,116, 10,102,
- 117,110, 99,116,105,111,110, 32,112,114,101, 95,114,101,103,
- 105,115,116,101,114, 95,104,111,111,107, 40,112, 97, 99,107,
- 97,103,101, 41, 10, 10,101,110,100, 10, 10, 45, 45, 32, 99,
- 97,108,108,101,100, 32,116,111, 32,111,117,116,112,117,116,
- 32, 97,110, 32,101,114,114,111,114, 32,109,101,115,115, 97,
- 103,101, 10,102,117,110, 99,116,105,111,110, 32,111,117,116,
- 112,117,116, 95,101,114,114,111,114, 95,104,111,111,107, 40,
- 46, 46, 46, 41, 10, 9,114,101,116,117,114,110, 32,115,116,
- 114,105,110,103, 46,102,111,114,109, 97,116, 40, 46, 46, 46,
- 41, 10,101,110,100, 10, 10, 45, 45, 32, 99,117,115,116,111,
- 109, 32,112,117,115,104,101,114,115, 10, 10, 95,112,117,115,
- 104, 95,102,117,110, 99,116,105,111,110,115, 32, 61, 32,123,
- 125, 10, 95,105,115, 95,102,117,110, 99,116,105,111,110,115,
- 32, 61, 32,123,125, 10, 95,116,111, 95,102,117,110, 99,116,
- 105,111,110,115, 32, 61, 32,123,125, 10, 10, 95, 98, 97,115,
- 101, 95,112,117,115,104, 95,102,117,110, 99,116,105,111,110,
- 115, 32, 61, 32,123,125, 10, 95, 98, 97,115,101, 95,105,115,
- 95,102,117,110, 99,116,105,111,110,115, 32, 61, 32,123,125,
- 10, 95, 98, 97,115,101, 95,116,111, 95,102,117,110, 99,116,
- 105,111,110,115, 32, 61, 32,123,125, 10, 10,108,111, 99, 97,
- 108, 32,102,117,110, 99,116,105,111,110, 32,115,101, 97,114,
- 99,104, 95, 98, 97,115,101, 40,116, 44, 32,102,117,110, 99,
- 115, 41, 10, 10, 9,108,111, 99, 97,108, 32, 99,108, 97,115,
- 115, 32, 61, 32, 95,103,108,111, 98, 97,108, 95, 99,108, 97,
- 115,115,101,115, 91,116, 93, 10, 10, 9,119,104,105,108,101,
- 32, 99,108, 97,115,115, 32,100,111, 10, 9, 9,105,102, 32,
- 102,117,110, 99,115, 91, 99,108, 97,115,115, 46,116,121,112,
- 101, 93, 32,116,104,101,110, 10, 9, 9, 9,114,101,116,117,
- 114,110, 32,102,117,110, 99,115, 91, 99,108, 97,115,115, 46,
- 116,121,112,101, 93, 10, 9, 9,101,110,100, 10, 9, 9, 99,
- 108, 97,115,115, 32, 61, 32, 95,103,108,111, 98, 97,108, 95,
- 99,108, 97,115,115,101,115, 91, 99,108, 97,115,115, 46, 98,
- 116,121,112,101, 93, 10, 9,101,110,100, 10, 9,114,101,116,
- 117,114,110, 32,110,105,108, 10,101,110,100, 10, 10,102,117,
- 110, 99,116,105,111,110, 32,103,101,116, 95,112,117,115,104,
- 95,102,117,110, 99,116,105,111,110, 40,116, 41, 10, 9,114,
- 101,116,117,114,110, 32, 95,112,117,115,104, 95,102,117,110,
- 99,116,105,111,110,115, 91,116, 93, 32,111,114, 32,115,101,
- 97,114, 99,104, 95, 98, 97,115,101, 40,116, 44, 32, 95, 98,
- 97,115,101, 95,112,117,115,104, 95,102,117,110, 99,116,105,
- 111,110,115, 41, 32,111,114, 32, 34,116,111,108,117, 97, 95,
- 112,117,115,104,117,115,101,114,116,121,112,101, 34, 10,101,
- 110,100, 10, 10,102,117,110, 99,116,105,111,110, 32,103,101,
- 116, 95,116,111, 95,102,117,110, 99,116,105,111,110, 40,116,
- 41, 10, 9,114,101,116,117,114,110, 32, 95,116,111, 95,102,
- 117,110, 99,116,105,111,110,115, 91,116, 93, 32,111,114, 32,
- 115,101, 97,114, 99,104, 95, 98, 97,115,101, 40,116, 44, 32,
- 95, 98, 97,115,101, 95,116,111, 95,102,117,110, 99,116,105,
- 111,110,115, 41, 32,111,114, 32, 34,116,111,108,117, 97, 95,
- 116,111,117,115,101,114,116,121,112,101, 34, 10,101,110,100,
- 10, 10,102,117,110, 99,116,105,111,110, 32,103,101,116, 95,
- 105,115, 95,102,117,110, 99,116,105,111,110, 40,116, 41, 10,
- 9,114,101,116,117,114,110, 32, 95,105,115, 95,102,117,110,
- 99,116,105,111,110,115, 91,116, 93, 32,111,114, 32,115,101,
- 97,114, 99,104, 95, 98, 97,115,101, 40,116, 44, 32, 95, 98,
- 97,115,101, 95,105,115, 95,102,117,110, 99,116,105,111,110,
- 115, 41, 32,111,114, 32, 34,116,111,108,117, 97, 95,105,115,
- 117,115,101,114,116,121,112,101, 34, 10,101,110,100,32
- };
- tolua_dobuffer(tolua_S,(char*)B,sizeof(B),"tolua embedded: src/bin/lua/basic.lua");
+ #include "basic_lua.h"
+ tolua_dobuffer(tolua_S,(char*)lua_basic_lua,sizeof(lua_basic_lua),"tolua embedded: src/bin/lua/basic.lua");
lua_settop(tolua_S, top);
} /* end of embedded lua code */
@@ -3788,1191 +3193,19 @@ TOLUA_API int tolua_tolua_open (lua_State* tolua_S)
} /* end of embedded lua code */
+
{ /* begin embedded lua code */
int top = lua_gettop(tolua_S);
- static unsigned char B[] = {
- 45, 45, 32,116,111,108,117, 97, 58, 32,101,110,117,109,101,
- 114, 97,116,101, 32, 99,108, 97,115,115, 10, 45, 45, 32, 87,
- 114,105,116,116,101,110, 32, 98,121, 32, 87, 97,108,100,101,
- 109, 97,114, 32, 67,101,108,101,115, 10, 45, 45, 32, 84,101,
- 67, 71,114, 97,102, 47, 80, 85, 67, 45, 82,105,111, 10, 45,
- 45, 32, 74,117,108, 32, 49, 57, 57, 56, 10, 45, 45, 32, 36,
- 73,100, 58, 32,101,110,117,109,101,114, 97,116,101, 46,108,
- 117, 97, 44,118, 32, 49, 46, 51, 32, 50, 48, 48, 48, 47, 48,
- 49, 47, 50, 52, 32, 50, 48, 58, 52, 49, 58, 49, 53, 32, 99,
- 101,108,101,115, 32, 69,120,112, 32, 36, 10, 10, 45, 45, 32,
- 84,104,105,115, 32, 99,111,100,101, 32,105,115, 32,102,114,
- 101,101, 32,115,111,102,116,119, 97,114,101, 59, 32,121,111,
- 117, 32, 99, 97,110, 32,114,101,100,105,115,116,114,105, 98,
- 117,116,101, 32,105,116, 32, 97,110,100, 47,111,114, 32,109,
- 111,100,105,102,121, 32,105,116, 46, 10, 45, 45, 32, 84,104,
- 101, 32,115,111,102,116,119, 97,114,101, 32,112,114,111,118,
- 105,100,101,100, 32,104,101,114,101,117,110,100,101,114, 32,
- 105,115, 32,111,110, 32, 97,110, 32, 34, 97,115, 32,105,115,
- 34, 32, 98, 97,115,105,115, 44, 32, 97,110,100, 10, 45, 45,
- 32,116,104,101, 32, 97,117,116,104,111,114, 32,104, 97,115,
- 32,110,111, 32,111, 98,108,105,103, 97,116,105,111,110, 32,
- 116,111, 32,112,114,111,118,105,100,101, 32,109, 97,105,110,
- 116,101,110, 97,110, 99,101, 44, 32,115,117,112,112,111,114,
- 116, 44, 32,117,112,100, 97,116,101,115, 44, 10, 45, 45, 32,
- 101,110,104, 97,110, 99,101,109,101,110,116,115, 44, 32,111,
- 114, 32,109,111,100,105,102,105, 99, 97,116,105,111,110,115,
- 46, 10, 10, 10, 45, 45, 32, 69,110,117,109,101,114, 97,116,
- 101, 32, 99,108, 97,115,115, 10, 45, 45, 32, 82,101,112,114,
- 101,115,101,110,116,115, 32,101,110,117,109,101,114, 97,116,
- 105,111,110, 10, 45, 45, 32, 84,104,101, 32,102,111,108,108,
- 111,119,105,110,103, 32,102,105,101,108,100,115, 32, 97,114,
- 101, 32,115,116,111,114,101,100, 58, 10, 45, 45, 32, 32, 32,
- 32,123,105,125, 32, 61, 32,108,105,115,116, 32,111,102, 32,
- 99,111,110,115,116, 97,110,116, 32,110, 97,109,101,115, 10,
- 99,108, 97,115,115, 69,110,117,109,101,114, 97,116,101, 32,
- 61, 32,123, 10,125, 10, 99,108, 97,115,115, 69,110,117,109,
- 101,114, 97,116,101, 46, 95, 95,105,110,100,101,120, 32, 61,
- 32, 99,108, 97,115,115, 69,110,117,109,101,114, 97,116,101,
- 10,115,101,116,109,101,116, 97,116, 97, 98,108,101, 40, 99,
- 108, 97,115,115, 69,110,117,109,101,114, 97,116,101, 44, 99,
- 108, 97,115,115, 70,101, 97,116,117,114,101, 41, 10, 10, 45,
- 45, 32,114,101,103,105,115,116,101,114, 32,101,110,117,109,
- 101,114, 97,116,105,111,110, 10,102,117,110, 99,116,105,111,
- 110, 32, 99,108, 97,115,115, 69,110,117,109,101,114, 97,116,
- 101, 58,114,101,103,105,115,116,101,114, 32, 40,112,114,101,
- 41, 10, 9,105,102, 32,110,111,116, 32,115,101,108,102, 58,
- 99,104,101, 99,107, 95,112,117, 98,108,105, 99, 95, 97, 99,
- 99,101,115,115, 40, 41, 32,116,104,101,110, 10, 9, 9,114,
- 101,116,117,114,110, 10, 9,101,110,100, 10, 32,112,114,101,
- 32, 61, 32,112,114,101, 32,111,114, 32, 39, 39, 10, 32,108,
- 111, 99, 97,108, 32,110,115,112, 97, 99,101, 32, 61, 32,103,
- 101,116,110, 97,109,101,115,112, 97, 99,101, 40, 99,108, 97,
- 115,115, 67,111,110,116, 97,105,110,101,114, 46, 99,117,114,
- 114, 41, 10, 32,108,111, 99, 97,108, 32,105, 61, 49, 10, 32,
- 119,104,105,108,101, 32,115,101,108,102, 91,105, 93, 32,100,
- 111, 10, 32, 9,105,102, 32,115,101,108,102, 46,108,110, 97,
- 109,101,115, 91,105, 93, 32, 97,110,100, 32,115,101,108,102,
- 46,108,110, 97,109,101,115, 91,105, 93, 32,126, 61, 32, 34,
- 34, 32,116,104,101,110, 10, 9, 10, 9, 9,111,117,116,112,
- 117,116, 40,112,114,101, 46, 46, 39,116,111,108,117, 97, 95,
- 99,111,110,115,116, 97,110,116, 40,116,111,108,117, 97, 95,
- 83, 44, 34, 39, 46, 46,115,101,108,102, 46,108,110, 97,109,
- 101,115, 91,105, 93, 46, 46, 39, 34, 44, 39, 46, 46,110,115,
- 112, 97, 99,101, 46, 46,115,101,108,102, 91,105, 93, 46, 46,
- 39, 41, 59, 39, 41, 10, 9,101,110,100, 10, 32, 32,105, 32,
- 61, 32,105, 43, 49, 10, 32,101,110,100, 10,101,110,100, 10,
- 10, 45, 45, 32, 80,114,105,110,116, 32,109,101,116,104,111,
- 100, 10,102,117,110, 99,116,105,111,110, 32, 99,108, 97,115,
- 115, 69,110,117,109,101,114, 97,116,101, 58,112,114,105,110,
- 116, 32, 40,105,100,101,110,116, 44, 99,108,111,115,101, 41,
- 10, 32,112,114,105,110,116, 40,105,100,101,110,116, 46, 46,
- 34, 69,110,117,109,101,114, 97,116,101,123, 34, 41, 10, 32,
- 112,114,105,110,116, 40,105,100,101,110,116, 46, 46, 34, 32,
- 110, 97,109,101, 32, 61, 32, 34, 46, 46,115,101,108,102, 46,
- 110, 97,109,101, 41, 10, 32,108,111, 99, 97,108, 32,105, 61,
- 49, 10, 32,119,104,105,108,101, 32,115,101,108,102, 91,105,
- 93, 32,100,111, 10, 32, 32,112,114,105,110,116, 40,105,100,
- 101,110,116, 46, 46, 34, 32, 39, 34, 46, 46,115,101,108,102,
- 91,105, 93, 46, 46, 34, 39, 40, 34, 46, 46,115,101,108,102,
- 46,108,110, 97,109,101,115, 91,105, 93, 46, 46, 34, 41, 44,
- 34, 41, 10, 32, 32,105, 32, 61, 32,105, 43, 49, 10, 32,101,
- 110,100, 10, 32,112,114,105,110,116, 40,105,100,101,110,116,
- 46, 46, 34,125, 34, 46, 46, 99,108,111,115,101, 41, 10,101,
- 110,100, 10, 10, 45, 45, 32, 73,110,116,101,114,110, 97,108,
- 32, 99,111,110,115,116,114,117, 99,116,111,114, 10,102,117,
- 110, 99,116,105,111,110, 32, 95, 69,110,117,109,101,114, 97,
- 116,101, 32, 40,116, 44,118, 97,114,110, 97,109,101, 41, 10,
- 32,115,101,116,109,101,116, 97,116, 97, 98,108,101, 40,116,
- 44, 99,108, 97,115,115, 69,110,117,109,101,114, 97,116,101,
- 41, 10, 32, 97,112,112,101,110,100, 40,116, 41, 10, 32, 97,
- 112,112,101,110,100,101,110,117,109, 40,116, 41, 10, 9, 32,
- 105,102, 32,118, 97,114,110, 97,109,101, 32, 97,110,100, 32,
- 118, 97,114,110, 97,109,101, 32,126, 61, 32, 34, 34, 32,116,
- 104,101,110, 10, 9, 9,105,102, 32,116, 46,110, 97,109,101,
- 32,126, 61, 32, 34, 34, 32,116,104,101,110, 10, 9, 9, 9,
- 86, 97,114,105, 97, 98,108,101, 40,116, 46,110, 97,109,101,
- 46, 46, 34, 32, 34, 46, 46,118, 97,114,110, 97,109,101, 41,
- 10, 9, 9,101,108,115,101, 10, 9, 9, 9,108,111, 99, 97,
- 108, 32,110,115, 32, 61, 32,103,101,116, 99,117,114,114,110,
- 97,109,101,115,112, 97, 99,101, 40, 41, 10, 9, 9, 9,119,
- 97,114,110,105,110,103, 40, 34, 86, 97,114,105, 97, 98,108,
- 101, 32, 34, 46, 46,110,115, 46, 46,118, 97,114,110, 97,109,
- 101, 46, 46, 34, 32,111,102, 32,116,121,112,101, 32, 60, 97,
- 110,111,110,121,109,111,117,115, 32,101,110,117,109, 62, 32,
- 105,115, 32,100,101, 99,108, 97,114,101,100, 32, 97,115, 32,
- 114,101, 97,100, 45,111,110,108,121, 34, 41, 10, 9, 9, 9,
- 86, 97,114,105, 97, 98,108,101, 40, 34,116,111,108,117, 97,
- 95,114,101, 97,100,111,110,108,121, 32,105,110,116, 32, 34,
- 46, 46,118, 97,114,110, 97,109,101, 41, 10, 9, 9,101,110,
- 100, 10, 9,101,110,100, 10, 9, 32,108,111, 99, 97,108, 32,
- 112, 97,114,101,110,116, 32, 61, 32, 99,108, 97,115,115, 67,
- 111,110,116, 97,105,110,101,114, 46, 99,117,114,114, 10, 9,
- 32,105,102, 32,112, 97,114,101,110,116, 32,116,104,101,110,
- 10, 9, 9,116, 46, 97, 99, 99,101,115,115, 32, 61, 32,112,
- 97,114,101,110,116, 46, 99,117,114,114, 95,109,101,109, 98,
- 101,114, 95, 97, 99, 99,101,115,115, 10, 9, 9,116, 46,103,
- 108,111, 98, 97,108, 95, 97, 99, 99,101,115,115, 32, 61, 32,
- 116, 58, 99,104,101, 99,107, 95,112,117, 98,108,105, 99, 95,
- 97, 99, 99,101,115,115, 40, 41, 10, 9, 32,101,110,100, 10,
- 114,101,116,117,114,110, 32,116, 10,101,110,100, 10, 10, 45,
- 45, 32, 67,111,110,115,116,114,117, 99,116,111,114, 10, 45,
- 45, 32, 69,120,112,101, 99,116,115, 32, 97, 32,115,116,114,
- 105,110,103, 32,114,101,112,114,101,115,101,110,116,105,110,
- 103, 32,116,104,101, 32,101,110,117,109,101,114, 97,116,101,
- 32, 98,111,100,121, 10,102,117,110, 99,116,105,111,110, 32,
- 69,110,117,109,101,114, 97,116,101, 32, 40,110, 44, 98, 44,
- 118, 97,114,110, 97,109,101, 41, 10, 9, 98, 32, 61, 32,115,
- 116,114,105,110,103, 46,103,115,117, 98, 40, 98, 44, 32, 34,
- 44, 91, 37,115, 92,110, 93, 42,125, 34, 44, 32, 34, 92,110,
- 125, 34, 41, 32, 45, 45, 32,101,108,105,109,105,110, 97,116,
- 101, 32,108, 97,115,116, 32, 39, 44, 39, 10, 32,108,111, 99,
- 97,108, 32,116, 32, 61, 32,115,112,108,105,116, 40,115,116,
- 114,115,117, 98, 40, 98, 44, 50, 44, 45, 50, 41, 44, 39, 44,
- 39, 41, 32, 45, 45, 32,101,108,105,109,105,110, 97,116,101,
- 32, 98,114, 97, 99,101,115, 10, 32,108,111, 99, 97,108, 32,
- 105, 32, 61, 32, 49, 10, 32,108,111, 99, 97,108, 32,101, 32,
- 61, 32,123,110, 61, 48,125, 10, 32,119,104,105,108,101, 32,
- 116, 91,105, 93, 32,100,111, 10, 32, 32,108,111, 99, 97,108,
- 32,116,116, 32, 61, 32,115,112,108,105,116, 40,116, 91,105,
- 93, 44, 39, 61, 39, 41, 32, 32, 45, 45, 32,100,105,115, 99,
- 97,114,100, 32,105,110,105,116,105, 97,108, 32,118, 97,108,
- 117,101, 10, 32, 32,101, 46,110, 32, 61, 32,101, 46,110, 32,
- 43, 32, 49, 10, 32, 32,101, 91,101, 46,110, 93, 32, 61, 32,
- 116,116, 91, 49, 93, 10, 32, 32,105, 32, 61, 32,105, 43, 49,
- 10, 32,101,110,100, 10, 32, 45, 45, 32,115,101,116, 32,108,
- 117, 97, 32,110, 97,109,101,115, 10, 32,105, 32, 32, 61, 32,
- 49, 10, 32,101, 46,108,110, 97,109,101,115, 32, 61, 32,123,
- 125, 10, 32,108,111, 99, 97,108, 32,110,115, 32, 61, 32,103,
- 101,116, 99,117,114,114,110, 97,109,101,115,112, 97, 99,101,
- 40, 41, 10, 32,119,104,105,108,101, 32,101, 91,105, 93, 32,
- 100,111, 10, 32, 32,108,111, 99, 97,108, 32,116, 32, 61, 32,
- 115,112,108,105,116, 40,101, 91,105, 93, 44, 39, 64, 39, 41,
- 10, 32, 32,101, 91,105, 93, 32, 61, 32,116, 91, 49, 93, 10,
- 9, 9,105,102, 32,110,111,116, 32,116, 91, 50, 93, 32,116,
- 104,101,110, 10, 9, 9, 32,116, 91, 50, 93, 32, 61, 32, 97,
- 112,112,108,121,114,101,110, 97,109,105,110,103, 40,116, 91,
- 49, 93, 41, 10, 9, 9,101,110,100, 10, 32, 32,101, 46,108,
- 110, 97,109,101,115, 91,105, 93, 32, 61, 32,116, 91, 50, 93,
- 32,111,114, 32,116, 91, 49, 93, 10, 32, 32, 95,103,108,111,
- 98, 97,108, 95,101,110,117,109,115, 91, 32,110,115, 46, 46,
- 101, 91,105, 93, 32, 93, 32, 61, 32, 40,110,115, 46, 46,101,
- 91,105, 93, 41, 10, 32, 32,105, 32, 61, 32,105, 43, 49, 10,
- 32,101,110,100, 10, 9,101, 46,110, 97,109,101, 32, 61, 32,
- 110, 10, 9,105,102, 32,110, 32,126, 61, 32, 34, 34, 32,116,
- 104,101,110, 10, 9, 9, 84,121,112,101,100,101,102, 40, 34,
- 105,110,116, 32, 34, 46, 46,110, 41, 10, 9,101,110,100, 10,
- 32,114,101,116,117,114,110, 32, 95, 69,110,117,109,101,114,
- 97,116,101, 40,101, 44, 32,118, 97,114,110, 97,109,101, 41,
- 10,101,110,100,32
- };
- tolua_dobuffer(tolua_S,(char*)B,sizeof(B),"tolua embedded: src/bin/lua/enumerate.lua");
+ #include "enumerate_lua.h"
+ tolua_dobuffer(tolua_S,(char*)lua_enumerate_lua,sizeof(lua_enumerate_lua),"tolua embedded: src/bin/lua/enumerate.lua");
lua_settop(tolua_S, top);
} /* end of embedded lua code */
{ /* begin embedded lua code */
int top = lua_gettop(tolua_S);
- static unsigned char B[] = {
- 45, 45, 32,116,111,108,117, 97, 58, 32,100,101, 99,108, 97,
- 114, 97,116,105,111,110, 32, 99,108, 97,115,115, 10, 45, 45,
- 32, 87,114,105,116,116,101,110, 32, 98,121, 32, 87, 97,108,
- 100,101,109, 97,114, 32, 67,101,108,101,115, 10, 45, 45, 32,
- 84,101, 67, 71,114, 97,102, 47, 80, 85, 67, 45, 82,105,111,
- 10, 45, 45, 32, 74,117,108, 32, 49, 57, 57, 56, 10, 45, 45,
- 32, 36, 73,100, 58, 32, 36, 10, 10, 45, 45, 32, 84,104,105,
- 115, 32, 99,111,100,101, 32,105,115, 32,102,114,101,101, 32,
- 115,111,102,116,119, 97,114,101, 59, 32,121,111,117, 32, 99,
- 97,110, 32,114,101,100,105,115,116,114,105, 98,117,116,101,
- 32,105,116, 32, 97,110,100, 47,111,114, 32,109,111,100,105,
- 102,121, 32,105,116, 46, 10, 45, 45, 32, 84,104,101, 32,115,
- 111,102,116,119, 97,114,101, 32,112,114,111,118,105,100,101,
- 100, 32,104,101,114,101,117,110,100,101,114, 32,105,115, 32,
- 111,110, 32, 97,110, 32, 34, 97,115, 32,105,115, 34, 32, 98,
- 97,115,105,115, 44, 32, 97,110,100, 10, 45, 45, 32,116,104,
- 101, 32, 97,117,116,104,111,114, 32,104, 97,115, 32,110,111,
- 32,111, 98,108,105,103, 97,116,105,111,110, 32,116,111, 32,
- 112,114,111,118,105,100,101, 32,109, 97,105,110,116,101,110,
- 97,110, 99,101, 44, 32,115,117,112,112,111,114,116, 44, 32,
- 117,112,100, 97,116,101,115, 44, 10, 45, 45, 32,101,110,104,
- 97,110, 99,101,109,101,110,116,115, 44, 32,111,114, 32,109,
- 111,100,105,102,105, 99, 97,116,105,111,110,115, 46, 10, 10,
- 10, 45, 45, 32, 68,101, 99,108, 97,114, 97,116,105,111,110,
- 32, 99,108, 97,115,115, 10, 45, 45, 32, 82,101,112,114,101,
- 115,101,110,116,115, 32,118, 97,114,105, 97, 98,108,101, 44,
- 32,102,117,110, 99,116,105,111,110, 44, 32,111,114, 32, 97,
- 114,103,117,109,101,110,116, 32,100,101, 99,108, 97,114, 97,
- 116,105,111,110, 46, 10, 45, 45, 32, 83,116,111,114,101,115,
- 32,116,104,101, 32,102,111,108,108,111,119,105,110,103, 32,
- 102,105,101,108,100,115, 58, 10, 45, 45, 32, 32,109,111,100,
- 32, 32, 61, 32,116,121,112,101, 32,109,111,100,105,102,105,
- 101,114,115, 10, 45, 45, 32, 32,116,121,112,101, 32, 61, 32,
- 116,121,112,101, 10, 45, 45, 32, 32,112,116,114, 32, 32, 61,
- 32, 34, 42, 34, 32,111,114, 32, 34, 38, 34, 44, 32,105,102,
- 32,114,101,112,114,101,115,101,110,116,105,110,103, 32, 97,
- 32,112,111,105,110,116,101,114, 32,111,114, 32, 97, 32,114,
- 101,102,101,114,101,110, 99,101, 10, 45, 45, 32, 32,110, 97,
- 109,101, 32, 61, 32,110, 97,109,101, 10, 45, 45, 32, 32,100,
- 105,109, 32, 32, 61, 32,100,105,109,101,110,115,105,111,110,
- 44, 32,105,102, 32, 97, 32,118,101, 99,116,111,114, 10, 45,
- 45, 32, 32,100,101,102, 32, 32, 61, 32,100,101,102, 97,117,
- 108,116, 32,118, 97,108,117,101, 44, 32,105,102, 32, 97,110,
- 121, 32, 40,111,110,108,121, 32,102,111,114, 32, 97,114,103,
- 117,109,101,110,116,115, 41, 10, 45, 45, 32, 32,114,101,116,
- 32, 32, 61, 32, 34, 42, 34, 32,111,114, 32, 34, 38, 34, 44,
- 32,105,102, 32,118, 97,108,117,101, 32,105,115, 32,116,111,
- 32, 98,101, 32,114,101,116,117,114,110,101,100, 32, 40,111,
- 110,108,121, 32,102,111,114, 32, 97,114,103,117,109,101,110,
- 116,115, 41, 10, 99,108, 97,115,115, 68,101, 99,108, 97,114,
- 97,116,105,111,110, 32, 61, 32,123, 10, 32,109,111,100, 32,
- 61, 32, 39, 39, 44, 10, 32,116,121,112,101, 32, 61, 32, 39,
- 39, 44, 10, 32,112,116,114, 32, 61, 32, 39, 39, 44, 10, 32,
- 110, 97,109,101, 32, 61, 32, 39, 39, 44, 10, 32,100,105,109,
- 32, 61, 32, 39, 39, 44, 10, 32,114,101,116, 32, 61, 32, 39,
- 39, 44, 10, 32,100,101,102, 32, 61, 32, 39, 39, 10,125, 10,
- 99,108, 97,115,115, 68,101, 99,108, 97,114, 97,116,105,111,
- 110, 46, 95, 95,105,110,100,101,120, 32, 61, 32, 99,108, 97,
- 115,115, 68,101, 99,108, 97,114, 97,116,105,111,110, 10,115,
- 101,116,109,101,116, 97,116, 97, 98,108,101, 40, 99,108, 97,
- 115,115, 68,101, 99,108, 97,114, 97,116,105,111,110, 44, 99,
- 108, 97,115,115, 70,101, 97,116,117,114,101, 41, 10, 10, 45,
- 45, 32, 67,114,101, 97,116,101, 32, 97,110, 32,117,110,105,
- 113,117,101, 32,118, 97,114,105, 97, 98,108,101, 32,110, 97,
- 109,101, 10,102,117,110, 99,116,105,111,110, 32, 99,114,101,
- 97,116,101, 95,118, 97,114,110, 97,109,101, 32, 40, 41, 10,
- 32,105,102, 32,110,111,116, 32, 95,118, 97,114,110,117,109,
- 98,101,114, 32,116,104,101,110, 32, 95,118, 97,114,110,117,
- 109, 98,101,114, 32, 61, 32, 48, 32,101,110,100, 10, 32, 95,
- 118, 97,114,110,117,109, 98,101,114, 32, 61, 32, 95,118, 97,
- 114,110,117,109, 98,101,114, 32, 43, 32, 49, 10, 32,114,101,
- 116,117,114,110, 32, 34,116,111,108,117, 97, 95,118, 97,114,
- 95, 34, 46, 46, 95,118, 97,114,110,117,109, 98,101,114, 10,
- 101,110,100, 10, 10, 45, 45, 32, 67,104,101, 99,107, 32,100,
- 101, 99,108, 97,114, 97,116,105,111,110, 32,110, 97,109,101,
- 10, 45, 45, 32, 73,116, 32, 97,108,115,111, 32,105,100,101,
- 110,116,105,102,105,101,115, 32,100,101,102, 97,117,108,116,
- 32,118, 97,108,117,101,115, 10,102,117,110, 99,116,105,111,
- 110, 32, 99,108, 97,115,115, 68,101, 99,108, 97,114, 97,116,
- 105,111,110, 58, 99,104,101, 99,107,110, 97,109,101, 32, 40,
- 41, 10, 10, 32,105,102, 32,115,116,114,115,117, 98, 40,115,
- 101,108,102, 46,110, 97,109,101, 44, 49, 44, 49, 41, 32, 61,
- 61, 32, 39, 91, 39, 32, 97,110,100, 32,110,111,116, 32,102,
- 105,110,100,116,121,112,101, 40,115,101,108,102, 46,116,121,
- 112,101, 41, 32,116,104,101,110, 10, 32, 32,115,101,108,102,
- 46,110, 97,109,101, 32, 61, 32,115,101,108,102, 46,116,121,
- 112,101, 46, 46,115,101,108,102, 46,110, 97,109,101, 10, 32,
- 32,108,111, 99, 97,108, 32,109, 32, 61, 32,115,112,108,105,
- 116, 40,115,101,108,102, 46,109,111,100, 44, 39, 37,115, 37,
- 115, 42, 39, 41, 10, 32, 32,115,101,108,102, 46,116,121,112,
- 101, 32, 61, 32,109, 91,109, 46,110, 93, 10, 32, 32,115,101,
- 108,102, 46,109,111,100, 32, 61, 32, 99,111,110, 99, 97,116,
- 40,109, 44, 49, 44,109, 46,110, 45, 49, 41, 10, 32,101,110,
- 100, 10, 10, 32,108,111, 99, 97,108, 32,116, 32, 61, 32,115,
- 112,108,105,116, 40,115,101,108,102, 46,110, 97,109,101, 44,
- 39, 61, 39, 41, 10, 32,105,102, 32,116, 46,110, 61, 61, 50,
- 32,116,104,101,110, 10, 32, 32,115,101,108,102, 46,110, 97,
- 109,101, 32, 61, 32,116, 91, 49, 93, 10, 32, 32,115,101,108,
- 102, 46,100,101,102, 32, 61, 32,102,105,110,100, 95,101,110,
- 117,109, 95,118, 97,114, 40,116, 91,116, 46,110, 93, 41, 10,
- 32,101,110,100, 10, 10, 32,108,111, 99, 97,108, 32, 98, 44,
- 101, 44,100, 32, 61, 32,115,116,114,102,105,110,100, 40,115,
- 101,108,102, 46,110, 97,109,101, 44, 34, 37, 91, 40, 46, 45,
- 41, 37, 93, 34, 41, 10, 32,105,102, 32, 98, 32,116,104,101,
- 110, 10, 32, 32,115,101,108,102, 46,110, 97,109,101, 32, 61,
- 32,115,116,114,115,117, 98, 40,115,101,108,102, 46,110, 97,
- 109,101, 44, 49, 44, 98, 45, 49, 41, 10, 32, 32,115,101,108,
- 102, 46,100,105,109, 32, 61, 32,102,105,110,100, 95,101,110,
- 117,109, 95,118, 97,114, 40,100, 41, 10, 32,101,110,100, 10,
- 10, 10, 32,105,102, 32,115,101,108,102, 46,116,121,112,101,
- 32,126, 61, 32, 39, 39, 32, 97,110,100, 32,115,101,108,102,
- 46,116,121,112,101, 32,126, 61, 32, 39,118,111,105,100, 39,
- 32, 97,110,100, 32,115,101,108,102, 46,110, 97,109,101, 32,
- 61, 61, 32, 39, 39, 32,116,104,101,110, 10, 32, 32,115,101,
- 108,102, 46,110, 97,109,101, 32, 61, 32, 99,114,101, 97,116,
- 101, 95,118, 97,114,110, 97,109,101, 40, 41, 10, 32,101,108,
- 115,101,105,102, 32,115,101,108,102, 46,107,105,110,100, 61,
- 61, 39,118, 97,114, 39, 32,116,104,101,110, 10, 32, 32,105,
- 102, 32,115,101,108,102, 46,116,121,112,101, 61, 61, 39, 39,
- 32, 97,110,100, 32,115,101,108,102, 46,110, 97,109,101,126,
- 61, 39, 39, 32,116,104,101,110, 10, 32, 32, 32,115,101,108,
- 102, 46,116,121,112,101, 32, 61, 32,115,101,108,102, 46,116,
- 121,112,101, 46, 46,115,101,108,102, 46,110, 97,109,101, 10,
- 32, 32, 32,115,101,108,102, 46,110, 97,109,101, 32, 61, 32,
- 99,114,101, 97,116,101, 95,118, 97,114,110, 97,109,101, 40,
- 41, 10, 32, 32,101,108,115,101,105,102, 32,102,105,110,100,
- 116,121,112,101, 40,115,101,108,102, 46,110, 97,109,101, 41,
- 32,116,104,101,110, 10, 32, 32, 32,105,102, 32,115,101,108,
- 102, 46,116,121,112,101, 61, 61, 39, 39, 32,116,104,101,110,
- 32,115,101,108,102, 46,116,121,112,101, 32, 61, 32,115,101,
- 108,102, 46,110, 97,109,101, 10, 32, 32, 32,101,108,115,101,
- 32,115,101,108,102, 46,116,121,112,101, 32, 61, 32,115,101,
- 108,102, 46,116,121,112,101, 46, 46, 39, 32, 39, 46, 46,115,
- 101,108,102, 46,110, 97,109,101, 32,101,110,100, 10, 32, 32,
- 32,115,101,108,102, 46,110, 97,109,101, 32, 61, 32, 99,114,
- 101, 97,116,101, 95,118, 97,114,110, 97,109,101, 40, 41, 10,
- 32, 32,101,110,100, 10, 32,101,110,100, 10, 10, 32, 45, 45,
- 32, 97,100,106,117,115,116, 32,116,121,112,101, 32,111,102,
- 32,115,116,114,105,110,103, 10, 32,105,102, 32,115,101,108,
- 102, 46,116,121,112,101, 32, 61, 61, 32, 39, 99,104, 97,114,
- 39, 32, 97,110,100, 32,115,101,108,102, 46,100,105,109, 32,
- 126, 61, 32, 39, 39, 32,116,104,101,110, 10, 9, 32,115,101,
- 108,102, 46,116,121,112,101, 32, 61, 32, 39, 99,104, 97,114,
- 42, 39, 10, 32,101,110,100, 10, 10, 9,105,102, 32,115,101,
- 108,102, 46,107,105,110,100, 32, 97,110,100, 32,115,101,108,
- 102, 46,107,105,110,100, 32, 61, 61, 32, 39,118, 97,114, 39,
- 32,116,104,101,110, 10, 9, 9,115,101,108,102, 46,110, 97,
- 109,101, 32, 61, 32,115,116,114,105,110,103, 46,103,115,117,
- 98, 40,115,101,108,102, 46,110, 97,109,101, 44, 32, 34, 58,
- 46, 42, 36, 34, 44, 32, 34, 34, 41, 32, 45, 45, 32, 63, 63,
- 63, 10, 9,101,110,100, 10,101,110,100, 10, 10, 45, 45, 32,
- 67,104,101, 99,107, 32,100,101, 99,108, 97,114, 97,116,105,
- 111,110, 32,116,121,112,101, 10, 45, 45, 32, 83,117, 98,115,
- 116,105,116,117,116,101,115, 32,116,121,112,101,100,101,102,
- 39,115, 46, 10,102,117,110, 99,116,105,111,110, 32, 99,108,
- 97,115,115, 68,101, 99,108, 97,114, 97,116,105,111,110, 58,
- 99,104,101, 99,107,116,121,112,101, 32, 40, 41, 10, 10, 32,
- 45, 45, 32, 99,104,101, 99,107, 32,105,102, 32,116,104,101,
- 114,101, 32,105,115, 32, 97, 32,112,111,105,110,116,101,114,
- 32,116,111, 32, 98, 97,115,105, 99, 32,116,121,112,101, 10,
- 32,108,111, 99, 97,108, 32, 98, 97,115,105, 99, 32, 61, 32,
- 105,115, 98, 97,115,105, 99, 40,115,101,108,102, 46,116,121,
- 112,101, 41, 10, 32,105,102, 32,115,101,108,102, 46,107,105,
- 110,100, 32, 61, 61, 32, 39,102,117,110, 99, 39, 32, 97,110,
- 100, 32, 98, 97,115,105, 99, 61, 61, 39,110,117,109, 98,101,
- 114, 39, 32, 97,110,100, 32,115,116,114,105,110,103, 46,102,
- 105,110,100, 40,115,101,108,102, 46,112,116,114, 44, 32, 34,
- 37, 42, 34, 41, 32,116,104,101,110, 10, 32, 9,115,101,108,
- 102, 46,116,121,112,101, 32, 61, 32, 39, 95,117,115,101,114,
- 100, 97,116, 97, 39, 10, 32, 9,115,101,108,102, 46,112,116,
- 114, 32, 61, 32, 34, 34, 10, 32,101,110,100, 10, 32,105,102,
- 32, 98, 97,115,105, 99, 32, 97,110,100, 32,115,101,108,102,
- 46,112,116,114,126, 61, 39, 39, 32,116,104,101,110, 10, 32,
- 32,115,101,108,102, 46,114,101,116, 32, 61, 32,115,101,108,
- 102, 46,112,116,114, 10, 32, 32,115,101,108,102, 46,112,116,
- 114, 32, 61, 32,110,105,108, 10, 32, 32,105,102, 32,105,115,
- 98, 97,115,105, 99, 40,115,101,108,102, 46,116,121,112,101,
- 41, 32, 61, 61, 32, 39,110,117,109, 98,101,114, 39, 32,116,
- 104,101,110, 10, 32, 32, 9,115,101,108,102, 46,114,101,116,
- 117,114,110, 95,117,115,101,114,100, 97,116, 97, 32, 61, 32,
- 116,114,117,101, 10, 32, 32,101,110,100, 10, 32,101,110,100,
- 10, 10, 32, 45, 45, 32, 99,104,101, 99,107, 32,105,102, 32,
- 116,104,101,114,101, 32,105,115, 32, 97,114,114, 97,121, 32,
- 116,111, 32, 98,101, 32,114,101,116,117,114,110,101,100, 10,
- 32,105,102, 32,115,101,108,102, 46,100,105,109,126, 61, 39,
- 39, 32, 97,110,100, 32,115,101,108,102, 46,114,101,116,126,
- 61, 39, 39, 32,116,104,101,110, 10, 32, 32, 32,101,114,114,
- 111,114, 40, 39, 35,105,110,118, 97,108,105,100, 32,112, 97,
- 114, 97,109,101,116,101,114, 58, 32, 99, 97,110,110,111,116,
- 32,114,101,116,117,114,110, 32, 97,110, 32, 97,114,114, 97,
- 121, 32,111,102, 32,118, 97,108,117,101,115, 39, 41, 10, 32,
- 101,110,100, 10, 32, 45, 45, 32,114,101,115,116,111,114,101,
- 32, 39,118,111,105,100, 42, 39, 32, 97,110,100, 32, 39,115,
- 116,114,105,110,103, 42, 39, 10, 32,105,102, 32,115,101,108,
- 102, 46,116,121,112,101, 32, 61, 61, 32, 39, 95,117,115,101,
- 114,100, 97,116, 97, 39, 32,116,104,101,110, 32,115,101,108,
- 102, 46,116,121,112,101, 32, 61, 32, 39,118,111,105,100, 42,
- 39, 10, 32,101,108,115,101,105,102, 32,115,101,108,102, 46,
- 116,121,112,101, 32, 61, 61, 32, 39, 95, 99,115,116,114,105,
- 110,103, 39, 32,116,104,101,110, 32,115,101,108,102, 46,116,
- 121,112,101, 32, 61, 32, 39, 99,104, 97,114, 42, 39, 10, 32,
- 101,108,115,101,105,102, 32,115,101,108,102, 46,116,121,112,
- 101, 32, 61, 61, 32, 39, 95,108,115,116, 97,116,101, 39, 32,
- 116,104,101,110, 32,115,101,108,102, 46,116,121,112,101, 32,
- 61, 32, 39,108,117, 97, 95, 83,116, 97,116,101, 42, 39, 10,
- 32,101,110,100, 10, 10, 32, 45, 45, 32,114,101,115,111,108,
- 118,101, 32,116,121,112,101,115, 32,105,110,115,105,100,101,
- 32,116,104,101, 32,116,101,109,112,108, 97,116,101,115, 10,
- 32,105,102, 32,115,101,108,102, 46,116,121,112,101, 32,116,
- 104,101,110, 10, 9, 32,115,101,108,102, 46,116,121,112,101,
- 32, 61, 32,114,101,115,111,108,118,101, 95,116,101,109,112,
- 108, 97,116,101, 95,116,121,112,101,115, 40,115,101,108,102,
- 46,116,121,112,101, 41, 10, 32,101,110,100, 10, 10, 45, 45,
- 10, 45, 45, 32, 45, 45, 32,105,102, 32,114,101,116,117,114,
- 110,105,110,103, 32,118, 97,108,117,101, 44, 32, 97,117,116,
- 111,109, 97,116,105, 99, 97,108,108,121, 32,115,101,116, 32,
- 100,101,102, 97,117,108,116, 32,118, 97,108,117,101, 10, 45,
- 45, 32,105,102, 32,115,101,108,102, 46,114,101,116, 32,126,
- 61, 32, 39, 39, 32, 97,110,100, 32,115,101,108,102, 46,100,
- 101,102, 32, 61, 61, 32, 39, 39, 32,116,104,101,110, 10, 45,
- 45, 32, 32,115,101,108,102, 46,100,101,102, 32, 61, 32, 39,
- 48, 39, 10, 45, 45, 32,101,110,100, 10, 45, 45, 10, 10,101,
- 110,100, 10, 10,102,117,110, 99,116,105,111,110, 32,114,101,
- 115,111,108,118,101, 95,116,101,109,112,108, 97,116,101, 95,
- 116,121,112,101,115, 40,116,121,112,101, 41, 10, 10, 9,105,
- 102, 32,105,115, 98, 97,115,105, 99, 40,116,121,112,101, 41,
- 32,116,104,101,110, 10, 9, 9,114,101,116,117,114,110, 32,
- 116,121,112,101, 10, 9,101,110,100, 10, 9,108,111, 99, 97,
- 108, 32, 98, 44, 95, 44,109, 32, 61, 32,115,116,114,105,110,
- 103, 46,102,105,110,100, 40,116,121,112,101, 44, 32, 34, 40,
- 37, 98, 60, 62, 41, 34, 41, 10, 9,105,102, 32, 98, 32,116,
- 104,101,110, 10, 10, 9, 9,109, 32, 61, 32,115,112,108,105,
- 116, 95, 99, 95,116,111,107,101,110,115, 40,115,116,114,105,
- 110,103, 46,115,117, 98, 40,109, 44, 32, 50, 44, 32, 45, 50,
- 41, 44, 32, 34, 44, 34, 41, 10, 9, 9,102,111,114, 32,105,
- 61, 49, 44, 32,116, 97, 98,108,101, 46,103,101,116,110, 40,
- 109, 41, 32,100,111, 10, 9, 9, 9,109, 91,105, 93, 32, 61,
- 32,115,116,114,105,110,103, 46,103,115,117, 98, 40,109, 91,
- 105, 93, 44, 34, 37,115, 42, 40, 91, 37, 42, 38, 93, 41, 34,
- 44, 32, 34, 37, 49, 34, 41, 10, 9, 9, 9,105,102, 32,110,
- 111,116, 32,105,115, 98, 97,115,105, 99, 40,109, 91,105, 93,
- 41, 32,116,104,101,110, 10, 9, 9, 9, 9,105,102, 32,110,
- 111,116, 32,105,115,101,110,117,109, 40,109, 91,105, 93, 41,
- 32,116,104,101,110, 32, 95, 44, 32,109, 91,105, 93, 32, 61,
- 32, 97,112,112,108,121,116,121,112,101,100,101,102, 40, 34,
- 34, 44, 32,109, 91,105, 93, 41, 32,101,110,100, 10, 9, 9,
- 9, 9,109, 91,105, 93, 32, 61, 32,102,105,110,100,116,121,
- 112,101, 40,109, 91,105, 93, 41, 32,111,114, 32,109, 91,105,
- 93, 10, 9, 9, 9, 9,109, 91,105, 93, 32, 61, 32,114,101,
- 115,111,108,118,101, 95,116,101,109,112,108, 97,116,101, 95,
- 116,121,112,101,115, 40,109, 91,105, 93, 41, 10, 9, 9, 9,
- 101,110,100, 10, 9, 9,101,110,100, 10, 10, 9, 9,108,111,
- 99, 97,108, 32, 98, 44,105, 10, 9, 9,116,121,112,101, 44,
- 98, 44,105, 32, 61, 32, 98,114,101, 97,107, 95,116,101,109,
- 112,108, 97,116,101, 40,116,121,112,101, 41, 10, 45, 45,112,
- 114,105,110,116, 40, 34, 99,111,110, 99, 97,116, 32,105,115,
- 32, 34, 44, 99,111,110, 99, 97,116, 40,109, 44, 32, 49, 44,
- 32,109, 46,110, 41, 41, 10, 9, 9,108,111, 99, 97,108, 32,
- 116,101,109,112,108, 97,116,101, 95,112, 97,114,116, 32, 61,
- 32, 34, 60, 34, 46, 46, 99,111,110, 99, 97,116, 40,109, 44,
- 32, 49, 44, 32,109, 46,110, 44, 32, 34, 44, 34, 41, 46, 46,
- 34, 62, 34, 10, 9, 9,116,121,112,101, 32, 61, 32,114,101,
- 98,117,105,108,100, 95,116,101,109,112,108, 97,116,101, 40,
- 116,121,112,101, 44, 32, 98, 44, 32,116,101,109,112,108, 97,
- 116,101, 95,112, 97,114,116, 41, 10, 9, 9,116,121,112,101,
- 32, 61, 32,115,116,114,105,110,103, 46,103,115,117, 98, 40,
- 116,121,112,101, 44, 32, 34, 62, 62, 34, 44, 32, 34, 62, 32,
- 62, 34, 41, 10, 9,101,110,100, 10, 9,114,101,116,117,114,
- 110, 32,116,121,112,101, 10,101,110,100, 10, 10,102,117,110,
- 99,116,105,111,110, 32, 98,114,101, 97,107, 95,116,101,109,
- 112,108, 97,116,101, 40,115, 41, 10, 9,108,111, 99, 97,108,
- 32, 98, 44,101, 44,116,105,109,112,108, 32, 61, 32,115,116,
- 114,105,110,103, 46,102,105,110,100, 40,115, 44, 32, 34, 40,
- 37, 98, 60, 62, 41, 34, 41, 10, 9,105,102, 32,116,105,109,
- 112,108, 32,116,104,101,110, 10, 9, 9,115, 32, 61, 32,115,
- 116,114,105,110,103, 46,103,115,117, 98, 40,115, 44, 32, 34,
- 37, 98, 60, 62, 34, 44, 32, 34, 34, 41, 10, 9, 9,114,101,
- 116,117,114,110, 32,115, 44, 32, 98, 44, 32,116,105,109,112,
- 108, 10, 9,101,108,115,101, 10, 9, 9,114,101,116,117,114,
- 110, 32,115, 44, 32, 48, 44, 32,110,105,108, 10, 9,101,110,
- 100, 10,101,110,100, 10, 10,102,117,110, 99,116,105,111,110,
- 32,114,101, 98,117,105,108,100, 95,116,101,109,112,108, 97,
- 116,101, 40,115, 44, 32, 98, 44, 32,116,105,109,112,108, 41,
- 10, 10, 9,105,102, 32, 98, 32, 61, 61, 32, 48, 32,116,104,
- 101,110, 10, 9, 9,114,101,116,117,114,110, 32,115, 10, 9,
- 101,110,100, 10, 10, 9,114,101,116,117,114,110, 32,115,116,
- 114,105,110,103, 46,115,117, 98, 40,115, 44, 32, 49, 44, 32,
- 98, 45, 49, 41, 46, 46,116,105,109,112,108, 46, 46,115,116,
- 114,105,110,103, 46,115,117, 98, 40,115, 44, 32, 98, 44, 32,
- 45, 49, 41, 10,101,110,100, 10, 10, 45, 45, 32, 80,114,105,
- 110,116, 32,109,101,116,104,111,100, 10,102,117,110, 99,116,
- 105,111,110, 32, 99,108, 97,115,115, 68,101, 99,108, 97,114,
- 97,116,105,111,110, 58,112,114,105,110,116, 32, 40,105,100,
- 101,110,116, 44, 99,108,111,115,101, 41, 10, 32,112,114,105,
- 110,116, 40,105,100,101,110,116, 46, 46, 34, 68,101, 99,108,
- 97,114, 97,116,105,111,110,123, 34, 41, 10, 32,112,114,105,
- 110,116, 40,105,100,101,110,116, 46, 46, 34, 32,109,111,100,
- 32, 32, 61, 32, 39, 34, 46, 46,115,101,108,102, 46,109,111,
- 100, 46, 46, 34, 39, 44, 34, 41, 10, 32,112,114,105,110,116,
- 40,105,100,101,110,116, 46, 46, 34, 32,116,121,112,101, 32,
- 61, 32, 39, 34, 46, 46,115,101,108,102, 46,116,121,112,101,
- 46, 46, 34, 39, 44, 34, 41, 10, 32,112,114,105,110,116, 40,
- 105,100,101,110,116, 46, 46, 34, 32,112,116,114, 32, 32, 61,
- 32, 39, 34, 46, 46,115,101,108,102, 46,112,116,114, 46, 46,
- 34, 39, 44, 34, 41, 10, 32,112,114,105,110,116, 40,105,100,
- 101,110,116, 46, 46, 34, 32,110, 97,109,101, 32, 61, 32, 39,
- 34, 46, 46,115,101,108,102, 46,110, 97,109,101, 46, 46, 34,
- 39, 44, 34, 41, 10, 32,112,114,105,110,116, 40,105,100,101,
- 110,116, 46, 46, 34, 32,100,105,109, 32, 32, 61, 32, 39, 34,
- 46, 46,115,101,108,102, 46,100,105,109, 46, 46, 34, 39, 44,
- 34, 41, 10, 32,112,114,105,110,116, 40,105,100,101,110,116,
- 46, 46, 34, 32,100,101,102, 32, 32, 61, 32, 39, 34, 46, 46,
- 115,101,108,102, 46,100,101,102, 46, 46, 34, 39, 44, 34, 41,
- 10, 32,112,114,105,110,116, 40,105,100,101,110,116, 46, 46,
- 34, 32,114,101,116, 32, 32, 61, 32, 39, 34, 46, 46,115,101,
- 108,102, 46,114,101,116, 46, 46, 34, 39, 44, 34, 41, 10, 32,
- 112,114,105,110,116, 40,105,100,101,110,116, 46, 46, 34,125,
- 34, 46, 46, 99,108,111,115,101, 41, 10,101,110,100, 10, 10,
- 45, 45, 32, 99,104,101, 99,107, 32,105,102, 32, 97,114,114,
- 97,121, 32,111,102, 32,118, 97,108,117,101,115, 32, 97,114,
- 101, 32,114,101,116,117,114,110,101,100, 32,116,111, 32, 76,
- 117, 97, 10,102,117,110, 99,116,105,111,110, 32, 99,108, 97,
- 115,115, 68,101, 99,108, 97,114, 97,116,105,111,110, 58,114,
- 101,113,117,105,114,101, 99,111,108,108,101, 99,116,105,111,
- 110, 32, 40,116, 41, 10, 32,105,102, 32,115,101,108,102, 46,
- 109,111,100, 32,126, 61, 32, 39, 99,111,110,115,116, 39, 32,
- 97,110,100, 10, 9, 32, 32, 32, 32,115,101,108,102, 46,100,
- 105,109, 32, 97,110,100, 32,115,101,108,102, 46,100,105,109,
- 32,126, 61, 32, 39, 39, 32, 97,110,100, 10, 9, 9, 9, 9,
- 32,110,111,116, 32,105,115, 98, 97,115,105, 99, 40,115,101,
- 108,102, 46,116,121,112,101, 41, 32, 97,110,100, 10, 9, 9,
- 9, 9, 32,115,101,108,102, 46,112,116,114, 32, 61, 61, 32,
- 39, 39, 32, 97,110,100, 32,115,101,108,102, 58, 99,104,101,
- 99,107, 95,112,117, 98,108,105, 99, 95, 97, 99, 99,101,115,
- 115, 40, 41, 32,116,104,101,110, 10, 9, 9,108,111, 99, 97,
- 108, 32,116,121,112,101, 32, 61, 32,103,115,117, 98, 40,115,
- 101,108,102, 46,116,121,112,101, 44, 34, 37,115, 42, 99,111,
- 110,115,116, 37,115, 43, 34, 44, 34, 34, 41, 10, 9, 9,116,
- 91,116,121,112,101, 93, 32, 61, 32, 34,116,111,108,117, 97,
- 95, 99,111,108,108,101, 99,116, 95, 34, 32, 46, 46, 32, 99,
- 108,101, 97,110, 95,116,101,109,112,108, 97,116,101, 40,116,
- 121,112,101, 41, 10, 9, 9,114,101,116,117,114,110, 32,116,
- 114,117,101, 10, 9,101,110,100, 10, 9,114,101,116,117,114,
- 110, 32,102, 97,108,115,101, 10,101,110,100, 10, 10, 45, 45,
- 32,100,101, 99,108, 97,114,101, 32,116, 97,103, 10,102,117,
- 110, 99,116,105,111,110, 32, 99,108, 97,115,115, 68,101, 99,
- 108, 97,114, 97,116,105,111,110, 58,100,101, 99,108,116,121,
- 112,101, 32, 40, 41, 10, 10, 9,115,101,108,102, 46,116,121,
- 112,101, 32, 61, 32,116,121,112,101,118, 97,114, 40,115,101,
- 108,102, 46,116,121,112,101, 41, 10, 9,105,102, 32,115,116,
- 114,102,105,110,100, 40,115,101,108,102, 46,109,111,100, 44,
- 39, 99,111,110,115,116, 39, 41, 32,116,104,101,110, 10, 9,
- 9,115,101,108,102, 46,116,121,112,101, 32, 61, 32, 39, 99,
- 111,110,115,116, 32, 39, 46, 46,115,101,108,102, 46,116,121,
- 112,101, 10, 9, 9,115,101,108,102, 46,109,111,100, 32, 61,
- 32,103,115,117, 98, 40,115,101,108,102, 46,109,111,100, 44,
- 39, 99,111,110,115,116, 37,115, 42, 39, 44, 39, 39, 41, 10,
- 9,101,110,100, 10,101,110,100, 10, 10, 10, 45, 45, 32,111,
- 117,116,112,117,116, 32,116,121,112,101, 32, 99,104,101, 99,
- 107,105,110,103, 10,102,117,110, 99,116,105,111,110, 32, 99,
- 108, 97,115,115, 68,101, 99,108, 97,114, 97,116,105,111,110,
- 58,111,117,116, 99,104,101, 99,107,116,121,112,101, 32, 40,
- 110, 97,114,103, 41, 10, 32,108,111, 99, 97,108, 32,100,101,
- 102, 10, 32,108,111, 99, 97,108, 32,116, 32, 61, 32,105,115,
- 98, 97,115,105, 99, 40,115,101,108,102, 46,116,121,112,101,
- 41, 10, 32,105,102, 32,115,101,108,102, 46,100,101,102,126,
- 61, 39, 39, 32,116,104,101,110, 10, 32, 32,100,101,102, 32,
- 61, 32, 49, 10, 32,101,108,115,101, 10, 32, 32,100,101,102,
- 32, 61, 32, 48, 10, 32,101,110,100, 10, 32,105,102, 32,115,
- 101,108,102, 46,100,105,109, 32,126, 61, 32, 39, 39, 32,116,
- 104,101,110, 10, 9, 45, 45,105,102, 32,116, 61, 61, 39,115,
- 116,114,105,110,103, 39, 32,116,104,101,110, 10, 9, 45, 45,
- 9,114,101,116,117,114,110, 32, 39,116,111,108,117, 97, 95,
- 105,115,115,116,114,105,110,103, 97,114,114, 97,121, 40,116,
- 111,108,117, 97, 95, 83, 44, 39, 46, 46,110, 97,114,103, 46,
- 46, 39, 44, 39, 46, 46,100,101,102, 46, 46, 39, 44, 38,116,
- 111,108,117, 97, 95,101,114,114, 41, 39, 10, 9, 45, 45,101,
- 108,115,101, 10, 9,114,101,116,117,114,110, 32, 39, 33,116,
- 111,108,117, 97, 95,105,115,116, 97, 98,108,101, 40,116,111,
- 108,117, 97, 95, 83, 44, 39, 46, 46,110, 97,114,103, 46, 46,
- 39, 44, 48, 44, 38,116,111,108,117, 97, 95,101,114,114, 41,
- 39, 10, 32, 9, 45, 45,101,110,100, 10, 32,101,108,115,101,
- 105,102, 32,116, 32,116,104,101,110, 10, 9,114,101,116,117,
- 114,110, 32, 39, 33,116,111,108,117, 97, 95,105,115, 39, 46,
- 46,116, 46, 46, 39, 40,116,111,108,117, 97, 95, 83, 44, 39,
- 46, 46,110, 97,114,103, 46, 46, 39, 44, 39, 46, 46,100,101,
- 102, 46, 46, 39, 44, 38,116,111,108,117, 97, 95,101,114,114,
- 41, 39, 10, 32,101,108,115,101, 10, 32, 32,108,111, 99, 97,
- 108, 32,105,115, 95,102,117,110, 99, 32, 61, 32,103,101,116,
- 95,105,115, 95,102,117,110, 99,116,105,111,110, 40,115,101,
- 108,102, 46,116,121,112,101, 41, 10, 32, 32,105,102, 32,115,
- 101,108,102, 46,112,116,114, 32, 61, 61, 32, 39, 38, 39, 32,
- 111,114, 32,115,101,108,102, 46,112,116,114, 32, 61, 61, 32,
- 39, 39, 32,116,104,101,110, 10, 32, 32, 9,114,101,116,117,
- 114,110, 32, 39, 40,116,111,108,117, 97, 95,105,115,118, 97,
- 108,117,101,110,105,108, 40,116,111,108,117, 97, 95, 83, 44,
- 39, 46, 46,110, 97,114,103, 46, 46, 39, 44, 38,116,111,108,
- 117, 97, 95,101,114,114, 41, 32,124,124, 32, 33, 39, 46, 46,
- 105,115, 95,102,117,110, 99, 46, 46, 39, 40,116,111,108,117,
- 97, 95, 83, 44, 39, 46, 46,110, 97,114,103, 46, 46, 39, 44,
- 34, 39, 46, 46,115,101,108,102, 46,116,121,112,101, 46, 46,
- 39, 34, 44, 39, 46, 46,100,101,102, 46, 46, 39, 44, 38,116,
- 111,108,117, 97, 95,101,114,114, 41, 41, 39, 10, 32, 32,101,
- 108,115,101, 10, 9,114,101,116,117,114,110, 32, 39, 33, 39,
- 46, 46,105,115, 95,102,117,110, 99, 46, 46, 39, 40,116,111,
- 108,117, 97, 95, 83, 44, 39, 46, 46,110, 97,114,103, 46, 46,
- 39, 44, 34, 39, 46, 46,115,101,108,102, 46,116,121,112,101,
- 46, 46, 39, 34, 44, 39, 46, 46,100,101,102, 46, 46, 39, 44,
- 38,116,111,108,117, 97, 95,101,114,114, 41, 39, 10, 32, 32,
- 101,110,100, 10, 32,101,110,100, 10,101,110,100, 10, 10,102,
- 117,110, 99,116,105,111,110, 32, 99,108, 97,115,115, 68,101,
- 99,108, 97,114, 97,116,105,111,110, 58, 98,117,105,108,100,
- 100,101, 99,108, 97,114, 97,116,105,111,110, 32, 40,110, 97,
- 114,103, 44, 32, 99,112,108,117,115,112,108,117,115, 41, 10,
- 32,108,111, 99, 97,108, 32, 97,114,114, 97,121, 32, 61, 32,
- 115,101,108,102, 46,100,105,109, 32,126, 61, 32, 39, 39, 32,
- 97,110,100, 32,116,111,110,117,109, 98,101,114, 40,115,101,
- 108,102, 46,100,105,109, 41, 61, 61,110,105,108, 10, 9,108,
- 111, 99, 97,108, 32,108,105,110,101, 32, 61, 32, 34, 34, 10,
- 32,108,111, 99, 97,108, 32,112,116,114, 32, 61, 32, 39, 39,
- 10, 32,108,111, 99, 97,108, 32,109,111,100, 10, 32,108,111,
- 99, 97,108, 32,116,121,112,101, 32, 61, 32,115,101,108,102,
- 46,116,121,112,101, 10, 32,108,111, 99, 97,108, 32,110, 99,
- 116,121,112,101, 32, 61, 32,103,115,117, 98, 40,115,101,108,
- 102, 46,116,121,112,101, 44, 39, 99,111,110,115,116, 37,115,
- 43, 39, 44, 39, 39, 41, 10, 32,105,102, 32,115,101,108,102,
- 46,100,105,109, 32,126, 61, 32, 39, 39, 32,116,104,101,110,
- 10, 9, 32,116,121,112,101, 32, 61, 32,103,115,117, 98, 40,
- 115,101,108,102, 46,116,121,112,101, 44, 39, 99,111,110,115,
- 116, 37,115, 43, 39, 44, 39, 39, 41, 32, 32, 45, 45, 32,101,
- 108,105,109,105,110, 97,116,101,115, 32, 99,111,110,115,116,
- 32,109,111,100,105,102,105,101,114, 32,102,111,114, 32, 97,
- 114,114, 97,121,115, 10, 32,101,110,100, 10, 32,105,102, 32,
- 115,101,108,102, 46,112,116,114,126, 61, 39, 39, 32, 97,110,
- 100, 32,110,111,116, 32,105,115, 98, 97,115,105, 99, 40,116,
- 121,112,101, 41, 32,116,104,101,110, 32,112,116,114, 32, 61,
- 32, 39, 42, 39, 32,101,110,100, 10, 32,108,105,110,101, 32,
- 61, 32, 99,111,110, 99, 97,116,112, 97,114, 97,109, 40,108,
- 105,110,101, 44, 34, 32, 34, 44,115,101,108,102, 46,109,111,
- 100, 44,116,121,112,101, 44,112,116,114, 41, 10, 32,105,102,
- 32, 97,114,114, 97,121, 32,116,104,101,110, 10, 32, 32,108,
- 105,110,101, 32, 61, 32, 99,111,110, 99, 97,116,112, 97,114,
- 97,109, 40,108,105,110,101, 44, 39, 42, 39, 41, 10, 32,101,
- 110,100, 10, 32,108,105,110,101, 32, 61, 32, 99,111,110, 99,
- 97,116,112, 97,114, 97,109, 40,108,105,110,101, 44,115,101,
- 108,102, 46,110, 97,109,101, 41, 10, 32,105,102, 32,115,101,
- 108,102, 46,100,105,109, 32,126, 61, 32, 39, 39, 32,116,104,
- 101,110, 10, 32, 32,105,102, 32,116,111,110,117,109, 98,101,
- 114, 40,115,101,108,102, 46,100,105,109, 41,126, 61,110,105,
- 108, 32,116,104,101,110, 10, 32, 32, 32,108,105,110,101, 32,
- 61, 32, 99,111,110, 99, 97,116,112, 97,114, 97,109, 40,108,
- 105,110,101, 44, 39, 91, 39, 44,115,101,108,102, 46,100,105,
- 109, 44, 39, 93, 59, 39, 41, 10, 32, 32,101,108,115,101, 10,
- 9,105,102, 32, 99,112,108,117,115,112,108,117,115, 32,116,
- 104,101,110, 10, 9, 9,108,105,110,101, 32, 61, 32, 99,111,
- 110, 99, 97,116,112, 97,114, 97,109, 40,108,105,110,101, 44,
- 39, 32, 61, 32, 77,116,111,108,117, 97, 95,110,101,119, 95,
- 100,105,109, 40, 39, 44,116,121,112,101, 44,112,116,114, 44,
- 39, 44, 32, 39, 46, 46,115,101,108,102, 46,100,105,109, 46,
- 46, 39, 41, 59, 39, 41, 10, 9,101,108,115,101, 10, 9, 9,
- 108,105,110,101, 32, 61, 32, 99,111,110, 99, 97,116,112, 97,
- 114, 97,109, 40,108,105,110,101, 44, 39, 32, 61, 32, 40, 39,
- 44,116,121,112,101, 44,112,116,114, 44, 39, 42, 41, 39, 44,
- 10, 9, 9, 39,109, 97,108,108,111, 99, 40, 40, 39, 44,115,
- 101,108,102, 46,100,105,109, 44, 39, 41, 42,115,105,122,101,
- 111,102, 40, 39, 44,116,121,112,101, 44,112,116,114, 44, 39,
- 41, 41, 59, 39, 41, 10, 9,101,110,100, 10, 32, 32,101,110,
- 100, 10, 32,101,108,115,101, 10, 32, 32,108,111, 99, 97,108,
- 32,116, 32, 61, 32,105,115, 98, 97,115,105, 99, 40,116,121,
- 112,101, 41, 10, 32, 32,108,105,110,101, 32, 61, 32, 99,111,
- 110, 99, 97,116,112, 97,114, 97,109, 40,108,105,110,101, 44,
- 39, 32, 61, 32, 39, 41, 10, 32, 32,105,102, 32,116, 32, 61,
- 61, 32, 39,115,116, 97,116,101, 39, 32,116,104,101,110, 10,
- 32, 32, 9,108,105,110,101, 32, 61, 32, 99,111,110, 99, 97,
- 116,112, 97,114, 97,109, 40,108,105,110,101, 44, 32, 39,116,
- 111,108,117, 97, 95, 83, 59, 39, 41, 10, 32, 32,101,108,115,
- 101, 10, 32, 32, 9, 45, 45,112,114,105,110,116, 40, 34,116,
- 32,105,115, 32, 34, 46, 46,116,111,115,116,114,105,110,103,
- 40,116, 41, 46, 46, 34, 44, 32,112,116,114, 32,105,115, 32,
- 34, 46, 46,116,111,115,116,114,105,110,103, 40,115,101,108,
- 102, 46,112,116,114, 41, 41, 10, 32, 32, 9,105,102, 32,116,
- 32, 61, 61, 32, 39,110,117,109, 98,101,114, 39, 32, 97,110,
- 100, 32,115,116,114,105,110,103, 46,102,105,110,100, 40,115,
- 101,108,102, 46,112,116,114, 44, 32, 34, 37, 42, 34, 41, 32,
- 116,104,101,110, 10, 32, 32, 9, 9,116, 32, 61, 32, 39,117,
- 115,101,114,100, 97,116, 97, 39, 10, 32, 32, 9,101,110,100,
- 10, 9,105,102, 32,110,111,116, 32,116, 32, 97,110,100, 32,
- 112,116,114, 61, 61, 39, 39, 32,116,104,101,110, 32,108,105,
- 110,101, 32, 61, 32, 99,111,110, 99, 97,116,112, 97,114, 97,
- 109, 40,108,105,110,101, 44, 39, 42, 39, 41, 32,101,110,100,
- 10, 9,108,105,110,101, 32, 61, 32, 99,111,110, 99, 97,116,
- 112, 97,114, 97,109, 40,108,105,110,101, 44, 39, 40, 40, 39,
- 44,115,101,108,102, 46,109,111,100, 44,116,121,112,101, 41,
- 10, 9,105,102, 32,110,111,116, 32,116, 32,116,104,101,110,
- 10, 9, 9,108,105,110,101, 32, 61, 32, 99,111,110, 99, 97,
- 116,112, 97,114, 97,109, 40,108,105,110,101, 44, 39, 42, 39,
- 41, 10, 9,101,110,100, 10, 9,108,105,110,101, 32, 61, 32,
- 99,111,110, 99, 97,116,112, 97,114, 97,109, 40,108,105,110,
- 101, 44, 39, 41, 32, 39, 41, 10, 9,105,102, 32,105,115,101,
- 110,117,109, 40,110, 99,116,121,112,101, 41, 32,116,104,101,
- 110, 10, 9, 9,108,105,110,101, 32, 61, 32, 99,111,110, 99,
- 97,116,112, 97,114, 97,109, 40,108,105,110,101, 44, 39, 40,
- 105,110,116, 41, 32, 39, 41, 10, 9,101,110,100, 10, 9,108,
- 111, 99, 97,108, 32,100,101,102, 32, 61, 32, 48, 10, 9,105,
- 102, 32,115,101,108,102, 46,100,101,102, 32,126, 61, 32, 39,
- 39, 32,116,104,101,110, 10, 9, 9,100,101,102, 32, 61, 32,
- 115,101,108,102, 46,100,101,102, 10, 9, 9,105,102, 32, 40,
- 112,116,114, 32, 61, 61, 32, 39, 39, 32,111,114, 32,115,101,
- 108,102, 46,112,116,114, 32, 61, 61, 32, 39, 38, 39, 41, 32,
- 97,110,100, 32,110,111,116, 32,116, 32,116,104,101,110, 10,
- 9, 9, 9,100,101,102, 32, 61, 32, 34, 40,118,111,105,100,
- 42, 41, 38, 40, 99,111,110,115,116, 32, 34, 46, 46,116,121,
- 112,101, 46, 46, 34, 41, 34, 46, 46,100,101,102, 10, 9, 9,
- 101,110,100, 10, 9,101,110,100, 10, 9,105,102, 32,116, 32,
- 116,104,101,110, 10, 9, 9,108,105,110,101, 32, 61, 32, 99,
- 111,110, 99, 97,116,112, 97,114, 97,109, 40,108,105,110,101,
- 44, 39,116,111,108,117, 97, 95,116,111, 39, 46, 46,116, 44,
- 39, 40,116,111,108,117, 97, 95, 83, 44, 39, 44,110, 97,114,
- 103, 44, 39, 44, 39, 44,100,101,102, 44, 39, 41, 41, 59, 39,
- 41, 10, 9,101,108,115,101, 10, 9, 9,108,111, 99, 97,108,
- 32,116,111, 95,102,117,110, 99, 32, 61, 32,103,101,116, 95,
- 116,111, 95,102,117,110, 99,116,105,111,110, 40,116,121,112,
- 101, 41, 10, 9, 9,108,105,110,101, 32, 61, 32, 99,111,110,
- 99, 97,116,112, 97,114, 97,109, 40,108,105,110,101, 44,116,
- 111, 95,102,117,110, 99, 46, 46, 39, 40,116,111,108,117, 97,
- 95, 83, 44, 39, 44,110, 97,114,103, 44, 39, 44, 39, 44,100,
- 101,102, 44, 39, 41, 41, 59, 39, 41, 10, 9,101,110,100, 10,
- 32, 32,101,110,100, 10, 32,101,110,100, 10, 9,114,101,116,
- 117,114,110, 32,108,105,110,101, 10,101,110,100, 10, 10, 45,
- 45, 32, 68,101, 99,108, 97,114,101, 32,118, 97,114,105, 97,
- 98,108,101, 10,102,117,110, 99,116,105,111,110, 32, 99,108,
- 97,115,115, 68,101, 99,108, 97,114, 97,116,105,111,110, 58,
- 100,101, 99,108, 97,114,101, 32, 40,110, 97,114,103, 41, 10,
- 32,105,102, 32,115,101,108,102, 46,100,105,109, 32,126, 61,
- 32, 39, 39, 32, 97,110,100, 32,116,111,110,117,109, 98,101,
- 114, 40,115,101,108,102, 46,100,105,109, 41, 61, 61,110,105,
- 108, 32,116,104,101,110, 10, 9, 32,111,117,116,112,117,116,
- 40, 39, 35,105,102,100,101,102, 32, 95, 95, 99,112,108,117,
- 115,112,108,117,115, 92,110, 39, 41, 10, 9, 9,111,117,116,
- 112,117,116, 40,115,101,108,102, 58, 98,117,105,108,100,100,
- 101, 99,108, 97,114, 97,116,105,111,110, 40,110, 97,114,103,
- 44,116,114,117,101, 41, 41, 10, 9, 9,111,117,116,112,117,
- 116, 40, 39, 35,101,108,115,101, 92,110, 39, 41, 10, 9, 9,
- 111,117,116,112,117,116, 40,115,101,108,102, 58, 98,117,105,
- 108,100,100,101, 99,108, 97,114, 97,116,105,111,110, 40,110,
- 97,114,103, 44,102, 97,108,115,101, 41, 41, 10, 9, 32,111,
- 117,116,112,117,116, 40, 39, 35,101,110,100,105,102, 92,110,
- 39, 41, 10, 9,101,108,115,101, 10, 9, 9,111,117,116,112,
- 117,116, 40,115,101,108,102, 58, 98,117,105,108,100,100,101,
- 99,108, 97,114, 97,116,105,111,110, 40,110, 97,114,103, 44,
- 102, 97,108,115,101, 41, 41, 10, 9,101,110,100, 10,101,110,
- 100, 10, 10, 45, 45, 32, 71,101,116, 32,112, 97,114, 97,109,
- 101,116,101,114, 32,118, 97,108,117,101, 10,102,117,110, 99,
- 116,105,111,110, 32, 99,108, 97,115,115, 68,101, 99,108, 97,
- 114, 97,116,105,111,110, 58,103,101,116, 97,114,114, 97,121,
- 32, 40,110, 97,114,103, 41, 10, 32,105,102, 32,115,101,108,
- 102, 46,100,105,109, 32,126, 61, 32, 39, 39, 32,116,104,101,
- 110, 10, 9, 32,108,111, 99, 97,108, 32,116,121,112,101, 32,
- 61, 32,103,115,117, 98, 40,115,101,108,102, 46,116,121,112,
- 101, 44, 39, 99,111,110,115,116, 32, 39, 44, 39, 39, 41, 10,
- 32, 32,111,117,116,112,117,116, 40, 39, 32, 32,123, 39, 41,
- 10, 9, 32,111,117,116,112,117,116, 40, 39, 35,105,102,110,
- 100,101,102, 32, 84, 79, 76, 85, 65, 95, 82, 69, 76, 69, 65,
- 83, 69, 92,110, 39, 41, 10, 32, 32,108,111, 99, 97,108, 32,
- 100,101,102, 59, 32,105,102, 32,115,101,108,102, 46,100,101,
- 102,126, 61, 39, 39, 32,116,104,101,110, 32,100,101,102, 61,
- 49, 32,101,108,115,101, 32,100,101,102, 61, 48, 32,101,110,
- 100, 10, 9, 9,108,111, 99, 97,108, 32,116, 32, 61, 32,105,
- 115, 98, 97,115,105, 99, 40,116,121,112,101, 41, 10, 9, 9,
- 105,102, 32, 40,116, 41, 32,116,104,101,110, 10, 9, 9, 32,
- 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32,105,102,
- 32, 40, 33,116,111,108,117, 97, 95,105,115, 39, 46, 46,116,
- 46, 46, 39, 97,114,114, 97,121, 40,116,111,108,117, 97, 95,
- 83, 44, 39, 44,110, 97,114,103, 44, 39, 44, 39, 44,115,101,
- 108,102, 46,100,105,109, 44, 39, 44, 39, 44,100,101,102, 44,
- 39, 44, 38,116,111,108,117, 97, 95,101,114,114, 41, 41, 39,
- 41, 10, 9, 9,101,108,115,101, 10, 9, 9, 32, 32, 32,111,
- 117,116,112,117,116, 40, 39, 32, 32, 32,105,102, 32, 40, 33,
- 116,111,108,117, 97, 95,105,115,117,115,101,114,116,121,112,
- 101, 97,114,114, 97,121, 40,116,111,108,117, 97, 95, 83, 44,
- 39, 44,110, 97,114,103, 44, 39, 44, 34, 39, 44,116,121,112,
- 101, 44, 39, 34, 44, 39, 44,115,101,108,102, 46,100,105,109,
- 44, 39, 44, 39, 44,100,101,102, 44, 39, 44, 38,116,111,108,
- 117, 97, 95,101,114,114, 41, 41, 39, 41, 10, 9, 9,101,110,
- 100, 10, 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32,
- 32,103,111,116,111, 32,116,111,108,117, 97, 95,108,101,114,
- 114,111,114, 59, 39, 41, 10, 32, 32,111,117,116,112,117,116,
- 40, 39, 32, 32, 32,101,108,115,101, 92,110, 39, 41, 10, 9,
- 32,111,117,116,112,117,116, 40, 39, 35,101,110,100,105,102,
- 92,110, 39, 41, 10, 32, 32,111,117,116,112,117,116, 40, 39,
- 32, 32, 32,123, 39, 41, 10, 32, 32,111,117,116,112,117,116,
- 40, 39, 32, 32, 32, 32,105,110,116, 32,105, 59, 39, 41, 10,
- 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32, 32,102,
- 111,114, 40,105, 61, 48, 59, 32,105, 60, 39, 46, 46,115,101,
- 108,102, 46,100,105,109, 46, 46, 39, 59,105, 43, 43, 41, 39,
- 41, 10, 32, 32,108,111, 99, 97,108, 32,116, 32, 61, 32,105,
- 115, 98, 97,115,105, 99, 40,116,121,112,101, 41, 10, 32, 32,
- 108,111, 99, 97,108, 32,112,116,114, 32, 61, 32, 39, 39, 10,
- 32, 32,105,102, 32,115,101,108,102, 46,112,116,114,126, 61,
- 39, 39, 32,116,104,101,110, 32,112,116,114, 32, 61, 32, 39,
- 42, 39, 32,101,110,100, 10, 32, 32,111,117,116,112,117,116,
- 40, 39, 32, 32, 32, 39, 44,115,101,108,102, 46,110, 97,109,
- 101, 46, 46, 39, 91,105, 93, 32, 61, 32, 39, 41, 10, 32, 32,
- 105,102, 32,110,111,116, 32,116, 32, 97,110,100, 32,112,116,
- 114, 61, 61, 39, 39, 32,116,104,101,110, 32,111,117,116,112,
- 117,116, 40, 39, 42, 39, 41, 32,101,110,100, 10, 32, 32,111,
- 117,116,112,117,116, 40, 39, 40, 40, 39, 44,116,121,112,101,
- 41, 10, 32, 32,105,102, 32,110,111,116, 32,116, 32,116,104,
- 101,110, 10, 32, 32, 32,111,117,116,112,117,116, 40, 39, 42,
- 39, 41, 10, 32, 32,101,110,100, 10, 32, 32,111,117,116,112,
- 117,116, 40, 39, 41, 32, 39, 41, 10, 32, 32,108,111, 99, 97,
- 108, 32,100,101,102, 32, 61, 32, 48, 10, 32, 32,105,102, 32,
- 115,101,108,102, 46,100,101,102, 32,126, 61, 32, 39, 39, 32,
- 116,104,101,110, 32,100,101,102, 32, 61, 32,115,101,108,102,
- 46,100,101,102, 32,101,110,100, 10, 32, 32,105,102, 32,116,
- 32,116,104,101,110, 10, 32, 32, 32,111,117,116,112,117,116,
- 40, 39,116,111,108,117, 97, 95,116,111,102,105,101,108,100,
- 39, 46, 46,116, 46, 46, 39, 40,116,111,108,117, 97, 95, 83,
- 44, 39, 44,110, 97,114,103, 44, 39, 44,105, 43, 49, 44, 39,
- 44,100,101,102, 44, 39, 41, 41, 59, 39, 41, 10, 32, 32,101,
- 108,115,101, 10, 32, 32, 32,111,117,116,112,117,116, 40, 39,
- 116,111,108,117, 97, 95,116,111,102,105,101,108,100,117,115,
- 101,114,116,121,112,101, 40,116,111,108,117, 97, 95, 83, 44,
- 39, 44,110, 97,114,103, 44, 39, 44,105, 43, 49, 44, 39, 44,
- 100,101,102, 44, 39, 41, 41, 59, 39, 41, 10, 32, 32,101,110,
- 100, 10, 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32,
- 125, 39, 41, 10, 32, 32,111,117,116,112,117,116, 40, 39, 32,
- 32,125, 39, 41, 10, 32,101,110,100, 10,101,110,100, 10, 10,
- 45, 45, 32, 71,101,116, 32,112, 97,114, 97,109,101,116,101,
- 114, 32,118, 97,108,117,101, 10,102,117,110, 99,116,105,111,
- 110, 32, 99,108, 97,115,115, 68,101, 99,108, 97,114, 97,116,
- 105,111,110, 58,115,101,116, 97,114,114, 97,121, 32, 40,110,
- 97,114,103, 41, 10, 32,105,102, 32,110,111,116, 32,115,116,
- 114,102,105,110,100, 40,115,101,108,102, 46,116,121,112,101,
- 44, 39, 99,111,110,115,116, 37,115, 43, 39, 41, 32, 97,110,
- 100, 32,115,101,108,102, 46,100,105,109, 32,126, 61, 32, 39,
- 39, 32,116,104,101,110, 10, 9, 32,108,111, 99, 97,108, 32,
- 116,121,112,101, 32, 61, 32,103,115,117, 98, 40,115,101,108,
- 102, 46,116,121,112,101, 44, 39, 99,111,110,115,116, 32, 39,
- 44, 39, 39, 41, 10, 32, 32,111,117,116,112,117,116, 40, 39,
- 32, 32,123, 39, 41, 10, 32, 32,111,117,116,112,117,116, 40,
- 39, 32, 32, 32,105,110,116, 32,105, 59, 39, 41, 10, 32, 32,
- 111,117,116,112,117,116, 40, 39, 32, 32, 32,102,111,114, 40,
- 105, 61, 48, 59, 32,105, 60, 39, 46, 46,115,101,108,102, 46,
- 100,105,109, 46, 46, 39, 59,105, 43, 43, 41, 39, 41, 10, 32,
- 32,108,111, 99, 97,108, 32,116, 44, 99,116, 32, 61, 32,105,
- 115, 98, 97,115,105, 99, 40,116,121,112,101, 41, 10, 32, 32,
- 105,102, 32,116, 32,116,104,101,110, 10, 32, 32, 32,111,117,
- 116,112,117,116, 40, 39, 32, 32, 32, 32,116,111,108,117, 97,
- 95,112,117,115,104,102,105,101,108,100, 39, 46, 46,116, 46,
- 46, 39, 40,116,111,108,117, 97, 95, 83, 44, 39, 44,110, 97,
- 114,103, 44, 39, 44,105, 43, 49, 44, 40, 39, 44, 99,116, 44,
- 39, 41, 39, 44,115,101,108,102, 46,110, 97,109,101, 44, 39,
- 91,105, 93, 41, 59, 39, 41, 10, 32, 32,101,108,115,101, 10,
- 32, 32, 32,105,102, 32,115,101,108,102, 46,112,116,114, 32,
- 61, 61, 32, 39, 39, 32,116,104,101,110, 10, 32, 32, 32, 32,
- 32,111,117,116,112,117,116, 40, 39, 32, 32, 32,123, 39, 41,
- 10, 32, 32, 32, 32, 32,111,117,116,112,117,116, 40, 39, 35,
- 105,102,100,101,102, 32, 95, 95, 99,112,108,117,115,112,108,
- 117,115, 92,110, 39, 41, 10, 32, 32, 32, 32, 32,111,117,116,
- 112,117,116, 40, 39, 32, 32, 32, 32,118,111,105,100, 42, 32,
- 116,111,108,117, 97, 95,111, 98,106, 32, 61, 32, 77,116,111,
- 108,117, 97, 95,110,101,119, 40, 40, 39, 44,116,121,112,101,
- 44, 39, 41, 40, 39, 44,115,101,108,102, 46,110, 97,109,101,
- 44, 39, 91,105, 93, 41, 41, 59, 39, 41, 10, 32, 32, 32, 32,
- 32,111,117,116,112,117,116, 40, 39, 32, 32, 32, 32,116,111,
- 108,117, 97, 95,112,117,115,104,102,105,101,108,100,117,115,
- 101,114,116,121,112,101, 95, 97,110,100, 95,116, 97,107,101,
- 111,119,110,101,114,115,104,105,112, 40,116,111,108,117, 97,
- 95, 83, 44, 39, 44,110, 97,114,103, 44, 39, 44,105, 43, 49,
- 44,116,111,108,117, 97, 95,111, 98,106, 44, 34, 39, 44,116,
- 121,112,101, 44, 39, 34, 41, 59, 39, 41, 10, 32, 32, 32, 32,
- 32,111,117,116,112,117,116, 40, 39, 35,101,108,115,101, 92,
- 110, 39, 41, 10, 32, 32, 32, 32, 32,111,117,116,112,117,116,
- 40, 39, 32, 32, 32, 32,118,111,105,100, 42, 32,116,111,108,
- 117, 97, 95,111, 98,106, 32, 61, 32,116,111,108,117, 97, 95,
- 99,111,112,121, 40,116,111,108,117, 97, 95, 83, 44, 40,118,
- 111,105,100, 42, 41, 38, 39, 44,115,101,108,102, 46,110, 97,
- 109,101, 44, 39, 91,105, 93, 44,115,105,122,101,111,102, 40,
- 39, 44,116,121,112,101, 44, 39, 41, 41, 59, 39, 41, 10, 32,
- 32, 32, 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32,
- 32,116,111,108,117, 97, 95,112,117,115,104,102,105,101,108,
- 100,117,115,101,114,116,121,112,101, 40,116,111,108,117, 97,
- 95, 83, 44, 39, 44,110, 97,114,103, 44, 39, 44,105, 43, 49,
- 44,116,111,108,117, 97, 95,111, 98,106, 44, 34, 39, 44,116,
- 121,112,101, 44, 39, 34, 41, 59, 39, 41, 10, 32, 32, 32, 32,
- 32,111,117,116,112,117,116, 40, 39, 35,101,110,100,105,102,
- 92,110, 39, 41, 10, 32, 32, 32, 32, 32,111,117,116,112,117,
- 116, 40, 39, 32, 32, 32,125, 39, 41, 10, 32, 32, 32,101,108,
- 115,101, 10, 32, 32, 32, 32,111,117,116,112,117,116, 40, 39,
- 32, 32, 32,116,111,108,117, 97, 95,112,117,115,104,102,105,
- 101,108,100,117,115,101,114,116,121,112,101, 40,116,111,108,
- 117, 97, 95, 83, 44, 39, 44,110, 97,114,103, 44, 39, 44,105,
- 43, 49, 44, 40,118,111,105,100, 42, 41, 39, 44,115,101,108,
- 102, 46,110, 97,109,101, 44, 39, 91,105, 93, 44, 34, 39, 44,
- 116,121,112,101, 44, 39, 34, 41, 59, 39, 41, 10, 32, 32, 32,
- 101,110,100, 10, 32, 32,101,110,100, 10, 32, 32,111,117,116,
- 112,117,116, 40, 39, 32, 32,125, 39, 41, 10, 32,101,110,100,
- 10,101,110,100, 10, 10, 45, 45, 32, 70,114,101,101, 32,100,
- 121,110, 97,109,105, 99, 97,108,108,121, 32, 97,108,108,111,
- 99, 97,116,101,100, 32, 97,114,114, 97,121, 10,102,117,110,
- 99,116,105,111,110, 32, 99,108, 97,115,115, 68,101, 99,108,
- 97,114, 97,116,105,111,110, 58,102,114,101,101, 97,114,114,
- 97,121, 32, 40, 41, 10, 32,105,102, 32,115,101,108,102, 46,
- 100,105,109, 32,126, 61, 32, 39, 39, 32, 97,110,100, 32,116,
- 111,110,117,109, 98,101,114, 40,115,101,108,102, 46,100,105,
- 109, 41, 61, 61,110,105,108, 32,116,104,101,110, 10, 9, 32,
- 111,117,116,112,117,116, 40, 39, 35,105,102,100,101,102, 32,
- 95, 95, 99,112,108,117,115,112,108,117,115, 92,110, 39, 41,
- 10, 9, 9,111,117,116,112,117,116, 40, 39, 32, 32, 77,116,
- 111,108,117, 97, 95,100,101,108,101,116,101, 95,100,105,109,
- 40, 39, 44,115,101,108,102, 46,110, 97,109,101, 44, 39, 41,
- 59, 39, 41, 10, 9, 32,111,117,116,112,117,116, 40, 39, 35,
- 101,108,115,101, 92,110, 39, 41, 10, 32, 32,111,117,116,112,
- 117,116, 40, 39, 32, 32,102,114,101,101, 40, 39, 44,115,101,
- 108,102, 46,110, 97,109,101, 44, 39, 41, 59, 39, 41, 10, 9,
- 32,111,117,116,112,117,116, 40, 39, 35,101,110,100,105,102,
- 92,110, 39, 41, 10, 32,101,110,100, 10,101,110,100, 10, 10,
- 45, 45, 32, 80, 97,115,115, 32,112, 97,114, 97,109,101,116,
- 101,114, 10,102,117,110, 99,116,105,111,110, 32, 99,108, 97,
- 115,115, 68,101, 99,108, 97,114, 97,116,105,111,110, 58,112,
- 97,115,115,112, 97,114, 32, 40, 41, 10, 32,105,102, 32,115,
- 101,108,102, 46,112,116,114, 61, 61, 39, 38, 39, 32, 97,110,
- 100, 32,110,111,116, 32,105,115, 98, 97,115,105, 99, 40,115,
- 101,108,102, 46,116,121,112,101, 41, 32,116,104,101,110, 10,
- 32, 32,111,117,116,112,117,116, 40, 39, 42, 39, 46, 46,115,
- 101,108,102, 46,110, 97,109,101, 41, 10, 32,101,108,115,101,
- 105,102, 32,115,101,108,102, 46,114,101,116, 61, 61, 39, 42,
- 39, 32,116,104,101,110, 10, 32, 32,111,117,116,112,117,116,
- 40, 39, 38, 39, 46, 46,115,101,108,102, 46,110, 97,109,101,
- 41, 10, 32,101,108,115,101, 10, 32, 32,111,117,116,112,117,
- 116, 40,115,101,108,102, 46,110, 97,109,101, 41, 10, 32,101,
- 110,100, 10,101,110,100, 10, 10, 45, 45, 32, 82,101,116,117,
- 114,110, 32,112, 97,114, 97,109,101,116,101,114, 32,118, 97,
- 108,117,101, 10,102,117,110, 99,116,105,111,110, 32, 99,108,
- 97,115,115, 68,101, 99,108, 97,114, 97,116,105,111,110, 58,
- 114,101,116,118, 97,108,117,101, 32, 40, 41, 10, 32,105,102,
- 32,115,101,108,102, 46,114,101,116, 32,126, 61, 32, 39, 39,
- 32,116,104,101,110, 10, 32, 32,108,111, 99, 97,108, 32,116,
- 44, 99,116, 32, 61, 32,105,115, 98, 97,115,105, 99, 40,115,
- 101,108,102, 46,116,121,112,101, 41, 10, 32, 32,105,102, 32,
- 116, 32, 97,110,100, 32,116,126, 61, 39, 39, 32,116,104,101,
- 110, 10, 32, 32, 32,111,117,116,112,117,116, 40, 39, 32, 32,
- 32,116,111,108,117, 97, 95,112,117,115,104, 39, 46, 46,116,
- 46, 46, 39, 40,116,111,108,117, 97, 95, 83, 44, 40, 39, 44,
- 99,116, 44, 39, 41, 39, 46, 46,115,101,108,102, 46,110, 97,
- 109,101, 46, 46, 39, 41, 59, 39, 41, 10, 32, 32,101,108,115,
- 101, 10, 32, 32, 32,108,111, 99, 97,108, 32,112,117,115,104,
- 95,102,117,110, 99, 32, 61, 32,103,101,116, 95,112,117,115,
- 104, 95,102,117,110, 99,116,105,111,110, 40,115,101,108,102,
- 46,116,121,112,101, 41, 10, 32, 32, 32,111,117,116,112,117,
- 116, 40, 39, 32, 32, 32, 39, 44,112,117,115,104, 95,102,117,
- 110, 99, 44, 39, 40,116,111,108,117, 97, 95, 83, 44, 40,118,
- 111,105,100, 42, 41, 39, 46, 46,115,101,108,102, 46,110, 97,
- 109,101, 46, 46, 39, 44, 34, 39, 44,115,101,108,102, 46,116,
- 121,112,101, 44, 39, 34, 41, 59, 39, 41, 10, 32, 32,101,110,
- 100, 10, 32, 32,114,101,116,117,114,110, 32, 49, 10, 32,101,
- 110,100, 10, 32,114,101,116,117,114,110, 32, 48, 10,101,110,
- 100, 10, 10, 45, 45, 32, 73,110,116,101,114,110, 97,108, 32,
- 99,111,110,115,116,114,117, 99,116,111,114, 10,102,117,110,
- 99,116,105,111,110, 32, 95, 68,101, 99,108, 97,114, 97,116,
- 105,111,110, 32, 40,116, 41, 10, 10, 32,115,101,116,109,101,
- 116, 97,116, 97, 98,108,101, 40,116, 44, 99,108, 97,115,115,
- 68,101, 99,108, 97,114, 97,116,105,111,110, 41, 10, 32,116,
- 58, 98,117,105,108,100,110, 97,109,101,115, 40, 41, 10, 32,
- 116, 58, 99,104,101, 99,107,110, 97,109,101, 40, 41, 10, 32,
- 116, 58, 99,104,101, 99,107,116,121,112,101, 40, 41, 10, 32,
- 108,111, 99, 97,108, 32,102,116, 32, 61, 32,102,105,110,100,
- 116,121,112,101, 40,116, 46,116,121,112,101, 41, 32,111,114,
- 32,116, 46,116,121,112,101, 10, 32,105,102, 32,110,111,116,
- 32,105,115,101,110,117,109, 40,102,116, 41, 32,116,104,101,
- 110, 10, 9,116, 46,109,111,100, 44, 32,116, 46,116,121,112,
- 101, 32, 61, 32, 97,112,112,108,121,116,121,112,101,100,101,
- 102, 40,116, 46,109,111,100, 44, 32,102,116, 41, 10, 32,101,
- 110,100, 10, 10, 32,105,102, 32,116, 46,107,105,110,100, 61,
- 61, 34,118, 97,114, 34, 32, 97,110,100, 32, 40,115,116,114,
- 105,110,103, 46,102,105,110,100, 40,116, 46,109,111,100, 44,
- 32, 34,116,111,108,117, 97, 95,112,114,111,112,101,114,116,
- 121, 37,115, 34, 41, 32,111,114, 32,115,116,114,105,110,103,
- 46,102,105,110,100, 40,116, 46,109,111,100, 44, 32, 34,116,
- 111,108,117, 97, 95,112,114,111,112,101,114,116,121, 36, 34,
- 41, 41, 32,116,104,101,110, 10, 32, 9,116, 46,109,111,100,
- 32, 61, 32,115,116,114,105,110,103, 46,103,115,117, 98, 40,
- 116, 46,109,111,100, 44, 32, 34,116,111,108,117, 97, 95,112,
- 114,111,112,101,114,116,121, 34, 44, 32, 34,116,111,108,117,
- 97, 95,112,114,111,112,101,114,116,121, 95, 95, 34, 46, 46,
- 103,101,116, 95,112,114,111,112,101,114,116,121, 95,116,121,
- 112,101, 40, 41, 41, 10, 32,101,110,100, 10, 10, 32,114,101,
- 116,117,114,110, 32,116, 10,101,110,100, 10, 10, 45, 45, 32,
- 67,111,110,115,116,114,117, 99,116,111,114, 10, 45, 45, 32,
- 69,120,112,101, 99,116,115, 32,116,104,101, 32,115,116,114,
- 105,110,103, 32,100,101, 99,108, 97,114, 97,116,105,111,110,
- 46, 10, 45, 45, 32, 84,104,101, 32,107,105,110,100, 32,111,
- 102, 32,100,101, 99,108, 97,114, 97,116,105,111,110, 32, 99,
- 97,110, 32, 98,101, 32, 34,118, 97,114, 34, 32,111,114, 32,
- 34,102,117,110, 99, 34, 46, 10,102,117,110, 99,116,105,111,
- 110, 32, 68,101, 99,108, 97,114, 97,116,105,111,110, 32, 40,
- 115, 44,107,105,110,100, 44,105,115, 95,112, 97,114, 97,109,
- 101,116,101,114, 41, 10, 10, 32, 45, 45, 32,101,108,105,109,
- 105,110, 97,116,101, 32,115,112, 97, 99,101,115, 32,105,102,
- 32,100,101,102, 97,117,108,116, 32,118, 97,108,117,101, 32,
- 105,115, 32,112,114,111,118,105,100,101,100, 10, 32,115, 32,
- 61, 32,103,115,117, 98, 40,115, 44, 34, 37,115, 42, 61, 37,
- 115, 42, 34, 44, 34, 61, 34, 41, 10, 32,115, 32, 61, 32,103,
- 115,117, 98, 40,115, 44, 32, 34, 37,115, 42, 60, 34, 44, 32,
- 34, 60, 34, 41, 10, 10, 32,108,111, 99, 97,108, 32,100,101,
- 102, 98, 44,116,109,112,100,101,102, 10, 32,100,101,102, 98,
- 44, 95, 44,116,109,112,100,101,102, 32, 61, 32,115,116,114,
- 105,110,103, 46,102,105,110,100, 40,115, 44, 32, 34, 40, 61,
- 46, 42, 41, 36, 34, 41, 10, 32,105,102, 32,100,101,102, 98,
- 32,116,104,101,110, 10, 32, 9,115, 32, 61, 32,115,116,114,
- 105,110,103, 46,103,115,117, 98, 40,115, 44, 32, 34, 61, 46,
- 42, 36, 34, 44, 32, 34, 34, 41, 10, 32,101,108,115,101, 10,
- 32, 9,116,109,112,100,101,102, 32, 61, 32, 39, 39, 10, 32,
- 101,110,100, 10, 32,105,102, 32,107,105,110,100, 32, 61, 61,
- 32, 34,118, 97,114, 34, 32,116,104,101,110, 10, 32, 32, 45,
- 45, 32, 99,104,101, 99,107, 32,116,104,101, 32,102,111,114,
- 109, 58, 32,118,111,105,100, 10, 32, 32,105,102, 32,115, 32,
- 61, 61, 32, 39, 39, 32,111,114, 32,115, 32, 61, 61, 32, 39,
- 118,111,105,100, 39, 32,116,104,101,110, 10, 32, 32, 32,114,
- 101,116,117,114,110, 32, 95, 68,101, 99,108, 97,114, 97,116,
- 105,111,110,123,116,121,112,101, 32, 61, 32, 39,118,111,105,
- 100, 39, 44, 32,107,105,110,100, 32, 61, 32,107,105,110,100,
- 44, 32,105,115, 95,112, 97,114, 97,109,101,116,101,114, 32,
- 61, 32,105,115, 95,112, 97,114, 97,109,101,116,101,114,125,
- 10, 32, 32,101,110,100, 10, 32,101,110,100, 10, 10, 32, 45,
- 45, 32, 99,104,101, 99,107, 32,116,104,101, 32,102,111,114,
- 109, 58, 32,109,111,100, 32,116,121,112,101, 42, 38, 32,110,
- 97,109,101, 10, 32,108,111, 99, 97,108, 32,116, 32, 61, 32,
- 115,112,108,105,116, 95, 99, 95,116,111,107,101,110,115, 40,
- 115, 44, 39, 37, 42, 37,115, 42, 38, 39, 41, 10, 32,105,102,
- 32,116, 46,110, 32, 61, 61, 32, 50, 32,116,104,101,110, 10,
- 32, 32,105,102, 32,107,105,110,100, 32, 61, 61, 32, 39,102,
- 117,110, 99, 39, 32,116,104,101,110, 10, 32, 32, 32,101,114,
- 114,111,114, 40, 34, 35,105,110,118, 97,108,105,100, 32,102,
- 117,110, 99,116,105,111,110, 32,114,101,116,117,114,110, 32,
- 116,121,112,101, 58, 32, 34, 46, 46,115, 41, 10, 32, 32,101,
- 110,100, 10, 32, 32, 45, 45,108,111, 99, 97,108, 32,109, 32,
- 61, 32,115,112,108,105,116, 40,116, 91, 49, 93, 44, 39, 37,
- 115, 37,115, 42, 39, 41, 10, 32, 32,108,111, 99, 97,108, 32,
- 109, 32, 61, 32,115,112,108,105,116, 95, 99, 95,116,111,107,
- 101,110,115, 40,116, 91, 49, 93, 44, 39, 37,115, 43, 39, 41,
- 10, 32, 32,114,101,116,117,114,110, 32, 95, 68,101, 99,108,
- 97,114, 97,116,105,111,110,123, 10, 32, 32, 32,110, 97,109,
- 101, 32, 61, 32,116, 91, 50, 93, 46, 46,116,109,112,100,101,
- 102, 44, 10, 32, 32, 32,112,116,114, 32, 61, 32, 39, 42, 39,
- 44, 10, 32, 32, 32,114,101,116, 32, 61, 32, 39, 38, 39, 44,
- 10, 32, 32, 32, 45, 45,116,121,112,101, 32, 61, 32,114,101,
- 98,117,105,108,100, 95,116,101,109,112,108, 97,116,101, 40,
- 109, 91,109, 46,110, 93, 44, 32,116, 98, 44, 32,116,105,109,
- 112,108, 41, 44, 10, 32, 32, 32,116,121,112,101, 32, 61, 32,
- 109, 91,109, 46,110, 93, 44, 10, 32, 32, 32,109,111,100, 32,
- 61, 32, 99,111,110, 99, 97,116, 40,109, 44, 49, 44,109, 46,
- 110, 45, 49, 41, 44, 10, 32, 32, 32,105,115, 95,112, 97,114,
- 97,109,101,116,101,114, 32, 61, 32,105,115, 95,112, 97,114,
- 97,109,101,116,101,114, 44, 10, 32, 32, 32,107,105,110,100,
- 32, 61, 32,107,105,110,100, 10, 32, 32,125, 10, 32,101,110,
- 100, 10, 10, 32, 45, 45, 32, 99,104,101, 99,107, 32,116,104,
- 101, 32,102,111,114,109, 58, 32,109,111,100, 32,116,121,112,
- 101, 42, 42, 32,110, 97,109,101, 10, 32,116, 32, 61, 32,115,
- 112,108,105,116, 95, 99, 95,116,111,107,101,110,115, 40,115,
- 44, 39, 37, 42, 37,115, 42, 37, 42, 39, 41, 10, 32,105,102,
- 32,116, 46,110, 32, 61, 61, 32, 50, 32,116,104,101,110, 10,
- 32, 32,105,102, 32,107,105,110,100, 32, 61, 61, 32, 39,102,
- 117,110, 99, 39, 32,116,104,101,110, 10, 32, 32, 32,101,114,
- 114,111,114, 40, 34, 35,105,110,118, 97,108,105,100, 32,102,
- 117,110, 99,116,105,111,110, 32,114,101,116,117,114,110, 32,
- 116,121,112,101, 58, 32, 34, 46, 46,115, 41, 10, 32, 32,101,
- 110,100, 10, 32, 32, 45, 45,108,111, 99, 97,108, 32,109, 32,
- 61, 32,115,112,108,105,116, 40,116, 91, 49, 93, 44, 39, 37,
- 115, 37,115, 42, 39, 41, 10, 32, 32,108,111, 99, 97,108, 32,
- 109, 32, 61, 32,115,112,108,105,116, 95, 99, 95,116,111,107,
- 101,110,115, 40,116, 91, 49, 93, 44, 39, 37,115, 43, 39, 41,
- 10, 32, 32,114,101,116,117,114,110, 32, 95, 68,101, 99,108,
- 97,114, 97,116,105,111,110,123, 10, 32, 32, 32,110, 97,109,
- 101, 32, 61, 32,116, 91, 50, 93, 46, 46,116,109,112,100,101,
- 102, 44, 10, 32, 32, 32,112,116,114, 32, 61, 32, 39, 42, 39,
- 44, 10, 32, 32, 32,114,101,116, 32, 61, 32, 39, 42, 39, 44,
- 10, 32, 32, 32, 45, 45,116,121,112,101, 32, 61, 32,114,101,
- 98,117,105,108,100, 95,116,101,109,112,108, 97,116,101, 40,
- 109, 91,109, 46,110, 93, 44, 32,116, 98, 44, 32,116,105,109,
- 112,108, 41, 44, 10, 32, 32, 32,116,121,112,101, 32, 61, 32,
- 109, 91,109, 46,110, 93, 44, 10, 32, 32, 32,109,111,100, 32,
- 61, 32, 99,111,110, 99, 97,116, 40,109, 44, 49, 44,109, 46,
- 110, 45, 49, 41, 44, 10, 32, 32, 32,105,115, 95,112, 97,114,
- 97,109,101,116,101,114, 32, 61, 32,105,115, 95,112, 97,114,
- 97,109,101,116,101,114, 44, 10, 32, 32, 32,107,105,110,100,
- 32, 61, 32,107,105,110,100, 10, 32, 32,125, 10, 32,101,110,
- 100, 10, 10, 32, 45, 45, 32, 99,104,101, 99,107, 32,116,104,
- 101, 32,102,111,114,109, 58, 32,109,111,100, 32,116,121,112,
- 101, 38, 32,110, 97,109,101, 10, 32,116, 32, 61, 32,115,112,
- 108,105,116, 95, 99, 95,116,111,107,101,110,115, 40,115, 44,
- 39, 38, 39, 41, 10, 32,105,102, 32,116, 46,110, 32, 61, 61,
- 32, 50, 32,116,104,101,110, 10, 32, 32, 45, 45,108,111, 99,
- 97,108, 32,109, 32, 61, 32,115,112,108,105,116, 40,116, 91,
- 49, 93, 44, 39, 37,115, 37,115, 42, 39, 41, 10, 32, 32,108,
- 111, 99, 97,108, 32,109, 32, 61, 32,115,112,108,105,116, 95,
- 99, 95,116,111,107,101,110,115, 40,116, 91, 49, 93, 44, 39,
- 37,115, 43, 39, 41, 10, 32, 32,114,101,116,117,114,110, 32,
- 95, 68,101, 99,108, 97,114, 97,116,105,111,110,123, 10, 32,
- 32, 32,110, 97,109,101, 32, 61, 32,116, 91, 50, 93, 46, 46,
- 116,109,112,100,101,102, 44, 10, 32, 32, 32,112,116,114, 32,
- 61, 32, 39, 38, 39, 44, 10, 32, 32, 32, 45, 45,116,121,112,
- 101, 32, 61, 32,114,101, 98,117,105,108,100, 95,116,101,109,
- 112,108, 97,116,101, 40,109, 91,109, 46,110, 93, 44, 32,116,
- 98, 44, 32,116,105,109,112,108, 41, 44, 10, 32, 32, 32,116,
- 121,112,101, 32, 61, 32,109, 91,109, 46,110, 93, 44, 10, 32,
- 32, 32,109,111,100, 32, 61, 32, 99,111,110, 99, 97,116, 40,
- 109, 44, 49, 44,109, 46,110, 45, 49, 41, 44, 10, 32, 32, 32,
- 105,115, 95,112, 97,114, 97,109,101,116,101,114, 32, 61, 32,
- 105,115, 95,112, 97,114, 97,109,101,116,101,114, 44, 10, 32,
- 32, 32,107,105,110,100, 32, 61, 32,107,105,110,100, 10, 32,
- 32,125, 10, 32,101,110,100, 10, 10, 32, 45, 45, 32, 99,104,
- 101, 99,107, 32,116,104,101, 32,102,111,114,109, 58, 32,109,
- 111,100, 32,116,121,112,101, 42, 32,110, 97,109,101, 10, 32,
- 108,111, 99, 97,108, 32,115, 49, 32, 61, 32,103,115,117, 98,
- 40,115, 44, 34, 40, 37, 98, 92, 91, 92, 93, 41, 34, 44,102,
- 117,110, 99,116,105,111,110, 32, 40,110, 41, 32,114,101,116,
- 117,114,110, 32,103,115,117, 98, 40,110, 44, 39, 37, 42, 39,
- 44, 39, 92, 49, 39, 41, 32,101,110,100, 41, 10, 32,116, 32,
- 61, 32,115,112,108,105,116, 95, 99, 95,116,111,107,101,110,
- 115, 40,115, 49, 44, 39, 37, 42, 39, 41, 10, 32,105,102, 32,
- 116, 46,110, 32, 61, 61, 32, 50, 32,116,104,101,110, 10, 32,
- 32,116, 91, 50, 93, 32, 61, 32,103,115,117, 98, 40,116, 91,
- 50, 93, 44, 39, 92, 49, 39, 44, 39, 37, 42, 39, 41, 32, 45,
- 45, 32,114,101,115,116,111,114,101, 32, 42, 32,105,110, 32,
- 100,105,109,101,110,115,105,111,110, 32,101,120,112,114,101,
- 115,115,105,111,110, 10, 32, 32, 45, 45,108,111, 99, 97,108,
- 32,109, 32, 61, 32,115,112,108,105,116, 40,116, 91, 49, 93,
- 44, 39, 37,115, 37,115, 42, 39, 41, 10, 32, 32,108,111, 99,
- 97,108, 32,109, 32, 61, 32,115,112,108,105,116, 95, 99, 95,
- 116,111,107,101,110,115, 40,116, 91, 49, 93, 44, 39, 37,115,
- 43, 39, 41, 10, 32, 32,114,101,116,117,114,110, 32, 95, 68,
- 101, 99,108, 97,114, 97,116,105,111,110,123, 10, 32, 32, 32,
- 110, 97,109,101, 32, 61, 32,116, 91, 50, 93, 46, 46,116,109,
- 112,100,101,102, 44, 10, 32, 32, 32,112,116,114, 32, 61, 32,
- 39, 42, 39, 44, 10, 32, 32, 32,116,121,112,101, 32, 61, 32,
- 109, 91,109, 46,110, 93, 44, 10, 32, 32, 32, 45, 45,116,121,
- 112,101, 32, 61, 32,114,101, 98,117,105,108,100, 95,116,101,
- 109,112,108, 97,116,101, 40,109, 91,109, 46,110, 93, 44, 32,
- 116, 98, 44, 32,116,105,109,112,108, 41, 44, 10, 32, 32, 32,
- 109,111,100, 32, 61, 32, 99,111,110, 99, 97,116, 40,109, 44,
- 49, 44,109, 46,110, 45, 49, 41, 32, 32, 32, 44, 10, 32, 32,
- 32,105,115, 95,112, 97,114, 97,109,101,116,101,114, 32, 61,
- 32,105,115, 95,112, 97,114, 97,109,101,116,101,114, 44, 10,
- 32, 32, 32,107,105,110,100, 32, 61, 32,107,105,110,100, 10,
- 32, 32,125, 10, 32,101,110,100, 10, 10, 32,105,102, 32,107,
- 105,110,100, 32, 61, 61, 32, 39,118, 97,114, 39, 32,116,104,
- 101,110, 10, 32, 32, 45, 45, 32, 99,104,101, 99,107, 32,116,
- 104,101, 32,102,111,114,109, 58, 32,109,111,100, 32,116,121,
- 112,101, 32,110, 97,109,101, 10, 32, 32, 45, 45,116, 32, 61,
- 32,115,112,108,105,116, 40,115, 44, 39, 37,115, 37,115, 42,
- 39, 41, 10, 32, 32,116, 32, 61, 32,115,112,108,105,116, 95,
- 99, 95,116,111,107,101,110,115, 40,115, 44, 39, 37,115, 43,
- 39, 41, 10, 32, 32,108,111, 99, 97,108, 32,118, 10, 32, 32,
- 105,102, 32,102,105,110,100,116,121,112,101, 40,116, 91,116,
- 46,110, 93, 41, 32,116,104,101,110, 32,118, 32, 61, 32, 99,
- 114,101, 97,116,101, 95,118, 97,114,110, 97,109,101, 40, 41,
- 32,101,108,115,101, 32,118, 32, 61, 32,116, 91,116, 46,110,
- 93, 59, 32,116, 46,110, 32, 61, 32,116, 46,110, 45, 49, 32,
- 101,110,100, 10, 32, 32,114,101,116,117,114,110, 32, 95, 68,
- 101, 99,108, 97,114, 97,116,105,111,110,123, 10, 32, 32, 32,
- 110, 97,109,101, 32, 61, 32,118, 46, 46,116,109,112,100,101,
- 102, 44, 10, 32, 32, 32, 45, 45,116,121,112,101, 32, 61, 32,
- 114,101, 98,117,105,108,100, 95,116,101,109,112,108, 97,116,
- 101, 40,116, 91,116, 46,110, 93, 44, 32,116, 98, 44, 32,116,
- 105,109,112,108, 41, 44, 10, 32, 32, 32,116,121,112,101, 32,
- 61, 32,116, 91,116, 46,110, 93, 44, 10, 32, 32, 32,109,111,
- 100, 32, 61, 32, 99,111,110, 99, 97,116, 40,116, 44, 49, 44,
- 116, 46,110, 45, 49, 41, 44, 10, 32, 32, 32,105,115, 95,112,
- 97,114, 97,109,101,116,101,114, 32, 61, 32,105,115, 95,112,
- 97,114, 97,109,101,116,101,114, 44, 10, 32, 32, 32,107,105,
- 110,100, 32, 61, 32,107,105,110,100, 10, 32, 32,125, 10, 10,
- 32,101,108,115,101, 32, 45, 45, 32,107,105,110,100, 32, 61,
- 61, 32, 34,102,117,110, 99, 34, 10, 10, 32, 32, 45, 45, 32,
- 99,104,101, 99,107, 32,116,104,101, 32,102,111,114,109, 58,
- 32,109,111,100, 32,116,121,112,101, 32,110, 97,109,101, 10,
- 32, 32, 45, 45,116, 32, 61, 32,115,112,108,105,116, 40,115,
- 44, 39, 37,115, 37,115, 42, 39, 41, 10, 32, 32,116, 32, 61,
- 32,115,112,108,105,116, 95, 99, 95,116,111,107,101,110,115,
- 40,115, 44, 39, 37,115, 43, 39, 41, 10, 32, 32,108,111, 99,
- 97,108, 32,118, 32, 61, 32,116, 91,116, 46,110, 93, 32, 32,
- 45, 45, 32,108, 97,115,116, 32,119,111,114,100, 32,105,115,
- 32,116,104,101, 32,102,117,110, 99,116,105,111,110, 32,110,
- 97,109,101, 10, 32, 32,108,111, 99, 97,108, 32,116,112, 44,
- 109,100, 10, 32, 32,105,102, 32,116, 46,110, 62, 49, 32,116,
- 104,101,110, 10, 32, 32, 32,116,112, 32, 61, 32,116, 91,116,
- 46,110, 45, 49, 93, 10, 32, 32, 32,109,100, 32, 61, 32, 99,
- 111,110, 99, 97,116, 40,116, 44, 49, 44,116, 46,110, 45, 50,
- 41, 10, 32, 32,101,110,100, 10, 32, 32, 45, 45,105,102, 32,
- 116,112, 32,116,104,101,110, 32,116,112, 32, 61, 32,114,101,
- 98,117,105,108,100, 95,116,101,109,112,108, 97,116,101, 40,
- 116,112, 44, 32,116, 98, 44, 32,116,105,109,112,108, 41, 32,
- 101,110,100, 10, 32, 32,114,101,116,117,114,110, 32, 95, 68,
- 101, 99,108, 97,114, 97,116,105,111,110,123, 10, 32, 32, 32,
- 110, 97,109,101, 32, 61, 32,118, 44, 10, 32, 32, 32,116,121,
- 112,101, 32, 61, 32,116,112, 44, 10, 32, 32, 32,109,111,100,
- 32, 61, 32,109,100, 44, 10, 32, 32, 32,105,115, 95,112, 97,
- 114, 97,109,101,116,101,114, 32, 61, 32,105,115, 95,112, 97,
- 114, 97,109,101,116,101,114, 44, 10, 32, 32, 32,107,105,110,
- 100, 32, 61, 32,107,105,110,100, 10, 32, 32,125, 10, 32,101,
- 110,100, 10, 10,101,110,100,32
- };
- tolua_dobuffer(tolua_S,(char*)B,sizeof(B),"tolua embedded: src/bin/lua/declaration.lua");
+ #include "declaration_lua.h"
+ tolua_dobuffer(tolua_S,(char*)lua_declaration_lua,sizeof(lua_declaration_lua),"tolua embedded: src/bin/lua/declaration.lua");
lua_settop(tolua_S, top);
} /* end of embedded lua code */
@@ -5972,960 +4205,8 @@ TOLUA_API int tolua_tolua_open (lua_State* tolua_S)
{ /* begin embedded lua code */
int top = lua_gettop(tolua_S);
- static unsigned char B[] = {
- 45, 45, 32,116,111,108,117, 97, 58, 32,102,117,110, 99,116,
- 105,111,110, 32, 99,108, 97,115,115, 10, 45, 45, 32, 87,114,
- 105,116,116,101,110, 32, 98,121, 32, 87, 97,108,100,101,109,
- 97,114, 32, 67,101,108,101,115, 10, 45, 45, 32, 84,101, 67,
- 71,114, 97,102, 47, 80, 85, 67, 45, 82,105,111, 10, 45, 45,
- 32, 74,117,108, 32, 49, 57, 57, 56, 10, 45, 45, 32, 36, 73,
- 100, 58, 32, 36, 10, 10, 45, 45, 32, 84,104,105,115, 32, 99,
- 111,100,101, 32,105,115, 32,102,114,101,101, 32,115,111,102,
- 116,119, 97,114,101, 59, 32,121,111,117, 32, 99, 97,110, 32,
- 114,101,100,105,115,116,114,105, 98,117,116,101, 32,105,116,
- 32, 97,110,100, 47,111,114, 32,109,111,100,105,102,121, 32,
- 105,116, 46, 10, 45, 45, 32, 84,104,101, 32,115,111,102,116,
- 119, 97,114,101, 32,112,114,111,118,105,100,101,100, 32,104,
- 101,114,101,117,110,100,101,114, 32,105,115, 32,111,110, 32,
- 97,110, 32, 34, 97,115, 32,105,115, 34, 32, 98, 97,115,105,
- 115, 44, 32, 97,110,100, 10, 45, 45, 32,116,104,101, 32, 97,
- 117,116,104,111,114, 32,104, 97,115, 32,110,111, 32,111, 98,
- 108,105,103, 97,116,105,111,110, 32,116,111, 32,112,114,111,
- 118,105,100,101, 32,109, 97,105,110,116,101,110, 97,110, 99,
- 101, 44, 32,115,117,112,112,111,114,116, 44, 32,117,112,100,
- 97,116,101,115, 44, 10, 45, 45, 32,101,110,104, 97,110, 99,
- 101,109,101,110,116,115, 44, 32,111,114, 32,109,111,100,105,
- 102,105, 99, 97,116,105,111,110,115, 46, 10, 10, 10, 10, 45,
- 45, 32, 70,117,110, 99,116,105,111,110, 32, 99,108, 97,115,
- 115, 10, 45, 45, 32, 82,101,112,114,101,115,101,110,116,115,
- 32, 97, 32,102,117,110, 99,116,105,111,110, 32,111,114, 32,
- 97, 32, 99,108, 97,115,115, 32,109,101,116,104,111,100, 46,
- 10, 45, 45, 32, 84,104,101, 32,102,111,108,108,111,119,105,
- 110,103, 32,102,105,101,108,100,115, 32, 97,114,101, 32,115,
- 116,111,114,101,100, 58, 10, 45, 45, 32, 32,109,111,100, 32,
- 32, 61, 32,116,121,112,101, 32,109,111,100,105,102,105,101,
- 114,115, 10, 45, 45, 32, 32,116,121,112,101, 32, 61, 32,116,
- 121,112,101, 10, 45, 45, 32, 32,112,116,114, 32, 32, 61, 32,
- 34, 42, 34, 32,111,114, 32, 34, 38, 34, 44, 32,105,102, 32,
- 114,101,112,114,101,115,101,110,116,105,110,103, 32, 97, 32,
- 112,111,105,110,116,101,114, 32,111,114, 32, 97, 32,114,101,
- 102,101,114,101,110, 99,101, 10, 45, 45, 32, 32,110, 97,109,
- 101, 32, 61, 32,110, 97,109,101, 10, 45, 45, 32, 32,108,110,
- 97,109,101, 32, 61, 32,108,117, 97, 32,110, 97,109,101, 10,
- 45, 45, 32, 32, 97,114,103,115, 32, 32, 61, 32,108,105,115,
- 116, 32,111,102, 32, 97,114,103,117,109,101,110,116, 32,100,
- 101, 99,108, 97,114, 97,116,105,111,110,115, 10, 45, 45, 32,
- 32, 99,111,110,115,116, 32, 61, 32,105,102, 32,105,116, 32,
- 105,115, 32, 97, 32,109,101,116,104,111,100, 32,114,101, 99,
- 101,105,118,105,110,103, 32, 97, 32, 99,111,110,115,116, 32,
- 34,116,104,105,115, 34, 46, 10, 99,108, 97,115,115, 70,117,
- 110, 99,116,105,111,110, 32, 61, 32,123, 10, 32,109,111,100,
- 32, 61, 32, 39, 39, 44, 10, 32,116,121,112,101, 32, 61, 32,
- 39, 39, 44, 10, 32,112,116,114, 32, 61, 32, 39, 39, 44, 10,
- 32,110, 97,109,101, 32, 61, 32, 39, 39, 44, 10, 32, 97,114,
- 103,115, 32, 61, 32,123,110, 61, 48,125, 44, 10, 32, 99,111,
- 110,115,116, 32, 61, 32, 39, 39, 44, 10,125, 10, 99,108, 97,
- 115,115, 70,117,110, 99,116,105,111,110, 46, 95, 95,105,110,
- 100,101,120, 32, 61, 32, 99,108, 97,115,115, 70,117,110, 99,
- 116,105,111,110, 10,115,101,116,109,101,116, 97,116, 97, 98,
- 108,101, 40, 99,108, 97,115,115, 70,117,110, 99,116,105,111,
- 110, 44, 99,108, 97,115,115, 70,101, 97,116,117,114,101, 41,
- 10, 10, 45, 45, 32,100,101, 99,108, 97,114,101, 32,116, 97,
- 103,115, 10,102,117,110, 99,116,105,111,110, 32, 99,108, 97,
- 115,115, 70,117,110, 99,116,105,111,110, 58,100,101, 99,108,
- 116,121,112,101, 32, 40, 41, 10, 32,115,101,108,102, 46,116,
- 121,112,101, 32, 61, 32,116,121,112,101,118, 97,114, 40,115,
- 101,108,102, 46,116,121,112,101, 41, 10, 32,105,102, 32,115,
- 116,114,102,105,110,100, 40,115,101,108,102, 46,109,111,100,
- 44, 39, 99,111,110,115,116, 39, 41, 32,116,104,101,110, 10,
- 9, 32,115,101,108,102, 46,116,121,112,101, 32, 61, 32, 39,
- 99,111,110,115,116, 32, 39, 46, 46,115,101,108,102, 46,116,
- 121,112,101, 10, 9, 9,115,101,108,102, 46,109,111,100, 32,
- 61, 32,103,115,117, 98, 40,115,101,108,102, 46,109,111,100,
- 44, 39, 99,111,110,115,116, 39, 44, 39, 39, 41, 10, 9,101,
- 110,100, 10, 32,108,111, 99, 97,108, 32,105, 61, 49, 10, 32,
- 119,104,105,108,101, 32,115,101,108,102, 46, 97,114,103,115,
- 91,105, 93, 32,100,111, 10, 32, 32,115,101,108,102, 46, 97,
- 114,103,115, 91,105, 93, 58,100,101, 99,108,116,121,112,101,
- 40, 41, 10, 32, 32,105, 32, 61, 32,105, 43, 49, 10, 32,101,
- 110,100, 10,101,110,100, 10, 10, 10, 45, 45, 32, 87,114,105,
- 116,101, 32, 98,105,110,100,105,110,103, 32,102,117,110, 99,
- 116,105,111,110, 10, 45, 45, 32, 79,117,116,112,117,116,115,
- 32, 67, 47, 67, 43, 43, 32, 98,105,110,100,105,110,103, 32,
- 102,117,110, 99,116,105,111,110, 46, 10,102,117,110, 99,116,
- 105,111,110, 32, 99,108, 97,115,115, 70,117,110, 99,116,105,
- 111,110, 58,115,117,112, 99,111,100,101, 32, 40,108,111, 99,
- 97,108, 95, 99,111,110,115,116,114,117, 99,116,111,114, 41,
- 10, 10, 32,108,111, 99, 97,108, 32,111,118,101,114,108,111,
- 97,100, 32, 61, 32,115,116,114,115,117, 98, 40,115,101,108,
- 102, 46, 99,110, 97,109,101, 44, 45, 50, 44, 45, 49, 41, 32,
- 45, 32, 49, 32, 32, 45, 45, 32,105,110,100,105, 99, 97,116,
- 101, 32,111,118,101,114,108,111, 97,100,101,100, 32,102,117,
- 110, 99, 10, 32,108,111, 99, 97,108, 32,110,114,101,116, 32,
- 61, 32, 48, 32, 32, 32, 32, 32, 32, 45, 45, 32,110,117,109,
- 98,101,114, 32,111,102, 32,114,101,116,117,114,110,101,100,
- 32,118, 97,108,117,101,115, 10, 32,108,111, 99, 97,108, 32,
- 99,108, 97,115,115, 32, 61, 32,115,101,108,102, 58,105,110,
- 99,108, 97,115,115, 40, 41, 10, 32,108,111, 99, 97,108, 32,
- 95, 44, 95, 44,115,116, 97,116,105, 99, 32, 61, 32,115,116,
- 114,102,105,110,100, 40,115,101,108,102, 46,109,111,100, 44,
- 39, 94, 37,115, 42, 40,115,116, 97,116,105, 99, 41, 39, 41,
- 10, 32,105,102, 32, 99,108, 97,115,115, 32,116,104,101,110,
- 10, 10, 32, 9,105,102, 32,115,101,108,102, 46,110, 97,109,
- 101, 32, 61, 61, 32, 39,110,101,119, 39, 32, 97,110,100, 32,
- 115,101,108,102, 46,112, 97,114,101,110,116, 46,102,108, 97,
- 103,115, 46,112,117,114,101, 95,118,105,114,116,117, 97,108,
- 32,116,104,101,110, 10, 32, 9, 9, 45, 45, 32,110,111, 32,
- 99,111,110,115,116,114,117, 99,116,111,114, 32,102,111,114,
- 32, 99,108, 97,115,115,101,115, 32,119,105,116,104, 32,112,
- 117,114,101, 32,118,105,114,116,117, 97,108, 32,109,101,116,
- 104,111,100,115, 10, 32, 9, 9,114,101,116,117,114,110, 10,
- 32, 9,101,110,100, 10, 10, 32, 9,105,102, 32,108,111, 99,
- 97,108, 95, 99,111,110,115,116,114,117, 99,116,111,114, 32,
- 116,104,101,110, 10, 9, 9,111,117,116,112,117,116, 40, 34,
- 47, 42, 32,109,101,116,104,111,100, 58, 32,110,101,119, 95,
- 108,111, 99, 97,108, 32,111,102, 32, 99,108, 97,115,115, 32,
- 34, 44, 99,108, 97,115,115, 44, 34, 32, 42, 47, 34, 41, 10,
- 9,101,108,115,101, 10, 9, 9,111,117,116,112,117,116, 40,
- 34, 47, 42, 32,109,101,116,104,111,100, 58, 34, 44,115,101,
- 108,102, 46,110, 97,109,101, 44, 34, 32,111,102, 32, 99,108,
- 97,115,115, 32, 34, 44, 99,108, 97,115,115, 44, 34, 32, 42,
- 47, 34, 41, 10, 9,101,110,100, 10, 32,101,108,115,101, 10,
- 32, 32,111,117,116,112,117,116, 40, 34, 47, 42, 32,102,117,
- 110, 99,116,105,111,110, 58, 34, 44,115,101,108,102, 46,110,
- 97,109,101, 44, 34, 32, 42, 47, 34, 41, 10, 32,101,110,100,
- 10, 10, 32,105,102, 32,108,111, 99, 97,108, 95, 99,111,110,
- 115,116,114,117, 99,116,111,114, 32,116,104,101,110, 10, 32,
- 32,111,117,116,112,117,116, 40, 34, 35,105,102,110,100,101,
- 102, 32, 84, 79, 76, 85, 65, 95, 68, 73, 83, 65, 66, 76, 69,
- 95, 34, 46, 46,115,101,108,102, 46, 99,110, 97,109,101, 46,
- 46, 34, 95,108,111, 99, 97,108, 34, 41, 10, 32, 32,111,117,
- 116,112,117,116, 40, 34, 92,110,115,116, 97,116,105, 99, 32,
- 105,110,116, 34, 44,115,101,108,102, 46, 99,110, 97,109,101,
- 46, 46, 34, 95,108,111, 99, 97,108, 34, 44, 34, 40,108,117,
- 97, 95, 83,116, 97,116,101, 42, 32,116,111,108,117, 97, 95,
- 83, 41, 34, 41, 10, 32,101,108,115,101, 10, 32, 32,111,117,
- 116,112,117,116, 40, 34, 35,105,102,110,100,101,102, 32, 84,
- 79, 76, 85, 65, 95, 68, 73, 83, 65, 66, 76, 69, 95, 34, 46,
- 46,115,101,108,102, 46, 99,110, 97,109,101, 41, 10, 32, 32,
- 111,117,116,112,117,116, 40, 34, 92,110,115,116, 97,116,105,
- 99, 32,105,110,116, 34, 44,115,101,108,102, 46, 99,110, 97,
- 109,101, 44, 34, 40,108,117, 97, 95, 83,116, 97,116,101, 42,
- 32,116,111,108,117, 97, 95, 83, 41, 34, 41, 10, 32,101,110,
- 100, 10, 32,111,117,116,112,117,116, 40, 34,123, 34, 41, 10,
- 10, 32, 45, 45, 32, 99,104,101, 99,107, 32,116,121,112,101,
- 115, 10, 9,105,102, 32,111,118,101,114,108,111, 97,100, 32,
- 60, 32, 48, 32,116,104,101,110, 10, 9, 32,111,117,116,112,
- 117,116, 40, 39, 35,105,102,110,100,101,102, 32, 84, 79, 76,
- 85, 65, 95, 82, 69, 76, 69, 65, 83, 69, 92,110, 39, 41, 10,
- 9,101,110,100, 10, 9,111,117,116,112,117,116, 40, 39, 32,
- 116,111,108,117, 97, 95, 69,114,114,111,114, 32,116,111,108,
- 117, 97, 95,101,114,114, 59, 39, 41, 10, 32,111,117,116,112,
- 117,116, 40, 39, 32,105,102, 32, 40, 92,110, 39, 41, 10, 32,
- 45, 45, 32, 99,104,101, 99,107, 32,115,101,108,102, 10, 32,
- 108,111, 99, 97,108, 32,110, 97,114,103, 10, 32,105,102, 32,
- 99,108, 97,115,115, 32,116,104,101,110, 32,110, 97,114,103,
- 61, 50, 32,101,108,115,101, 32,110, 97,114,103, 61, 49, 32,
- 101,110,100, 10, 32,105,102, 32, 99,108, 97,115,115, 32,116,
- 104,101,110, 10, 9, 9,108,111, 99, 97,108, 32,102,117,110,
- 99, 32, 61, 32,103,101,116, 95,105,115, 95,102,117,110, 99,
- 116,105,111,110, 40,115,101,108,102, 46,112, 97,114,101,110,
- 116, 46,116,121,112,101, 41, 10, 9, 9,108,111, 99, 97,108,
- 32,116,121,112,101, 32, 61, 32,115,101,108,102, 46,112, 97,
- 114,101,110,116, 46,116,121,112,101, 10, 9, 9,105,102, 32,
- 115,101,108,102, 46,110, 97,109,101, 61, 61, 39,110,101,119,
- 39, 32,111,114, 32,115,116, 97,116,105, 99,126, 61,110,105,
- 108, 32,116,104,101,110, 10, 9, 9, 9,102,117,110, 99, 32,
- 61, 32, 39,116,111,108,117, 97, 95,105,115,117,115,101,114,
- 116, 97, 98,108,101, 39, 10, 9, 9, 9,116,121,112,101, 32,
- 61, 32,115,101,108,102, 46,112, 97,114,101,110,116, 46,116,
- 121,112,101, 10, 9, 9,101,110,100, 10, 9, 9,105,102, 32,
- 115,101,108,102, 46, 99,111,110,115,116, 32,126, 61, 32, 39,
- 39, 32,116,104,101,110, 10, 9, 9, 9,116,121,112,101, 32,
- 61, 32, 34, 99,111,110,115,116, 32, 34, 46, 46,116,121,112,
- 101, 10, 9, 9,101,110,100, 10, 9, 9,111,117,116,112,117,
- 116, 40, 39, 32, 32, 32, 32, 32, 33, 39, 46, 46,102,117,110,
- 99, 46, 46, 39, 40,116,111,108,117, 97, 95, 83, 44, 49, 44,
- 34, 39, 46, 46,116,121,112,101, 46, 46, 39, 34, 44, 48, 44,
- 38,116,111,108,117, 97, 95,101,114,114, 41, 32,124,124, 92,
- 110, 39, 41, 10, 32,101,110,100, 10, 32, 45, 45, 32, 99,104,
- 101, 99,107, 32, 97,114,103,115, 10, 32,105,102, 32,115,101,
- 108,102, 46, 97,114,103,115, 91, 49, 93, 46,116,121,112,101,
- 32,126, 61, 32, 39,118,111,105,100, 39, 32,116,104,101,110,
- 10, 32, 32,108,111, 99, 97,108, 32,105, 61, 49, 10, 32, 32,
- 119,104,105,108,101, 32,115,101,108,102, 46, 97,114,103,115,
- 91,105, 93, 32,100,111, 10, 32, 32, 32,108,111, 99, 97,108,
- 32, 98,116,121,112,101, 32, 61, 32,105,115, 98, 97,115,105,
- 99, 40,115,101,108,102, 46, 97,114,103,115, 91,105, 93, 46,
- 116,121,112,101, 41, 10, 32, 32, 32,105,102, 32, 98,116,121,
- 112,101, 32,126, 61, 32, 39,118, 97,108,117,101, 39, 32, 97,
- 110,100, 32, 98,116,121,112,101, 32,126, 61, 32, 39,115,116,
- 97,116,101, 39, 32,116,104,101,110, 10, 32, 32, 32, 32,111,
- 117,116,112,117,116, 40, 39, 32, 32, 32, 32, 32, 39, 46, 46,
- 115,101,108,102, 46, 97,114,103,115, 91,105, 93, 58,111,117,
- 116, 99,104,101, 99,107,116,121,112,101, 40,110, 97,114,103,
- 41, 46, 46, 39, 32,124,124, 92,110, 39, 41, 10, 32, 32, 32,
- 101,110,100, 10, 32, 32, 32,105,102, 32, 98,116,121,112,101,
- 32,126, 61, 32, 39,115,116, 97,116,101, 39, 32,116,104,101,
- 110, 10, 9, 32, 32, 32,110, 97,114,103, 32, 61, 32,110, 97,
- 114,103, 43, 49, 10, 32, 32, 32,101,110,100, 10, 32, 32, 32,
- 105, 32, 61, 32,105, 43, 49, 10, 32, 32,101,110,100, 10, 32,
- 101,110,100, 10, 32, 45, 45, 32, 99,104,101, 99,107, 32,101,
- 110,100, 32,111,102, 32,108,105,115,116, 10, 32,111,117,116,
- 112,117,116, 40, 39, 32, 32, 32, 32, 32, 33,116,111,108,117,
- 97, 95,105,115,110,111,111, 98,106, 40,116,111,108,117, 97,
- 95, 83, 44, 39, 46, 46,110, 97,114,103, 46, 46, 39, 44, 38,
- 116,111,108,117, 97, 95,101,114,114, 41, 92,110, 32, 41, 39,
- 41, 10, 9,111,117,116,112,117,116, 40, 39, 32, 32,103,111,
- 116,111, 32,116,111,108,117, 97, 95,108,101,114,114,111,114,
- 59, 39, 41, 10, 10, 32,111,117,116,112,117,116, 40, 39, 32,
- 101,108,115,101, 92,110, 39, 41, 10, 9,105,102, 32,111,118,
- 101,114,108,111, 97,100, 32, 60, 32, 48, 32,116,104,101,110,
- 10, 9, 32,111,117,116,112,117,116, 40, 39, 35,101,110,100,
- 105,102, 92,110, 39, 41, 10, 9,101,110,100, 10, 9,111,117,
- 116,112,117,116, 40, 39, 32,123, 39, 41, 10, 10, 32, 45, 45,
- 32,100,101, 99,108, 97,114,101, 32,115,101,108,102, 44, 32,
- 105,102, 32,116,104,101, 32, 99, 97,115,101, 10, 32,108,111,
- 99, 97,108, 32,110, 97,114,103, 10, 32,105,102, 32, 99,108,
- 97,115,115, 32,116,104,101,110, 32,110, 97,114,103, 61, 50,
- 32,101,108,115,101, 32,110, 97,114,103, 61, 49, 32,101,110,
- 100, 10, 32,105,102, 32, 99,108, 97,115,115, 32, 97,110,100,
- 32,115,101,108,102, 46,110, 97,109,101,126, 61, 39,110,101,
- 119, 39, 32, 97,110,100, 32,115,116, 97,116,105, 99, 61, 61,
- 110,105,108, 32,116,104,101,110, 10, 32, 32,111,117,116,112,
- 117,116, 40, 39, 32, 39, 44,115,101,108,102, 46, 99,111,110,
- 115,116, 44,115,101,108,102, 46,112, 97,114,101,110,116, 46,
- 116,121,112,101, 44, 39, 42, 39, 44, 39,115,101,108,102, 32,
- 61, 32, 39, 41, 10, 32, 32,111,117,116,112,117,116, 40, 39,
- 40, 39, 44,115,101,108,102, 46, 99,111,110,115,116, 44,115,
- 101,108,102, 46,112, 97,114,101,110,116, 46,116,121,112,101,
- 44, 39, 42, 41, 32, 39, 41, 10, 32, 32,108,111, 99, 97,108,
- 32,116,111, 95,102,117,110, 99, 32, 61, 32,103,101,116, 95,
- 116,111, 95,102,117,110, 99,116,105,111,110, 40,115,101,108,
- 102, 46,112, 97,114,101,110,116, 46,116,121,112,101, 41, 10,
- 32, 32,111,117,116,112,117,116, 40,116,111, 95,102,117,110,
- 99, 44, 39, 40,116,111,108,117, 97, 95, 83, 44, 49, 44, 48,
- 41, 59, 39, 41, 10, 32,101,108,115,101,105,102, 32,115,116,
- 97,116,105, 99, 32,116,104,101,110, 10, 32, 32, 95, 44, 95,
- 44,115,101,108,102, 46,109,111,100, 32, 61, 32,115,116,114,
- 102,105,110,100, 40,115,101,108,102, 46,109,111,100, 44, 39,
- 94, 37,115, 42,115,116, 97,116,105, 99, 37,115, 37,115, 42,
- 40, 46, 42, 41, 39, 41, 10, 32,101,110,100, 10, 32, 45, 45,
- 32,100,101, 99,108, 97,114,101, 32,112, 97,114, 97,109,101,
- 116,101,114,115, 10, 32,105,102, 32,115,101,108,102, 46, 97,
- 114,103,115, 91, 49, 93, 46,116,121,112,101, 32,126, 61, 32,
- 39,118,111,105,100, 39, 32,116,104,101,110, 10, 32, 32,108,
- 111, 99, 97,108, 32,105, 61, 49, 10, 32, 32,119,104,105,108,
- 101, 32,115,101,108,102, 46, 97,114,103,115, 91,105, 93, 32,
- 100,111, 10, 32, 32, 32,115,101,108,102, 46, 97,114,103,115,
- 91,105, 93, 58,100,101, 99,108, 97,114,101, 40,110, 97,114,
- 103, 41, 10, 32, 32, 32,105,102, 32,105,115, 98, 97,115,105,
- 99, 40,115,101,108,102, 46, 97,114,103,115, 91,105, 93, 46,
- 116,121,112,101, 41, 32,126, 61, 32, 34,115,116, 97,116,101,
- 34, 32,116,104,101,110, 10, 9, 32, 32, 32,110, 97,114,103,
- 32, 61, 32,110, 97,114,103, 43, 49, 10, 32, 32, 32,101,110,
- 100, 10, 32, 32, 32,105, 32, 61, 32,105, 43, 49, 10, 32, 32,
- 101,110,100, 10, 32,101,110,100, 10, 10, 32, 45, 45, 32, 99,
- 104,101, 99,107, 32,115,101,108,102, 10, 32,105,102, 32, 99,
- 108, 97,115,115, 32, 97,110,100, 32,115,101,108,102, 46,110,
- 97,109,101,126, 61, 39,110,101,119, 39, 32, 97,110,100, 32,
- 115,116, 97,116,105, 99, 61, 61,110,105,108, 32,116,104,101,
- 110, 10, 9, 32,111,117,116,112,117,116, 40, 39, 35,105,102,
- 110,100,101,102, 32, 84, 79, 76, 85, 65, 95, 82, 69, 76, 69,
- 65, 83, 69, 92,110, 39, 41, 10, 9, 32,111,117,116,112,117,
- 116, 40, 39, 32, 32,105,102, 32, 40, 33,115,101,108,102, 41,
- 32,116,111,108,117, 97, 95,101,114,114,111,114, 40,116,111,
- 108,117, 97, 95, 83, 44, 34, 39, 46, 46,111,117,116,112,117,
- 116, 95,101,114,114,111,114, 95,104,111,111,107, 40, 34,105,
- 110,118, 97,108,105,100, 32, 92, 39,115,101,108,102, 92, 39,
- 32,105,110, 32,102,117,110, 99,116,105,111,110, 32, 92, 39,
- 37,115, 92, 39, 34, 44, 32,115,101,108,102, 46,110, 97,109,
- 101, 41, 46, 46, 39, 34, 44, 32, 78, 85, 76, 76, 41, 59, 39,
- 41, 59, 10, 9, 32,111,117,116,112,117,116, 40, 39, 35,101,
- 110,100,105,102, 92,110, 39, 41, 10, 32,101,110,100, 10, 10,
- 32, 45, 45, 32,103,101,116, 32, 97,114,114, 97,121, 32,101,
- 108,101,109,101,110,116, 32,118, 97,108,117,101,115, 10, 32,
- 105,102, 32, 99,108, 97,115,115, 32,116,104,101,110, 32,110,
- 97,114,103, 61, 50, 32,101,108,115,101, 32,110, 97,114,103,
- 61, 49, 32,101,110,100, 10, 32,105,102, 32,115,101,108,102,
- 46, 97,114,103,115, 91, 49, 93, 46,116,121,112,101, 32,126,
- 61, 32, 39,118,111,105,100, 39, 32,116,104,101,110, 10, 32,
- 32,108,111, 99, 97,108, 32,105, 61, 49, 10, 32, 32,119,104,
- 105,108,101, 32,115,101,108,102, 46, 97,114,103,115, 91,105,
- 93, 32,100,111, 10, 32, 32, 32,115,101,108,102, 46, 97,114,
- 103,115, 91,105, 93, 58,103,101,116, 97,114,114, 97,121, 40,
- 110, 97,114,103, 41, 10, 32, 32, 32,110, 97,114,103, 32, 61,
- 32,110, 97,114,103, 43, 49, 10, 32, 32, 32,105, 32, 61, 32,
- 105, 43, 49, 10, 32, 32,101,110,100, 10, 32,101,110,100, 10,
- 10, 32,112,114,101, 95, 99, 97,108,108, 95,104,111,111,107,
- 40,115,101,108,102, 41, 10, 10, 32,108,111, 99, 97,108, 32,
- 111,117,116, 32, 61, 32,115,116,114,105,110,103, 46,102,105,
- 110,100, 40,115,101,108,102, 46,109,111,100, 44, 32, 34,116,
- 111,108,117, 97, 95,111,117,116,115,105,100,101, 34, 41, 10,
- 32, 45, 45, 32, 99, 97,108,108, 32,102,117,110, 99,116,105,
- 111,110, 10, 32,105,102, 32, 99,108, 97,115,115, 32, 97,110,
- 100, 32,115,101,108,102, 46,110, 97,109,101, 61, 61, 39,100,
- 101,108,101,116,101, 39, 32,116,104,101,110, 10, 32, 32,111,
- 117,116,112,117,116, 40, 39, 32, 32, 77,116,111,108,117, 97,
- 95,100,101,108,101,116,101, 40,115,101,108,102, 41, 59, 39,
- 41, 10, 32,101,108,115,101,105,102, 32, 99,108, 97,115,115,
- 32, 97,110,100, 32,115,101,108,102, 46,110, 97,109,101, 32,
- 61, 61, 32, 39,111,112,101,114, 97,116,111,114, 38, 91, 93,
- 39, 32,116,104,101,110, 10, 32, 32,105,102, 32,102,108, 97,
- 103,115, 91, 39, 49, 39, 93, 32,116,104,101,110, 32, 45, 45,
- 32,102,111,114, 32, 99,111,109,112, 97,116,105, 98,105,108,
- 105,116,121, 32,119,105,116,104, 32,116,111,108,117, 97, 53,
- 32, 63, 10, 9,111,117,116,112,117,116, 40, 39, 32, 32,115,
- 101,108,102, 45, 62,111,112,101,114, 97,116,111,114, 91, 93,
- 40, 39, 44,115,101,108,102, 46, 97,114,103,115, 91, 49, 93,
- 46,110, 97,109,101, 44, 39, 45, 49, 41, 32, 61, 32, 39, 44,
- 115,101,108,102, 46, 97,114,103,115, 91, 50, 93, 46,110, 97,
- 109,101, 44, 39, 59, 39, 41, 10, 32, 32,101,108,115,101, 10,
- 32, 32, 32, 32,111,117,116,112,117,116, 40, 39, 32, 32,115,
- 101,108,102, 45, 62,111,112,101,114, 97,116,111,114, 91, 93,
- 40, 39, 44,115,101,108,102, 46, 97,114,103,115, 91, 49, 93,
- 46,110, 97,109,101, 44, 39, 41, 32, 61, 32, 39, 44,115,101,
- 108,102, 46, 97,114,103,115, 91, 50, 93, 46,110, 97,109,101,
- 44, 39, 59, 39, 41, 10, 32, 32,101,110,100, 10, 32,101,108,
- 115,101, 10, 32, 32,111,117,116,112,117,116, 40, 39, 32, 32,
- 123, 39, 41, 10, 32, 32,105,102, 32,115,101,108,102, 46,116,
- 121,112,101, 32,126, 61, 32, 39, 39, 32, 97,110,100, 32,115,
- 101,108,102, 46,116,121,112,101, 32,126, 61, 32, 39,118,111,
- 105,100, 39, 32,116,104,101,110, 10, 32, 32, 32,111,117,116,
- 112,117,116, 40, 39, 32, 32, 39, 44,115,101,108,102, 46,109,
- 111,100, 44,115,101,108,102, 46,116,121,112,101, 44,115,101,
- 108,102, 46,112,116,114, 44, 39,116,111,108,117, 97, 95,114,
- 101,116, 32, 61, 32, 39, 41, 10, 32, 32, 32,111,117,116,112,
- 117,116, 40, 39, 40, 39, 44,115,101,108,102, 46,109,111,100,
- 44,115,101,108,102, 46,116,121,112,101, 44,115,101,108,102,
- 46,112,116,114, 44, 39, 41, 32, 39, 41, 10, 32, 32,101,108,
- 115,101, 10, 32, 32, 32,111,117,116,112,117,116, 40, 39, 32,
- 32, 39, 41, 10, 32, 32,101,110,100, 10, 32, 32,105,102, 32,
- 99,108, 97,115,115, 32, 97,110,100, 32,115,101,108,102, 46,
- 110, 97,109,101, 61, 61, 39,110,101,119, 39, 32,116,104,101,
- 110, 10, 32, 32, 32,111,117,116,112,117,116, 40, 39, 77,116,
- 111,108,117, 97, 95,110,101,119, 40, 40, 39, 44,115,101,108,
- 102, 46,116,121,112,101, 44, 39, 41, 40, 39, 41, 10, 32, 32,
- 101,108,115,101,105,102, 32, 99,108, 97,115,115, 32, 97,110,
- 100, 32,115,116, 97,116,105, 99, 32,116,104,101,110, 10, 9,
- 105,102, 32,111,117,116, 32,116,104,101,110, 10, 9, 9,111,
- 117,116,112,117,116, 40,115,101,108,102, 46,110, 97,109,101,
- 44, 39, 40, 39, 41, 10, 9,101,108,115,101, 10, 9, 9,111,
- 117,116,112,117,116, 40, 99,108, 97,115,115, 46, 46, 39, 58,
- 58, 39, 46, 46,115,101,108,102, 46,110, 97,109,101, 44, 39,
- 40, 39, 41, 10, 9,101,110,100, 10, 32, 32,101,108,115,101,
- 105,102, 32, 99,108, 97,115,115, 32,116,104,101,110, 10, 9,
- 105,102, 32,111,117,116, 32,116,104,101,110, 10, 9, 9,111,
- 117,116,112,117,116, 40,115,101,108,102, 46,110, 97,109,101,
- 44, 39, 40, 39, 41, 10, 9,101,108,115,101, 10, 9, 32, 32,
- 105,102, 32,115,101,108,102, 46, 99, 97,115,116, 95,111,112,
- 101,114, 97,116,111,114, 32,116,104,101,110, 10, 9, 32, 32,
- 9, 45, 45,111,117,116,112,117,116, 40, 39,115,116, 97,116,
- 105, 99, 95, 99, 97,115,116, 60, 39, 44,115,101,108,102, 46,
- 109,111,100, 44,115,101,108,102, 46,116,121,112,101, 44,115,
- 101,108,102, 46,112,116,114, 44, 39, 32, 62, 40, 42,115,101,
- 108,102, 39, 41, 10, 9, 9,111,117,116,112,117,116, 40, 39,
- 115,101,108,102, 45, 62,111,112,101,114, 97,116,111,114, 32,
- 39, 44,115,101,108,102, 46,109,111,100, 44,115,101,108,102,
- 46,116,121,112,101, 44, 39, 40, 39, 41, 10, 9, 32, 32,101,
- 108,115,101, 10, 9, 9,111,117,116,112,117,116, 40, 39,115,
- 101,108,102, 45, 62, 39, 46, 46,115,101,108,102, 46,110, 97,
- 109,101, 44, 39, 40, 39, 41, 10, 9, 32, 32,101,110,100, 10,
- 9,101,110,100, 10, 32, 32,101,108,115,101, 10, 32, 32, 32,
- 111,117,116,112,117,116, 40,115,101,108,102, 46,110, 97,109,
- 101, 44, 39, 40, 39, 41, 10, 32, 32,101,110,100, 10, 10, 32,
- 32,105,102, 32,111,117,116, 32, 97,110,100, 32,110,111,116,
- 32,115,116, 97,116,105, 99, 32,116,104,101,110, 10, 32, 32,
- 9,111,117,116,112,117,116, 40, 39,115,101,108,102, 39, 41,
- 10, 9,105,102, 32,115,101,108,102, 46, 97,114,103,115, 91,
- 49, 93, 32, 97,110,100, 32,115,101,108,102, 46, 97,114,103,
- 115, 91, 49, 93, 46,110, 97,109,101, 32,126, 61, 32, 39, 39,
- 32,116,104,101,110, 10, 9, 9,111,117,116,112,117,116, 40,
- 39, 44, 39, 41, 10, 9,101,110,100, 10, 32, 32,101,110,100,
- 10, 32, 32, 45, 45, 32,119,114,105,116,101, 32,112, 97,114,
- 97,109,101,116,101,114,115, 10, 32, 32,108,111, 99, 97,108,
- 32,105, 61, 49, 10, 32, 32,119,104,105,108,101, 32,115,101,
- 108,102, 46, 97,114,103,115, 91,105, 93, 32,100,111, 10, 32,
- 32, 32,115,101,108,102, 46, 97,114,103,115, 91,105, 93, 58,
- 112, 97,115,115,112, 97,114, 40, 41, 10, 32, 32, 32,105, 32,
- 61, 32,105, 43, 49, 10, 32, 32, 32,105,102, 32,115,101,108,
- 102, 46, 97,114,103,115, 91,105, 93, 32,116,104,101,110, 10,
- 32, 32, 32, 32,111,117,116,112,117,116, 40, 39, 44, 39, 41,
- 10, 32, 32, 32,101,110,100, 10, 32, 32,101,110,100, 10, 10,
- 32, 32,105,102, 32, 99,108, 97,115,115, 32, 97,110,100, 32,
- 115,101,108,102, 46,110, 97,109,101, 32, 61, 61, 32, 39,111,
- 112,101,114, 97,116,111,114, 91, 93, 39, 32, 97,110,100, 32,
- 102,108, 97,103,115, 91, 39, 49, 39, 93, 32,116,104,101,110,
- 10, 9,111,117,116,112,117,116, 40, 39, 45, 49, 41, 59, 39,
- 41, 10, 32, 32,101,108,115,101, 10, 9,105,102, 32, 99,108,
- 97,115,115, 32, 97,110,100, 32,115,101,108,102, 46,110, 97,
- 109,101, 61, 61, 39,110,101,119, 39, 32,116,104,101,110, 10,
- 9, 9,111,117,116,112,117,116, 40, 39, 41, 41, 59, 39, 41,
- 32, 45, 45, 32, 99,108,111,115,101, 32, 77,116,111,108,117,
- 97, 95,110,101,119, 40, 10, 9,101,108,115,101, 10, 9, 9,
- 111,117,116,112,117,116, 40, 39, 41, 59, 39, 41, 10, 9,101,
- 110,100, 10, 32, 32,101,110,100, 10, 10, 32, 32, 45, 45, 32,
- 114,101,116,117,114,110, 32,118, 97,108,117,101,115, 10, 32,
- 32,105,102, 32,115,101,108,102, 46,116,121,112,101, 32,126,
- 61, 32, 39, 39, 32, 97,110,100, 32,115,101,108,102, 46,116,
- 121,112,101, 32,126, 61, 32, 39,118,111,105,100, 39, 32,116,
- 104,101,110, 10, 32, 32, 32,110,114,101,116, 32, 61, 32,110,
- 114,101,116, 32, 43, 32, 49, 10, 32, 32, 32,108,111, 99, 97,
- 108, 32,116, 44, 99,116, 32, 61, 32,105,115, 98, 97,115,105,
- 99, 40,115,101,108,102, 46,116,121,112,101, 41, 10, 32, 32,
- 32,105,102, 32,116, 32, 97,110,100, 32,115,101,108,102, 46,
- 110, 97,109,101, 32,126, 61, 32, 34,110,101,119, 34, 32,116,
- 104,101,110, 10, 32, 32, 32, 9,105,102, 32,115,101,108,102,
- 46, 99, 97,115,116, 95,111,112,101,114, 97,116,111,114, 32,
- 97,110,100, 32, 95, 98, 97,115,105, 99, 95,114, 97,119, 95,
- 112,117,115,104, 91,116, 93, 32,116,104,101,110, 10, 9, 9,
- 111,117,116,112,117,116, 40, 39, 32, 32, 32, 39, 44, 95, 98,
- 97,115,105, 99, 95,114, 97,119, 95,112,117,115,104, 91,116,
- 93, 44, 39, 40,116,111,108,117, 97, 95, 83, 44, 40, 39, 44,
- 99,116, 44, 39, 41,116,111,108,117, 97, 95,114,101,116, 41,
- 59, 39, 41, 10, 32, 32, 32, 9,101,108,115,101, 10, 9, 32,
- 32, 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32,116,
- 111,108,117, 97, 95,112,117,115,104, 39, 46, 46,116, 46, 46,
- 39, 40,116,111,108,117, 97, 95, 83, 44, 40, 39, 44, 99,116,
- 44, 39, 41,116,111,108,117, 97, 95,114,101,116, 41, 59, 39,
- 41, 10, 9,101,110,100, 10, 32, 32, 32,101,108,115,101, 10,
- 9,116, 32, 61, 32,115,101,108,102, 46,116,121,112,101, 10,
- 9,110,101,119, 95,116, 32, 61, 32,115,116,114,105,110,103,
- 46,103,115,117, 98, 40,116, 44, 32, 34, 99,111,110,115,116,
- 37,115, 43, 34, 44, 32, 34, 34, 41, 10, 9,108,111, 99, 97,
- 108, 32,111,119,110,101,100, 32, 61, 32,102, 97,108,115,101,
- 10, 9,105,102, 32,115,116,114,105,110,103, 46,102,105,110,
- 100, 40,115,101,108,102, 46,109,111,100, 44, 32, 34,116,111,
- 108,117, 97, 95,111,119,110,101,100, 34, 41, 32,116,104,101,
- 110, 10, 9, 9,111,119,110,101,100, 32, 61, 32,116,114,117,
- 101, 10, 9,101,110,100, 10, 32, 32, 32, 32,108,111, 99, 97,
- 108, 32,112,117,115,104, 95,102,117,110, 99, 32, 61, 32,103,
- 101,116, 95,112,117,115,104, 95,102,117,110, 99,116,105,111,
- 110, 40,116, 41, 10, 32, 32, 32, 32,105,102, 32,115,101,108,
- 102, 46,112,116,114, 32, 61, 61, 32, 39, 39, 32,116,104,101,
- 110, 10, 32, 32, 32, 32, 32,111,117,116,112,117,116, 40, 39,
- 32, 32, 32,123, 39, 41, 10, 32, 32, 32, 32, 32,111,117,116,
- 112,117,116, 40, 39, 35,105,102,100,101,102, 32, 95, 95, 99,
- 112,108,117,115,112,108,117,115, 92,110, 39, 41, 10, 32, 32,
- 32, 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32, 32,
- 118,111,105,100, 42, 32,116,111,108,117, 97, 95,111, 98,106,
- 32, 61, 32, 77,116,111,108,117, 97, 95,110,101,119, 40, 40,
- 39, 44,110,101,119, 95,116, 44, 39, 41, 40,116,111,108,117,
- 97, 95,114,101,116, 41, 41, 59, 39, 41, 10, 32, 32, 32, 32,
- 32,111,117,116,112,117,116, 40, 39, 32, 32, 32, 32, 39, 44,
- 112,117,115,104, 95,102,117,110, 99, 44, 39, 40,116,111,108,
- 117, 97, 95, 83, 44,116,111,108,117, 97, 95,111, 98,106, 44,
- 34, 39, 44,116, 44, 39, 34, 41, 59, 39, 41, 10, 32, 32, 32,
- 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32, 32,116,
- 111,108,117, 97, 95,114,101,103,105,115,116,101,114, 95,103,
- 99, 40,116,111,108,117, 97, 95, 83, 44,108,117, 97, 95,103,
- 101,116,116,111,112, 40,116,111,108,117, 97, 95, 83, 41, 41,
- 59, 39, 41, 10, 32, 32, 32, 32, 32,111,117,116,112,117,116,
- 40, 39, 35,101,108,115,101, 92,110, 39, 41, 10, 32, 32, 32,
- 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32, 32,118,
- 111,105,100, 42, 32,116,111,108,117, 97, 95,111, 98,106, 32,
- 61, 32,116,111,108,117, 97, 95, 99,111,112,121, 40,116,111,
- 108,117, 97, 95, 83, 44, 40,118,111,105,100, 42, 41, 38,116,
- 111,108,117, 97, 95,114,101,116, 44,115,105,122,101,111,102,
- 40, 39, 44,116, 44, 39, 41, 41, 59, 39, 41, 10, 32, 32, 32,
- 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32, 32, 39,
- 44,112,117,115,104, 95,102,117,110, 99, 44, 39, 40,116,111,
- 108,117, 97, 95, 83, 44,116,111,108,117, 97, 95,111, 98,106,
- 44, 34, 39, 44,116, 44, 39, 34, 41, 59, 39, 41, 10, 32, 32,
- 32, 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32, 32,
- 116,111,108,117, 97, 95,114,101,103,105,115,116,101,114, 95,
- 103, 99, 40,116,111,108,117, 97, 95, 83, 44,108,117, 97, 95,
- 103,101,116,116,111,112, 40,116,111,108,117, 97, 95, 83, 41,
- 41, 59, 39, 41, 10, 32, 32, 32, 32, 32,111,117,116,112,117,
- 116, 40, 39, 35,101,110,100,105,102, 92,110, 39, 41, 10, 32,
- 32, 32, 32, 32,111,117,116,112,117,116, 40, 39, 32, 32, 32,
- 125, 39, 41, 10, 32, 32, 32, 32,101,108,115,101,105,102, 32,
- 115,101,108,102, 46,112,116,114, 32, 61, 61, 32, 39, 38, 39,
- 32,116,104,101,110, 10, 32, 32, 32, 32, 32,111,117,116,112,
- 117,116, 40, 39, 32, 32, 32, 39, 44,112,117,115,104, 95,102,
- 117,110, 99, 44, 39, 40,116,111,108,117, 97, 95, 83, 44, 40,
- 118,111,105,100, 42, 41, 38,116,111,108,117, 97, 95,114,101,
- 116, 44, 34, 39, 44,116, 44, 39, 34, 41, 59, 39, 41, 10, 32,
- 32, 32, 32,101,108,115,101, 10, 9, 32,111,117,116,112,117,
- 116, 40, 39, 32, 32, 32, 39, 44,112,117,115,104, 95,102,117,
- 110, 99, 44, 39, 40,116,111,108,117, 97, 95, 83, 44, 40,118,
- 111,105,100, 42, 41,116,111,108,117, 97, 95,114,101,116, 44,
- 34, 39, 44,116, 44, 39, 34, 41, 59, 39, 41, 10, 9, 32,105,
- 102, 32,111,119,110,101,100, 32,111,114, 32,108,111, 99, 97,
- 108, 95, 99,111,110,115,116,114,117, 99,116,111,114, 32,116,
- 104,101,110, 10, 32, 32, 32, 32, 32, 32,111,117,116,112,117,
- 116, 40, 39, 32, 32, 32, 32,116,111,108,117, 97, 95,114,101,
- 103,105,115,116,101,114, 95,103, 99, 40,116,111,108,117, 97,
- 95, 83, 44,108,117, 97, 95,103,101,116,116,111,112, 40,116,
- 111,108,117, 97, 95, 83, 41, 41, 59, 39, 41, 10, 9, 32,101,
- 110,100, 10, 32, 32, 32, 32,101,110,100, 10, 32, 32, 32,101,
- 110,100, 10, 32, 32,101,110,100, 10, 32, 32,108,111, 99, 97,
- 108, 32,105, 61, 49, 10, 32, 32,119,104,105,108,101, 32,115,
- 101,108,102, 46, 97,114,103,115, 91,105, 93, 32,100,111, 10,
- 32, 32, 32,110,114,101,116, 32, 61, 32,110,114,101,116, 32,
- 43, 32,115,101,108,102, 46, 97,114,103,115, 91,105, 93, 58,
- 114,101,116,118, 97,108,117,101, 40, 41, 10, 32, 32, 32,105,
- 32, 61, 32,105, 43, 49, 10, 32, 32,101,110,100, 10, 32, 32,
- 111,117,116,112,117,116, 40, 39, 32, 32,125, 39, 41, 10, 10,
- 32, 32, 45, 45, 32,115,101,116, 32, 97,114,114, 97,121, 32,
- 101,108,101,109,101,110,116, 32,118, 97,108,117,101,115, 10,
- 32, 32,105,102, 32, 99,108, 97,115,115, 32,116,104,101,110,
- 32,110, 97,114,103, 61, 50, 32,101,108,115,101, 32,110, 97,
- 114,103, 61, 49, 32,101,110,100, 10, 32, 32,105,102, 32,115,
- 101,108,102, 46, 97,114,103,115, 91, 49, 93, 46,116,121,112,
- 101, 32,126, 61, 32, 39,118,111,105,100, 39, 32,116,104,101,
- 110, 10, 32, 32, 32,108,111, 99, 97,108, 32,105, 61, 49, 10,
- 32, 32, 32,119,104,105,108,101, 32,115,101,108,102, 46, 97,
- 114,103,115, 91,105, 93, 32,100,111, 10, 32, 32, 32, 32,115,
- 101,108,102, 46, 97,114,103,115, 91,105, 93, 58,115,101,116,
- 97,114,114, 97,121, 40,110, 97,114,103, 41, 10, 32, 32, 32,
- 32,110, 97,114,103, 32, 61, 32,110, 97,114,103, 43, 49, 10,
- 32, 32, 32, 32,105, 32, 61, 32,105, 43, 49, 10, 32, 32, 32,
- 101,110,100, 10, 32, 32,101,110,100, 10, 10, 32, 32, 45, 45,
- 32,102,114,101,101, 32,100,121,110, 97,109,105, 99, 97,108,
- 108,121, 32, 97,108,108,111, 99, 97,116,101,100, 32, 97,114,
- 114, 97,121, 10, 32, 32,105,102, 32,115,101,108,102, 46, 97,
- 114,103,115, 91, 49, 93, 46,116,121,112,101, 32,126, 61, 32,
- 39,118,111,105,100, 39, 32,116,104,101,110, 10, 32, 32, 32,
- 108,111, 99, 97,108, 32,105, 61, 49, 10, 32, 32, 32,119,104,
- 105,108,101, 32,115,101,108,102, 46, 97,114,103,115, 91,105,
- 93, 32,100,111, 10, 32, 32, 32, 32,115,101,108,102, 46, 97,
- 114,103,115, 91,105, 93, 58,102,114,101,101, 97,114,114, 97,
- 121, 40, 41, 10, 32, 32, 32, 32,105, 32, 61, 32,105, 43, 49,
- 10, 32, 32, 32,101,110,100, 10, 32, 32,101,110,100, 10, 32,
- 101,110,100, 10, 10, 32,112,111,115,116, 95, 99, 97,108,108,
- 95,104,111,111,107, 40,115,101,108,102, 41, 10, 10, 32,111,
- 117,116,112,117,116, 40, 39, 32,125, 39, 41, 10, 32,111,117,
- 116,112,117,116, 40, 39, 32,114,101,116,117,114,110, 32, 39,
- 46, 46,110,114,101,116, 46, 46, 39, 59, 39, 41, 10, 10, 32,
- 45, 45, 32, 99, 97,108,108, 32,111,118,101,114,108,111, 97,
- 100,101,100, 32,102,117,110, 99,116,105,111,110, 32,111,114,
- 32,103,101,110,101,114, 97,116,101, 32,101,114,114,111,114,
- 10, 9,105,102, 32,111,118,101,114,108,111, 97,100, 32, 60,
- 32, 48, 32,116,104,101,110, 10, 10, 9, 9,111,117,116,112,
- 117,116, 40, 39, 35,105,102,110,100,101,102, 32, 84, 79, 76,
- 85, 65, 95, 82, 69, 76, 69, 65, 83, 69, 92,110, 39, 41, 10,
- 9, 9,111,117,116,112,117,116, 40, 39,116,111,108,117, 97,
- 95,108,101,114,114,111,114, 58, 92,110, 39, 41, 10, 9, 9,
- 111,117,116,112,117,116, 40, 39, 32,116,111,108,117, 97, 95,
- 101,114,114,111,114, 40,116,111,108,117, 97, 95, 83, 44, 34,
- 39, 46, 46,111,117,116,112,117,116, 95,101,114,114,111,114,
- 95,104,111,111,107, 40, 34, 35,102,101,114,114,111,114, 32,
- 105,110, 32,102,117,110, 99,116,105,111,110, 32, 92, 39, 37,
- 115, 92, 39, 46, 34, 44, 32,115,101,108,102, 46,108,110, 97,
- 109,101, 41, 46, 46, 39, 34, 44, 38,116,111,108,117, 97, 95,
- 101,114,114, 41, 59, 39, 41, 10, 9, 9,111,117,116,112,117,
- 116, 40, 39, 32,114,101,116,117,114,110, 32, 48, 59, 39, 41,
- 10, 9, 9,111,117,116,112,117,116, 40, 39, 35,101,110,100,
- 105,102, 92,110, 39, 41, 10, 9,101,108,115,101, 10, 9, 9,
- 108,111, 99, 97,108, 32, 95,108,111, 99, 97,108, 32, 61, 32,
- 34, 34, 10, 9, 9,105,102, 32,108,111, 99, 97,108, 95, 99,
- 111,110,115,116,114,117, 99,116,111,114, 32,116,104,101,110,
- 10, 9, 9, 9, 95,108,111, 99, 97,108, 32, 61, 32, 34, 95,
- 108,111, 99, 97,108, 34, 10, 9, 9,101,110,100, 10, 9, 9,
- 111,117,116,112,117,116, 40, 39,116,111,108,117, 97, 95,108,
- 101,114,114,111,114, 58, 92,110, 39, 41, 10, 9, 9,111,117,
- 116,112,117,116, 40, 39, 32,114,101,116,117,114,110, 32, 39,
- 46, 46,115,116,114,115,117, 98, 40,115,101,108,102, 46, 99,
- 110, 97,109,101, 44, 49, 44, 45, 51, 41, 46, 46,102,111,114,
- 109, 97,116, 40, 34, 37, 48, 50,100, 34, 44,111,118,101,114,
- 108,111, 97,100, 41, 46, 46, 95,108,111, 99, 97,108, 46, 46,
- 39, 40,116,111,108,117, 97, 95, 83, 41, 59, 39, 41, 10, 9,
- 101,110,100, 10, 32,111,117,116,112,117,116, 40, 39,125, 39,
- 41, 10, 32,111,117,116,112,117,116, 40, 39, 35,101,110,100,
- 105,102, 32, 47, 47, 35,105,102,110,100,101,102, 32, 84, 79,
- 76, 85, 65, 95, 68, 73, 83, 65, 66, 76, 69, 92,110, 39, 41,
- 10, 32,111,117,116,112,117,116, 40, 39, 92,110, 39, 41, 10,
- 10, 9, 45, 45, 32,114,101, 99,117,114,115,105,118,101, 32,
- 99, 97,108,108, 32,116,111, 32,119,114,105,116,101, 32,108,
- 111, 99, 97,108, 32, 99,111,110,115,116,114,117, 99,116,111,
- 114, 10, 9,105,102, 32, 99,108, 97,115,115, 32, 97,110,100,
- 32,115,101,108,102, 46,110, 97,109,101, 61, 61, 39,110,101,
- 119, 39, 32, 97,110,100, 32,110,111,116, 32,108,111, 99, 97,
- 108, 95, 99,111,110,115,116,114,117, 99,116,111,114, 32,116,
- 104,101,110, 10, 10, 9, 9,115,101,108,102, 58,115,117,112,
- 99,111,100,101, 40, 49, 41, 10, 9,101,110,100, 10, 10,101,
- 110,100, 10, 10, 10, 45, 45, 32,114,101,103,105,115,116,101,
- 114, 32,102,117,110, 99,116,105,111,110, 10,102,117,110, 99,
- 116,105,111,110, 32, 99,108, 97,115,115, 70,117,110, 99,116,
- 105,111,110, 58,114,101,103,105,115,116,101,114, 32, 40,112,
- 114,101, 41, 10, 10, 9,105,102, 32,110,111,116, 32,115,101,
- 108,102, 58, 99,104,101, 99,107, 95,112,117, 98,108,105, 99,
- 95, 97, 99, 99,101,115,115, 40, 41, 32,116,104,101,110, 10,
- 9, 9,114,101,116,117,114,110, 10, 9,101,110,100, 10, 10,
- 32, 9,105,102, 32,115,101,108,102, 46,110, 97,109,101, 32,
- 61, 61, 32, 39,110,101,119, 39, 32, 97,110,100, 32,115,101,
- 108,102, 46,112, 97,114,101,110,116, 46,102,108, 97,103,115,
- 46,112,117,114,101, 95,118,105,114,116,117, 97,108, 32,116,
- 104,101,110, 10, 32, 9, 9, 45, 45, 32,110,111, 32, 99,111,
- 110,115,116,114,117, 99,116,111,114, 32,102,111,114, 32, 99,
- 108, 97,115,115,101,115, 32,119,105,116,104, 32,112,117,114,
- 101, 32,118,105,114,116,117, 97,108, 32,109,101,116,104,111,
- 100,115, 10, 32, 9, 9,114,101,116,117,114,110, 10, 32, 9,
- 101,110,100, 10, 10, 32,111,117,116,112,117,116, 40,112,114,
- 101, 46, 46, 39,116,111,108,117, 97, 95,102,117,110, 99,116,
- 105,111,110, 40,116,111,108,117, 97, 95, 83, 44, 34, 39, 46,
- 46,115,101,108,102, 46,108,110, 97,109,101, 46, 46, 39, 34,
- 44, 39, 46, 46,115,101,108,102, 46, 99,110, 97,109,101, 46,
- 46, 39, 41, 59, 39, 41, 10, 32, 32,105,102, 32,115,101,108,
- 102, 46,110, 97,109,101, 32, 61, 61, 32, 39,110,101,119, 39,
- 32,116,104,101,110, 10, 9, 32, 32,111,117,116,112,117,116,
- 40,112,114,101, 46, 46, 39,116,111,108,117, 97, 95,102,117,
- 110, 99,116,105,111,110, 40,116,111,108,117, 97, 95, 83, 44,
- 34,110,101,119, 95,108,111, 99, 97,108, 34, 44, 39, 46, 46,
- 115,101,108,102, 46, 99,110, 97,109,101, 46, 46, 39, 95,108,
- 111, 99, 97,108, 41, 59, 39, 41, 10, 9, 32, 32,111,117,116,
- 112,117,116, 40,112,114,101, 46, 46, 39,116,111,108,117, 97,
- 95,102,117,110, 99,116,105,111,110, 40,116,111,108,117, 97,
- 95, 83, 44, 34, 46, 99, 97,108,108, 34, 44, 39, 46, 46,115,
- 101,108,102, 46, 99,110, 97,109,101, 46, 46, 39, 95,108,111,
- 99, 97,108, 41, 59, 39, 41, 10, 9, 32, 32, 45, 45,111,117,
- 116,112,117,116, 40, 39, 32,116,111,108,117, 97, 95,115,101,
- 116, 95, 99, 97,108,108, 95,101,118,101,110,116, 40,116,111,
- 108,117, 97, 95, 83, 44, 39, 46, 46,115,101,108,102, 46, 99,
- 110, 97,109,101, 46, 46, 39, 95,108,111, 99, 97,108, 44, 32,
- 34, 39, 46, 46,115,101,108,102, 46,112, 97,114,101,110,116,
- 46,116,121,112,101, 46, 46, 39, 34, 41, 59, 39, 41, 10, 32,
- 32,101,110,100, 10,101,110,100, 10, 10, 45, 45, 32, 80,114,
- 105,110,116, 32,109,101,116,104,111,100, 10,102,117,110, 99,
- 116,105,111,110, 32, 99,108, 97,115,115, 70,117,110, 99,116,
- 105,111,110, 58,112,114,105,110,116, 32, 40,105,100,101,110,
- 116, 44, 99,108,111,115,101, 41, 10, 32,112,114,105,110,116,
- 40,105,100,101,110,116, 46, 46, 34, 70,117,110, 99,116,105,
- 111,110,123, 34, 41, 10, 32,112,114,105,110,116, 40,105,100,
- 101,110,116, 46, 46, 34, 32,109,111,100, 32, 32, 61, 32, 39,
- 34, 46, 46,115,101,108,102, 46,109,111,100, 46, 46, 34, 39,
- 44, 34, 41, 10, 32,112,114,105,110,116, 40,105,100,101,110,
- 116, 46, 46, 34, 32,116,121,112,101, 32, 61, 32, 39, 34, 46,
- 46,115,101,108,102, 46,116,121,112,101, 46, 46, 34, 39, 44,
- 34, 41, 10, 32,112,114,105,110,116, 40,105,100,101,110,116,
- 46, 46, 34, 32,112,116,114, 32, 32, 61, 32, 39, 34, 46, 46,
- 115,101,108,102, 46,112,116,114, 46, 46, 34, 39, 44, 34, 41,
- 10, 32,112,114,105,110,116, 40,105,100,101,110,116, 46, 46,
- 34, 32,110, 97,109,101, 32, 61, 32, 39, 34, 46, 46,115,101,
- 108,102, 46,110, 97,109,101, 46, 46, 34, 39, 44, 34, 41, 10,
- 32,112,114,105,110,116, 40,105,100,101,110,116, 46, 46, 34,
- 32,108,110, 97,109,101, 32, 61, 32, 39, 34, 46, 46,115,101,
- 108,102, 46,108,110, 97,109,101, 46, 46, 34, 39, 44, 34, 41,
- 10, 32,112,114,105,110,116, 40,105,100,101,110,116, 46, 46,
- 34, 32, 99,111,110,115,116, 32, 61, 32, 39, 34, 46, 46,115,
- 101,108,102, 46, 99,111,110,115,116, 46, 46, 34, 39, 44, 34,
- 41, 10, 32,112,114,105,110,116, 40,105,100,101,110,116, 46,
- 46, 34, 32, 99,110, 97,109,101, 32, 61, 32, 39, 34, 46, 46,
- 115,101,108,102, 46, 99,110, 97,109,101, 46, 46, 34, 39, 44,
- 34, 41, 10, 32,112,114,105,110,116, 40,105,100,101,110,116,
- 46, 46, 34, 32,108,110, 97,109,101, 32, 61, 32, 39, 34, 46,
- 46,115,101,108,102, 46,108,110, 97,109,101, 46, 46, 34, 39,
- 44, 34, 41, 10, 32,112,114,105,110,116, 40,105,100,101,110,
- 116, 46, 46, 34, 32, 97,114,103,115, 32, 61, 32,123, 34, 41,
- 10, 32,108,111, 99, 97,108, 32,105, 61, 49, 10, 32,119,104,
- 105,108,101, 32,115,101,108,102, 46, 97,114,103,115, 91,105,
- 93, 32,100,111, 10, 32, 32,115,101,108,102, 46, 97,114,103,
- 115, 91,105, 93, 58,112,114,105,110,116, 40,105,100,101,110,
- 116, 46, 46, 34, 32, 32, 34, 44, 34, 44, 34, 41, 10, 32, 32,
- 105, 32, 61, 32,105, 43, 49, 10, 32,101,110,100, 10, 32,112,
- 114,105,110,116, 40,105,100,101,110,116, 46, 46, 34, 32,125,
- 34, 41, 10, 32,112,114,105,110,116, 40,105,100,101,110,116,
- 46, 46, 34,125, 34, 46, 46, 99,108,111,115,101, 41, 10,101,
- 110,100, 10, 10, 45, 45, 32, 99,104,101, 99,107, 32,105,102,
- 32,105,116, 32,114,101,116,117,114,110,115, 32, 97,110, 32,
- 111, 98,106,101, 99,116, 32, 98,121, 32,118, 97,108,117,101,
- 10,102,117,110, 99,116,105,111,110, 32, 99,108, 97,115,115,
- 70,117,110, 99,116,105,111,110, 58,114,101,113,117,105,114,
- 101, 99,111,108,108,101, 99,116,105,111,110, 32, 40,116, 41,
- 10, 9,108,111, 99, 97,108, 32,114, 32, 61, 32,102, 97,108,
- 115,101, 10, 9,105,102, 32,115,101,108,102, 46,116,121,112,
- 101, 32,126, 61, 32, 39, 39, 32, 97,110,100, 32,110,111,116,
- 32,105,115, 98, 97,115,105, 99, 40,115,101,108,102, 46,116,
- 121,112,101, 41, 32, 97,110,100, 32,115,101,108,102, 46,112,
- 116,114, 61, 61, 39, 39, 32,116,104,101,110, 10, 9, 9,108,
- 111, 99, 97,108, 32,116,121,112,101, 32, 61, 32,103,115,117,
- 98, 40,115,101,108,102, 46,116,121,112,101, 44, 34, 37,115,
- 42, 99,111,110,115,116, 37,115, 43, 34, 44, 34, 34, 41, 10,
- 9, 32,116, 91,116,121,112,101, 93, 32, 61, 32, 34,116,111,
- 108,117, 97, 95, 99,111,108,108,101, 99,116, 95, 34, 32, 46,
- 46, 32, 99,108,101, 97,110, 95,116,101,109,112,108, 97,116,
- 101, 40,116,121,112,101, 41, 10, 9, 32,114, 32, 61, 32,116,
- 114,117,101, 10, 9,101,110,100, 10, 9,108,111, 99, 97,108,
- 32,105, 61, 49, 10, 9,119,104,105,108,101, 32,115,101,108,
- 102, 46, 97,114,103,115, 91,105, 93, 32,100,111, 10, 9, 9,
- 114, 32, 61, 32,115,101,108,102, 46, 97,114,103,115, 91,105,
- 93, 58,114,101,113,117,105,114,101, 99,111,108,108,101, 99,
- 116,105,111,110, 40,116, 41, 32,111,114, 32,114, 10, 9, 9,
- 105, 32, 61, 32,105, 43, 49, 10, 9,101,110,100, 10, 9,114,
- 101,116,117,114,110, 32,114, 10,101,110,100, 10, 10, 45, 45,
- 32,100,101,116,101,114,109,105,110,101, 32,108,117, 97, 32,
- 102,117,110, 99,116,105,111,110, 32,110, 97,109,101, 32,111,
- 118,101,114,108,111, 97,100, 10,102,117,110, 99,116,105,111,
- 110, 32, 99,108, 97,115,115, 70,117,110, 99,116,105,111,110,
- 58,111,118,101,114,108,111, 97,100, 32, 40, 41, 10, 32,114,
- 101,116,117,114,110, 32,115,101,108,102, 46,112, 97,114,101,
- 110,116, 58,111,118,101,114,108,111, 97,100, 40,115,101,108,
- 102, 46,108,110, 97,109,101, 41, 10,101,110,100, 10, 10, 10,
- 102,117,110, 99,116,105,111,110, 32,112, 97,114, 97,109, 95,
- 111, 98,106,101, 99,116, 40,112, 97,114, 41, 32, 45, 45, 32,
- 114,101,116,117,114,110,115, 32,116,114,117,101, 32,105,102,
- 32,116,104,101, 32,112, 97,114, 97,109,101,116,101,114, 32,
- 104, 97,115, 32, 97,110, 32,111, 98,106,101, 99,116, 32, 97,
- 115, 32,105,116,115, 32,100,101,102, 97,117,108,116, 32,118,
- 97,108,117,101, 10, 10, 9,105,102, 32,110,111,116, 32,115,
- 116,114,105,110,103, 46,102,105,110,100, 40,112, 97,114, 44,
- 32, 39, 61, 39, 41, 32,116,104,101,110, 32,114,101,116,117,
- 114,110, 32,102, 97,108,115,101, 32,101,110,100, 32, 45, 45,
- 32,105,116, 32,104, 97,115, 32,110,111, 32,100,101,102, 97,
- 117,108,116, 32,118, 97,108,117,101, 10, 10, 9,108,111, 99,
- 97,108, 32, 95, 44, 95, 44,100,101,102, 32, 61, 32,115,116,
- 114,105,110,103, 46,102,105,110,100, 40,112, 97,114, 44, 32,
- 34, 61, 40, 46, 42, 41, 36, 34, 41, 10, 10, 9,105,102, 32,
- 115,116,114,105,110,103, 46,102,105,110,100, 40,112, 97,114,
- 44, 32, 34,124, 34, 41, 32,116,104,101,110, 32, 45, 45, 32,
- 97, 32,108,105,115,116, 32,111,102, 32,102,108, 97,103,115,
- 10, 10, 9, 9,114,101,116,117,114,110, 32,116,114,117,101,
- 10, 9,101,110,100, 10, 10, 9,105,102, 32,115,116,114,105,
- 110,103, 46,102,105,110,100, 40,112, 97,114, 44, 32, 34, 37,
- 42, 34, 41, 32,116,104,101,110, 32, 45, 45, 32,105,116, 39,
- 115, 32, 97, 32,112,111,105,110,116,101,114, 32,119,105,116,
- 104, 32, 97, 32,100,101,102, 97,117,108,116, 32,118, 97,108,
- 117,101, 10, 10, 9, 9,105,102, 32,115,116,114,105,110,103,
- 46,102,105,110,100, 40,112, 97,114, 44, 32, 39, 61, 37,115,
- 42,110,101,119, 39, 41, 32,111,114, 32,115,116,114,105,110,
- 103, 46,102,105,110,100, 40,112, 97,114, 44, 32, 34, 37, 40,
- 34, 41, 32,116,104,101,110, 32, 45, 45, 32,105,116, 39,115,
- 32, 97, 32,112,111,105,110,116,101,114, 32,119,105,116,104,
- 32, 97,110, 32,105,110,115,116, 97,110, 99,101, 32, 97,115,
- 32,100,101,102, 97,117,108,116, 32,112, 97,114, 97,109,101,
- 116,101,114, 46, 46, 32,105,115, 32,116,104, 97,116, 32,118,
- 97,108,105,100, 63, 10, 9, 9, 9,114,101,116,117,114,110,
- 32,116,114,117,101, 10, 9, 9,101,110,100, 10, 9, 9,114,
- 101,116,117,114,110, 32,102, 97,108,115,101, 32, 45, 45, 32,
- 100,101,102, 97,117,108,116, 32,118, 97,108,117,101, 32,105,
- 115, 32, 39, 78, 85, 76, 76, 39, 32,111,114, 32,115,111,109,
- 101,116,104,105,110,103, 10, 9,101,110,100, 10, 10, 10, 9,
- 105,102, 32,115,116,114,105,110,103, 46,102,105,110,100, 40,
- 112, 97,114, 44, 32, 34, 91, 37, 40, 38, 93, 34, 41, 32,116,
- 104,101,110, 10, 9, 9,114,101,116,117,114,110, 32,116,114,
- 117,101, 10, 9,101,110,100, 32, 45, 45, 32,100,101,102, 97,
- 117,108,116, 32,118, 97,108,117,101, 32,105,115, 32, 97, 32,
- 99,111,110,115,116,114,117, 99,116,111,114, 32, 99, 97,108,
- 108, 32, 40,109,111,115,116, 32,108,105,107,101,108,121, 32,
- 102,111,114, 32, 97, 32, 99,111,110,115,116, 32,114,101,102,
- 101,114,101,110, 99,101, 41, 10, 10, 9, 45, 45,105,102, 32,
- 115,116,114,105,110,103, 46,102,105,110,100, 40,112, 97,114,
- 44, 32, 34, 38, 34, 41, 32,116,104,101,110, 10, 10, 9, 45,
- 45, 9,105,102, 32,115,116,114,105,110,103, 46,102,105,110,
- 100, 40,100,101,102, 44, 32, 34, 58, 34, 41, 32,111,114, 32,
- 115,116,114,105,110,103, 46,102,105,110,100, 40,100,101,102,
- 44, 32, 34, 94, 37,115, 42,110,101,119, 37,115, 43, 34, 41,
- 32,116,104,101,110, 10, 10, 9, 45, 45, 9, 9, 45, 45, 32,
- 105,116, 39,115, 32, 97, 32,114,101,102,101,114,101,110, 99,
- 101, 32,119,105,116,104, 32,100,101,102, 97,117,108,116, 32,
- 116,111, 32,115,111,109,101,116,104,105,110,103, 32,108,105,
- 107,101, 32, 67,108, 97,115,115, 58, 58,109,101,109, 98,101,
- 114, 44, 32,111,114, 32, 39,110,101,119, 32, 67,108, 97,115,
- 115, 39, 10, 9, 45, 45, 9, 9,114,101,116,117,114,110, 32,
- 116,114,117,101, 10, 9, 45, 45, 9,101,110,100, 10, 9, 45,
- 45,101,110,100, 10, 10, 9,114,101,116,117,114,110, 32,102,
- 97,108,115,101, 32, 45, 45, 32, 63, 10,101,110,100, 10, 10,
- 102,117,110, 99,116,105,111,110, 32,115,116,114,105,112, 95,
- 108, 97,115,116, 95, 97,114,103, 40, 97,108,108, 95, 97,114,
- 103,115, 44, 32,108, 97,115,116, 95, 97,114,103, 41, 32, 45,
- 45, 32,115,116,114,105,112,115, 32,116,104,101, 32,100,101,
- 102, 97,117,108,116, 32,118, 97,108,117,101, 32,102,114,111,
- 109, 32,116,104,101, 32,108, 97,115,116, 32, 97,114,103,117,
- 109,101,110,116, 10, 10, 9,108,111, 99, 97,108, 32, 95, 44,
- 95, 44,115, 95, 97,114,103, 32, 61, 32,115,116,114,105,110,
- 103, 46,102,105,110,100, 40,108, 97,115,116, 95, 97,114,103,
- 44, 32, 34, 94, 40, 91, 94, 61, 93, 43, 41, 34, 41, 10, 9,
- 108, 97,115,116, 95, 97,114,103, 32, 61, 32,115,116,114,105,
- 110,103, 46,103,115,117, 98, 40,108, 97,115,116, 95, 97,114,
- 103, 44, 32, 34, 40, 91, 37, 37, 37, 40, 37, 41, 93, 41, 34,
- 44, 32, 34, 37, 37, 37, 49, 34, 41, 59, 10, 9, 97,108,108,
- 95, 97,114,103,115, 32, 61, 32,115,116,114,105,110,103, 46,
- 103,115,117, 98, 40, 97,108,108, 95, 97,114,103,115, 44, 32,
- 34, 37,115, 42, 44, 37,115, 42, 34, 46, 46,108, 97,115,116,
- 95, 97,114,103, 46, 46, 34, 37,115, 42, 37, 41, 37,115, 42,
- 36, 34, 44, 32, 34, 41, 34, 41, 10, 9,114,101,116,117,114,
- 110, 32, 97,108,108, 95, 97,114,103,115, 44, 32,115, 95, 97,
- 114,103, 10,101,110,100, 10, 10, 10, 10, 45, 45, 32, 73,110,
- 116,101,114,110, 97,108, 32, 99,111,110,115,116,114,117, 99,
- 116,111,114, 10,102,117,110, 99,116,105,111,110, 32, 95, 70,
- 117,110, 99,116,105,111,110, 32, 40,116, 41, 10, 32,115,101,
- 116,109,101,116, 97,116, 97, 98,108,101, 40,116, 44, 99,108,
- 97,115,115, 70,117,110, 99,116,105,111,110, 41, 10, 10, 32,
- 105,102, 32,116, 46, 99,111,110,115,116, 32,126, 61, 32, 39,
- 99,111,110,115,116, 39, 32, 97,110,100, 32,116, 46, 99,111,
- 110,115,116, 32,126, 61, 32, 39, 39, 32,116,104,101,110, 10,
- 32, 32,101,114,114,111,114, 40, 34, 35,105,110,118, 97,108,
- 105,100, 32, 39, 99,111,110,115,116, 39, 32,115,112,101, 99,
- 105,102,105, 99, 97,116,105,111,110, 34, 41, 10, 32,101,110,
- 100, 10, 10, 32, 97,112,112,101,110,100, 40,116, 41, 10, 32,
- 105,102, 32,116, 58,105,110, 99,108, 97,115,115, 40, 41, 32,
- 116,104,101,110, 10, 32, 45, 45,112,114,105,110,116, 32, 40,
- 39,116, 46,110, 97,109,101, 32,105,115, 32, 39, 46, 46,116,
- 46,110, 97,109,101, 46, 46, 39, 44, 32,112, 97,114,101,110,
- 116, 46,110, 97,109,101, 32,105,115, 32, 39, 46, 46,116, 46,
- 112, 97,114,101,110,116, 46,110, 97,109,101, 41, 10, 32, 32,
- 105,102, 32,115,116,114,105,110,103, 46,103,115,117, 98, 40,
- 116, 46,110, 97,109,101, 44, 32, 34, 37, 98, 60, 62, 34, 44,
- 32, 34, 34, 41, 32, 61, 61, 32,115,116,114,105,110,103, 46,
- 103,115,117, 98, 40,116, 46,112, 97,114,101,110,116, 46,111,
- 114,105,103,105,110, 97,108, 95,110, 97,109,101, 32,111,114,
- 32,116, 46,112, 97,114,101,110,116, 46,110, 97,109,101, 44,
- 32, 34, 37, 98, 60, 62, 34, 44, 32, 34, 34, 41, 32,116,104,
- 101,110, 10, 32, 32, 32,116, 46,110, 97,109,101, 32, 61, 32,
- 39,110,101,119, 39, 10, 32, 32, 32,116, 46,108,110, 97,109,
- 101, 32, 61, 32, 39,110,101,119, 39, 10, 32, 32, 32,116, 46,
- 112, 97,114,101,110,116, 46, 95,110,101,119, 32, 61, 32,116,
- 114,117,101, 10, 32, 32, 32,116, 46,116,121,112,101, 32, 61,
- 32,116, 46,112, 97,114,101,110,116, 46,110, 97,109,101, 10,
- 32, 32, 32,116, 46,112,116,114, 32, 61, 32, 39, 42, 39, 10,
- 32, 32,101,108,115,101,105,102, 32,115,116,114,105,110,103,
- 46,103,115,117, 98, 40,116, 46,110, 97,109,101, 44, 32, 34,
- 37, 98, 60, 62, 34, 44, 32, 34, 34, 41, 32, 61, 61, 32, 39,
- 126, 39, 46, 46,115,116,114,105,110,103, 46,103,115,117, 98,
- 40,116, 46,112, 97,114,101,110,116, 46,111,114,105,103,105,
- 110, 97,108, 95,110, 97,109,101, 32,111,114, 32,116, 46,112,
- 97,114,101,110,116, 46,110, 97,109,101, 44, 32, 34, 37, 98,
- 60, 62, 34, 44, 32, 34, 34, 41, 32,116,104,101,110, 10, 32,
- 32, 32,116, 46,110, 97,109,101, 32, 61, 32, 39,100,101,108,
- 101,116,101, 39, 10, 32, 32, 32,116, 46,108,110, 97,109,101,
- 32, 61, 32, 39,100,101,108,101,116,101, 39, 10, 32, 32, 32,
- 116, 46,112, 97,114,101,110,116, 46, 95,100,101,108,101,116,
- 101, 32, 61, 32,116,114,117,101, 10, 32, 32,101,110,100, 10,
- 32,101,110,100, 10, 32,116, 46, 99,110, 97,109,101, 32, 61,
- 32,116, 58, 99,102,117,110, 99,110, 97,109,101, 40, 34,116,
- 111,108,117, 97, 34, 41, 46, 46,116, 58,111,118,101,114,108,
- 111, 97,100, 40,116, 41, 10, 32,114,101,116,117,114,110, 32,
- 116, 10,101,110,100, 10, 10, 45, 45, 32, 67,111,110,115,116,
- 114,117, 99,116,111,114, 10, 45, 45, 32, 69,120,112,101, 99,
- 116,115, 32,116,104,114,101,101, 32,115,116,114,105,110,103,
- 115, 58, 32,111,110,101, 32,114,101,112,114,101,115,101,110,
- 116,105,110,103, 32,116,104,101, 32,102,117,110, 99,116,105,
- 111,110, 32,100,101, 99,108, 97,114, 97,116,105,111,110, 44,
- 10, 45, 45, 32, 97,110,111,116,104,101,114, 32,114,101,112,
- 114,101,115,101,110,116,105,110,103, 32,116,104,101, 32, 97,
- 114,103,117,109,101,110,116, 32,108,105,115,116, 44, 32, 97,
- 110,100, 32,116,104,101, 32,116,104,105,114,100, 32,114,101,
- 112,114,101,115,101,110,116,105,110,103, 10, 45, 45, 32,116,
- 104,101, 32, 34, 99,111,110,115,116, 34, 32,111,114, 32,101,
- 109,112,116,121, 32,115,116,114,105,110,103, 46, 10,102,117,
- 110, 99,116,105,111,110, 32, 70,117,110, 99,116,105,111,110,
- 32, 40,100, 44, 97, 44, 99, 41, 10, 32, 45, 45,108,111, 99,
- 97,108, 32,116, 32, 61, 32,115,112,108,105,116, 40,115,116,
- 114,115,117, 98, 40, 97, 44, 50, 44, 45, 50, 41, 44, 39, 44,
- 39, 41, 32, 45, 45, 32,101,108,105,109,105,110, 97,116,101,
- 32, 98,114, 97, 99,101,115, 10, 32, 45, 45,108,111, 99, 97,
- 108, 32,116, 32, 61, 32,115,112,108,105,116, 95,112, 97,114,
- 97,109,115, 40,115,116,114,115,117, 98, 40, 97, 44, 50, 44,
- 45, 50, 41, 41, 10, 10, 9,105,102, 32,110,111,116, 32,102,
- 108, 97,103,115, 91, 39, 87, 39, 93, 32, 97,110,100, 32,115,
- 116,114,105,110,103, 46,102,105,110,100, 40, 97, 44, 32, 34,
- 37, 46, 37, 46, 37, 46, 37,115, 42, 37, 41, 34, 41, 32,116,
- 104,101,110, 10, 10, 9, 9,119, 97,114,110,105,110,103, 40,
- 34, 70,117,110, 99,116,105,111,110,115, 32,119,105,116,104,
- 32,118, 97,114,105, 97, 98,108,101, 32, 97,114,103,117,109,
- 101,110,116,115, 32, 40, 96, 46, 46, 46, 39, 41, 32, 97,114,
- 101, 32,110,111,116, 32,115,117,112,112,111,114,116,101,100,
- 46, 32, 73,103,110,111,114,105,110,103, 32, 34, 46, 46,100,
- 46, 46, 97, 46, 46, 99, 41, 10, 9, 9,114,101,116,117,114,
- 110, 32,110,105,108, 10, 9,101,110,100, 10, 10, 10, 32,108,
- 111, 99, 97,108, 32,105, 61, 49, 10, 32,108,111, 99, 97,108,
- 32,108, 32, 61, 32,123,110, 61, 48,125, 10, 10, 32, 9, 97,
- 32, 61, 32,115,116,114,105,110,103, 46,103,115,117, 98, 40,
- 97, 44, 32, 34, 37,115, 42, 40, 91, 37, 40, 37, 41, 93, 41,
- 37,115, 42, 34, 44, 32, 34, 37, 49, 34, 41, 10, 9,108,111,
- 99, 97,108, 32,116, 44,115,116,114,105,112, 44,108, 97,115,
- 116, 32, 61, 32,115,116,114,105,112, 95,112, 97,114,115, 40,
- 115,116,114,115,117, 98, 40, 97, 44, 50, 44, 45, 50, 41, 41,
- 59, 10, 9,105,102, 32,115,116,114,105,112, 32,116,104,101,
- 110, 10, 9, 9, 45, 45,108,111, 99, 97,108, 32,110,115, 32,
- 61, 32,115,116,114,105,110,103, 46,115,117, 98, 40,115,116,
- 114,115,117, 98, 40, 97, 44, 49, 44, 45, 50, 41, 44, 32, 49,
- 44, 32, 45, 40,115,116,114,105,110,103, 46,108,101,110, 40,
- 108, 97,115,116, 41, 43, 49, 41, 41, 10, 9, 9,108,111, 99,
- 97,108, 32,110,115, 32, 61, 32,106,111,105,110, 40,116, 44,
- 32, 34, 44, 34, 44, 32, 49, 44, 32,108, 97,115,116, 45, 49,
- 41, 10, 10, 9, 9,110,115, 32, 61, 32, 34, 40, 34, 46, 46,
- 115,116,114,105,110,103, 46,103,115,117, 98, 40,110,115, 44,
- 32, 34, 37,115, 42, 44, 37,115, 42, 36, 34, 44, 32, 34, 34,
- 41, 46, 46, 39, 41, 39, 10, 9, 9, 45, 45,110,115, 32, 61,
- 32,115,116,114,105,112, 95,100,101,102, 97,117,108,116,115,
- 40,110,115, 41, 10, 10, 9, 9,108,111, 99, 97,108, 32,102,
- 32, 61, 32, 70,117,110, 99,116,105,111,110, 40,100, 44, 32,
- 110,115, 44, 32, 99, 41, 10, 9, 9,102,111,114, 32,105, 61,
- 49, 44,108, 97,115,116, 32,100,111, 10, 9, 9, 9,116, 91,
- 105, 93, 32, 61, 32,115,116,114,105,110,103, 46,103,115,117,
- 98, 40,116, 91,105, 93, 44, 32, 34, 61, 46, 42, 36, 34, 44,
- 32, 34, 34, 41, 10, 9, 9,101,110,100, 10, 9,101,110,100,
- 10, 10, 32,119,104,105,108,101, 32,116, 91,105, 93, 32,100,
- 111, 10, 32, 32,108, 46,110, 32, 61, 32,108, 46,110, 43, 49,
- 10, 32, 32,108, 91,108, 46,110, 93, 32, 61, 32, 68,101, 99,
- 108, 97,114, 97,116,105,111,110, 40,116, 91,105, 93, 44, 39,
- 118, 97,114, 39, 44,116,114,117,101, 41, 10, 32, 32,105, 32,
- 61, 32,105, 43, 49, 10, 32,101,110,100, 10, 32,108,111, 99,
- 97,108, 32,102, 32, 61, 32, 68,101, 99,108, 97,114, 97,116,
- 105,111,110, 40,100, 44, 39,102,117,110, 99, 39, 41, 10, 32,
- 102, 46, 97,114,103,115, 32, 61, 32,108, 10, 32,102, 46, 99,
- 111,110,115,116, 32, 61, 32, 99, 10, 32,114,101,116,117,114,
- 110, 32, 95, 70,117,110, 99,116,105,111,110, 40,102, 41, 10,
- 101,110,100, 10, 10,102,117,110, 99,116,105,111,110, 32,106,
- 111,105,110, 40,116, 44, 32,115,101,112, 44, 32,102,105,114,
- 115,116, 44, 32,108, 97,115,116, 41, 10, 10, 9,102,105,114,
- 115,116, 32, 61, 32,102,105,114,115,116, 32,111,114, 32, 49,
- 10, 9,108, 97,115,116, 32, 61, 32,108, 97,115,116, 32,111,
- 114, 32,116, 97, 98,108,101, 46,103,101,116,110, 40,116, 41,
- 10, 9,108,111, 99, 97,108, 32,108,115,101,112, 32, 61, 32,
- 34, 34, 10, 9,108,111, 99, 97,108, 32,114,101,116, 32, 61,
- 32, 34, 34, 10, 9,108,111, 99, 97,108, 32,108,111,111,112,
- 32, 61, 32,102, 97,108,115,101, 10, 9,102,111,114, 32,105,
- 32, 61, 32,102,105,114,115,116, 44,108, 97,115,116, 32,100,
- 111, 10, 10, 9, 9,114,101,116, 32, 61, 32,114,101,116, 46,
- 46,108,115,101,112, 46, 46,116, 91,105, 93, 10, 9, 9,108,
- 115,101,112, 32, 61, 32,115,101,112, 10, 9, 9,108,111,111,
- 112, 32, 61, 32,116,114,117,101, 10, 9,101,110,100, 10, 9,
- 105,102, 32,110,111,116, 32,108,111,111,112, 32,116,104,101,
- 110, 10, 9, 9,114,101,116,117,114,110, 32, 34, 34, 10, 9,
- 101,110,100, 10, 10, 9,114,101,116,117,114,110, 32,114,101,
- 116, 10,101,110,100, 10, 10,102,117,110, 99,116,105,111,110,
- 32,115,116,114,105,112, 95,112, 97,114,115, 40,115, 41, 10,
- 10, 9,108,111, 99, 97,108, 32,116, 32, 61, 32,115,112,108,
- 105,116, 95, 99, 95,116,111,107,101,110,115, 40,115, 44, 32,
- 39, 44, 39, 41, 10, 9,108,111, 99, 97,108, 32,115,116,114,
- 105,112, 32, 61, 32,102, 97,108,115,101, 10, 9,108,111, 99,
- 97,108, 32,108, 97,115,116, 10, 10, 9,102,111,114, 32,105,
- 61,116, 46,110, 44, 49, 44, 45, 49, 32,100,111, 10, 10, 9,
- 9,105,102, 32,110,111,116, 32,115,116,114,105,112, 32, 97,
- 110,100, 32,112, 97,114, 97,109, 95,111, 98,106,101, 99,116,
- 40,116, 91,105, 93, 41, 32,116,104,101,110, 10, 9, 9, 9,
- 108, 97,115,116, 32, 61, 32,105, 10, 9, 9, 9,115,116,114,
- 105,112, 32, 61, 32,116,114,117,101, 10, 9, 9,101,110,100,
- 10, 9, 9, 45, 45,105,102, 32,115,116,114,105,112, 32,116,
- 104,101,110, 10, 9, 9, 45, 45, 9,116, 91,105, 93, 32, 61,
- 32,115,116,114,105,110,103, 46,103,115,117, 98, 40,116, 91,
- 105, 93, 44, 32, 34, 61, 46, 42, 36, 34, 44, 32, 34, 34, 41,
- 10, 9, 9, 45, 45,101,110,100, 10, 9,101,110,100, 10, 10,
- 9,114,101,116,117,114,110, 32,116, 44,115,116,114,105,112,
- 44,108, 97,115,116, 10, 10,101,110,100, 10, 10,102,117,110,
- 99,116,105,111,110, 32,115,116,114,105,112, 95,100,101,102,
- 97,117,108,116,115, 40,115, 41, 10, 10, 9,115, 32, 61, 32,
- 115,116,114,105,110,103, 46,103,115,117, 98, 40,115, 44, 32,
- 34, 94, 37, 40, 34, 44, 32, 34, 34, 41, 10, 9,115, 32, 61,
- 32,115,116,114,105,110,103, 46,103,115,117, 98, 40,115, 44,
- 32, 34, 37, 41, 36, 34, 44, 32, 34, 34, 41, 10, 10, 9,108,
- 111, 99, 97,108, 32,116, 32, 61, 32,115,112,108,105,116, 95,
- 99, 95,116,111,107,101,110,115, 40,115, 44, 32, 34, 44, 34,
- 41, 10, 9,108,111, 99, 97,108, 32,115,101,112, 44, 32,114,
- 101,116, 32, 61, 32, 34, 34, 44, 34, 34, 10, 9,102,111,114,
- 32,105, 61, 49, 44,116, 46,110, 32,100,111, 10, 9, 9,116,
- 91,105, 93, 32, 61, 32,115,116,114,105,110,103, 46,103,115,
- 117, 98, 40,116, 91,105, 93, 44, 32, 34, 61, 46, 42, 36, 34,
- 44, 32, 34, 34, 41, 10, 9, 9,114,101,116, 32, 61, 32,114,
- 101,116, 46, 46,115,101,112, 46, 46,116, 91,105, 93, 10, 9,
- 9,115,101,112, 32, 61, 32, 34, 44, 34, 10, 9,101,110,100,
- 10, 10, 9,114,101,116,117,114,110, 32, 34, 40, 34, 46, 46,
- 114,101,116, 46, 46, 34, 41, 34, 10,101,110,100,32
- };
- tolua_dobuffer(tolua_S,(char*)B,sizeof(B),"tolua embedded: src/bin/lua/function.lua");
+ #include "function_lua.h"
+ tolua_dobuffer(tolua_S,(char*)lua_function_lua,sizeof(lua_function_lua),"tolua embedded: src/bin/lua/function.lua");
lua_settop(tolua_S, top);
} /* end of embedded lua code */
diff --git a/src/Bindings/LuaChunkStay.cpp b/src/Bindings/LuaChunkStay.cpp
index 0e982637f..db865cfa4 100644
--- a/src/Bindings/LuaChunkStay.cpp
+++ b/src/Bindings/LuaChunkStay.cpp
@@ -131,9 +131,6 @@ void cLuaChunkStay::Enable(cChunkMap & a_ChunkMap, int a_OnChunkAvailableStackPo
void cLuaChunkStay::OnChunkAvailable(int a_ChunkX, int a_ChunkZ)
{
- // DEBUG:
- LOGD("LuaChunkStay: Chunk [%d, %d] is now available, calling the callback...", a_ChunkX, a_ChunkZ);
-
cPluginLua::cOperation Op(m_Plugin);
Op().Call((int)m_OnChunkAvailable, a_ChunkX, a_ChunkZ);
}
diff --git a/src/Bindings/LuaState.cpp b/src/Bindings/LuaState.cpp
index f24e15c3b..13eb17f7d 100644
--- a/src/Bindings/LuaState.cpp
+++ b/src/Bindings/LuaState.cpp
@@ -479,6 +479,18 @@ void cLuaState::Push(cEntity * a_Entity)
+void cLuaState::Push(cProjectileEntity * a_ProjectileEntity)
+{
+ ASSERT(IsValid());
+
+ tolua_pushusertype(m_LuaState, a_ProjectileEntity, "cProjectileEntity");
+ m_NumCurrentFunctionArgs += 1;
+}
+
+
+
+
+
void cLuaState::Push(cMonster * a_Monster)
{
ASSERT(IsValid());
@@ -689,9 +701,10 @@ void cLuaState::Push(void * a_Ptr)
ASSERT(IsValid());
// Investigate the cause of this - what is the callstack?
- LOGWARNING("Lua engine encountered an error - attempting to push a plain pointer");
+ // One code path leading here is the OnHookExploding / OnHookExploded with exotic parameters. Need to decide what to do with them
+ LOGWARNING("Lua engine: attempting to push a plain pointer, pushing nil instead.");
+ LOGWARNING("This indicates an unimplemented part of MCS bindings");
LogStackTrace();
- ASSERT(!"A plain pointer should never be pushed on Lua stack");
lua_pushnil(m_LuaState);
m_NumCurrentFunctionArgs += 1;
@@ -1080,20 +1093,20 @@ bool cLuaState::ReportErrors(lua_State * a_LuaState, int a_Status)
-void cLuaState::LogStackTrace(void)
+void cLuaState::LogStackTrace(int a_StartingDepth)
{
- LogStackTrace(m_LuaState);
+ LogStackTrace(m_LuaState, a_StartingDepth);
}
-void cLuaState::LogStackTrace(lua_State * a_LuaState)
+void cLuaState::LogStackTrace(lua_State * a_LuaState, int a_StartingDepth)
{
LOGWARNING("Stack trace:");
lua_Debug entry;
- int depth = 0;
+ int depth = a_StartingDepth;
while (lua_getstack(a_LuaState, depth, &entry))
{
lua_getinfo(a_LuaState, "Sln", &entry);
@@ -1312,7 +1325,7 @@ void cLuaState::LogStack(lua_State * a_LuaState, const char * a_Header)
int cLuaState::ReportFnCallErrors(lua_State * a_LuaState)
{
LOGWARNING("LUA: %s", lua_tostring(a_LuaState, -1));
- LogStackTrace(a_LuaState);
+ LogStackTrace(a_LuaState, 1);
return 1; // We left the error message on the stack as the return value
}
diff --git a/src/Bindings/LuaState.h b/src/Bindings/LuaState.h
index f5cb8379d..b9ca2f29b 100644
--- a/src/Bindings/LuaState.h
+++ b/src/Bindings/LuaState.h
@@ -38,6 +38,7 @@ extern "C"
class cWorld;
class cPlayer;
class cEntity;
+class cProjectileEntity;
class cMonster;
class cItem;
class cItems;
@@ -183,6 +184,7 @@ public:
void Push(cPlayer * a_Player);
void Push(const cPlayer * a_Player);
void Push(cEntity * a_Entity);
+ void Push(cProjectileEntity * a_ProjectileEntity);
void Push(cMonster * a_Monster);
void Push(cItem * a_Item);
void Push(cItems * a_Items);
@@ -200,7 +202,7 @@ public:
void Push(const HTTPTemplateRequest * a_Request);
void Push(cTNTEntity * a_TNTEntity);
void Push(Vector3i * a_Vector);
- NORETURNDEBUG void Push(void * a_Ptr);
+ void Push(void * a_Ptr);
void Push(cHopperEntity * a_Hopper);
void Push(cBlockEntity * a_BlockEntity);
@@ -868,10 +870,10 @@ public:
static bool ReportErrors(lua_State * a_LuaState, int status);
/** Logs all items in the current stack trace to the server console */
- void LogStackTrace(void);
+ void LogStackTrace(int a_StartingDepth = 0);
/** Logs all items in the current stack trace to the server console */
- static void LogStackTrace(lua_State * a_LuaState);
+ static void LogStackTrace(lua_State * a_LuaState, int a_StartingDepth = 0);
/** Returns the type of the item on the specified position in the stack */
AString GetTypeText(int a_StackPos);
diff --git a/src/Bindings/ManualBindings.cpp b/src/Bindings/ManualBindings.cpp
index 20bbc48f2..51b9f3e27 100644
--- a/src/Bindings/ManualBindings.cpp
+++ b/src/Bindings/ManualBindings.cpp
@@ -115,10 +115,44 @@ static int tolua_StringSplitAndTrim(lua_State * tolua_S)
-static int tolua_LOG(lua_State* tolua_S)
+/** Retrieves the log message from the first param on the Lua stack.
+Can take either a string or a cCompositeChat.
+*/
+static AString GetLogMessage(lua_State * tolua_S)
{
- const char* str = tolua_tocppstring(tolua_S,1,0);
- cMCLogger::GetInstance()->LogSimple( str, 0 );
+ tolua_Error err;
+ if (tolua_isusertype(tolua_S, 1, "cCompositeChat", false, &err))
+ {
+ return ((cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL))->ExtractText();
+ }
+ else
+ {
+ size_t len = 0;
+ const char * str = lua_tolstring(tolua_S, 1, &len);
+ if (str != NULL)
+ {
+ return AString(str, len);
+ }
+ }
+ return "";
+}
+
+
+
+
+
+static int tolua_LOG(lua_State * tolua_S)
+{
+ // If the param is a cCompositeChat, read the log level from it:
+ cMCLogger::eLogLevel LogLevel = cMCLogger::llRegular;
+ tolua_Error err;
+ if (tolua_isusertype(tolua_S, 1, "cCompositeChat", false, &err))
+ {
+ LogLevel = cCompositeChat::MessageTypeToLogLevel(((cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL))->GetMessageType());
+ }
+
+ // Log the message:
+ cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), LogLevel);
return 0;
}
@@ -126,10 +160,9 @@ static int tolua_LOG(lua_State* tolua_S)
-static int tolua_LOGINFO(lua_State* tolua_S)
+static int tolua_LOGINFO(lua_State * tolua_S)
{
- const char* str = tolua_tocppstring(tolua_S,1,0);
- cMCLogger::GetInstance()->LogSimple( str, 1 );
+ cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llInfo);
return 0;
}
@@ -137,10 +170,9 @@ static int tolua_LOGINFO(lua_State* tolua_S)
-static int tolua_LOGWARN(lua_State* tolua_S)
+static int tolua_LOGWARN(lua_State * tolua_S)
{
- const char* str = tolua_tocppstring(tolua_S,1,0);
- cMCLogger::GetInstance()->LogSimple( str, 2 );
+ cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llWarning);
return 0;
}
@@ -148,10 +180,9 @@ static int tolua_LOGWARN(lua_State* tolua_S)
-static int tolua_LOGERROR(lua_State* tolua_S)
+static int tolua_LOGERROR(lua_State * tolua_S)
{
- const char* str = tolua_tocppstring(tolua_S,1,0);
- cMCLogger::GetInstance()->LogSimple( str, 3 );
+ cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llError);
return 0;
}
@@ -159,6 +190,50 @@ static int tolua_LOGERROR(lua_State* tolua_S)
+static int tolua_Base64Encode(lua_State * tolua_S)
+{
+ cLuaState L(tolua_S);
+ if (
+ !L.CheckParamString(1) ||
+ !L.CheckParamEnd(2)
+ )
+ {
+ return 0;
+ }
+
+ AString Src;
+ L.GetStackValue(1, Src);
+ AString res = Base64Encode(Src);
+ L.Push(res);
+ return 1;
+}
+
+
+
+
+
+static int tolua_Base64Decode(lua_State * tolua_S)
+{
+ cLuaState L(tolua_S);
+ if (
+ !L.CheckParamString(1) ||
+ !L.CheckParamEnd(2)
+ )
+ {
+ return 0;
+ }
+
+ AString Src;
+ L.GetStackValue(1, Src);
+ AString res = Base64Decode(Src);
+ L.Push(res);
+ return 1;
+}
+
+
+
+
+
cPluginLua * GetLuaPlugin(lua_State * L)
{
// Get the plugin identification out of LuaState:
@@ -2838,6 +2913,8 @@ void ManualBindings::Bind(lua_State * tolua_S)
tolua_function(tolua_S, "LOGWARN", tolua_LOGWARN);
tolua_function(tolua_S, "LOGWARNING", tolua_LOGWARN);
tolua_function(tolua_S, "LOGERROR", tolua_LOGERROR);
+ tolua_function(tolua_S, "Base64Encode", tolua_Base64Encode);
+ tolua_function(tolua_S, "Base64Decode", tolua_Base64Decode);
tolua_beginmodule(tolua_S, "cFile");
tolua_function(tolua_S, "GetFolderContents", tolua_cFile_GetFolderContents);
diff --git a/src/Bindings/Plugin.h b/src/Bindings/Plugin.h
index 949e4693a..df0bd4dcc 100644
--- a/src/Bindings/Plugin.h
+++ b/src/Bindings/Plugin.h
@@ -46,6 +46,7 @@ public:
* On all these functions, return true if you want to override default behavior and not call other plugins on that callback.
* You can also return false, so default behavior is used.
**/
+ virtual bool OnBlockSpread (cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source) = 0;
virtual bool OnBlockToPickups (cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) = 0;
virtual bool OnChat (cPlayer * a_Player, AString & a_Message) = 0;
virtual bool OnChunkAvailable (cWorld * a_World, int a_ChunkX, int a_ChunkZ) = 0;
@@ -89,6 +90,8 @@ public:
virtual bool OnPluginsLoaded (void) = 0;
virtual bool OnPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0;
virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0;
+ virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile) = 0;
+ virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) = 0;
virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) = 0;
virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) = 0;
virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) = 0;
diff --git a/src/Bindings/PluginLua.cpp b/src/Bindings/PluginLua.cpp
index cccbc3c93..7e69e0f4b 100644
--- a/src/Bindings/PluginLua.cpp
+++ b/src/Bindings/PluginLua.cpp
@@ -195,6 +195,26 @@ void cPluginLua::Tick(float a_Dt)
+bool cPluginLua::OnBlockSpread(cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source)
+{
+ cCSLock Lock(m_CriticalSection);
+ bool res = false;
+ cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_BLOCK_SPREAD];
+ for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
+ {
+ m_LuaState.Call((int)(**itr), a_World, a_BlockX, a_BlockY, a_BlockZ, a_Source, cLuaState::Return, res);
+ if (res)
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
bool cPluginLua::OnBlockToPickups(cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups)
{
cCSLock Lock(m_CriticalSection);
@@ -1088,6 +1108,46 @@ bool cPluginLua::OnPreCrafting(const cPlayer * a_Player, const cCraftingGrid * a
+bool cPluginLua::OnProjectileHitBlock(cProjectileEntity & a_Projectile)
+{
+ cCSLock Lock(m_CriticalSection);
+ bool res = false;
+ cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PROJECTILE_HIT_BLOCK];
+ for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
+ {
+ m_LuaState.Call((int)(**itr), &a_Projectile, cLuaState::Return, res);
+ if (res)
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
+bool cPluginLua::OnProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity & a_HitEntity)
+{
+ cCSLock Lock(m_CriticalSection);
+ bool res = false;
+ cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PROJECTILE_HIT_ENTITY];
+ for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
+ {
+ m_LuaState.Call((int)(**itr), &a_Projectile, &a_HitEntity, cLuaState::Return, res);
+ if (res)
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
bool cPluginLua::OnSpawnedEntity(cWorld & a_World, cEntity & a_Entity)
{
cCSLock Lock(m_CriticalSection);
@@ -1430,6 +1490,7 @@ const char * cPluginLua::GetHookFnName(int a_HookType)
{
switch (a_HookType)
{
+ case cPluginManager::HOOK_BLOCK_SPREAD: return "OnBlockSpread";
case cPluginManager::HOOK_BLOCK_TO_PICKUPS: return "OnBlockToPickups";
case cPluginManager::HOOK_CHAT: return "OnChat";
case cPluginManager::HOOK_CHUNK_AVAILABLE: return "OnChunkAvailable";
diff --git a/src/Bindings/PluginLua.h b/src/Bindings/PluginLua.h
index a177f5288..59542d23a 100644
--- a/src/Bindings/PluginLua.h
+++ b/src/Bindings/PluginLua.h
@@ -69,6 +69,7 @@ public:
virtual void Tick(float a_Dt) override;
+ virtual bool OnBlockSpread (cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source) override;
virtual bool OnBlockToPickups (cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) override;
virtual bool OnChat (cPlayer * a_Player, AString & a_Message) override;
virtual bool OnChunkAvailable (cWorld * a_World, int a_ChunkX, int a_ChunkZ) override;
@@ -112,6 +113,8 @@ public:
virtual bool OnPluginsLoaded (void) override;
virtual bool OnPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override;
virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override;
+ virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile) override;
+ virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) override;
virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) override;
virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) override;
virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) override;
diff --git a/src/Bindings/PluginManager.cpp b/src/Bindings/PluginManager.cpp
index b9cf160c4..6a5356c0b 100644
--- a/src/Bindings/PluginManager.cpp
+++ b/src/Bindings/PluginManager.cpp
@@ -205,6 +205,27 @@ void cPluginManager::Tick(float a_Dt)
+bool cPluginManager::CallHookBlockSpread(cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source)
+{
+ HookMap::iterator Plugins = m_Hooks.find(HOOK_BLOCK_SPREAD);
+ if (Plugins == m_Hooks.end())
+ {
+ return false;
+ }
+ for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
+ {
+ if ((*itr)->OnBlockSpread(a_World, a_BlockX, a_BlockY, a_BlockZ, a_Source))
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
bool cPluginManager::CallHookBlockToPickups(
cWorld * a_World, cEntity * a_Digger,
int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta,
@@ -1133,6 +1154,48 @@ bool cPluginManager::CallHookPreCrafting(const cPlayer * a_Player, const cCrafti
+bool cPluginManager::CallHookProjectileHitBlock(cProjectileEntity & a_Projectile)
+{
+ HookMap::iterator Plugins = m_Hooks.find(HOOK_PROJECTILE_HIT_BLOCK);
+ if (Plugins == m_Hooks.end())
+ {
+ return false;
+ }
+ for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
+ {
+ if ((*itr)->OnProjectileHitBlock(a_Projectile))
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
+bool cPluginManager::CallHookProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity & a_HitEntity)
+{
+ HookMap::iterator Plugins = m_Hooks.find(HOOK_PROJECTILE_HIT_ENTITY);
+ if (Plugins == m_Hooks.end())
+ {
+ return false;
+ }
+ for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
+ {
+ if ((*itr)->OnProjectileHitEntity(a_Projectile, a_HitEntity))
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
bool cPluginManager::CallHookSpawnedEntity(cWorld & a_World, cEntity & a_Entity)
{
HookMap::iterator Plugins = m_Hooks.find(HOOK_SPAWNED_ENTITY);
diff --git a/src/Bindings/PluginManager.h b/src/Bindings/PluginManager.h
index 44bc5a8d7..512bc1351 100644
--- a/src/Bindings/PluginManager.h
+++ b/src/Bindings/PluginManager.h
@@ -18,6 +18,9 @@ class cChunkDesc;
// fwd: Entities/Entity.h
class cEntity;
+// fwd: Entities/ProjectileEntity.h
+class cProjectileEntity;
+
// fwd: Mobs/Monster.h
class cMonster;
@@ -58,6 +61,7 @@ public: // tolua_export
// tolua_begin
enum PluginHook
{
+ HOOK_BLOCK_SPREAD,
HOOK_BLOCK_TO_PICKUPS,
HOOK_CHAT,
HOOK_CHUNK_AVAILABLE,
@@ -101,6 +105,8 @@ public: // tolua_export
HOOK_PLUGINS_LOADED,
HOOK_POST_CRAFTING,
HOOK_PRE_CRAFTING,
+ HOOK_PROJECTILE_HIT_BLOCK,
+ HOOK_PROJECTILE_HIT_ENTITY,
HOOK_SPAWNED_ENTITY,
HOOK_SPAWNED_MONSTER,
HOOK_SPAWNING_ENTITY,
@@ -127,6 +133,8 @@ public: // tolua_export
class cCommandEnumCallback
{
public:
+ virtual ~cCommandEnumCallback() {}
+
/** Called for each command; return true to abort enumeration
For console commands, a_Permission is not used (set to empty string)
*/
@@ -154,6 +162,7 @@ public: // tolua_export
unsigned int GetNumPlugins() const; // tolua_export
// Calls for individual hooks. Each returns false if the action is to continue or true if the plugin wants to abort
+ bool CallHookBlockSpread (cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source);
bool CallHookBlockToPickups (cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups);
bool CallHookChat (cPlayer * a_Player, AString & a_Message);
bool CallHookChunkAvailable (cWorld * a_World, int a_ChunkX, int a_ChunkZ);
@@ -197,6 +206,8 @@ public: // tolua_export
bool CallHookPluginsLoaded (void);
bool CallHookPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe);
bool CallHookPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe);
+ bool CallHookProjectileHitBlock (cProjectileEntity & a_Projectile);
+ bool CallHookProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity);
bool CallHookSpawnedEntity (cWorld & a_World, cEntity & a_Entity);
bool CallHookSpawnedMonster (cWorld & a_World, cMonster & a_Monster);
bool CallHookSpawningEntity (cWorld & a_World, cEntity & a_Entity);
diff --git a/src/Bindings/lua5.1.dll b/src/Bindings/lua51.dll
similarity index 100%
rename from src/Bindings/lua5.1.dll
rename to src/Bindings/lua51.dll
diff --git a/src/Bindings/tolua++.exe b/src/Bindings/tolua++.exe
index e5cec6d78..1e3cc7789 100644
Binary files a/src/Bindings/tolua++.exe and b/src/Bindings/tolua++.exe differ
diff --git a/src/BlockArea.cpp b/src/BlockArea.cpp
index 406e18a3b..60e4f11e5 100644
--- a/src/BlockArea.cpp
+++ b/src/BlockArea.cpp
@@ -54,7 +54,7 @@ template void InternalMergeBlocks(
/// Combinator used for cBlockArea::msOverwrite merging
-static void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
a_DstType = a_SrcType;
a_DstMeta = a_SrcMeta;
@@ -65,7 +65,7 @@ static void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType,
/// Combinator used for cBlockArea::msFillAir merging
-static void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
if (a_DstType == E_BLOCK_AIR)
{
@@ -80,7 +80,7 @@ static void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, N
/// Combinator used for cBlockArea::msImprint merging
-static void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
if (a_SrcType != E_BLOCK_AIR)
{
@@ -95,7 +95,7 @@ static void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, N
/// Combinator used for cBlockArea::msLake merging
-static void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
// Sponge is the NOP block
if (a_SrcType == E_BLOCK_SPONGE)
@@ -158,17 +158,59 @@ static void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBB
+/** Combinator used for cBlockArea::msSpongePrint merging */
+static inline void MergeCombinatorSpongePrint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+{
+ // Sponge overwrites nothing, everything else overwrites anything
+ if (a_SrcType != E_BLOCK_SPONGE)
+ {
+ a_DstType = a_SrcType;
+ a_DstMeta = a_SrcMeta;
+ }
+}
+
+
+
+
+
+/** Combinator used for cBlockArea::msDifference merging */
+static inline void MergeCombinatorDifference(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+{
+ if ((a_DstType == a_SrcType) && (a_DstMeta == a_SrcMeta))
+ {
+ a_DstType = E_BLOCK_AIR;
+ a_DstMeta = 0;
+ }
+ else
+ {
+ a_DstType = a_SrcType;
+ a_DstMeta = a_SrcMeta;
+ }
+}
+
+
+
+
+
+/** Combinator used for cBlockArea::msMask merging */
+static inline void MergeCombinatorMask(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+{
+ // If the blocks are the same, keep the dest; otherwise replace with air
+ if ((a_SrcType != a_DstType) || (a_SrcMeta != a_DstMeta))
+ {
+ a_DstType = E_BLOCK_AIR;
+ a_DstMeta = 0;
+ }
+}
+
+
+
+
+
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
// cBlockArea:
cBlockArea::cBlockArea(void) :
- m_OriginX(0),
- m_OriginY(0),
- m_OriginZ(0),
- m_SizeX(0),
- m_SizeY(0),
- m_SizeZ(0),
- m_WEOffset(0, 0, 0),
m_BlockTypes(NULL),
m_BlockMetas(NULL),
m_BlockLight(NULL),
@@ -195,12 +237,8 @@ void cBlockArea::Clear(void)
delete[] m_BlockMetas; m_BlockMetas = NULL;
delete[] m_BlockLight; m_BlockLight = NULL;
delete[] m_BlockSkyLight; m_BlockSkyLight = NULL;
- m_OriginX = 0;
- m_OriginY = 0;
- m_OriginZ = 0;
- m_SizeX = 0;
- m_SizeY = 0;
- m_SizeZ = 0;
+ m_Origin.Set(0, 0, 0);
+ m_Size.Set(0, 0, 0);
}
@@ -243,12 +281,17 @@ void cBlockArea::Create(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes)
m_BlockSkyLight[i] = 0x0f;
}
}
- m_SizeX = a_SizeX;
- m_SizeY = a_SizeY;
- m_SizeZ = a_SizeZ;
- m_OriginX = 0;
- m_OriginY = 0;
- m_OriginZ = 0;
+ m_Size.Set(a_SizeX, a_SizeY, a_SizeZ);
+ m_Origin.Set(0, 0, 0);
+}
+
+
+
+
+
+void cBlockArea::Create(const Vector3i & a_Size, int a_DataTypes)
+{
+ Create(a_Size.x, a_Size.y, a_Size.z, a_DataTypes);
}
@@ -275,9 +318,7 @@ void cBlockArea::SetWEOffset(const Vector3i & a_Offset)
void cBlockArea::SetOrigin(int a_OriginX, int a_OriginY, int a_OriginZ)
{
- m_OriginX = a_OriginX;
- m_OriginY = a_OriginY;
- m_OriginZ = a_OriginZ;
+ m_Origin.Set(a_OriginX, a_OriginY, a_OriginZ);
}
@@ -286,7 +327,7 @@ void cBlockArea::SetOrigin(int a_OriginX, int a_OriginY, int a_OriginZ)
void cBlockArea::SetOrigin(const Vector3i & a_Origin)
{
- SetOrigin(a_Origin.x, a_Origin.y, a_Origin.z);
+ m_Origin.Set(a_Origin.x, a_Origin.y, a_Origin.z);
}
@@ -342,9 +383,7 @@ bool cBlockArea::Read(cForEachChunkProvider * a_ForEachChunkProvider, int a_MinB
{
return false;
}
- m_OriginX = a_MinBlockX;
- m_OriginY = a_MinBlockY;
- m_OriginZ = a_MinBlockZ;
+ m_Origin.Set(a_MinBlockX, a_MinBlockY, a_MinBlockZ);
cChunkReader Reader(*this);
// Convert block coords to chunks coords:
@@ -408,10 +447,10 @@ bool cBlockArea::Write(cForEachChunkProvider * a_ForEachChunkProvider, int a_Min
LOGWARNING("%s: MinBlockY less than zero, adjusting to zero", __FUNCTION__);
a_MinBlockY = 0;
}
- else if (a_MinBlockY > cChunkDef::Height - m_SizeY)
+ else if (a_MinBlockY > cChunkDef::Height - m_Size.y)
{
LOGWARNING("%s: MinBlockY + m_SizeY more than chunk height, adjusting to chunk height", __FUNCTION__);
- a_MinBlockY = cChunkDef::Height - m_SizeY;
+ a_MinBlockY = cChunkDef::Height - m_Size.y;
}
return a_ForEachChunkProvider->WriteBlockArea(*this, a_MinBlockX, a_MinBlockY, a_MinBlockZ, a_DataTypes);
@@ -443,10 +482,8 @@ void cBlockArea::CopyTo(cBlockArea & a_Into) const
}
a_Into.Clear();
- a_Into.SetSize(m_SizeX, m_SizeY, m_SizeZ, GetDataTypes());
- a_Into.m_OriginX = m_OriginX;
- a_Into.m_OriginY = m_OriginY;
- a_Into.m_OriginZ = m_OriginZ;
+ a_Into.SetSize(m_Size.x, m_Size.y, m_Size.z, GetDataTypes());
+ a_Into.m_Origin = m_Origin;
int BlockCount = GetBlockCount();
if (HasBlockTypes())
{
@@ -487,9 +524,9 @@ void cBlockArea::DumpToRawFile(const AString & a_FileName)
LOGWARNING("cBlockArea: Cannot open file \"%s\" for raw dump", a_FileName.c_str());
return;
}
- UInt32 SizeX = ntohl(m_SizeX);
- UInt32 SizeY = ntohl(m_SizeY);
- UInt32 SizeZ = ntohl(m_SizeZ);
+ UInt32 SizeX = ntohl(m_Size.x);
+ UInt32 SizeY = ntohl(m_Size.y);
+ UInt32 SizeZ = ntohl(m_Size.z);
f.Write(&SizeX, 4);
f.Write(&SizeY, 4);
f.Write(&SizeZ, 4);
@@ -532,13 +569,13 @@ void cBlockArea::DumpToRawFile(const AString & a_FileName)
void cBlockArea::Crop(int a_AddMinX, int a_SubMaxX, int a_AddMinY, int a_SubMaxY, int a_AddMinZ, int a_SubMaxZ)
{
if (
- (a_AddMinX + a_SubMaxX >= m_SizeX) ||
- (a_AddMinY + a_SubMaxY >= m_SizeY) ||
- (a_AddMinZ + a_SubMaxZ >= m_SizeZ)
+ (a_AddMinX + a_SubMaxX >= m_Size.x) ||
+ (a_AddMinY + a_SubMaxY >= m_Size.y) ||
+ (a_AddMinZ + a_SubMaxZ >= m_Size.z)
)
{
LOGWARNING("cBlockArea:Crop called with more croping than the dimensions: %d x %d x %d with cropping %d, %d and %d",
- m_SizeX, m_SizeY, m_SizeZ,
+ m_Size.x, m_Size.y, m_Size.z,
a_AddMinX + a_SubMaxX, a_AddMinY + a_SubMaxY, a_AddMinZ + a_SubMaxZ
);
return;
@@ -560,12 +597,10 @@ void cBlockArea::Crop(int a_AddMinX, int a_SubMaxX, int a_AddMinY, int a_SubMaxY
{
CropNibbles(m_BlockSkyLight, a_AddMinX, a_SubMaxX, a_AddMinY, a_SubMaxY, a_AddMinZ, a_SubMaxZ);
}
- m_OriginX += a_AddMinX;
- m_OriginY += a_AddMinY;
- m_OriginZ += a_AddMinZ;
- m_SizeX -= a_AddMinX + a_SubMaxX;
- m_SizeY -= a_AddMinY + a_SubMaxY;
- m_SizeZ -= a_AddMinZ + a_SubMaxZ;
+ m_Origin.Move(a_AddMinX, a_AddMinY, a_AddMinZ);
+ m_Size.x -= a_AddMinX + a_SubMaxX;
+ m_Size.y -= a_AddMinY + a_SubMaxY;
+ m_Size.z -= a_AddMinZ + a_SubMaxZ;
}
@@ -590,12 +625,10 @@ void cBlockArea::Expand(int a_SubMinX, int a_AddMaxX, int a_SubMinY, int a_AddMa
{
ExpandNibbles(m_BlockSkyLight, a_SubMinX, a_AddMaxX, a_SubMinY, a_AddMaxY, a_SubMinZ, a_AddMaxZ);
}
- m_OriginX -= a_SubMinX;
- m_OriginY -= a_SubMinY;
- m_OriginZ -= a_SubMinZ;
- m_SizeX += a_SubMinX + a_AddMaxX;
- m_SizeY += a_SubMinY + a_AddMaxY;
- m_SizeZ += a_SubMinZ + a_AddMaxZ;
+ m_Origin.Move(-a_SubMinX, -a_SubMinY, -a_SubMinZ);
+ m_Size.x += a_SubMinX + a_AddMaxX;
+ m_Size.y += a_SubMinY + a_AddMaxY;
+ m_Size.z += a_SubMinZ + a_AddMaxZ;
}
@@ -645,7 +678,7 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R
SrcOffX, SrcOffY, SrcOffZ,
DstOffX, DstOffY, DstOffZ,
a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
- m_SizeX, m_SizeY, m_SizeZ,
+ m_Size.x, m_Size.y, m_Size.z,
MergeCombinatorOverwrite
);
break;
@@ -660,7 +693,7 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R
SrcOffX, SrcOffY, SrcOffZ,
DstOffX, DstOffY, DstOffZ,
a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
- m_SizeX, m_SizeY, m_SizeZ,
+ m_Size.x, m_Size.y, m_Size.z,
MergeCombinatorFillAir
);
break;
@@ -675,7 +708,7 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R
SrcOffX, SrcOffY, SrcOffZ,
DstOffX, DstOffY, DstOffZ,
a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
- m_SizeX, m_SizeY, m_SizeZ,
+ m_Size.x, m_Size.y, m_Size.z,
MergeCombinatorImprint
);
break;
@@ -690,12 +723,57 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R
SrcOffX, SrcOffY, SrcOffZ,
DstOffX, DstOffY, DstOffZ,
a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
- m_SizeX, m_SizeY, m_SizeZ,
+ m_Size.x, m_Size.y, m_Size.z,
MergeCombinatorLake
);
break;
} // case msLake
+ case msSpongePrint:
+ {
+ InternalMergeBlocks(
+ m_BlockTypes, a_Src.GetBlockTypes(),
+ DstMetas, SrcMetas,
+ SizeX, SizeY, SizeZ,
+ SrcOffX, SrcOffY, SrcOffZ,
+ DstOffX, DstOffY, DstOffZ,
+ a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
+ m_Size.x, m_Size.y, m_Size.z,
+ MergeCombinatorSpongePrint
+ );
+ break;
+ } // case msSpongePrint
+
+ case msDifference:
+ {
+ InternalMergeBlocks(
+ m_BlockTypes, a_Src.GetBlockTypes(),
+ DstMetas, SrcMetas,
+ SizeX, SizeY, SizeZ,
+ SrcOffX, SrcOffY, SrcOffZ,
+ DstOffX, DstOffY, DstOffZ,
+ a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
+ m_Size.x, m_Size.y, m_Size.z,
+ MergeCombinatorDifference
+ );
+ break;
+ } // case msDifference
+
+ case msMask:
+ {
+ InternalMergeBlocks(
+ m_BlockTypes, a_Src.GetBlockTypes(),
+ DstMetas, SrcMetas,
+ SizeX, SizeY, SizeZ,
+ SrcOffX, SrcOffY, SrcOffZ,
+ DstOffX, DstOffY, DstOffZ,
+ a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
+ m_Size.x, m_Size.y, m_Size.z,
+ MergeCombinatorMask
+ );
+ break;
+ } // case msMask
+
default:
{
LOGWARNING("Unknown block area merge strategy: %d", a_Strategy);
@@ -982,17 +1060,17 @@ void cBlockArea::RotateCCW(void)
}
// We are guaranteed that both blocktypes and blockmetas exist; rotate both at the same time:
- BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ];
- NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ];
- for (int x = 0; x < m_SizeX; x++)
+ BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()];
+ NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()];
+ for (int x = 0; x < m_Size.x; x++)
{
- int NewZ = m_SizeX - x - 1;
- for (int z = 0; z < m_SizeZ; z++)
+ int NewZ = m_Size.x - x - 1;
+ for (int z = 0; z < m_Size.z; z++)
{
int NewX = z;
- for (int y = 0; y < m_SizeY; y++)
+ for (int y = 0; y < m_Size.y; y++)
{
- int NewIdx = NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ;
+ int NewIdx = NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z;
int OldIdx = MakeIndex(x, y, z);
NewTypes[NewIdx] = m_BlockTypes[OldIdx];
NewMetas[NewIdx] = BlockHandler(m_BlockTypes[OldIdx])->MetaRotateCCW(m_BlockMetas[OldIdx]);
@@ -1004,7 +1082,7 @@ void cBlockArea::RotateCCW(void)
delete[] NewTypes;
delete[] NewMetas;
- std::swap(m_SizeX, m_SizeZ);
+ std::swap(m_Size.x, m_Size.z);
}
@@ -1027,17 +1105,17 @@ void cBlockArea::RotateCW(void)
}
// We are guaranteed that both blocktypes and blockmetas exist; rotate both at the same time:
- BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ];
- NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ];
- for (int x = 0; x < m_SizeX; x++)
+ BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()];
+ NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()];
+ for (int x = 0; x < m_Size.x; x++)
{
int NewZ = x;
- for (int z = 0; z < m_SizeZ; z++)
+ for (int z = 0; z < m_Size.z; z++)
{
- int NewX = m_SizeZ - z - 1;
- for (int y = 0; y < m_SizeY; y++)
+ int NewX = m_Size.z - z - 1;
+ for (int y = 0; y < m_Size.y; y++)
{
- int NewIdx = NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ;
+ int NewIdx = NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z;
int OldIdx = MakeIndex(x, y, z);
NewTypes[NewIdx] = m_BlockTypes[OldIdx];
NewMetas[NewIdx] = BlockHandler(m_BlockTypes[OldIdx])->MetaRotateCW(m_BlockMetas[OldIdx]);
@@ -1049,7 +1127,7 @@ void cBlockArea::RotateCW(void)
delete[] NewTypes;
delete[] NewMetas;
- std::swap(m_SizeX, m_SizeZ);
+ std::swap(m_Size.x, m_Size.z);
}
@@ -1072,13 +1150,13 @@ void cBlockArea::MirrorXY(void)
}
// We are guaranteed that both blocktypes and blockmetas exist; mirror both at the same time:
- int HalfZ = m_SizeZ / 2;
- int MaxZ = m_SizeZ - 1;
- for (int y = 0; y < m_SizeY; y++)
+ int HalfZ = m_Size.z / 2;
+ int MaxZ = m_Size.z - 1;
+ for (int y = 0; y < m_Size.y; y++)
{
for (int z = 0; z < HalfZ; z++)
{
- for (int x = 0; x < m_SizeX; x++)
+ for (int x = 0; x < m_Size.x; x++)
{
int Idx1 = MakeIndex(x, y, z);
int Idx2 = MakeIndex(x, y, MaxZ - z);
@@ -1112,13 +1190,13 @@ void cBlockArea::MirrorXZ(void)
}
// We are guaranteed that both blocktypes and blockmetas exist; mirror both at the same time:
- int HalfY = m_SizeY / 2;
- int MaxY = m_SizeY - 1;
+ int HalfY = m_Size.y / 2;
+ int MaxY = m_Size.y - 1;
for (int y = 0; y < HalfY; y++)
{
- for (int z = 0; z < m_SizeZ; z++)
+ for (int z = 0; z < m_Size.z; z++)
{
- for (int x = 0; x < m_SizeX; x++)
+ for (int x = 0; x < m_Size.x; x++)
{
int Idx1 = MakeIndex(x, y, z);
int Idx2 = MakeIndex(x, MaxY - y, z);
@@ -1152,11 +1230,11 @@ void cBlockArea::MirrorYZ(void)
}
// We are guaranteed that both blocktypes and blockmetas exist; mirror both at the same time:
- int HalfX = m_SizeX / 2;
- int MaxX = m_SizeX - 1;
- for (int y = 0; y < m_SizeY; y++)
+ int HalfX = m_Size.x / 2;
+ int MaxX = m_Size.x - 1;
+ for (int y = 0; y < m_Size.y; y++)
{
- for (int z = 0; z < m_SizeZ; z++)
+ for (int z = 0; z < m_Size.z; z++)
{
for (int x = 0; x < HalfX; x++)
{
@@ -1180,16 +1258,16 @@ void cBlockArea::RotateCCWNoMeta(void)
{
if (HasBlockTypes())
{
- BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ];
- for (int x = 0; x < m_SizeX; x++)
+ BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()];
+ for (int x = 0; x < m_Size.x; x++)
{
- int NewZ = m_SizeX - x - 1;
- for (int z = 0; z < m_SizeZ; z++)
+ int NewZ = m_Size.x - x - 1;
+ for (int z = 0; z < m_Size.z; z++)
{
int NewX = z;
- for (int y = 0; y < m_SizeY; y++)
+ for (int y = 0; y < m_Size.y; y++)
{
- NewTypes[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockTypes[MakeIndex(x, y, z)];
+ NewTypes[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockTypes[MakeIndex(x, y, z)];
} // for y
} // for z
} // for x
@@ -1198,23 +1276,23 @@ void cBlockArea::RotateCCWNoMeta(void)
}
if (HasBlockMetas())
{
- NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ];
- for (int x = 0; x < m_SizeX; x++)
+ NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()];
+ for (int x = 0; x < m_Size.x; x++)
{
- int NewZ = m_SizeX - x - 1;
- for (int z = 0; z < m_SizeZ; z++)
+ int NewZ = m_Size.x - x - 1;
+ for (int z = 0; z < m_Size.z; z++)
{
int NewX = z;
- for (int y = 0; y < m_SizeY; y++)
+ for (int y = 0; y < m_Size.y; y++)
{
- NewMetas[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockMetas[MakeIndex(x, y, z)];
+ NewMetas[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockMetas[MakeIndex(x, y, z)];
} // for y
} // for z
} // for x
std::swap(m_BlockMetas, NewMetas);
delete[] NewMetas;
}
- std::swap(m_SizeX, m_SizeZ);
+ std::swap(m_Size.x, m_Size.z);
}
@@ -1225,16 +1303,16 @@ void cBlockArea::RotateCWNoMeta(void)
{
if (HasBlockTypes())
{
- BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ];
- for (int z = 0; z < m_SizeZ; z++)
+ BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()];
+ for (int z = 0; z < m_Size.z; z++)
{
- int NewX = m_SizeZ - z - 1;
- for (int x = 0; x < m_SizeX; x++)
+ int NewX = m_Size.z - z - 1;
+ for (int x = 0; x < m_Size.x; x++)
{
int NewZ = x;
- for (int y = 0; y < m_SizeY; y++)
+ for (int y = 0; y < m_Size.y; y++)
{
- NewTypes[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockTypes[MakeIndex(x, y, z)];
+ NewTypes[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockTypes[MakeIndex(x, y, z)];
} // for y
} // for x
} // for z
@@ -1243,23 +1321,23 @@ void cBlockArea::RotateCWNoMeta(void)
}
if (HasBlockMetas())
{
- NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ];
- for (int z = 0; z < m_SizeZ; z++)
+ NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()];
+ for (int z = 0; z < m_Size.z; z++)
{
- int NewX = m_SizeZ - z - 1;
- for (int x = 0; x < m_SizeX; x++)
+ int NewX = m_Size.z - z - 1;
+ for (int x = 0; x < m_Size.x; x++)
{
int NewZ = x;
- for (int y = 0; y < m_SizeY; y++)
+ for (int y = 0; y < m_Size.y; y++)
{
- NewMetas[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockMetas[MakeIndex(x, y, z)];
+ NewMetas[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockMetas[MakeIndex(x, y, z)];
} // for y
} // for x
} // for z
std::swap(m_BlockMetas, NewMetas);
delete[] NewMetas;
}
- std::swap(m_SizeX, m_SizeZ);
+ std::swap(m_Size.x, m_Size.z);
}
@@ -1268,15 +1346,15 @@ void cBlockArea::RotateCWNoMeta(void)
void cBlockArea::MirrorXYNoMeta(void)
{
- int HalfZ = m_SizeZ / 2;
- int MaxZ = m_SizeZ - 1;
+ int HalfZ = m_Size.z / 2;
+ int MaxZ = m_Size.z - 1;
if (HasBlockTypes())
{
- for (int y = 0; y < m_SizeY; y++)
+ for (int y = 0; y < m_Size.y; y++)
{
for (int z = 0; z < HalfZ; z++)
{
- for (int x = 0; x < m_SizeX; x++)
+ for (int x = 0; x < m_Size.x; x++)
{
std::swap(m_BlockTypes[MakeIndex(x, y, z)], m_BlockTypes[MakeIndex(x, y, MaxZ - z)]);
} // for x
@@ -1286,11 +1364,11 @@ void cBlockArea::MirrorXYNoMeta(void)
if (HasBlockMetas())
{
- for (int y = 0; y < m_SizeY; y++)
+ for (int y = 0; y < m_Size.y; y++)
{
for (int z = 0; z < HalfZ; z++)
{
- for (int x = 0; x < m_SizeX; x++)
+ for (int x = 0; x < m_Size.x; x++)
{
std::swap(m_BlockMetas[MakeIndex(x, y, z)], m_BlockMetas[MakeIndex(x, y, MaxZ - z)]);
} // for x
@@ -1305,15 +1383,15 @@ void cBlockArea::MirrorXYNoMeta(void)
void cBlockArea::MirrorXZNoMeta(void)
{
- int HalfY = m_SizeY / 2;
- int MaxY = m_SizeY - 1;
+ int HalfY = m_Size.y / 2;
+ int MaxY = m_Size.y - 1;
if (HasBlockTypes())
{
for (int y = 0; y < HalfY; y++)
{
- for (int z = 0; z < m_SizeZ; z++)
+ for (int z = 0; z < m_Size.z; z++)
{
- for (int x = 0; x < m_SizeX; x++)
+ for (int x = 0; x < m_Size.x; x++)
{
std::swap(m_BlockTypes[MakeIndex(x, y, z)], m_BlockTypes[MakeIndex(x, MaxY - y, z)]);
} // for x
@@ -1325,9 +1403,9 @@ void cBlockArea::MirrorXZNoMeta(void)
{
for (int y = 0; y < HalfY; y++)
{
- for (int z = 0; z < m_SizeZ; z++)
+ for (int z = 0; z < m_Size.z; z++)
{
- for (int x = 0; x < m_SizeX; x++)
+ for (int x = 0; x < m_Size.x; x++)
{
std::swap(m_BlockMetas[MakeIndex(x, y, z)], m_BlockMetas[MakeIndex(x, MaxY - y, z)]);
} // for x
@@ -1342,13 +1420,13 @@ void cBlockArea::MirrorXZNoMeta(void)
void cBlockArea::MirrorYZNoMeta(void)
{
- int HalfX = m_SizeX / 2;
- int MaxX = m_SizeX - 1;
+ int HalfX = m_Size.x / 2;
+ int MaxX = m_Size.x - 1;
if (HasBlockTypes())
{
- for (int y = 0; y < m_SizeY; y++)
+ for (int y = 0; y < m_Size.y; y++)
{
- for (int z = 0; z < m_SizeZ; z++)
+ for (int z = 0; z < m_Size.z; z++)
{
for (int x = 0; x < HalfX; x++)
{
@@ -1360,9 +1438,9 @@ void cBlockArea::MirrorYZNoMeta(void)
if (HasBlockMetas())
{
- for (int y = 0; y < m_SizeY; y++)
+ for (int y = 0; y < m_Size.y; y++)
{
- for (int z = 0; z < m_SizeZ; z++)
+ for (int z = 0; z < m_Size.z; z++)
{
for (int x = 0; x < HalfX; x++)
{
@@ -1393,7 +1471,7 @@ void cBlockArea::SetRelBlockType(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE a
void cBlockArea::SetBlockType(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType)
{
- SetRelBlockType(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_BlockType);
+ SetRelBlockType(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_BlockType);
}
@@ -1470,7 +1548,7 @@ BLOCKTYPE cBlockArea::GetRelBlockType(int a_RelX, int a_RelY, int a_RelZ) const
BLOCKTYPE cBlockArea::GetBlockType(int a_BlockX, int a_BlockY, int a_BlockZ) const
{
- return GetRelBlockType(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ);
+ return GetRelBlockType(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z);
}
@@ -1533,7 +1611,7 @@ NIBBLETYPE cBlockArea::GetBlockSkyLight(int a_BlockX, int a_BlockY, int a_BlockZ
void cBlockArea::SetBlockTypeMeta(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta)
{
- SetRelBlockTypeMeta(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_BlockType, a_BlockMeta);
+ SetRelBlockTypeMeta(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_BlockType, a_BlockMeta);
}
@@ -1567,7 +1645,7 @@ void cBlockArea::SetRelBlockTypeMeta(int a_RelX, int a_RelY, int a_RelZ, B
void cBlockArea::GetBlockTypeMeta(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) const
{
- return GetRelBlockTypeMeta(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_BlockType, a_BlockMeta);
+ return GetRelBlockTypeMeta(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_BlockType, a_BlockMeta);
}
@@ -1670,9 +1748,7 @@ bool cBlockArea::SetSize(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes)
return false;
}
}
- m_SizeX = a_SizeX;
- m_SizeY = a_SizeY;
- m_SizeZ = a_SizeZ;
+ m_Size.Set(a_SizeX, a_SizeY, a_SizeZ);
return true;
}
@@ -1683,13 +1759,13 @@ bool cBlockArea::SetSize(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes)
int cBlockArea::MakeIndex(int a_RelX, int a_RelY, int a_RelZ) const
{
ASSERT(a_RelX >= 0);
- ASSERT(a_RelX < m_SizeX);
+ ASSERT(a_RelX < m_Size.x);
ASSERT(a_RelY >= 0);
- ASSERT(a_RelY < m_SizeY);
+ ASSERT(a_RelY < m_Size.y);
ASSERT(a_RelZ >= 0);
- ASSERT(a_RelZ < m_SizeZ);
+ ASSERT(a_RelZ < m_Size.z);
- return a_RelX + a_RelZ * m_SizeX + a_RelY * m_SizeX * m_SizeZ;
+ return a_RelX + a_RelZ * m_Size.x + a_RelY * m_Size.x * m_Size.z;
}
@@ -1712,7 +1788,7 @@ void cBlockArea::SetRelNibble(int a_RelX, int a_RelY, int a_RelZ, NIBBLETYPE a_V
void cBlockArea::SetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYPE a_Value, NIBBLETYPE * a_Array)
{
- SetRelNibble(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_Value, a_Array);
+ SetRelNibble(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_Value, a_Array);
}
@@ -1735,7 +1811,7 @@ NIBBLETYPE cBlockArea::GetRelNibble(int a_RelX, int a_RelY, int a_RelZ, NIBBLETY
NIBBLETYPE cBlockArea::GetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYPE * a_Array) const
{
- return GetRelNibble(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_Array);
+ return GetRelNibble(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_Array);
}
@@ -1748,9 +1824,7 @@ NIBBLETYPE cBlockArea::GetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBL
cBlockArea::cChunkReader::cChunkReader(cBlockArea & a_Area) :
m_Area(a_Area),
- m_OriginX(a_Area.m_OriginX),
- m_OriginY(a_Area.m_OriginY),
- m_OriginZ(a_Area.m_OriginZ)
+ m_Origin(a_Area.m_Origin.x, a_Area.m_Origin.y, a_Area.m_Origin.z)
{
}
@@ -1760,8 +1834,8 @@ cBlockArea::cChunkReader::cChunkReader(cBlockArea & a_Area) :
void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLETYPE * a_ChunkSrc)
{
- int SizeY = m_Area.m_SizeY;
- int MinY = m_OriginY;
+ int SizeY = m_Area.m_Size.y;
+ int MinY = m_Origin.y;
// SizeX, SizeZ are the dmensions of the block data to copy from the current chunk (size of the geometric union)
// OffX, OffZ are the offsets of the current chunk data from the area origin
@@ -1770,7 +1844,7 @@ void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLET
int SizeZ = cChunkDef::Width;
int OffX, OffZ;
int BaseX, BaseZ;
- OffX = m_CurrentChunkX * cChunkDef::Width - m_OriginX;
+ OffX = m_CurrentChunkX * cChunkDef::Width - m_Origin.x;
if (OffX < 0)
{
BaseX = -OffX;
@@ -1781,7 +1855,7 @@ void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLET
{
BaseX = 0;
}
- OffZ = m_CurrentChunkZ * cChunkDef::Width - m_OriginZ;
+ OffZ = m_CurrentChunkZ * cChunkDef::Width - m_Origin.z;
if (OffZ < 0)
{
BaseZ = -OffZ;
@@ -1793,13 +1867,13 @@ void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLET
BaseZ = 0;
}
// If the chunk extends beyond the area in the X or Z axis, cut off the Size:
- if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_OriginX + m_Area.m_SizeX)
+ if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_Origin.x + m_Area.m_Size.x)
{
- SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_OriginX + m_Area.m_SizeX);
+ SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_Origin.x + m_Area.m_Size.x);
}
- if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_OriginZ + m_Area.m_SizeZ)
+ if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_Origin.z + m_Area.m_Size.z)
{
- SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_OriginZ + m_Area.m_SizeZ);
+ SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_Origin.z + m_Area.m_Size.z);
}
for (int y = 0; y < SizeY; y++)
@@ -1843,8 +1917,8 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes)
return;
}
- int SizeY = m_Area.m_SizeY;
- int MinY = m_OriginY;
+ int SizeY = m_Area.m_Size.y;
+ int MinY = m_Origin.y;
// SizeX, SizeZ are the dmensions of the block data to copy from the current chunk (size of the geometric union)
// OffX, OffZ are the offsets of the current chunk data from the area origin
@@ -1853,7 +1927,7 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes)
int SizeZ = cChunkDef::Width;
int OffX, OffZ;
int BaseX, BaseZ;
- OffX = m_CurrentChunkX * cChunkDef::Width - m_OriginX;
+ OffX = m_CurrentChunkX * cChunkDef::Width - m_Origin.x;
if (OffX < 0)
{
BaseX = -OffX;
@@ -1864,7 +1938,7 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes)
{
BaseX = 0;
}
- OffZ = m_CurrentChunkZ * cChunkDef::Width - m_OriginZ;
+ OffZ = m_CurrentChunkZ * cChunkDef::Width - m_Origin.z;
if (OffZ < 0)
{
BaseZ = -OffZ;
@@ -1876,13 +1950,13 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes)
BaseZ = 0;
}
// If the chunk extends beyond the area in the X or Z axis, cut off the Size:
- if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_OriginX + m_Area.m_SizeX)
+ if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_Origin.x + m_Area.m_Size.x)
{
- SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_OriginX + m_Area.m_SizeX);
+ SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_Origin.x + m_Area.m_Size.x);
}
- if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_OriginZ + m_Area.m_SizeZ)
+ if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_Origin.z + m_Area.m_Size.z)
{
- SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_OriginZ + m_Area.m_SizeZ);
+ SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_Origin.z + m_Area.m_Size.z);
}
for (int y = 0; y < SizeY; y++)
@@ -2002,21 +2076,21 @@ void cBlockArea::CropNibbles(NIBBLEARRAY & a_Array, int a_AddMinX, int a_SubMaxX
void cBlockArea::ExpandBlockTypes(int a_SubMinX, int a_AddMaxX, int a_SubMinY, int a_AddMaxY, int a_SubMinZ, int a_AddMaxZ)
{
- int NewSizeX = m_SizeX + a_SubMinX + a_AddMaxX;
- int NewSizeY = m_SizeY + a_SubMinY + a_AddMaxY;
- int NewSizeZ = m_SizeZ + a_SubMinZ + a_AddMaxZ;
+ int NewSizeX = m_Size.x + a_SubMinX + a_AddMaxX;
+ int NewSizeY = m_Size.y + a_SubMinY + a_AddMaxY;
+ int NewSizeZ = m_Size.z + a_SubMinZ + a_AddMaxZ;
int BlockCount = NewSizeX * NewSizeY * NewSizeZ;
BLOCKTYPE * NewBlockTypes = new BLOCKTYPE[BlockCount];
memset(NewBlockTypes, 0, BlockCount * sizeof(BLOCKTYPE));
int OldIndex = 0;
- for (int y = 0; y < m_SizeY; y++)
+ for (int y = 0; y < m_Size.y; y++)
{
- int IndexBaseY = (y + a_SubMinY) * m_SizeX * m_SizeZ;
- for (int z = 0; z < m_SizeZ; z++)
+ int IndexBaseY = (y + a_SubMinY) * m_Size.x * m_Size.z;
+ for (int z = 0; z < m_Size.z; z++)
{
- int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_SizeX;
+ int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_Size.x;
int idx = IndexBaseZ + a_SubMinX;
- for (int x = 0; x < m_SizeX; x++)
+ for (int x = 0; x < m_Size.x; x++)
{
NewBlockTypes[idx++] = m_BlockTypes[OldIndex++];
} // for x
@@ -2032,21 +2106,21 @@ void cBlockArea::ExpandBlockTypes(int a_SubMinX, int a_AddMaxX, int a_SubMinY, i
void cBlockArea::ExpandNibbles(NIBBLEARRAY & a_Array, int a_SubMinX, int a_AddMaxX, int a_SubMinY, int a_AddMaxY, int a_SubMinZ, int a_AddMaxZ)
{
- int NewSizeX = m_SizeX + a_SubMinX + a_AddMaxX;
- int NewSizeY = m_SizeY + a_SubMinY + a_AddMaxY;
- int NewSizeZ = m_SizeZ + a_SubMinZ + a_AddMaxZ;
+ int NewSizeX = m_Size.x + a_SubMinX + a_AddMaxX;
+ int NewSizeY = m_Size.y + a_SubMinY + a_AddMaxY;
+ int NewSizeZ = m_Size.z + a_SubMinZ + a_AddMaxZ;
int BlockCount = NewSizeX * NewSizeY * NewSizeZ;
NIBBLETYPE * NewNibbles = new NIBBLETYPE[BlockCount];
memset(NewNibbles, 0, BlockCount * sizeof(NIBBLETYPE));
int OldIndex = 0;
- for (int y = 0; y < m_SizeY; y++)
+ for (int y = 0; y < m_Size.y; y++)
{
- int IndexBaseY = (y + a_SubMinY) * m_SizeX * m_SizeZ;
- for (int z = 0; z < m_SizeZ; z++)
+ int IndexBaseY = (y + a_SubMinY) * m_Size.x * m_Size.z;
+ for (int z = 0; z < m_Size.z; z++)
{
- int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_SizeX;
+ int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_Size.x;
int idx = IndexBaseZ + a_SubMinX;
- for (int x = 0; x < m_SizeX; x++)
+ for (int x = 0; x < m_Size.x; x++)
{
NewNibbles[idx++] = a_Array[OldIndex++];
} // for x
@@ -2057,6 +2131,9 @@ void cBlockArea::ExpandNibbles(NIBBLEARRAY & a_Array, int a_SubMinX, int a_AddMa
}
+
+
+
void cBlockArea::RelSetData(
int a_RelX, int a_RelY, int a_RelZ,
int a_DataTypes, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta,
diff --git a/src/BlockArea.h b/src/BlockArea.h
index e0e8fe972..c48175b8c 100644
--- a/src/BlockArea.h
+++ b/src/BlockArea.h
@@ -43,12 +43,17 @@ public:
baSkyLight = 8,
} ;
+ /** The per-block strategy to use when merging another block area into this object.
+ See the Merge function for the description of these */
enum eMergeStrategy
{
msOverwrite,
msFillAir,
msImprint,
msLake,
+ msSpongePrint,
+ msDifference,
+ msMask,
} ;
cBlockArea(void);
@@ -57,12 +62,18 @@ public:
/** Clears the data stored to reclaim memory */
void Clear(void);
- /** Creates a new area of the specified size and contents.
- Origin is set to all zeroes.
+ /** Creates a new area of the specified size and contents.
+ Origin is set to all zeroes.
BlockTypes are set to air, block metas to zero, blocklights to zero and skylights to full light.
*/
void Create(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes = baTypes | baMetas);
+ /** Creates a new area of the specified size and contents.
+ Origin is set to all zeroes.
+ BlockTypes are set to air, block metas to zero, blocklights to zero and skylights to full light.
+ */
+ void Create(const Vector3i & a_Size, int a_DataTypes = baTypes | baMetas);
+
/** Resets the origin. No other changes are made, contents are untouched. */
void SetOrigin(int a_OriginX, int a_OriginY, int a_OriginZ);
@@ -119,8 +130,8 @@ public:
- msFillAir overwrites only those blocks that were air
- msImprint overwrites with only those blocks that are non-air
- Special strategies:
- msLake (evaluate top-down, first match wins):
+ Special strategies (evaluate top-down, first match wins):
+ msLake:
| area block | |
| this | Src | result |
+----------+--------+--------+
@@ -135,6 +146,22 @@ public:
| mycelium | stone | stone | ... and mycelium
| A | stone | A | ... but nothing else
| A | * | A | Everything else is left as it is
+
+ msSpongePrint:
+ Used for most generators, it allows carving out air pockets, too, and uses the Sponge as the NOP block
+ | area block | |
+ | this | Src | result |
+ +----------+--------+--------+
+ | A | sponge | A | Sponge is the NOP block
+ | * | B | B | Everything else overwrites anything
+
+ msMask:
+ Combines two areas, the blocks that are the same are kept, differing ones are reset to air
+ | area block | |
+ | this | Src | result |
+ +------+-------+--------+
+ | A | A | A | Same blocks are kept
+ | A | non-A | air | Everything else is replaced with air
*/
void Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_RelZ, eMergeStrategy a_Strategy);
@@ -232,18 +259,24 @@ public:
void GetBlockTypeMeta (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) const;
void GetRelBlockTypeMeta(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) const;
+ // GetSize() is already exported manually to return 3 numbers, can't auto-export
+ const Vector3i & GetSize(void) const { return m_Size; }
+
+ // GetOrigin() is already exported manually to return 3 numbers, can't auto-export
+ const Vector3i & GetOrigin(void) const { return m_Origin; }
+
// tolua_begin
- int GetSizeX(void) const { return m_SizeX; }
- int GetSizeY(void) const { return m_SizeY; }
- int GetSizeZ(void) const { return m_SizeZ; }
+ int GetSizeX(void) const { return m_Size.x; }
+ int GetSizeY(void) const { return m_Size.y; }
+ int GetSizeZ(void) const { return m_Size.z; }
/** Returns the volume of the area, as number of blocks */
- int GetVolume(void) const { return m_SizeX * m_SizeY * m_SizeZ; }
+ int GetVolume(void) const { return m_Size.x * m_Size.y * m_Size.z; }
- int GetOriginX(void) const { return m_OriginX; }
- int GetOriginY(void) const { return m_OriginY; }
- int GetOriginZ(void) const { return m_OriginZ; }
+ int GetOriginX(void) const { return m_Origin.x; }
+ int GetOriginY(void) const { return m_Origin.y; }
+ int GetOriginZ(void) const { return m_Origin.z; }
/** Returns the datatypes that are stored in the object (bitmask of baXXX values) */
int GetDataTypes(void) const;
@@ -261,7 +294,7 @@ public:
NIBBLETYPE * GetBlockMetas (void) const { return m_BlockMetas; } // NOTE: one byte per block!
NIBBLETYPE * GetBlockLight (void) const { return m_BlockLight; } // NOTE: one byte per block!
NIBBLETYPE * GetBlockSkyLight(void) const { return m_BlockSkyLight; } // NOTE: one byte per block!
- int GetBlockCount(void) const { return m_SizeX * m_SizeY * m_SizeZ; }
+ int GetBlockCount(void) const { return m_Size.x * m_Size.y * m_Size.z; }
int MakeIndex(int a_RelX, int a_RelY, int a_RelZ) const;
protected:
@@ -276,9 +309,7 @@ protected:
protected:
cBlockArea & m_Area;
- int m_OriginX;
- int m_OriginY;
- int m_OriginZ;
+ Vector3i m_Origin;
int m_CurrentChunkX;
int m_CurrentChunkZ;
@@ -295,12 +326,8 @@ protected:
typedef NIBBLETYPE * NIBBLEARRAY;
- int m_OriginX;
- int m_OriginY;
- int m_OriginZ;
- int m_SizeX;
- int m_SizeY;
- int m_SizeZ;
+ Vector3i m_Origin;
+ Vector3i m_Size;
/** An extra data value sometimes stored in the .schematic file. Used mainly by the WorldEdit plugin.
cBlockArea doesn't use this value in any way. */
diff --git a/src/BlockEntities/DispenserEntity.cpp b/src/BlockEntities/DispenserEntity.cpp
index cbfbb1b6a..e03bf776d 100644
--- a/src/BlockEntities/DispenserEntity.cpp
+++ b/src/BlockEntities/DispenserEntity.cpp
@@ -138,6 +138,12 @@ void cDispenserEntity::DropSpenseFromSlot(cChunk & a_Chunk, int a_SlotNum)
break;
}
+ case E_ITEM_FIRE_CHARGE:
+ {
+ // TODO: Spawn fireball entity
+ break;
+ }
+
default:
{
DropFromSlot(a_Chunk, a_SlotNum);
diff --git a/src/BlockEntities/HopperEntity.cpp b/src/BlockEntities/HopperEntity.cpp
index af7043767..41fb9f811 100644
--- a/src/BlockEntities/HopperEntity.cpp
+++ b/src/BlockEntities/HopperEntity.cpp
@@ -219,7 +219,7 @@ bool cHopperEntity::MovePickupsIn(cChunk & a_Chunk, Int64 a_CurrentTick)
Vector3f EntityPos = a_Entity->GetPosition();
Vector3f BlockPos(m_Pos.x + 0.5f, (float)m_Pos.y + 1, m_Pos.z + 0.5f); // One block above hopper, and search from center outwards
- float Distance = (EntityPos - BlockPos).Length();
+ double Distance = (EntityPos - BlockPos).Length();
if (Distance < 0.5)
{
diff --git a/src/BlockID.h b/src/BlockID.h
index 1c454cd23..2fec512e2 100644
--- a/src/BlockID.h
+++ b/src/BlockID.h
@@ -853,9 +853,30 @@ enum eExplosionSource
esWitherSkullBlue,
esWitherBirth,
esPlugin,
-
- // Obsolete constants, kept for compatibility, will be removed after some time:
- esCreeper = esMonster,
+} ;
+
+
+
+
+
+enum eShrapnelLevel
+{
+ slNone,
+ slGravityAffectedOnly,
+ slAll
+} ;
+
+
+
+
+
+enum eSpreadSource
+{
+ ssFireSpread,
+ ssGrassSpread,
+ ssMushroomSpread,
+ ssMycelSpread,
+ ssVineSpread,
} ;
// tolua_end
diff --git a/src/BlockInfo.cpp b/src/BlockInfo.cpp
index d1ecfdf7e..6fb5aa5b3 100644
--- a/src/BlockInfo.cpp
+++ b/src/BlockInfo.cpp
@@ -93,6 +93,7 @@ void cBlockInfo::Initialize(void)
ms_Info[E_BLOCK_IRON_BARS ].m_SpreadLightFalloff = 1;
ms_Info[E_BLOCK_IRON_DOOR ].m_SpreadLightFalloff = 1;
ms_Info[E_BLOCK_LEAVES ].m_SpreadLightFalloff = 1;
+ ms_Info[E_BLOCK_NEW_LEAVES ].m_SpreadLightFalloff = 1;
ms_Info[E_BLOCK_SIGN_POST ].m_SpreadLightFalloff = 1;
ms_Info[E_BLOCK_TORCH ].m_SpreadLightFalloff = 1;
ms_Info[E_BLOCK_VINES ].m_SpreadLightFalloff = 1;
@@ -364,7 +365,7 @@ void cBlockInfo::Initialize(void)
ms_Info[E_BLOCK_WOODEN_SLAB ].m_IsSolid = false;
- // Torch placeable blocks:
+ // Blocks that fully occupy their voxel - used as a guide for torch placeable blocks, amongst other things:
ms_Info[E_BLOCK_NEW_LOG ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_BEDROCK ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_BLOCK_OF_COAL ].m_FullyOccupiesVoxel = true;
@@ -396,6 +397,7 @@ void cBlockInfo::Initialize(void)
ms_Info[E_BLOCK_HAY_BALE ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_HUGE_BROWN_MUSHROOM ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_HUGE_RED_MUSHROOM ].m_FullyOccupiesVoxel = true;
+ ms_Info[E_BLOCK_ICE ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_IRON_BLOCK ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_IRON_ORE ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_JACK_O_LANTERN ].m_FullyOccupiesVoxel = true;
diff --git a/src/Blocks/BlockAnvil.h b/src/Blocks/BlockAnvil.h
new file mode 100644
index 000000000..93a796ef7
--- /dev/null
+++ b/src/Blocks/BlockAnvil.h
@@ -0,0 +1,61 @@
+
+#pragma once
+
+#include "BlockHandler.h"
+#include "../World.h"
+#include "../Entities/Player.h"
+
+
+
+
+
+class cBlockAnvilHandler :
+ public cBlockHandler
+{
+public:
+ cBlockAnvilHandler(BLOCKTYPE a_BlockType)
+ : cBlockHandler(a_BlockType)
+ {
+ }
+
+
+ virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
+ {
+ a_Pickups.push_back(cItem(E_BLOCK_ANVIL, 1, a_BlockMeta >> 2));
+ }
+
+
+ virtual bool GetPlacementBlockTypeMeta(
+ cChunkInterface & a_ChunkInterface, cPlayer * a_Player,
+ int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace,
+ int a_CursorX, int a_CursorY, int a_CursorZ,
+ BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta
+ ) override
+ {
+ a_BlockType = m_BlockType;
+ NIBBLETYPE HighBits = a_BlockMeta & 0x0c; // Only highest two bits are preserved
+ int Direction = (int)floor(a_Player->GetYaw() * 4.0 / 360.0 + 1.5) & 0x3;
+ switch (Direction)
+ {
+ case 0: a_BlockMeta = 0x2 | HighBits; break;
+ case 1: a_BlockMeta = 0x3 | HighBits; break;
+ case 2: a_BlockMeta = 0x0 | HighBits; break;
+ case 3: a_BlockMeta = 0x1 | HighBits; break;
+ default:
+ {
+ return false;
+ }
+ }
+ return true;
+ }
+
+
+ virtual bool IsUseable() override
+ {
+ return true;
+ }
+} ;
+
+
+
+
diff --git a/src/Blocks/BlockBed.cpp b/src/Blocks/BlockBed.cpp
index 3dad4feba..6a3c6a55b 100644
--- a/src/Blocks/BlockBed.cpp
+++ b/src/Blocks/BlockBed.cpp
@@ -51,6 +51,49 @@ void cBlockBedHandler::OnDestroyed(cChunkInterface & a_ChunkInterface, cWorldInt
+class cTimeFastForwardTester :
+ public cPlayerListCallback
+{
+ virtual bool Item(cPlayer * a_Player) override
+ {
+ if (!a_Player->IsInBed())
+ {
+ return true;
+ }
+
+ return false;
+ }
+};
+
+
+
+
+
+class cPlayerBedStateUnsetter :
+ public cPlayerListCallback
+{
+public:
+ cPlayerBedStateUnsetter(Vector3i a_Position, cWorldInterface & a_WorldInterface) :
+ m_Position(a_Position), m_WorldInterface(a_WorldInterface)
+ {
+ }
+
+ virtual bool Item(cPlayer * a_Player) override
+ {
+ a_Player->SetIsInBed(false);
+ m_WorldInterface.GetBroadcastManager().BroadcastEntityAnimation(*a_Player, 2);
+ return false;
+ }
+
+private:
+ Vector3i m_Position;
+ cWorldInterface & m_WorldInterface;
+};
+
+
+
+
+
void cBlockBedHandler::OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ)
{
if (a_WorldInterface.GetDimension() != dimOverworld)
@@ -69,6 +112,8 @@ void cBlockBedHandler::OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface
}
else
{
+ Vector3i PillowDirection(0, 0, 0);
+
if (Meta & 0x8)
{
// Is pillow
@@ -77,16 +122,30 @@ void cBlockBedHandler::OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface
else
{
// Is foot end
- Vector3i Direction = MetaDataToDirection( Meta & 0x7 );
- if (a_ChunkInterface.GetBlock(a_BlockX + Direction.x, a_BlockY, a_BlockZ + Direction.z) == E_BLOCK_BED) // Must always use pillow location for sleeping
+ VERIFY((Meta & 0x4) != 0x4); // Occupied flag should never be set, else our compilator (intended) is broken
+
+ PillowDirection = MetaDataToDirection(Meta & 0x7);
+ if (a_ChunkInterface.GetBlock(a_BlockX + PillowDirection.x, a_BlockY, a_BlockZ + PillowDirection.z) == E_BLOCK_BED) // Must always use pillow location for sleeping
{
- a_WorldInterface.GetBroadcastManager().BroadcastUseBed(*a_Player, a_BlockX + Direction.x, a_BlockY, a_BlockZ + Direction.z);
+ a_WorldInterface.GetBroadcastManager().BroadcastUseBed(*a_Player, a_BlockX + PillowDirection.x, a_BlockY, a_BlockZ + PillowDirection.z);
}
}
- a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, (Meta | (1 << 2)));
- }
-
- } else {
+
+ a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta | 0x4); // Where 0x4 = occupied bit
+ a_Player->SetIsInBed(true);
+
+ cTimeFastForwardTester Tester;
+ if (a_WorldInterface.ForEachPlayer(Tester))
+ {
+ cPlayerBedStateUnsetter Unsetter(Vector3i(a_BlockX + PillowDirection.x, a_BlockY, a_BlockZ + PillowDirection.z), a_WorldInterface);
+ a_WorldInterface.ForEachPlayer(Unsetter);
+ a_WorldInterface.SetTimeOfDay(0);
+ a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta & 0xB); // Where 0xB = 1011, and zero is to make sure 'occupied' bit is always unset
+ }
+ }
+ }
+ else
+ {
a_Player->SendMessageFailure("You can only sleep at night");
}
}
diff --git a/src/Blocks/BlockBed.h b/src/Blocks/BlockBed.h
index 6daa94730..92804aaac 100644
--- a/src/Blocks/BlockBed.h
+++ b/src/Blocks/BlockBed.h
@@ -4,7 +4,7 @@
#include "BlockHandler.h"
#include "ChunkInterface.h"
#include "WorldInterface.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
#include "../Entities/Player.h"
@@ -12,11 +12,11 @@
class cBlockBedHandler :
- public cMetaRotater
+ public cMetaRotator
{
public:
cBlockBedHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockButton.h b/src/Blocks/BlockButton.h
index 740cbe3c4..4b2f6f618 100644
--- a/src/Blocks/BlockButton.h
+++ b/src/Blocks/BlockButton.h
@@ -2,17 +2,17 @@
#include "BlockHandler.h"
#include "Chunk.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockButtonHandler :
- public cMetaRotater
+ public cMetaRotator
{
public:
cBlockButtonHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockCake.h b/src/Blocks/BlockCake.h
new file mode 100644
index 000000000..36e133388
--- /dev/null
+++ b/src/Blocks/BlockCake.h
@@ -0,0 +1,55 @@
+#pragma once
+
+#include "BlockHandler.h"
+
+
+
+
+
+class cBlockCakeHandler :
+ public cBlockHandler
+{
+public:
+ cBlockCakeHandler(BLOCKTYPE a_BlockType)
+ : cBlockHandler(a_BlockType)
+ {
+ }
+
+ virtual void OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) override
+ {
+ NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
+
+ if (!a_Player->Feed(2, 0.1))
+ {
+ return;
+ }
+
+ if (Meta >= 5)
+ {
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+ }
+ else
+ {
+ a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta + 1);
+ }
+ }
+
+ virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
+ {
+ // Give nothing
+ }
+
+ virtual bool IsUseable(void) override
+ {
+ return true;
+ }
+
+ virtual const char * GetStepSound(void) override
+ {
+ return "step.cloth";
+ }
+} ;
+
+
+
+
diff --git a/src/Blocks/BlockCauldron.h b/src/Blocks/BlockCauldron.h
index 2e1032d2b..41b79b6c3 100644
--- a/src/Blocks/BlockCauldron.h
+++ b/src/Blocks/BlockCauldron.h
@@ -23,7 +23,7 @@ public:
virtual void OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) override
{
- char Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
+ NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
switch (a_Player->GetEquippedItem().m_ItemType)
{
case E_ITEM_WATER_BUCKET:
diff --git a/src/Blocks/BlockChest.h b/src/Blocks/BlockChest.h
index 30588d8fc..a1ded4c26 100644
--- a/src/Blocks/BlockChest.h
+++ b/src/Blocks/BlockChest.h
@@ -4,18 +4,18 @@
#include "BlockEntity.h"
#include "../BlockArea.h"
#include "../Entities/Player.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockChestHandler :
- public cMetaRotater
+ public cMetaRotator
{
public:
cBlockChestHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockComparator.h b/src/Blocks/BlockComparator.h
index e570ff302..4dd05366d 100644
--- a/src/Blocks/BlockComparator.h
+++ b/src/Blocks/BlockComparator.h
@@ -3,18 +3,18 @@
#include "BlockHandler.h"
#include "BlockRedstoneRepeater.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockComparatorHandler :
- public cMetaRotater
+ public cMetaRotator
{
public:
cBlockComparatorHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockCrops.h b/src/Blocks/BlockCrops.h
index ffc2b3f8b..8606cf3f3 100644
--- a/src/Blocks/BlockCrops.h
+++ b/src/Blocks/BlockCrops.h
@@ -2,7 +2,7 @@
#pragma once
#include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
@@ -21,7 +21,7 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_Meta) override
{
- MTRand rand;
+ cFastRandom rand;
if (a_Meta == 0x7)
{
@@ -31,18 +31,18 @@ public:
case E_BLOCK_CROPS:
{
a_Pickups.push_back(cItem(E_ITEM_WHEAT, 1, 0));
- a_Pickups.push_back(cItem(E_ITEM_SEEDS, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2
+ a_Pickups.push_back(cItem(E_ITEM_SEEDS, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2
break;
}
case E_BLOCK_CARROTS:
{
- a_Pickups.push_back(cItem(E_ITEM_CARROT, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2
+ a_Pickups.push_back(cItem(E_ITEM_CARROT, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2
break;
}
case E_BLOCK_POTATOES:
{
- a_Pickups.push_back(cItem(E_ITEM_POTATO, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2
- if (rand.randInt(20) == 0)
+ a_Pickups.push_back(cItem(E_ITEM_POTATO, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2
+ if (rand.NextInt(21) == 0)
{
// With a 5% chance, drop a poisonous potato as well
a_Pickups.push_back(cItem(E_ITEM_POISONOUS_POTATO, 1, 0));
diff --git a/src/Blocks/BlockDirt.h b/src/Blocks/BlockDirt.h
index 544424a04..aa24b8668 100644
--- a/src/Blocks/BlockDirt.h
+++ b/src/Blocks/BlockDirt.h
@@ -2,7 +2,7 @@
#pragma once
#include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
@@ -44,12 +44,12 @@ public:
}
// Grass spreads to adjacent dirt blocks:
- MTRand rand; // TODO: Replace with cFastRandom
+ cFastRandom rand;
for (int i = 0; i < 2; i++) // Pick two blocks to grow to
{
- int OfsX = rand.randInt(2) - 1; // [-1 .. 1]
- int OfsY = rand.randInt(4) - 3; // [-3 .. 1]
- int OfsZ = rand.randInt(2) - 1; // [-1 .. 1]
+ int OfsX = rand.NextInt(3, a_RelX) - 1; // [-1 .. 1]
+ int OfsY = rand.NextInt(5, a_RelY) - 3; // [-3 .. 1]
+ int OfsZ = rand.NextInt(3, a_RelZ) - 1; // [-1 .. 1]
BLOCKTYPE DestBlock;
NIBBLETYPE DestMeta;
@@ -79,7 +79,10 @@ public:
Chunk->GetBlockTypeMeta(BlockX, BlockY + 1, BlockZ, AboveDest, AboveMeta);
if ((cBlockInfo::IsOneHitDig(AboveDest) || cBlockInfo::IsTransparent(AboveDest)) && !IsBlockWater(AboveDest))
{
- Chunk->FastSetBlock(BlockX, BlockY, BlockZ, E_BLOCK_GRASS, 0);
+ if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, BlockX * cChunkDef::Width, BlockY, BlockZ * cChunkDef::Width, ssGrassSpread))
+ {
+ Chunk->FastSetBlock(BlockX, BlockY, BlockZ, E_BLOCK_GRASS, 0);
+ }
}
} // for i - repeat twice
}
diff --git a/src/Blocks/BlockDoor.cpp b/src/Blocks/BlockDoor.cpp
index 4e38ef334..479c68153 100644
--- a/src/Blocks/BlockDoor.cpp
+++ b/src/Blocks/BlockDoor.cpp
@@ -110,3 +110,87 @@ const char * cBlockDoorHandler::GetStepSound(void)
+
+NIBBLETYPE cBlockDoorHandler::MetaRotateCCW(NIBBLETYPE a_Meta)
+{
+ if (a_Meta & 0x08)
+ {
+ return a_Meta;
+ }
+ else
+ {
+ return super::MetaRotateCCW(a_Meta);
+ }
+}
+
+
+
+NIBBLETYPE cBlockDoorHandler::MetaRotateCW(NIBBLETYPE a_Meta)
+{
+ if (a_Meta & 0x08)
+ {
+ return a_Meta;
+ }
+ else
+ {
+ return super::MetaRotateCW(a_Meta);
+ }
+}
+
+
+
+NIBBLETYPE cBlockDoorHandler::MetaMirrorXY(NIBBLETYPE a_Meta)
+{
+ // Top bit (0x08) contains door panel type (Top/Bottom panel) Only Bottom panels contain position data
+ // Return a_Meta if panel is a top panel (0x08 bit is set to 1)
+
+ // Note: Currently, you can not properly mirror the hinges on a double door. The orientation of the door is stored
+ // in only the bottom tile while the hinge position is in the top tile. This function only operates on one tile at a time,
+ // so the function can only see either the hinge position or orientation, but not both, at any given time. The class itself
+ // needs extra datamembers.
+ if (a_Meta & 0x08) return a_Meta;
+
+ // Holds open/closed meta data. 0x0C == 1100.
+ NIBBLETYPE OtherMeta = a_Meta & 0x0C;
+
+ // Mirrors according to a table. 0x03 == 0011.
+ switch (a_Meta & 0x03)
+ {
+ case 0x03: return 0x01 + OtherMeta; // South -> North
+ case 0x01: return 0x03 + OtherMeta; // North -> South
+ }
+
+ // Not Facing North or South; No change.
+ return a_Meta;
+}
+
+
+
+NIBBLETYPE cBlockDoorHandler::MetaMirrorYZ(NIBBLETYPE a_Meta)
+{
+ // Top bit (0x08) contains door panel type (Top/Bottom panel) Only Bottom panels contain position data
+ // Return a_Meta if panel is a top panel (0x08 bit is set to 1)
+
+ // Note: Currently, you can not properly mirror the hinges on a double door. The orientation of the door is stored
+ // in only the bottom tile while the hinge position is in the top tile. This function only operates on one tile at a time,
+ // so the function can only see either the hinge position or orientation, but not both, at any given time.The class itself
+ // needs extra datamembers.
+
+ if (a_Meta & 0x08) return a_Meta;
+
+ // Holds open/closed meta data. 0x0C == 1100.
+ NIBBLETYPE OtherMeta = a_Meta & 0x0C;
+
+ // Mirrors according to a table. 0x03 == 0011.
+ switch (a_Meta & 0x03)
+ {
+ case 0x00: return 0x02 + OtherMeta; // West -> East
+ case 0x02: return 0x00 + OtherMeta; // East -> West
+ }
+
+ // Not Facing North or South; No change.
+ return a_Meta;
+}
+
+
+
diff --git a/src/Blocks/BlockDoor.h b/src/Blocks/BlockDoor.h
index 981774c17..797fe484c 100644
--- a/src/Blocks/BlockDoor.h
+++ b/src/Blocks/BlockDoor.h
@@ -4,15 +4,15 @@
#include "BlockHandler.h"
#include "../Entities/Player.h"
#include "Chunk.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockDoorHandler :
- public cMetaRotater
+ public cMetaRotator
{
- typedef cMetaRotater super;
+ typedef cMetaRotator super;
public:
cBlockDoorHandler(BLOCKTYPE a_BlockType);
@@ -21,6 +21,10 @@ public:
virtual void OnCancelRightClick(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override;
virtual const char * GetStepSound(void) override;
+ virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override;
+ virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override;
+ virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override;
+ virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override;
virtual bool GetPlacementBlockTypeMeta(
cChunkInterface & a_ChunkInterface, cPlayer * a_Player,
@@ -142,14 +146,14 @@ public:
static void ChangeDoor(cChunkInterface & a_ChunkInterface, int a_X, int a_Y, int a_Z)
{
NIBBLETYPE OldMetaData = a_ChunkInterface.GetBlockMeta(a_X, a_Y, a_Z);
-
+
a_ChunkInterface.SetBlockMeta(a_X, a_Y, a_Z, ChangeStateMetaData(OldMetaData));
-
+
if (OldMetaData & 8)
{
// Current block is top of the door
BLOCKTYPE BottomBlock = a_ChunkInterface.GetBlock(a_X, a_Y - 1, a_Z);
- NIBBLETYPE BottomMeta = a_ChunkInterface.GetBlockMeta(a_X, a_Y - 1, a_Z);
+ NIBBLETYPE BottomMeta = a_ChunkInterface.GetBlockMeta(a_X, a_Y - 1, a_Z);
if (IsDoor(BottomBlock) && !(BottomMeta & 8))
{
@@ -168,62 +172,6 @@ public:
}
}
}
-
-
- virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
- {
- if (a_Meta & 0x08)
- {
- return a_Meta;
- }
- else
- {
- return super::MetaRotateCCW(a_Meta);
- }
- }
-
-
-
- virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
- {
- if (a_Meta & 0x08)
- {
- return a_Meta;
- }
- else
- {
- return super::MetaRotateCW(a_Meta);
- }
- }
-
-
-
- virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
- {
- if (a_Meta & 0x08)
- {
- return a_Meta;
- }
- else
- {
- return super::MetaMirrorXY(a_Meta);
- }
- }
-
-
-
- virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
- {
- if (a_Meta & 0x08)
- {
- return a_Meta;
- }
- else
- {
- return super::MetaMirrorYZ(a_Meta);
- }
- }
-
} ;
diff --git a/src/Blocks/BlockDropSpenser.h b/src/Blocks/BlockDropSpenser.h
index 7e0ad0e55..88b61a418 100644
--- a/src/Blocks/BlockDropSpenser.h
+++ b/src/Blocks/BlockDropSpenser.h
@@ -6,18 +6,18 @@
#pragma once
#include "../Piston.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockDropSpenserHandler :
- public cMetaRotater
+ public cMetaRotator
{
public:
cBlockDropSpenserHandler(BLOCKTYPE a_BlockType) :
- cMetaRotater(a_BlockType)
+ cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockEnderchest.h b/src/Blocks/BlockEnderchest.h
index 97cf484fb..67955f8ce 100644
--- a/src/Blocks/BlockEnderchest.h
+++ b/src/Blocks/BlockEnderchest.h
@@ -2,17 +2,17 @@
#pragma once
#include "BlockEntity.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockEnderchestHandler :
- public cMetaRotater
+ public cMetaRotator
{
public:
cBlockEnderchestHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockFenceGate.h b/src/Blocks/BlockFenceGate.h
index e3162bbd6..e202c6610 100644
--- a/src/Blocks/BlockFenceGate.h
+++ b/src/Blocks/BlockFenceGate.h
@@ -2,17 +2,17 @@
#pragma once
#include "BlockHandler.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockFenceGateHandler :
- public cMetaRotater
+ public cMetaRotator
{
public:
cBlockFenceGateHandler(BLOCKTYPE a_BlockType) :
- cMetaRotater(a_BlockType)
+ cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockFire.h b/src/Blocks/BlockFire.h
index a25b87858..c8f158e7e 100644
--- a/src/Blocks/BlockFire.h
+++ b/src/Blocks/BlockFire.h
@@ -17,25 +17,27 @@ public:
}
/// Portal boundary and direction variables
- int XZP, XZM, Dir; // For wont of a better name...
+ // 2014_03_30 _X: What are these used for? Why do we need extra variables?
+ int XZP, XZM;
+ NIBBLETYPE Dir;
virtual void OnPlaced(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override
{
/*
PORTAL FINDING ALGORITH
=======================
- -Get clicked base block
- -Trace upwards to find first obsidian block; aborts if anything other than obsidian or air is encountered.
- Uses this value as a reference (the 'ceiling')
- -For both directions (if one fails, try the other), BASE (clicked) block:
- -Go in one direction, only stop if a non obsidian block is encountered (abort) OR a portal border is encountered (FindObsidianCeiling returns -1)
- -If a border was encountered, go the other direction and repeat above
- -Write borders to XZP and XZM, write direction portal faces to Dir
- -Loop through boundary variables, and fill with portal blocks based on Dir with meta from Dir
+ - Get clicked base block
+ - Trace upwards to find first obsidian block; aborts if anything other than obsidian or air is encountered.
+ Uses this value as a reference (the 'ceiling')
+ - For both directions (if one fails, try the other), BASE (clicked) block:
+ - Go in one direction, only stop if a non obsidian block is encountered (abort) OR a portal border is encountered (FindObsidianCeiling returns -1)
+ - If a border was encountered, go the other direction and repeat above
+ - Write borders to XZP and XZM, write direction portal faces to Dir
+ - Loop through boundary variables, and fill with portal blocks based on Dir with meta from Dir
*/
a_BlockY--; // Because we want the block below the fire
- FindAndSetPortalFrame(a_BlockX, a_BlockY, a_BlockZ, a_ChunkInterface, a_WorldInterface); // Brought to you by Aperture Science
+ FindAndSetPortalFrame(a_BlockX, a_BlockY, a_BlockZ, a_ChunkInterface, a_WorldInterface);
}
virtual void OnDigging(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) override
diff --git a/src/Blocks/BlockFurnace.h b/src/Blocks/BlockFurnace.h
index 27ef2689f..a7a807957 100644
--- a/src/Blocks/BlockFurnace.h
+++ b/src/Blocks/BlockFurnace.h
@@ -4,17 +4,17 @@
#include "BlockEntity.h"
#include "../World.h"
#include "../Piston.h"
-
+#include "MetaRotator.h"
class cBlockFurnaceHandler :
- public cBlockEntityHandler
+ public cMetaRotator
{
public:
- cBlockFurnaceHandler(BLOCKTYPE a_BlockType) :
- cBlockEntityHandler(a_BlockType)
+ cBlockFurnaceHandler(BLOCKTYPE a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockHandler.cpp b/src/Blocks/BlockHandler.cpp
index aa97b2ca9..7fd8c183c 100644
--- a/src/Blocks/BlockHandler.cpp
+++ b/src/Blocks/BlockHandler.cpp
@@ -6,10 +6,12 @@
#include "../Root.h"
#include "../Bindings/PluginManager.h"
#include "../Chunk.h"
+#include "BlockAnvil.h"
#include "BlockBed.h"
#include "BlockBrewingStand.h"
#include "BlockButton.h"
#include "BlockCactus.h"
+#include "BlockCake.h"
#include "BlockCarpet.h"
#include "BlockCauldron.h"
#include "BlockChest.h"
@@ -39,6 +41,7 @@
#include "BlockIce.h"
#include "BlockLadder.h"
#include "BlockLeaves.h"
+#include "BlockLilypad.h"
#include "BlockNewLeaves.h"
#include "BlockLever.h"
#include "BlockMelon.h"
@@ -85,12 +88,14 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType)
// Block handlers, alphabetically sorted:
case E_BLOCK_ACACIA_WOOD_STAIRS: return new cBlockStairsHandler (a_BlockType);
case E_BLOCK_ACTIVATOR_RAIL: return new cBlockRailHandler (a_BlockType);
+ case E_BLOCK_ANVIL: return new cBlockAnvilHandler (a_BlockType);
case E_BLOCK_BED: return new cBlockBedHandler (a_BlockType);
case E_BLOCK_BIRCH_WOOD_STAIRS: return new cBlockStairsHandler (a_BlockType);
case E_BLOCK_BREWING_STAND: return new cBlockBrewingStandHandler (a_BlockType);
case E_BLOCK_BRICK_STAIRS: return new cBlockStairsHandler (a_BlockType);
case E_BLOCK_BROWN_MUSHROOM: return new cBlockMushroomHandler (a_BlockType);
case E_BLOCK_CACTUS: return new cBlockCactusHandler (a_BlockType);
+ case E_BLOCK_CAKE: return new cBlockCakeHandler (a_BlockType);
case E_BLOCK_CARROTS: return new cBlockCropsHandler (a_BlockType);
case E_BLOCK_CARPET: return new cBlockCarpetHandler (a_BlockType);
case E_BLOCK_CAULDRON: return new cBlockCauldronHandler (a_BlockType);
@@ -138,6 +143,7 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType)
case E_BLOCK_LAPIS_ORE: return new cBlockOreHandler (a_BlockType);
case E_BLOCK_LAVA: return new cBlockLavaHandler (a_BlockType);
case E_BLOCK_LEAVES: return new cBlockLeavesHandler (a_BlockType);
+ case E_BLOCK_LILY_PAD: return new cBlockLilypadHandler (a_BlockType);
case E_BLOCK_LIT_FURNACE: return new cBlockFurnaceHandler (a_BlockType);
case E_BLOCK_LOG: return new cBlockSidewaysHandler (a_BlockType);
case E_BLOCK_MELON: return new cBlockMelonHandler (a_BlockType);
diff --git a/src/Blocks/BlockHopper.h b/src/Blocks/BlockHopper.h
index 59b84aa0e..a882bb077 100644
--- a/src/Blocks/BlockHopper.h
+++ b/src/Blocks/BlockHopper.h
@@ -3,16 +3,16 @@
// Declares the cBlockHopperHandler class representing the handler for the Hopper block
-
+#include "MetaRotator.h"
class cBlockHopperHandler :
- public cBlockEntityHandler
+ public cMetaRotator
{
public:
cBlockHopperHandler(BLOCKTYPE a_BlockType)
- : cBlockEntityHandler(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
@@ -39,6 +39,21 @@ public:
}
return true;
}
+
+
+ virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override
+ {
+ // Bit 0x08 is a flag. Lowest three bits are position. 0x08 == 1000
+ NIBBLETYPE OtherMeta = a_Meta & 0x08;
+ // Mirrors defined by by a table. (Source, mincraft.gamepedia.com) 0x07 == 0111
+ switch (a_Meta & 0x07)
+ {
+ case 0x00: return 0x01 + OtherMeta; // Down -> Up
+ case 0x01: return 0x00 + OtherMeta; // Up -> Down
+ }
+ // Not Facing Up or Down; No change.
+ return a_Meta;
+ }
} ;
diff --git a/src/Blocks/BlockLadder.h b/src/Blocks/BlockLadder.h
index a3e9edc6b..a605edf3f 100644
--- a/src/Blocks/BlockLadder.h
+++ b/src/Blocks/BlockLadder.h
@@ -9,11 +9,11 @@
class cBlockLadderHandler :
- public cBlockHandler
+ public cMetaRotator
{
public:
cBlockLadderHandler(BLOCKTYPE a_BlockType)
- : cBlockHandler(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockLeaves.h b/src/Blocks/BlockLeaves.h
index 7b8f0b378..8af14686e 100644
--- a/src/Blocks/BlockLeaves.h
+++ b/src/Blocks/BlockLeaves.h
@@ -1,6 +1,6 @@
#pragma once
#include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
#include "../World.h"
#include "../BlockArea.h"
@@ -16,6 +16,7 @@
{ \
case E_BLOCK_LEAVES: a_Area.SetBlockType(x, y, z, (BLOCKTYPE)(E_BLOCK_SPONGE + i + 1)); break; \
case E_BLOCK_LOG: return true; \
+ case E_BLOCK_NEW_LOG: return true; \
}
bool HasNearLog(cBlockArea &a_Area, int a_BlockX, int a_BlockY, int a_BlockZ);
@@ -36,16 +37,18 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- MTRand rand;
+ cFastRandom rand;
// Only the first 2 bits contain the display information, the others are for growing
- if (rand.randInt(5) == 0)
+ if (rand.NextInt(6) == 0)
{
a_Pickups.push_back(cItem(E_BLOCK_SAPLING, 1, a_BlockMeta & 3));
}
- if ((a_BlockMeta & 3) == E_META_SAPLING_APPLE)
+
+ // 1 % chance of dropping an apple, if the leaves' type is Apple Leaves
+ if ((a_BlockMeta & 3) == E_META_LEAVES_APPLE)
{
- if (rand.rand(100) == 0)
+ if (rand.NextInt(101) == 0)
{
a_Pickups.push_back(cItem(E_ITEM_RED_APPLE, 1, 0));
}
@@ -57,11 +60,10 @@ public:
{
cBlockHandler::OnDestroyed(a_ChunkInterface, a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ);
- //0.5% chance of dropping an apple
+ // 0.5% chance of dropping an apple, if the leaves' type is Apple Leaves:
NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
- //check if Oak (0x1 and 0x2 bit not set)
- MTRand rand;
- if(!(Meta & 3) && rand.randInt(200) == 100)
+ cFastRandom rand;
+ if (((Meta & 3) == E_META_LEAVES_APPLE) && (rand.NextInt(201) == 100))
{
cItems Drops;
Drops.push_back(cItem(E_ITEM_RED_APPLE, 1, 0));
diff --git a/src/Blocks/BlockLever.h b/src/Blocks/BlockLever.h
index ef6e102cd..ad2ae29e5 100644
--- a/src/Blocks/BlockLever.h
+++ b/src/Blocks/BlockLever.h
@@ -1,17 +1,18 @@
#pragma once
#include "BlockHandler.h"
-
+#include "MetaRotator.h"
class cBlockLeverHandler :
- public cBlockHandler
+ public cMetaRotator
{
+ typedef cMetaRotator super;
public:
cBlockLeverHandler(BLOCKTYPE a_BlockType)
- : cBlockHandler(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
@@ -104,6 +105,36 @@ public:
return (a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn);
}
+
+
+ virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
+ {
+ switch (a_Meta)
+ {
+ case 0x00: return 0x07; // Ceiling rotation
+ case 0x07: return 0x00;
+
+ case 0x05: return 0x06; // Ground rotation
+ case 0x06: return 0x05;
+
+ default: return super::MetaRotateCCW(a_Meta); // Wall Rotation
+ }
+ }
+
+
+ virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
+ {
+ switch (a_Meta)
+ {
+ case 0x00: return 0x07; // Ceiling rotation
+ case 0x07: return 0x00;
+
+ case 0x05: return 0x06; // Ground rotation
+ case 0x06: return 0x05;
+
+ default: return super::MetaRotateCCW(a_Meta); // Wall Rotation
+ }
+ }
} ;
diff --git a/src/Blocks/BlockLilypad.h b/src/Blocks/BlockLilypad.h
new file mode 100644
index 000000000..2dd4ec768
--- /dev/null
+++ b/src/Blocks/BlockLilypad.h
@@ -0,0 +1,28 @@
+
+#pragma once
+
+#include "BlockHandler.h"
+#include "Entities/Pickup.h"
+
+
+
+
+class cBlockLilypadHandler :
+ public cBlockHandler
+{
+public:
+ cBlockLilypadHandler(BLOCKTYPE a_BlockType)
+ : cBlockHandler(a_BlockType)
+ {
+ }
+
+ virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
+ {
+ // Reset meta to zero
+ a_Pickups.push_back(cItem(E_BLOCK_LILY_PAD, 1, 0));
+ }
+};
+
+
+
+
diff --git a/src/Blocks/BlockMobHead.h b/src/Blocks/BlockMobHead.h
index 2b128f13b..acd1c88fb 100644
--- a/src/Blocks/BlockMobHead.h
+++ b/src/Blocks/BlockMobHead.h
@@ -21,6 +21,103 @@ public:
{
a_Pickups.push_back(cItem(E_ITEM_HEAD, 1, 0));
}
+
+ bool TrySpawnWither(cChunkInterface & a_ChunkInterface, cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ)
+ {
+ if (a_BlockY < 2)
+ {
+ return false;
+ }
+
+ class cCallback : public cMobHeadCallback
+ {
+ bool m_IsWither;
+
+ virtual bool Item (cMobHeadEntity * a_MobHeadEntity)
+ {
+ m_IsWither = (a_MobHeadEntity->GetType() == SKULL_TYPE_WITHER);
+
+ return false;
+ }
+
+ public:
+ cCallback () : m_IsWither(false) {}
+
+ bool IsWither(void) const { return m_IsWither; }
+
+ void Reset(void) { m_IsWither = false; }
+ } CallbackA, CallbackB;
+
+ a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ, CallbackA);
+
+ if (!CallbackA.IsWither())
+ {
+ return false;
+ }
+
+ CallbackA.Reset();
+
+ BLOCKTYPE BlockY1 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ);
+ BLOCKTYPE BlockY2 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 2, a_BlockZ);
+
+ if ((BlockY1 != E_BLOCK_SOULSAND) || (BlockY2 != E_BLOCK_SOULSAND))
+ {
+ return false;
+ }
+
+ a_World->DoWithMobHeadAt(a_BlockX - 1, a_BlockY, a_BlockZ, CallbackA);
+ a_World->DoWithMobHeadAt(a_BlockX + 1, a_BlockY, a_BlockZ, CallbackB);
+
+ BLOCKTYPE Block1 = a_ChunkInterface.GetBlock(a_BlockX - 1, a_BlockY - 1, a_BlockZ);
+ BLOCKTYPE Block2 = a_ChunkInterface.GetBlock(a_BlockX + 1, a_BlockY - 1, a_BlockZ);
+
+ if ((Block1 == E_BLOCK_SOULSAND) && (Block2 == E_BLOCK_SOULSAND) && CallbackA.IsWither() && CallbackB.IsWither())
+ {
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX + 1, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX - 1, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0);
+
+ // Block entities
+ a_World->SetBlock(a_BlockX + 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+ a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+ a_World->SetBlock(a_BlockX - 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+
+ // Spawn the wither:
+ a_World->SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither);
+
+ return true;
+ }
+
+ CallbackA.Reset();
+ CallbackB.Reset();
+
+ a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ - 1, CallbackA);
+ a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ + 1, CallbackB);
+
+ Block1 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ - 1);
+ Block2 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ + 1);
+
+ if ((Block1 == E_BLOCK_SOULSAND) && (Block2 == E_BLOCK_SOULSAND) && CallbackA.IsWither() && CallbackB.IsWither())
+ {
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ + 1, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ - 1, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0);
+
+ // Block entities
+ a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ + 1, E_BLOCK_AIR, 0);
+ a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+ a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ - 1, E_BLOCK_AIR, 0);
+
+ // Spawn the wither:
+ a_World->SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither);
+
+ return true;
+ }
+
+ return false;
+ }
virtual void OnPlacedByPlayer(
cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player,
@@ -50,18 +147,37 @@ public:
}
public:
- cCallback (cPlayer * a_Player, NIBBLETYPE a_OldBlockMeta, NIBBLETYPE a_NewBlockMeta) :
- m_Player(a_Player),
+ cCallback (cPlayer * a_CBPlayer, NIBBLETYPE a_OldBlockMeta, NIBBLETYPE a_NewBlockMeta) :
+ m_Player(a_CBPlayer),
m_OldBlockMeta(a_OldBlockMeta),
m_NewBlockMeta(a_NewBlockMeta)
{}
};
cCallback Callback(a_Player, a_BlockMeta, static_cast(a_BlockFace));
- a_BlockMeta = a_BlockFace;
+ a_BlockMeta = (NIBBLETYPE)a_BlockFace;
cWorld * World = (cWorld *) &a_WorldInterface;
World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ, Callback);
a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, a_BlockMeta);
+
+ if (a_BlockMeta == SKULL_TYPE_WITHER)
+ {
+ static const Vector3i Coords[] =
+ {
+ Vector3i( 0, 0, 0),
+ Vector3i( 1, 0, 0),
+ Vector3i(-1, 0, 0),
+ Vector3i( 0, 0, 1),
+ Vector3i( 0, 0, -1),
+ };
+ for (size_t i = 0; i < ARRAYCOUNT(Coords); ++i)
+ {
+ if (TrySpawnWither(a_ChunkInterface, World, a_BlockX + Coords[i].x, a_BlockY, a_BlockZ + Coords[i].z))
+ {
+ break;
+ }
+ } // for i - Coords[]
+ }
}
} ;
diff --git a/src/Blocks/BlockMushroom.h b/src/Blocks/BlockMushroom.h
index 623cfda64..135d418d7 100644
--- a/src/Blocks/BlockMushroom.h
+++ b/src/Blocks/BlockMushroom.h
@@ -17,6 +17,9 @@ public:
}
+ // TODO: Add Mushroom Spread
+
+
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
// Reset meta to 0
@@ -39,6 +42,7 @@ public:
case E_BLOCK_CACTUS:
case E_BLOCK_ICE:
case E_BLOCK_LEAVES:
+ case E_BLOCK_NEW_LEAVES:
case E_BLOCK_AIR:
{
return false;
diff --git a/src/Blocks/BlockMycelium.h b/src/Blocks/BlockMycelium.h
index 7f897c72a..2a8ef5fca 100644
--- a/src/Blocks/BlockMycelium.h
+++ b/src/Blocks/BlockMycelium.h
@@ -16,6 +16,8 @@ public:
{
}
+ // TODO: Add Mycel Spread
+
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
a_Pickups.push_back(cItem(E_BLOCK_DIRT, 1, 0));
diff --git a/src/Blocks/BlockNetherWart.h b/src/Blocks/BlockNetherWart.h
index 923180e19..812cf906f 100644
--- a/src/Blocks/BlockNetherWart.h
+++ b/src/Blocks/BlockNetherWart.h
@@ -2,14 +2,13 @@
#pragma once
#include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
#include "../World.h"
-/// Common class that takes care of carrots, potatoes and wheat
class cBlockNetherWartHandler :
public cBlockHandler
{
@@ -22,12 +21,12 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_Meta) override
{
- MTRand rand;
+ cFastRandom rand;
if (a_Meta == 0x7)
{
- // Is fully grown, drop the entire produce:
- a_Pickups.push_back(cItem(E_ITEM_NETHER_WART, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0));
+ // Fully grown, drop the entire produce:
+ a_Pickups.push_back(cItem(E_ITEM_NETHER_WART, (char)(1 + (rand.NextInt(3) + rand.NextInt(3))) / 2, 0));
}
else
{
@@ -35,18 +34,20 @@ public:
}
}
+
virtual void OnUpdate(cChunkInterface & cChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_PluginInterface, cChunk & a_Chunk, int a_RelX, int a_RelY, int a_RelZ) override
{
- NIBBLETYPE Meta = a_Chunk.GetMeta (a_RelX, a_RelY, a_RelZ);
-
+ NIBBLETYPE Meta = a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ);
if (Meta < 7)
{
a_Chunk.FastSetBlock(a_RelX, a_RelY, a_RelZ, E_BLOCK_NETHER_WART, ++Meta);
}
}
+
virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override
{
+ // Needs to be placed on top of a Soulsand block:
return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) == E_BLOCK_SOULSAND));
}
} ;
diff --git a/src/Blocks/BlockPluginInterface.h b/src/Blocks/BlockPluginInterface.h
index 7428c9a7a..3a36c40b1 100644
--- a/src/Blocks/BlockPluginInterface.h
+++ b/src/Blocks/BlockPluginInterface.h
@@ -1,8 +1,14 @@
#pragma once
+/** This interface is used to decouple block handlers from the cPluginManager dependancy through cWorld.
+The block handlers call this interface, which is then implemented by the specific classes that
+the caller provides.
+*/
class cBlockPluginInterface
{
public:
+ virtual ~cBlockPluginInterface() {}
+
virtual bool CallHookBlockToPickups(cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) = 0;
};
diff --git a/src/Blocks/BlockPumpkin.h b/src/Blocks/BlockPumpkin.h
index 349f52605..ac2b9817a 100644
--- a/src/Blocks/BlockPumpkin.h
+++ b/src/Blocks/BlockPumpkin.h
@@ -1,16 +1,16 @@
#pragma once
#include "BlockHandler.h"
-
+#include "MetaRotator.h"
class cBlockPumpkinHandler :
- public cBlockHandler
+ public cMetaRotator
{
public:
cBlockPumpkinHandler(BLOCKTYPE a_BlockType)
- : cBlockHandler(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockRail.h b/src/Blocks/BlockRail.h
index 07e9814cd..ad78d290a 100644
--- a/src/Blocks/BlockRail.h
+++ b/src/Blocks/BlockRail.h
@@ -431,9 +431,145 @@ public:
}
break;
}
+ default: break;
}
return true;
}
+
+
+ virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
+ {
+ // Bit 0x08 is a flag when a_Meta is in the range 0x00--0x05 and 0x0A--0x0F.
+ // Bit 0x08 specifies direction when a_Meta is in the range 0x06-0x09.
+ if ((a_Meta < 0x06) || (a_Meta > 0x09))
+ {
+ // Save powered rail flag.
+ NIBBLETYPE OtherMeta = a_Meta & 0x08;
+ // Rotates according to table; 0x07 == 0111.
+ // Rails can either be flat (North/South) or Ascending (Asc. East)
+ switch (a_Meta & 0x07)
+ {
+ case 0x00: return 0x01 + OtherMeta; // North/South -> East/West
+ case 0x01: return 0x00 + OtherMeta; // East/West -> North/South
+
+ case 0x02: return 0x04 + OtherMeta; // Asc. East -> Asc. North
+ case 0x04: return 0x03 + OtherMeta; // Asc. North -> Asc. West
+ case 0x03: return 0x05 + OtherMeta; // Asc. West -> Asc. South
+ case 0x05: return 0x02 + OtherMeta; // Asc. South -> Asc. East
+ }
+ }
+ else
+ {
+ switch (a_Meta)
+ {
+ // Corner Directions
+ case 0x06: return 0x09; // Northwest Cnr. -> Southwest Cnr.
+ case 0x07: return 0x06; // Northeast Cnr. -> Northwest Cnr.
+ case 0x08: return 0x07; // Southeast Cnr. -> Northeast Cnr.
+ case 0x09: return 0x08; // Southwest Cnr. -> Southeast Cnr.
+ }
+ }
+ // To avoid a compiler warning;
+ return a_Meta;
+ }
+
+
+ virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
+ {
+ // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09.
+ if ((a_Meta < 0x06) || (a_Meta > 0x09))
+ {
+ // Save powered rail flag.
+ NIBBLETYPE OtherMeta = a_Meta & 0x08;
+ // Rotates according to table; 0x07 == 0111.
+ // Rails can either be flat (North/South) or Ascending (Asc. East)
+ switch (a_Meta & 0x07)
+ {
+ case 0x00: return 0x01 + OtherMeta; // North/South -> East/West
+ case 0x01: return 0x00 + OtherMeta; // East/West -> North/South
+
+ case 0x02: return 0x05 + OtherMeta; // Asc. East -> Asc. South
+ case 0x05: return 0x03 + OtherMeta; // Asc. South -> Asc. West
+ case 0x03: return 0x04 + OtherMeta; // Asc. West -> Asc. North
+ case 0x04: return 0x02 + OtherMeta; // Asc. North -> Asc. East
+ }
+ }
+ else
+ {
+ switch (a_Meta)
+ {
+ // Corner Directions
+ case 0x06: return 0x07; // Northwest Cnr. -> Northeast Cnr.
+ case 0x07: return 0x08; // Northeast Cnr. -> Southeast Cnr.
+ case 0x08: return 0x09; // Southeast Cnr. -> Southwest Cnr.
+ case 0x09: return 0x06; // Southwest Cnr. -> Northwest Cnr.
+ }
+ }
+ // To avoid a compiler warning;
+ return a_Meta;
+ }
+
+
+ virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
+ {
+ // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09.
+ if ((a_Meta < 0x06) || (a_Meta > 0x09))
+ {
+ // Save powered rail flag.
+ NIBBLETYPE OtherMeta = a_Meta & 0x08;
+ // Mirrors according to table; 0x07 == 0111.
+ // Rails can either be flat (North/South) or Ascending (Asc. East)
+ switch (a_Meta & 0x07)
+ {
+ case 0x05: return 0x04 + OtherMeta; // Asc. South -> Asc. North
+ case 0x04: return 0x05 + OtherMeta; // Asc. North -> Asc. South
+ }
+ }
+ else
+ {
+ switch (a_Meta)
+ {
+ // Corner Directions
+ case 0x06: return 0x09; // Northwest Cnr. -> Southwest Cnr.
+ case 0x07: return 0x08; // Northeast Cnr. -> Southeast Cnr.
+ case 0x08: return 0x07; // Southeast Cnr. -> Northeast Cnr.
+ case 0x09: return 0x06; // Southwest Cnr. -> Northwest Cnr.
+ }
+ }
+ // To avoid a compiler warning;
+ return a_Meta;
+ }
+
+
+ virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
+ {
+ // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09.
+ if ((a_Meta < 0x06) || (a_Meta > 0x09))
+ {
+ // Save powered rail flag.
+ NIBBLETYPE OtherMeta = a_Meta & 0x08;
+ // Mirrors according to table; 0x07 == 0111.
+ // Rails can either be flat (North/South) or Ascending (Asc. East)
+ switch (a_Meta & 0x07)
+ {
+ case 0x02: return 0x03 + OtherMeta; // Asc. East -> Asc. West
+ case 0x03: return 0x02 + OtherMeta; // Asc. West -> Asc. East
+ }
+ }
+ else
+ {
+ switch (a_Meta)
+ {
+ // Corner Directions
+ case 0x06: return 0x07; // Northwest Cnr. -> Northeast Cnr.
+ case 0x07: return 0x06; // Northeast Cnr. -> Northwest Cnr.
+ case 0x08: return 0x09; // Southeast Cnr. -> Southwest Cnr.
+ case 0x09: return 0x08; // Southwest Cnr. -> Southeast Cnr.
+ }
+ }
+ // To avoid a compiler warning;
+ return a_Meta;
+ }
} ;
diff --git a/src/Blocks/BlockRedstoneRepeater.h b/src/Blocks/BlockRedstoneRepeater.h
index 1e2a86949..fe6cd21b9 100644
--- a/src/Blocks/BlockRedstoneRepeater.h
+++ b/src/Blocks/BlockRedstoneRepeater.h
@@ -3,17 +3,17 @@
#include "BlockHandler.h"
#include "Chunk.h"
-
+#include "MetaRotator.h"
class cBlockRedstoneRepeaterHandler :
- public cBlockHandler
+ public cMetaRotator
{
public:
cBlockRedstoneRepeaterHandler(BLOCKTYPE a_BlockType)
- : cBlockHandler(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockSideways.h b/src/Blocks/BlockSideways.h
index 69c0a7230..d67c3aa24 100644
--- a/src/Blocks/BlockSideways.h
+++ b/src/Blocks/BlockSideways.h
@@ -29,7 +29,13 @@ public:
return true;
}
-
+
+ virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
+ {
+ a_Pickups.Add(m_BlockType, 1, a_BlockMeta & 0x3);
+ }
+
+
inline static NIBBLETYPE BlockFaceToMetaData(eBlockFace a_BlockFace, NIBBLETYPE a_WoodMeta)
{
switch (a_BlockFace)
diff --git a/src/Blocks/BlockSign.h b/src/Blocks/BlockSign.h
index cd0c02a40..6c0becfd6 100644
--- a/src/Blocks/BlockSign.h
+++ b/src/Blocks/BlockSign.h
@@ -71,6 +71,37 @@ public:
{
a_Player->GetClientHandle()->SendEditSign(a_BlockX, a_BlockY, a_BlockZ);
}
+
+
+ virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
+ {
+ return (++a_Meta) & 0x0F;
+ }
+
+
+ virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
+ {
+ return (--a_Meta) & 0x0F;
+ }
+
+ virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
+ {
+ // Mirrors signs over the XY plane (North-South Mirroring)
+
+ // There are 16 meta values which correspond to different directions.
+ // These values are equated to angles on a circle; 0x08 = 180 degrees.
+ return (a_Meta < 0x08) ? 0x08 + a_Meta : 0x08 - a_Meta;
+ }
+
+
+ virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
+ {
+ // Mirrors signs over the YZ plane (East-West Mirroring)
+
+ // There are 16 meta values which correspond to different directions.
+ // These values are equated to angles on a circle; 0x10 = 360 degrees.
+ return 0x10 - a_Meta;
+ }
} ;
diff --git a/src/Blocks/BlockSlab.h b/src/Blocks/BlockSlab.h
index 7cd2c97b2..4f94d45f6 100644
--- a/src/Blocks/BlockSlab.h
+++ b/src/Blocks/BlockSlab.h
@@ -14,8 +14,6 @@
-
-
class cBlockSlabHandler :
public cBlockHandler
{
@@ -105,6 +103,7 @@ public:
a_BlockMeta = Meta & 0x7; break;
}
}
+ case BLOCK_FACE_NONE: return false;
} // switch (a_BlockFace)
return true;
}
@@ -184,6 +183,15 @@ public:
ASSERT(!"Unhandled double slab type!");
return "";
}
+
+
+ virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override
+ {
+ NIBBLETYPE OtherMeta = a_Meta & 0x07; // Contains unrelated meta data.
+
+ // 8th bit is up/down. 1 right-side-up, 0 is up-side-down.
+ return (a_Meta & 0x08) ? 0x00 + OtherMeta : 0x01 + OtherMeta;
+ }
} ;
diff --git a/src/Blocks/BlockStairs.h b/src/Blocks/BlockStairs.h
index ea8405597..09ff254a6 100644
--- a/src/Blocks/BlockStairs.h
+++ b/src/Blocks/BlockStairs.h
@@ -2,17 +2,17 @@
#pragma once
#include "BlockHandler.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockStairsHandler :
- public cMetaRotater
+ public cMetaRotator
{
public:
cBlockStairsHandler(BLOCKTYPE a_BlockType) :
- cMetaRotater(a_BlockType)
+ cMetaRotator(a_BlockType)
{
}
@@ -30,9 +30,7 @@ public:
UNUSED(a_BlockY);
UNUSED(a_BlockZ);
UNUSED(a_CursorX);
- UNUSED(a_CursorY);
UNUSED(a_CursorZ);
- UNUSED(a_BlockMeta);
a_BlockType = m_BlockType;
a_BlockMeta = RotationToMetaData(a_Player->GetYaw());
switch (a_BlockFace)
@@ -51,10 +49,12 @@ public:
}
break;
}
+ case BLOCK_FACE_NONE: return false;
}
return true;
}
+
virtual const char * GetStepSound(void) override
{
if (
diff --git a/src/Blocks/BlockStems.h b/src/Blocks/BlockStems.h
index 705436345..b726a0901 100644
--- a/src/Blocks/BlockStems.h
+++ b/src/Blocks/BlockStems.h
@@ -17,9 +17,10 @@ public:
{
}
+
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- int ItemType = (m_BlockType == E_BLOCK_MELON_STEM) ? E_ITEM_MELON_SEEDS : E_ITEM_PUMPKIN_SEEDS;
+ short ItemType = (m_BlockType == E_BLOCK_MELON_STEM) ? E_ITEM_MELON_SEEDS : E_ITEM_PUMPKIN_SEEDS;
a_Pickups.push_back(cItem(ItemType, 1, 0));
}
diff --git a/src/Blocks/BlockTorch.h b/src/Blocks/BlockTorch.h
index d32c77629..8ddec8de1 100644
--- a/src/Blocks/BlockTorch.h
+++ b/src/Blocks/BlockTorch.h
@@ -2,17 +2,17 @@
#include "BlockHandler.h"
#include "../Chunk.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockTorchHandler :
- public cMetaRotater
+ public cMetaRotator
{
public:
cBlockTorchHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockTrapdoor.h b/src/Blocks/BlockTrapdoor.h
index 9bae92c4d..6a36ab874 100644
--- a/src/Blocks/BlockTrapdoor.h
+++ b/src/Blocks/BlockTrapdoor.h
@@ -2,17 +2,17 @@
#pragma once
#include "BlockHandler.h"
-
+#include "MetaRotator.h"
class cBlockTrapdoorHandler :
- public cBlockHandler
+ public cMetaRotator
{
public:
cBlockTrapdoorHandler(BLOCKTYPE a_BlockType)
- : cBlockHandler(a_BlockType)
+ : cMetaRotator(a_BlockType)
{
}
diff --git a/src/Blocks/BlockVine.h b/src/Blocks/BlockVine.h
index 708583e70..7bb9dc484 100644
--- a/src/Blocks/BlockVine.h
+++ b/src/Blocks/BlockVine.h
@@ -1,7 +1,7 @@
#pragma once
#include "BlockHandler.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
@@ -73,7 +73,7 @@ public:
/// Returns true if the specified block type is good for vines to attach to
static bool IsBlockAttachable(BLOCKTYPE a_BlockType)
{
- return (a_BlockType == E_BLOCK_LEAVES) || cBlockInfo::IsSolid(a_BlockType);
+ return (a_BlockType == E_BLOCK_LEAVES) || (a_BlockType == E_BLOCK_NEW_LEAVES) || cBlockInfo::IsSolid(a_BlockType);
}
@@ -83,7 +83,7 @@ public:
static const struct
{
int x, z;
- int Bit;
+ NIBBLETYPE Bit;
} Coords[] =
{
{ 0, 1, 1}, // south, ZP
@@ -91,7 +91,7 @@ public:
{ 0, -1, 4}, // north, ZM
{ 1, 0, 8}, // east, XP
} ;
- int res = 0;
+ NIBBLETYPE res = 0;
for (size_t i = 0; i < ARRAYCOUNT(Coords); i++)
{
BLOCKTYPE BlockType;
@@ -175,7 +175,10 @@ public:
a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY - 1, a_RelZ, Block);
if (Block == E_BLOCK_AIR)
{
- a_Chunk.UnboundedRelSetBlock(a_RelX, a_RelY - 1, a_RelZ, E_BLOCK_VINES, a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ));
+ if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, a_RelX * cChunkDef::Width, a_RelY - 1, a_RelZ * cChunkDef::Width, ssVineSpread))
+ {
+ a_Chunk.UnboundedRelSetBlock(a_RelX, a_RelY - 1, a_RelZ, E_BLOCK_VINES, a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ));
+ }
}
}
@@ -194,14 +197,14 @@ public:
virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
{
// Bits 2 and 4 stay, bits 1 and 3 swap
- return ((a_Meta & 0x0a) | ((a_Meta & 0x01) << 2) | ((a_Meta & 0x04) >> 2));
+ return (NIBBLETYPE)((a_Meta & 0x0a) | ((a_Meta & 0x01) << 2) | ((a_Meta & 0x04) >> 2));
}
virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
{
// Bits 1 and 3 stay, bits 2 and 4 swap
- return ((a_Meta & 0x05) | ((a_Meta & 0x02) << 2) | ((a_Meta & 0x08) >> 2));
+ return (NIBBLETYPE)((a_Meta & 0x05) | ((a_Meta & 0x02) << 2) | ((a_Meta & 0x08) >> 2));
}
} ;
diff --git a/src/Blocks/BroadcastInterface.h b/src/Blocks/BroadcastInterface.h
index f6ccd580b..b1b450690 100644
--- a/src/Blocks/BroadcastInterface.h
+++ b/src/Blocks/BroadcastInterface.h
@@ -4,7 +4,9 @@
class cBroadcastInterface
{
public:
-
- virtual void BroadcastUseBed(const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ ) = 0;
- virtual void BroadcastSoundEffect (const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL) = 0;
+ virtual ~cBroadcastInterface() {}
+
+ virtual void BroadcastUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ ) = 0;
+ virtual void BroadcastSoundEffect(const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL) = 0;
+ virtual void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL) = 0;
};
diff --git a/src/Blocks/MetaRotater.h b/src/Blocks/MetaRotator.h
similarity index 88%
rename from src/Blocks/MetaRotater.h
rename to src/Blocks/MetaRotator.h
index dde88e6db..899c583e1 100644
--- a/src/Blocks/MetaRotater.h
+++ b/src/Blocks/MetaRotator.h
@@ -1,4 +1,4 @@
-// MetaRotater.h
+// MetaRotator.h
// Provides a mixin for rotations and reflections
@@ -21,15 +21,15 @@ Inherit from this class providing your base class as Base, the BitMask for the d
*/
template
-class cMetaRotater : public Base
+class cMetaRotator : public Base
{
public:
- cMetaRotater(BLOCKTYPE a_BlockType) :
+ cMetaRotator(BLOCKTYPE a_BlockType) :
Base(a_BlockType)
{}
- virtual ~cMetaRotater() {}
+ virtual ~cMetaRotator() {}
virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override;
virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override;
@@ -42,7 +42,7 @@ public:
template
-NIBBLETYPE cMetaRotater::MetaRotateCW(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator::MetaRotateCW(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
switch (a_Meta & BitMask)
@@ -64,7 +64,7 @@ NIBBLETYPE cMetaRotater
-NIBBLETYPE cMetaRotater::MetaRotateCCW(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator::MetaRotateCCW(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
switch (a_Meta & BitMask)
@@ -86,7 +86,7 @@ NIBBLETYPE cMetaRotater
-NIBBLETYPE cMetaRotater::MetaMirrorXY(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator::MetaMirrorXY(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
switch (a_Meta & BitMask)
@@ -103,7 +103,7 @@ NIBBLETYPE cMetaRotater
-NIBBLETYPE cMetaRotater::MetaMirrorYZ(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator::MetaMirrorYZ(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
switch (a_Meta & BitMask)
diff --git a/src/Blocks/WorldInterface.h b/src/Blocks/WorldInterface.h
index e59b00eff..bfbb053d9 100644
--- a/src/Blocks/WorldInterface.h
+++ b/src/Blocks/WorldInterface.h
@@ -9,7 +9,8 @@ class cItems;
class cWorldInterface
{
public:
-
+ virtual ~cWorldInterface() {}
+
virtual Int64 GetTimeOfDay(void) const = 0;
virtual Int64 GetWorldAge(void) const = 0;
@@ -27,7 +28,13 @@ public:
/** Spawns a mob of the specified type. Returns the mob's EntityID if recognized and spawned, <0 otherwise */
virtual int SpawnMob(double a_PosX, double a_PosY, double a_PosZ, cMonster::eType a_MonsterType) = 0;
-
+
/** Sends the block on those coords to the player */
virtual void SendBlockTo(int a_BlockX, int a_BlockY, int a_BlockZ, cPlayer * a_Player) = 0;
+
+ /** Calls the callback for each player in the list; returns true if all players processed, false if the callback aborted by returning true */
+ virtual bool ForEachPlayer(cItemCallback & a_Callback) = 0;
+
+ virtual void SetTimeOfDay(Int64 a_TimeOfDay) = 0;
+
};
diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt
index 0f8700692..30e9dbfd4 100644
--- a/src/CMakeLists.txt
+++ b/src/CMakeLists.txt
@@ -6,16 +6,17 @@ include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/jsoncpp/include")
include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/polarssl/include")
set(FOLDERS OSSupport HTTPServer Items Blocks Protocol Generating)
-set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities)
+set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities Generating/Prefabs)
if (NOT MSVC)
- #Bindings needs to reference other folders so are done here
+ # Bindings need to reference other folders, so they are done here instead
- #lib dependecies are not included
+ # lib dependencies are not included
set(BINDING_DEPENDECIES
+ tolua
${CMAKE_CURRENT_SOURCE_DIR}/Bindings/virtual_method_hooks.lua
${CMAKE_CURRENT_SOURCE_DIR}/Bindings/AllToLua.pkg
Bindings/LuaFunctions.h
@@ -57,6 +58,9 @@ if (NOT MSVC)
Entities/Player.h
Entities/ProjectileEntity.h
Entities/TNTEntity.h
+ Entities/ExpOrb.h
+ Entities/HangingEntity.h
+ Entities/ItemFrame.h
Generating/ChunkDesc.h
Group.h
Inventory.h
@@ -100,7 +104,6 @@ if (NOT MSVC)
Bindings/PluginLua
Bindings/PluginManager
Bindings/WebPlugin
- Bindings/WebPlugin
)
target_link_libraries(Bindings lua sqlite tolualib)
@@ -134,6 +137,7 @@ if (NOT MSVC)
else ()
+ # MSVC-specific handling: Put all files into one project, separate by the folders:
# Generate the Bindings if they don't exist:
if (NOT EXISTS "${PROJECT_SOURCE_DIR}/Bindings/Bindings.cpp")
@@ -145,6 +149,14 @@ else ()
)
endif()
+ # Get all files in this folder:
+ file(GLOB_RECURSE SOURCE
+ "*.cpp"
+ "*.h"
+ "*.pkg"
+ )
+ source_group("" FILES ${SOURCE})
+
# Add all subfolders as solution-folders:
list(APPEND FOLDERS "Resources")
list(APPEND FOLDERS "Bindings")
@@ -155,23 +167,16 @@ else ()
"${PATH}/*.rc"
"${PATH}/*.pkg"
)
- source_group("${PATH}" FILES ${FOLDER_FILES})
+ string(REPLACE "/" "\\" PROJECT_PATH ${PATH})
+ source_group("${PROJECT_PATH}" FILES ${FOLDER_FILES})
endfunction(includefolder)
foreach(folder ${FOLDERS})
includefolder(${folder})
endforeach(folder)
- file(GLOB_RECURSE SOURCE
- "*.cpp"
- "*.h"
- "*.pkg"
- )
-
include_directories("${PROJECT_SOURCE_DIR}")
- source_group("" FILES ${SOURCE})
-
# Precompiled headers (1st part)
SET_SOURCE_FILES_PROPERTIES(
Globals.cpp PROPERTIES COMPILE_FLAGS "/Yc\"Globals.h\""
@@ -227,7 +232,7 @@ endif ()
if (NOT MSVC)
target_link_libraries(${EXECUTABLE} OSSupport HTTPServer Bindings Items Blocks)
- target_link_libraries(${EXECUTABLE} Protocol Generating WorldStorage)
+ target_link_libraries(${EXECUTABLE} Protocol Generating Generating_Prefabs WorldStorage)
target_link_libraries(${EXECUTABLE} Mobs Entities Simulator UI BlockEntities)
endif ()
if (WIN32)
diff --git a/src/Chunk.cpp b/src/Chunk.cpp
index 957d7d575..22b33c595 100644
--- a/src/Chunk.cpp
+++ b/src/Chunk.cpp
@@ -884,7 +884,7 @@ void cChunk::ApplyWeatherToTop()
FastSetBlock(X, Height, Z, E_BLOCK_SNOW, TopMeta - 1);
}
}
- else if (cBlockInfo::IsSnowable(TopBlock))
+ else if (cBlockInfo::IsSnowable(TopBlock) && (Height + 1 < cChunkDef::Height))
{
SetBlock(X, Height + 1, Z, E_BLOCK_SNOW, 0);
}
@@ -2510,6 +2510,17 @@ cChunk * cChunk::GetNeighborChunk(int a_BlockX, int a_BlockZ)
cChunk * cChunk::GetRelNeighborChunk(int a_RelX, int a_RelZ)
{
+ // If the relative coords are too far away, use the parent's chunk lookup instead:
+ if ((a_RelX < 128) || (a_RelX > 128) || (a_RelZ < -128) || (a_RelZ > 128))
+ {
+ int BlockX = m_PosX * cChunkDef::Width + a_RelX;
+ int BlockZ = m_PosZ * cChunkDef::Width + a_RelZ;
+ int BlockY, ChunkX, ChunkZ;
+ AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ);
+ return m_ChunkMap->GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ);
+ }
+
+ // Walk the neighbors:
bool ReturnThis = true;
if (a_RelX < 0)
{
diff --git a/src/ChunkMap.cpp b/src/ChunkMap.cpp
index 40964c654..e695f0ab2 100644
--- a/src/ChunkMap.cpp
+++ b/src/ChunkMap.cpp
@@ -1376,8 +1376,9 @@ void cChunkMap::ReplaceTreeBlocks(const sSetBlockVector & a_Blocks)
break;
}
case E_BLOCK_LEAVES:
+ case E_BLOCK_NEW_LEAVES:
{
- if (itr->BlockType == E_BLOCK_LOG)
+ if ((itr->BlockType == E_BLOCK_LOG) || (itr->BlockType == E_BLOCK_NEW_LOG))
{
Chunk->SetBlock(itr->x, itr->y, itr->z, itr->BlockType, itr->BlockMeta);
}
@@ -1784,57 +1785,73 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
BLOCKTYPE Block = area.GetBlockType(bx + x, by + y, bz + z);
switch (Block)
{
- case E_BLOCK_TNT:
- {
- // Activate the TNT, with a random fuse between 10 to 30 game ticks
- double FuseTime = (double)(10 + m_World->GetTickRandomNumber(20)) / 20;
- m_World->SpawnPrimedTNT(a_BlockX + x + 0.5, a_BlockY + y + 0.5, a_BlockZ + z + 0.5, FuseTime);
- area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_AIR);
- a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
- break;
- }
- case E_BLOCK_OBSIDIAN:
- case E_BLOCK_BEDROCK:
- case E_BLOCK_WATER:
- case E_BLOCK_LAVA:
- {
- // These blocks are not affected by explosions
- break;
- }
-
- case E_BLOCK_STATIONARY_WATER:
- {
- // Turn into simulated water:
- area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_WATER);
- break;
- }
-
- case E_BLOCK_STATIONARY_LAVA:
- {
- // Turn into simulated lava:
- area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_LAVA);
- break;
- }
-
- case E_BLOCK_AIR:
- {
- // No pickups for air
- break;
- }
-
- default:
- {
- if (m_World->GetTickRandomNumber(100) <= 25) // 25% chance of pickups
+ case E_BLOCK_TNT:
{
- cItems Drops;
- cBlockHandler * Handler = BlockHandler(Block);
-
- Handler->ConvertToPickups(Drops, area.GetBlockMeta(bx + x, by + y, bz + z)); // Stone becomes cobblestone, coal ore becomes coal, etc.
- m_World->SpawnItemPickups(Drops, bx + x, by + y, bz + z);
+ // Activate the TNT, with a random fuse between 10 to 30 game ticks
+ int FuseTime = 10 + m_World->GetTickRandomNumber(20);
+ m_World->SpawnPrimedTNT(a_BlockX + x + 0.5, a_BlockY + y + 0.5, a_BlockZ + z + 0.5, FuseTime);
+ area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_AIR);
+ a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
+ break;
+ }
+
+ case E_BLOCK_OBSIDIAN:
+ case E_BLOCK_BEDROCK:
+ case E_BLOCK_WATER:
+ case E_BLOCK_LAVA:
+ {
+ // These blocks are not affected by explosions
+ break;
+ }
+
+ case E_BLOCK_STATIONARY_WATER:
+ {
+ // Turn into simulated water:
+ area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_WATER);
+ break;
+ }
+
+ case E_BLOCK_STATIONARY_LAVA:
+ {
+ // Turn into simulated lava:
+ area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_LAVA);
+ break;
+ }
+
+ case E_BLOCK_AIR:
+ {
+ // No pickups for air
+ break;
+ }
+
+ default:
+ {
+ if (m_World->GetTickRandomNumber(100) <= 25) // 25% chance of pickups
+ {
+ cItems Drops;
+ cBlockHandler * Handler = BlockHandler(Block);
+
+ Handler->ConvertToPickups(Drops, area.GetBlockMeta(bx + x, by + y, bz + z)); // Stone becomes cobblestone, coal ore becomes coal, etc.
+ m_World->SpawnItemPickups(Drops, bx + x, by + y, bz + z);
+ }
+ else if ((m_World->GetTNTShrapnelLevel() > slNone) && (m_World->GetTickRandomNumber(100) < 20)) // 20% chance of flinging stuff around
+ {
+ if (!cBlockInfo::FullyOccupiesVoxel(Block))
+ {
+ break;
+ }
+ else if ((m_World->GetTNTShrapnelLevel() == slGravityAffectedOnly) && ((Block != E_BLOCK_SAND) && (Block != E_BLOCK_GRAVEL)))
+ {
+ break;
+ }
+ m_World->SpawnFallingBlock(bx + x, by + y + 5, bz + z, Block, area.GetBlockMeta(bx + x, by + y, bz + z));
+ }
+
+ area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_AIR);
+ a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
+ break;
+
}
- area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_AIR);
- a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
- }
} // switch (BlockType)
} // for z
} // for y
@@ -1846,11 +1863,10 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
public cEntityCallback
{
public:
- cTNTDamageCallback(cBoundingBox & a_bbTNT, Vector3d a_ExplosionPos, int a_ExplosionSize, int a_ExplosionSizeSq) :
+ cTNTDamageCallback(cBoundingBox & a_bbTNT, Vector3d a_ExplosionPos, int a_ExplosionSize) :
m_bbTNT(a_bbTNT),
m_ExplosionPos(a_ExplosionPos),
- m_ExplosionSize(a_ExplosionSize),
- m_ExplosionSizeSq(a_ExplosionSizeSq)
+ m_ExplosionSize(a_ExplosionSize)
{
}
@@ -1873,14 +1889,16 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
}
Vector3d AbsoluteEntityPos(abs(EntityPos.x), abs(EntityPos.y), abs(EntityPos.z));
- Vector3d MaxExplosionBoundary(m_ExplosionSizeSq, m_ExplosionSizeSq, m_ExplosionSizeSq);
// Work out how far we are from the edge of the TNT's explosive effect
AbsoluteEntityPos -= m_ExplosionPos;
- AbsoluteEntityPos = MaxExplosionBoundary - AbsoluteEntityPos;
- double FinalDamage = ((AbsoluteEntityPos.x + AbsoluteEntityPos.y + AbsoluteEntityPos.z) / 3) * m_ExplosionSize;
- FinalDamage = a_Entity->GetMaxHealth() - abs(FinalDamage);
+ // All to positive
+ AbsoluteEntityPos.x = abs(AbsoluteEntityPos.x);
+ AbsoluteEntityPos.y = abs(AbsoluteEntityPos.y);
+ AbsoluteEntityPos.z = abs(AbsoluteEntityPos.z);
+
+ double FinalDamage = (((1 / AbsoluteEntityPos.x) + (1 / AbsoluteEntityPos.y) + (1 / AbsoluteEntityPos.z)) * 2) * m_ExplosionSize;
// Clip damage values
if (FinalDamage > a_Entity->GetMaxHealth())
@@ -1888,7 +1906,7 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
else if (FinalDamage < 0)
FinalDamage = 0;
- if (!a_Entity->IsTNT()) // Don't apply damage to other TNT entities, they should be invincible
+ if (!a_Entity->IsTNT() && !a_Entity->IsFallingBlock()) // Don't apply damage to other TNT entities and falling blocks, they should be invincible
{
a_Entity->TakeDamage(dtExplosion, NULL, (int)FinalDamage, 0);
}
@@ -1898,7 +1916,7 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
if (distance_explosion.SqrLength() < 4096.0)
{
distance_explosion.Normalize();
- distance_explosion *= m_ExplosionSizeSq;
+ distance_explosion *= m_ExplosionSize * m_ExplosionSize;
a_Entity->AddSpeed(distance_explosion);
}
@@ -1910,14 +1928,13 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
cBoundingBox & m_bbTNT;
Vector3d m_ExplosionPos;
int m_ExplosionSize;
- int m_ExplosionSizeSq;
};
cBoundingBox bbTNT(Vector3d(a_BlockX, a_BlockY, a_BlockZ), 0.5, 1);
bbTNT.Expand(ExplosionSizeInt * 2, ExplosionSizeInt * 2, ExplosionSizeInt * 2);
- cTNTDamageCallback TNTDamageCallback(bbTNT, Vector3d(a_BlockX, a_BlockY, a_BlockZ), ExplosionSizeInt, ExplosionSizeSq);
+ cTNTDamageCallback TNTDamageCallback(bbTNT, Vector3d(a_BlockX, a_BlockY, a_BlockZ), ExplosionSizeInt);
ForEachEntity(TNTDamageCallback);
// Wake up all simulators for the area, so that water and lava flows and sand falls into the blasted holes (FS #391):
diff --git a/src/ClientHandle.cpp b/src/ClientHandle.cpp
index 46c10ae82..5ed5f1085 100644
--- a/src/ClientHandle.cpp
+++ b/src/ClientHandle.cpp
@@ -941,6 +941,8 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
}
return;
}
+
+ m_NumBlockChangeInteractionsThisTick++;
if (!CheckBlockInteractionsRate())
{
@@ -960,7 +962,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
);
// Let's send the current world block to the client, so that it can immediately "let the user know" that they haven't placed the block
- if (a_BlockFace > -1)
+ if (a_BlockFace != BLOCK_FACE_NONE)
{
AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace);
World->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player);
@@ -988,7 +990,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
cItemHandler * ItemHandler = cItemHandler::GetItemHandler(Equipped.m_ItemType);
- if (ItemHandler->IsPlaceable() && (a_BlockFace > -1))
+ if (ItemHandler->IsPlaceable() && (a_BlockFace != BLOCK_FACE_NONE))
{
HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler);
}
@@ -1026,6 +1028,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, cItemHandler & a_ItemHandler)
{
+ BLOCKTYPE EquippedBlock = (BLOCKTYPE)(m_Player->GetEquippedItem().m_ItemType);
if (a_BlockFace < 0)
{
// Clicked in air
@@ -1036,7 +1039,6 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e
BLOCKTYPE ClickedBlock;
NIBBLETYPE ClickedBlockMeta;
- BLOCKTYPE EquippedBlock = (BLOCKTYPE)(m_Player->GetEquippedItem().m_ItemType);
NIBBLETYPE EquippedBlockDamage = (NIBBLETYPE)(m_Player->GetEquippedItem().m_ItemDamage);
if ((a_BlockY < 0) || (a_BlockY >= cChunkDef::Height))
@@ -1053,8 +1055,8 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e
cBlockSlabHandler::IsAnySlabType(EquippedBlock) && // Is the player placing another slab?
((ClickedBlockMeta & 0x07) == EquippedBlockDamage) && // Is it the same slab type?
(
- (a_BlockFace == BLOCK_FACE_TOP) || // Clicking the top of a bottom slab
- (a_BlockFace == BLOCK_FACE_BOTTOM) // Clicking the bottom of a top slab
+ (a_BlockFace == BLOCK_FACE_TOP) || // Clicking the top of a bottom slab
+ (a_BlockFace == BLOCK_FACE_BOTTOM) // Clicking the bottom of a top slab
)
)
{
@@ -1138,7 +1140,7 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e
// The actual block placement:
World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, BlockType, BlockMeta);
- if (m_Player->GetGameMode() != gmCreative)
+ if (!m_Player->IsGameModeCreative())
{
m_Player->GetInventory().RemoveOneEquippedItem();
}
@@ -1606,10 +1608,8 @@ void cClientHandle::MoveToWorld(cWorld & a_World, bool a_SendRespawnPacket)
m_Protocol->SendUnloadChunk(itr->m_ChunkX, itr->m_ChunkZ);
} // for itr - Chunks[]
- // Do NOT stream new chunks, the new world runs its own tick thread and may deadlock
- // Instead, the chunks will be streamed when the client is moved to the new world's Tick list,
- // by setting state to csAuthenticated
- m_State = csAuthenticated;
+ // StreamChunks() called in cPlayer::MoveToWorld() after new world has been set
+ // Meanwhile here, we set last streamed values to bogus ones so everything is resent
m_LastStreamedChunkX = 0x7fffffff;
m_LastStreamedChunkZ = 0x7fffffff;
m_HasSentPlayerChunk = false;
diff --git a/src/CompositeChat.cpp b/src/CompositeChat.cpp
index a917ee70f..c70ef1070 100644
--- a/src/CompositeChat.cpp
+++ b/src/CompositeChat.cpp
@@ -112,8 +112,8 @@ cCompositeChat::cCompositeChat(void) :
-cCompositeChat::cCompositeChat(const AString & a_ParseText) :
- m_MessageType(mtCustom)
+cCompositeChat::cCompositeChat(const AString & a_ParseText, eMessageType a_MessageType) :
+ m_MessageType(a_MessageType)
{
ParseText(a_ParseText);
}
@@ -314,6 +314,58 @@ void cCompositeChat::UnderlineUrls(void)
+AString cCompositeChat::ExtractText(void) const
+{
+ AString Msg;
+ for (cParts::const_iterator itr = m_Parts.begin(), end = m_Parts.end(); itr != end; ++itr)
+ {
+ switch ((*itr)->m_PartType)
+ {
+ case ptText:
+ case ptClientTranslated:
+ case ptRunCommand:
+ case ptSuggestCommand:
+ {
+ Msg.append((*itr)->m_Text);
+ break;
+ }
+ case ptUrl:
+ {
+ Msg.append(((cUrlPart *)(*itr))->m_Url);
+ break;
+ }
+ } // switch (PartType)
+ } // for itr - m_Parts[]
+ return Msg;
+}
+
+
+
+
+
+cMCLogger::eLogLevel cCompositeChat::MessageTypeToLogLevel(eMessageType a_MessageType)
+{
+ switch (a_MessageType)
+ {
+ case mtCustom: return cMCLogger::llRegular;
+ case mtFailure: return cMCLogger::llWarning;
+ case mtInformation: return cMCLogger::llInfo;
+ case mtSuccess: return cMCLogger::llRegular;
+ case mtWarning: return cMCLogger::llWarning;
+ case mtFatal: return cMCLogger::llError;
+ case mtDeath: return cMCLogger::llRegular;
+ case mtPrivateMessage: return cMCLogger::llRegular;
+ case mtJoin: return cMCLogger::llRegular;
+ case mtLeave: return cMCLogger::llRegular;
+ }
+ ASSERT(!"Unhandled MessageType");
+ return cMCLogger::llError;
+}
+
+
+
+
+
void cCompositeChat::AddStyle(AString & a_Style, const AString & a_AddStyle)
{
if (a_AddStyle.empty())
diff --git a/src/CompositeChat.h b/src/CompositeChat.h
index 27319490d..5b9c5f612 100644
--- a/src/CompositeChat.h
+++ b/src/CompositeChat.h
@@ -117,7 +117,7 @@ public:
/** Creates a new chat message and parses the text into parts.
Recognizes "http:" and "https:" links and @color-codes.
Uses ParseText() for the actual parsing. */
- cCompositeChat(const AString & a_ParseText);
+ cCompositeChat(const AString & a_ParseText, eMessageType a_MessageType = mtCustom);
~cCompositeChat();
@@ -164,10 +164,19 @@ public:
/** Returns the message type set previously by SetMessageType(). */
eMessageType GetMessageType(void) const { return m_MessageType; }
+ /** Returns the text from the parts that comprises the human-readable data.
+ Used for older protocols that don't support composite chat
+ and for console-logging. */
+ AString ExtractText(void) const;
+
// tolua_end
const cParts & GetParts(void) const { return m_Parts; }
+ /** Converts the MessageType to a LogLevel value.
+ Used by the logging bindings when logging a cCompositeChat object. */
+ static cMCLogger::eLogLevel MessageTypeToLogLevel(eMessageType a_MessageType);
+
protected:
/** All the parts that */
cParts m_Parts;
diff --git a/src/DeadlockDetect.cpp b/src/DeadlockDetect.cpp
index c42d09b89..322084dc4 100644
--- a/src/DeadlockDetect.cpp
+++ b/src/DeadlockDetect.cpp
@@ -7,7 +7,7 @@
#include "DeadlockDetect.h"
#include "Root.h"
#include "World.h"
-# include
+#include
@@ -16,9 +16,6 @@
/// Number of milliseconds per cycle
const int CYCLE_MILLISECONDS = 100;
-/// When the number of cycles for the same world age hits this value, it is considered a deadlock
-const int NUM_CYCLES_LIMIT = 200; // 200 = twenty seconds
-
@@ -121,7 +118,6 @@ void cDeadlockDetect::CheckWorldAge(const AString & a_WorldName, Int64 a_Age)
if (itr->second.m_NumCyclesSame > (1000 * m_IntervalSec) / CYCLE_MILLISECONDS)
{
DeadlockDetected();
- return;
}
}
else
diff --git a/src/Defines.h b/src/Defines.h
index 3b7654265..1a8b3fa4a 100644
--- a/src/Defines.h
+++ b/src/Defines.h
@@ -290,7 +290,10 @@ inline AString BlockFaceToString(eBlockFace a_BlockFace)
case BLOCK_FACE_ZP: return "BLOCK_FACE_ZP";
case BLOCK_FACE_NONE: return "BLOCK_FACE_NONE";
}
+ // clang optimisises this line away then warns that it has done so.
+ #if !defined(__clang__)
return Printf("Unknown BLOCK_FACE: %d", a_BlockFace);
+ #endif
}
@@ -530,16 +533,22 @@ enum eMessageType
// http://forum.mc-server.org/showthread.php?tid=1212
// MessageType...
- mtCustom, // Send raw data without any processing
- mtFailure, // Something could not be done (i.e. command not executed due to insufficient privilege)
- mtInformation, // Informational message (i.e. command usage)
- mtSuccess, // Something executed successfully
- mtWarning, // Something concerning (i.e. reload) is about to happen
- mtFatal, // Something catastrophic occured (i.e. plugin crash)
- mtDeath, // Denotes death of player
- mtPrivateMessage, // Player to player messaging identifier
- mtJoin, // A player has joined the server
- mtLeave, // A player has left the server
+ mtCustom, // Send raw data without any processing
+ mtFailure, // Something could not be done (i.e. command not executed due to insufficient privilege)
+ mtInformation, // Informational message (i.e. command usage)
+ mtSuccess, // Something executed successfully
+ mtWarning, // Something concerning (i.e. reload) is about to happen
+ mtFatal, // Something catastrophic occured (i.e. plugin crash)
+ mtDeath, // Denotes death of player
+ mtPrivateMessage, // Player to player messaging identifier
+ mtJoin, // A player has joined the server
+ mtLeave, // A player has left the server
+
+ // Common aliases:
+ mtFail = mtFailure,
+ mtError = mtFailure,
+ mtInfo = mtInformation,
+ mtPM = mtPrivateMessage,
};
diff --git a/src/Entities/EnderCrystal.cpp b/src/Entities/EnderCrystal.cpp
new file mode 100644
index 000000000..a640b236c
--- /dev/null
+++ b/src/Entities/EnderCrystal.cpp
@@ -0,0 +1,56 @@
+
+#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules
+
+#include "EnderCrystal.h"
+#include "ClientHandle.h"
+#include "Player.h"
+#include "../Chunk.h"
+
+
+
+
+
+cEnderCrystal::cEnderCrystal(double a_X, double a_Y, double a_Z)
+ : cEntity(etEnderCrystal, a_X, a_Y, a_Z, 1.0, 1.0)
+{
+ SetMaxHealth(5);
+}
+
+
+
+
+
+void cEnderCrystal::SpawnOn(cClientHandle & a_ClientHandle)
+{
+ a_ClientHandle.SendSpawnObject(*this, 51, 0, (Byte)GetYaw(), (Byte)GetPitch());
+}
+
+
+
+
+
+void cEnderCrystal::Tick(float a_Dt, cChunk & a_Chunk)
+{
+ UNUSED(a_Dt);
+
+ a_Chunk.SetBlock(POSX_TOINT, POSY_TOINT, POSZ_TOINT, E_BLOCK_FIRE, 0);
+
+ // No further processing (physics e.t.c.) is needed
+}
+
+
+
+
+
+void cEnderCrystal::KilledBy(cEntity * a_Killer)
+{
+ super::KilledBy(a_Killer);
+
+ m_World->DoExplosionAt(6.0, GetPosX(), GetPosY(), GetPosZ(), true, esEnderCrystal, this);
+
+ Destroy();
+}
+
+
+
+
diff --git a/src/Entities/EnderCrystal.h b/src/Entities/EnderCrystal.h
new file mode 100644
index 000000000..5b86df987
--- /dev/null
+++ b/src/Entities/EnderCrystal.h
@@ -0,0 +1,33 @@
+
+#pragma once
+
+#include "Entity.h"
+
+
+
+
+
+// tolua_begin
+class cEnderCrystal :
+ public cEntity
+{
+ // tolua_end
+ typedef cEntity super;
+
+public:
+ CLASS_PROTODEF(cEnderCrystal);
+
+ cEnderCrystal(double a_X, double a_Y, double a_Z);
+
+private:
+
+ // cEntity overrides:
+ virtual void SpawnOn(cClientHandle & a_ClientHandle) override;
+ virtual void Tick(float a_Dt, cChunk & a_Chunk) override;
+ virtual void KilledBy(cEntity * a_Killer) override;
+
+}; // tolua_export
+
+
+
+
diff --git a/src/Entities/Entity.cpp b/src/Entities/Entity.cpp
index 0750ae05e..221cbbea7 100644
--- a/src/Entities/Entity.cpp
+++ b/src/Entities/Entity.cpp
@@ -521,28 +521,36 @@ void cEntity::Tick(float a_Dt, cChunk & a_Chunk)
{
if (a_Chunk.IsValid())
{
- HandlePhysics(a_Dt, a_Chunk);
+ cChunk * NextChunk = a_Chunk.GetNeighborChunk(POSX_TOINT, POSZ_TOINT);
+
+ if ((NextChunk == NULL) || !NextChunk->IsValid())
+ {
+ return;
+ }
+
+ TickBurning(*NextChunk);
+
+ if (GetPosY() < VOID_BOUNDARY)
+ {
+ TickInVoid(*NextChunk);
+ }
+ else
+ {
+ m_TicksSinceLastVoidDamage = 0;
+ }
+
+ if (IsMob() || IsPlayer())
+ {
+ // Set swimming state
+ SetSwimState(*NextChunk);
+
+ // Handle drowning
+ HandleAir();
+ }
+
+ HandlePhysics(a_Dt, *NextChunk);
}
}
- if (a_Chunk.IsValid())
- {
- TickBurning(a_Chunk);
- }
- if ((a_Chunk.IsValid()) && (GetPosY() < -46))
- {
- TickInVoid(a_Chunk);
- }
- else
- m_TicksSinceLastVoidDamage = 0;
-
- if (IsMob() || IsPlayer())
- {
- // Set swimming state
- SetSwimState(a_Chunk);
-
- // Handle drowning
- HandleAir();
- }
}
@@ -562,7 +570,7 @@ void cEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk)
if ((BlockY >= cChunkDef::Height) || (BlockY < 0))
{
// Outside of the world
-
+
cChunk * NextChunk = a_Chunk.GetNeighborChunk(BlockX, BlockZ);
// See if we can commit our changes. If not, we will discard them.
if (NextChunk != NULL)
@@ -571,210 +579,205 @@ void cEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk)
NextPos += (NextSpeed * a_Dt);
SetPosition(NextPos);
}
+
return;
}
- // Make sure we got the correct chunk and a valid one. No one ever knows...
- cChunk * NextChunk = a_Chunk.GetNeighborChunk(BlockX, BlockZ);
- if (NextChunk != NULL)
+ int RelBlockX = BlockX - (a_Chunk.GetPosX() * cChunkDef::Width);
+ int RelBlockZ = BlockZ - (a_Chunk.GetPosZ() * cChunkDef::Width);
+ BLOCKTYPE BlockIn = a_Chunk.GetBlock( RelBlockX, BlockY, RelBlockZ );
+ BLOCKTYPE BlockBelow = (BlockY > 0) ? a_Chunk.GetBlock(RelBlockX, BlockY - 1, RelBlockZ) : E_BLOCK_AIR;
+ if (!cBlockInfo::IsSolid(BlockIn)) // Making sure we are not inside a solid block
{
- int RelBlockX = BlockX - (NextChunk->GetPosX() * cChunkDef::Width);
- int RelBlockZ = BlockZ - (NextChunk->GetPosZ() * cChunkDef::Width);
- BLOCKTYPE BlockIn = NextChunk->GetBlock( RelBlockX, BlockY, RelBlockZ );
- BLOCKTYPE BlockBelow = (BlockY > 0) ? NextChunk->GetBlock(RelBlockX, BlockY - 1, RelBlockZ) : E_BLOCK_AIR;
- if (!cBlockInfo::IsSolid(BlockIn)) // Making sure we are not inside a solid block
+ if (m_bOnGround) // check if it's still on the ground
{
- if (m_bOnGround) // check if it's still on the ground
+ if (!cBlockInfo::IsSolid(BlockBelow)) // Check if block below is air or water.
{
- if (!cBlockInfo::IsSolid(BlockBelow)) // Check if block below is air or water.
- {
- m_bOnGround = false;
- }
+ m_bOnGround = false;
}
}
- else
+ }
+ else
+ {
+ // Push out entity.
+ BLOCKTYPE GotBlock;
+
+ static const struct
{
- // Push out entity.
- BLOCKTYPE GotBlock;
+ int x, y, z;
+ } gCrossCoords[] =
+ {
+ { 1, 0, 0},
+ {-1, 0, 0},
+ { 0, 0, 1},
+ { 0, 0, -1},
+ } ;
- static const struct
+ bool IsNoAirSurrounding = true;
+ for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++)
+ {
+ if (!a_Chunk.UnboundedRelGetBlockType(RelBlockX + gCrossCoords[i].x, BlockY, RelBlockZ + gCrossCoords[i].z, GotBlock))
{
- int x, y, z;
- } gCrossCoords[] =
+ // The pickup is too close to an unloaded chunk, bail out of any physics handling
+ return;
+ }
+ if (!cBlockInfo::IsSolid(GotBlock))
{
- { 1, 0, 0},
- {-1, 0, 0},
- { 0, 0, 1},
- { 0, 0, -1},
- } ;
-
- bool IsNoAirSurrounding = true;
- for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++)
- {
- if (!NextChunk->UnboundedRelGetBlockType(RelBlockX + gCrossCoords[i].x, BlockY, RelBlockZ + gCrossCoords[i].z, GotBlock))
- {
- // The pickup is too close to an unloaded chunk, bail out of any physics handling
- return;
- }
- if (!cBlockInfo::IsSolid(GotBlock))
- {
- NextPos.x += gCrossCoords[i].x;
- NextPos.z += gCrossCoords[i].z;
- IsNoAirSurrounding = false;
- break;
- }
- } // for i - gCrossCoords[]
+ NextPos.x += gCrossCoords[i].x;
+ NextPos.z += gCrossCoords[i].z;
+ IsNoAirSurrounding = false;
+ break;
+ }
+ } // for i - gCrossCoords[]
- if (IsNoAirSurrounding)
- {
- NextPos.y += 0.5;
- }
-
- m_bOnGround = true;
-
- /*
- // DEBUG:
- LOGD("Entity #%d (%s) is inside a block at {%d, %d, %d}",
- m_UniqueID, GetClass(), BlockX, BlockY, BlockZ
- );
- */
+ if (IsNoAirSurrounding)
+ {
+ NextPos.y += 0.5;
}
- if (!m_bOnGround)
+ m_bOnGround = true;
+
+ /*
+ // DEBUG:
+ LOGD("Entity #%d (%s) is inside a block at {%d, %d, %d}",
+ m_UniqueID, GetClass(), BlockX, BlockY, BlockZ
+ );
+ */
+ }
+
+ if (!m_bOnGround)
+ {
+ float fallspeed;
+ if (IsBlockWater(BlockIn))
{
- float fallspeed;
- if (IsBlockWater(BlockIn))
- {
- fallspeed = m_Gravity * a_Dt / 3; // Fall 3x slower in water.
- }
- else if (BlockIn == E_BLOCK_COBWEB)
- {
- NextSpeed.y *= 0.05; // Reduce overall falling speed
- fallspeed = 0; // No falling.
- }
- else
- {
- // Normal gravity
- fallspeed = m_Gravity * a_Dt;
- }
- NextSpeed.y += fallspeed;
+ fallspeed = m_Gravity * a_Dt / 3; // Fall 3x slower in water.
+ }
+ else if (BlockIn == E_BLOCK_COBWEB)
+ {
+ NextSpeed.y *= 0.05; // Reduce overall falling speed
+ fallspeed = 0; // No falling.
}
else
{
- // Friction
- if (NextSpeed.SqrLength() > 0.0004f)
+ // Normal gravity
+ fallspeed = m_Gravity * a_Dt;
+ }
+ NextSpeed.y += fallspeed;
+ }
+ else
+ {
+ // Friction
+ if (NextSpeed.SqrLength() > 0.0004f)
+ {
+ NextSpeed.x *= 0.7f / (1 + a_Dt);
+ if (fabs(NextSpeed.x) < 0.05)
{
- NextSpeed.x *= 0.7f / (1 + a_Dt);
- if (fabs(NextSpeed.x) < 0.05)
- {
- NextSpeed.x = 0;
- }
- NextSpeed.z *= 0.7f / (1 + a_Dt);
- if (fabs(NextSpeed.z) < 0.05)
- {
- NextSpeed.z = 0;
- }
+ NextSpeed.x = 0;
+ }
+ NextSpeed.z *= 0.7f / (1 + a_Dt);
+ if (fabs(NextSpeed.z) < 0.05)
+ {
+ NextSpeed.z = 0;
}
}
+ }
- // Adjust X and Z speed for COBWEB temporary. This speed modification should be handled inside block handlers since we
- // might have different speed modifiers according to terrain.
- if (BlockIn == E_BLOCK_COBWEB)
- {
- NextSpeed.x *= 0.25;
- NextSpeed.z *= 0.25;
- }
+ // Adjust X and Z speed for COBWEB temporary. This speed modification should be handled inside block handlers since we
+ // might have different speed modifiers according to terrain.
+ if (BlockIn == E_BLOCK_COBWEB)
+ {
+ NextSpeed.x *= 0.25;
+ NextSpeed.z *= 0.25;
+ }
- //Get water direction
- Direction WaterDir = m_World->GetWaterSimulator()->GetFlowingDirection(BlockX, BlockY, BlockZ);
+ //Get water direction
+ Direction WaterDir = m_World->GetWaterSimulator()->GetFlowingDirection(BlockX, BlockY, BlockZ);
- m_WaterSpeed *= 0.9f; //Reduce speed each tick
+ m_WaterSpeed *= 0.9f; //Reduce speed each tick
- switch(WaterDir)
- {
- case X_PLUS:
- m_WaterSpeed.x = 0.2f;
- m_bOnGround = false;
- break;
- case X_MINUS:
- m_WaterSpeed.x = -0.2f;
- m_bOnGround = false;
- break;
- case Z_PLUS:
- m_WaterSpeed.z = 0.2f;
- m_bOnGround = false;
- break;
- case Z_MINUS:
- m_WaterSpeed.z = -0.2f;
- m_bOnGround = false;
- break;
-
- default:
+ switch(WaterDir)
+ {
+ case X_PLUS:
+ m_WaterSpeed.x = 0.2f;
+ m_bOnGround = false;
break;
- }
+ case X_MINUS:
+ m_WaterSpeed.x = -0.2f;
+ m_bOnGround = false;
+ break;
+ case Z_PLUS:
+ m_WaterSpeed.z = 0.2f;
+ m_bOnGround = false;
+ break;
+ case Z_MINUS:
+ m_WaterSpeed.z = -0.2f;
+ m_bOnGround = false;
+ break;
+
+ default:
+ break;
+ }
- if (fabs(m_WaterSpeed.x) < 0.05)
+ if (fabs(m_WaterSpeed.x) < 0.05)
+ {
+ m_WaterSpeed.x = 0;
+ }
+
+ if (fabs(m_WaterSpeed.z) < 0.05)
+ {
+ m_WaterSpeed.z = 0;
+ }
+
+ NextSpeed += m_WaterSpeed;
+
+ if( NextSpeed.SqrLength() > 0.f )
+ {
+ cTracer Tracer( GetWorld() );
+ bool HasHit = Tracer.Trace( NextPos, NextSpeed, 2 );
+ if (HasHit) // Oh noez! we hit something
{
- m_WaterSpeed.x = 0;
- }
-
- if (fabs(m_WaterSpeed.z) < 0.05)
- {
- m_WaterSpeed.z = 0;
- }
-
- NextSpeed += m_WaterSpeed;
-
- if( NextSpeed.SqrLength() > 0.f )
- {
- cTracer Tracer( GetWorld() );
- int Ret = Tracer.Trace( NextPos, NextSpeed, 2 );
- if( Ret ) // Oh noez! we hit something
+ // Set to hit position
+ if ((Tracer.RealHit - NextPos).SqrLength() <= (NextSpeed * a_Dt).SqrLength())
{
- // Set to hit position
- if( (Tracer.RealHit - NextPos).SqrLength() <= ( NextSpeed * a_Dt ).SqrLength() )
- {
- if( Ret == 1 )
- {
- if( Tracer.HitNormal.x != 0.f ) NextSpeed.x = 0.f;
- if( Tracer.HitNormal.y != 0.f ) NextSpeed.y = 0.f;
- if( Tracer.HitNormal.z != 0.f ) NextSpeed.z = 0.f;
+ if (Tracer.HitNormal.x != 0.f) NextSpeed.x = 0.f;
+ if (Tracer.HitNormal.y != 0.f) NextSpeed.y = 0.f;
+ if (Tracer.HitNormal.z != 0.f) NextSpeed.z = 0.f;
- if( Tracer.HitNormal.y > 0 ) // means on ground
- {
- m_bOnGround = true;
- }
- }
- NextPos.Set(Tracer.RealHit.x,Tracer.RealHit.y,Tracer.RealHit.z);
- NextPos.x += Tracer.HitNormal.x * 0.3f;
- NextPos.y += Tracer.HitNormal.y * 0.05f; // Any larger produces entity vibration-upon-the-spot
- NextPos.z += Tracer.HitNormal.z * 0.3f;
- }
- else
+ if (Tracer.HitNormal.y > 0) // means on ground
{
- NextPos += (NextSpeed * a_Dt);
+ m_bOnGround = true;
}
+ NextPos.Set(Tracer.RealHit.x,Tracer.RealHit.y,Tracer.RealHit.z);
+ NextPos.x += Tracer.HitNormal.x * 0.3f;
+ NextPos.y += Tracer.HitNormal.y * 0.05f; // Any larger produces entity vibration-upon-the-spot
+ NextPos.z += Tracer.HitNormal.z * 0.3f;
}
else
{
- // We didn't hit anything, so move =]
NextPos += (NextSpeed * a_Dt);
}
}
- BlockX = (int) floor(NextPos.x);
- BlockZ = (int) floor(NextPos.z);
- NextChunk = NextChunk->GetNeighborChunk(BlockX,BlockZ);
- // See if we can commit our changes. If not, we will discard them.
- if (NextChunk != NULL)
+ else
{
- if (NextPos.x != GetPosX()) SetPosX(NextPos.x);
- if (NextPos.y != GetPosY()) SetPosY(NextPos.y);
- if (NextPos.z != GetPosZ()) SetPosZ(NextPos.z);
- if (NextSpeed.x != GetSpeedX()) SetSpeedX(NextSpeed.x);
- if (NextSpeed.y != GetSpeedY()) SetSpeedY(NextSpeed.y);
- if (NextSpeed.z != GetSpeedZ()) SetSpeedZ(NextSpeed.z);
+ // We didn't hit anything, so move =]
+ NextPos += (NextSpeed * a_Dt);
}
}
+
+ BlockX = (int) floor(NextPos.x);
+ BlockZ = (int) floor(NextPos.z);
+
+ cChunk * NextChunk = a_Chunk.GetNeighborChunk(BlockX, BlockZ);
+ // See if we can commit our changes. If not, we will discard them.
+ if (NextChunk != NULL)
+ {
+ if (NextPos.x != GetPosX()) SetPosX(NextPos.x);
+ if (NextPos.y != GetPosY()) SetPosY(NextPos.y);
+ if (NextPos.z != GetPosZ()) SetPosZ(NextPos.z);
+ if (NextSpeed.x != GetSpeedX()) SetSpeedX(NextSpeed.x);
+ if (NextSpeed.y != GetSpeedY()) SetSpeedY(NextSpeed.y);
+ if (NextSpeed.z != GetSpeedZ()) SetSpeedZ(NextSpeed.z);
+ }
}
@@ -815,14 +818,13 @@ void cEntity::TickBurning(cChunk & a_Chunk)
{
int RelX = x;
int RelZ = z;
- cChunk * CurChunk = a_Chunk.GetRelNeighborChunkAdjustCoords(RelX, RelZ);
- if (CurChunk == NULL)
- {
- continue;
- }
+
for (int y = MinY; y <= MaxY; y++)
{
- switch (CurChunk->GetBlock(RelX, y, RelZ))
+ BLOCKTYPE Block;
+ a_Chunk.UnboundedRelGetBlockType(RelX, y, RelZ, Block);
+
+ switch (Block)
{
case E_BLOCK_FIRE:
{
@@ -922,7 +924,7 @@ void cEntity::TickInVoid(cChunk & a_Chunk)
void cEntity::SetSwimState(cChunk & a_Chunk)
{
- int RelY = (int)floor(m_LastPosY + 0.1);
+ int RelY = (int)floor(GetPosY() + 0.1);
if ((RelY < 0) || (RelY >= cChunkDef::Height - 1))
{
m_IsSwimming = false;
@@ -931,11 +933,10 @@ void cEntity::SetSwimState(cChunk & a_Chunk)
}
BLOCKTYPE BlockIn;
- int RelX = (int)floor(m_LastPosX) - a_Chunk.GetPosX() * cChunkDef::Width;
- int RelZ = (int)floor(m_LastPosZ) - a_Chunk.GetPosZ() * cChunkDef::Width;
+ int RelX = POSX_TOINT - a_Chunk.GetPosX() * cChunkDef::Width;
+ int RelZ = POSZ_TOINT - a_Chunk.GetPosZ() * cChunkDef::Width;
// Check if the player is swimming:
- // Use Unbounded, because we're being called *after* processing super::Tick(), which could have changed our chunk
if (!a_Chunk.UnboundedRelGetBlockType(RelX, RelY, RelZ, BlockIn))
{
// This sometimes happens on Linux machines
diff --git a/src/Entities/Entity.h b/src/Entities/Entity.h
index a73565de7..e41f74b09 100644
--- a/src/Entities/Entity.h
+++ b/src/Entities/Entity.h
@@ -69,6 +69,7 @@ public:
enum eEntityType
{
etEntity, // For all other types
+ etEnderCrystal,
etPlayer,
etPickup,
etMonster,
@@ -117,6 +118,7 @@ public:
BURN_TICKS = 200, ///< How long to keep an entity burning after it has stood in lava / fire
MAX_AIR_LEVEL = 300, ///< Maximum air an entity can have
DROWNING_TICKS = 20, ///< Number of ticks per heart of damage
+ VOID_BOUNDARY = -46 ///< At what position Y to begin applying void damage
} ;
cEntity(eEntityType a_EntityType, double a_X, double a_Y, double a_Z, double a_Width, double a_Height);
@@ -129,18 +131,19 @@ public:
eEntityType GetEntityType(void) const { return m_EntityType; }
- bool IsPlayer (void) const { return (m_EntityType == etPlayer); }
- bool IsPickup (void) const { return (m_EntityType == etPickup); }
- bool IsMob (void) const { return (m_EntityType == etMonster); }
+ bool IsEnderCrystal(void) const { return (m_EntityType == etEnderCrystal); }
+ bool IsPlayer (void) const { return (m_EntityType == etPlayer); }
+ bool IsPickup (void) const { return (m_EntityType == etPickup); }
+ bool IsMob (void) const { return (m_EntityType == etMonster); }
bool IsFallingBlock(void) const { return (m_EntityType == etFallingBlock); }
- bool IsMinecart (void) const { return (m_EntityType == etMinecart); }
- bool IsBoat (void) const { return (m_EntityType == etBoat); }
- bool IsTNT (void) const { return (m_EntityType == etTNT); }
- bool IsProjectile (void) const { return (m_EntityType == etProjectile); }
- bool IsExpOrb (void) const { return (m_EntityType == etExpOrb); }
- bool IsFloater (void) const { return (m_EntityType == etFloater); }
- bool IsItemFrame (void) const { return (m_EntityType == etItemFrame); }
- bool IsPainting (void) const { return (m_EntityType == etPainting); }
+ bool IsMinecart (void) const { return (m_EntityType == etMinecart); }
+ bool IsBoat (void) const { return (m_EntityType == etBoat); }
+ bool IsTNT (void) const { return (m_EntityType == etTNT); }
+ bool IsProjectile (void) const { return (m_EntityType == etProjectile); }
+ bool IsExpOrb (void) const { return (m_EntityType == etExpOrb); }
+ bool IsFloater (void) const { return (m_EntityType == etFloater); }
+ bool IsItemFrame (void) const { return (m_EntityType == etItemFrame); }
+ bool IsPainting (void) const { return (m_EntityType == etPainting); }
/// Returns true if the entity is of the specified class or a subclass (cPawn's IsA("cEntity") returns true)
virtual bool IsA(const char * a_ClassName) const;
diff --git a/src/Entities/ExpOrb.cpp b/src/Entities/ExpOrb.cpp
index 3398f1c7b..3623c869a 100644
--- a/src/Entities/ExpOrb.cpp
+++ b/src/Entities/ExpOrb.cpp
@@ -5,20 +5,26 @@
#include "../ClientHandle.h"
-cExpOrb::cExpOrb(double a_X, double a_Y, double a_Z, int a_Reward) :
- cEntity(etExpOrb, a_X, a_Y, a_Z, 0.98, 0.98),
- m_Reward(a_Reward)
+cExpOrb::cExpOrb(double a_X, double a_Y, double a_Z, int a_Reward)
+ : cEntity(etExpOrb, a_X, a_Y, a_Z, 0.98, 0.98)
+ , m_Reward(a_Reward)
+ , m_Timer(0.f)
{
+ SetMaxHealth(5);
+ SetHealth(5);
}
-cExpOrb::cExpOrb(const Vector3d & a_Pos, int a_Reward) :
- cEntity(etExpOrb, a_Pos.x, a_Pos.y, a_Pos.z, 0.98, 0.98),
- m_Reward(a_Reward)
+cExpOrb::cExpOrb(const Vector3d & a_Pos, int a_Reward)
+ : cEntity(etExpOrb, a_Pos.x, a_Pos.y, a_Pos.z, 0.98, 0.98)
+ , m_Reward(a_Reward)
+ , m_Timer(0.f)
{
+ SetMaxHealth(5);
+ SetHealth(5);
}
@@ -52,7 +58,7 @@ void cExpOrb::Tick(float a_Dt, cChunk & a_Chunk)
LOGD("Player %s picked up an ExpOrb. His reward is %i", a_ClosestPlayer->GetName().c_str(), m_Reward);
a_ClosestPlayer->DeltaExperience(m_Reward);
- m_World->BroadcastSoundEffect("random.orb", (int)GetPosX() * 8, (int)GetPosY() * 8, (int)GetPosZ() * 8, 0.5f, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64));
+ m_World->BroadcastSoundEffect("random.orb", (int)(GetPosX() * 8), (int)(GetPosY() * 8), (int)(GetPosZ() * 8), 0.5f, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64));
Destroy();
}
@@ -64,4 +70,10 @@ void cExpOrb::Tick(float a_Dt, cChunk & a_Chunk)
BroadcastMovementUpdate();
}
HandlePhysics(a_Dt, a_Chunk);
+
+ m_Timer += a_Dt;
+ if (m_Timer >= 1000 * 60 * 5) // 5 minutes
+ {
+ Destroy(true);
+ }
}
diff --git a/src/Entities/ExpOrb.h b/src/Entities/ExpOrb.h
index 47d86922c..c1150bd03 100644
--- a/src/Entities/ExpOrb.h
+++ b/src/Entities/ExpOrb.h
@@ -7,14 +7,17 @@
+// tolua_begin
class cExpOrb :
public cEntity
{
typedef cExpOrb super;
public:
+ // tolua_end
+
CLASS_PROTODEF(cExpOrb);
-
+
cExpOrb(double a_X, double a_Y, double a_Z, int a_Reward);
cExpOrb(const Vector3d & a_Pos, int a_Reward);
@@ -22,9 +25,21 @@ public:
virtual void Tick(float a_Dt, cChunk & a_Chunk) override;
virtual void SpawnOn(cClientHandle & a_Client) override;
- // cExpOrb functions
- int GetReward(void) const { return m_Reward; }
+ /** Returns the number of ticks that this entity has existed */
+ int GetAge(void) const { return (int)(m_Timer / 50); } // tolua_export
+
+ /** Set the number of ticks that this entity has existed */
+ void SetAge(int a_Age) { m_Timer = (float)(a_Age * 50); } // tolua_export
+
+ /** Get the exp amount */
+ int GetReward(void) const { return m_Reward; } // tolua_export
+
+ /** Set the exp amount */
+ void SetReward(int a_Reward) { m_Reward = a_Reward; } // tolua_export
protected:
int m_Reward;
-} ;
\ No newline at end of file
+
+ /** The number of ticks that the entity has existed / timer between collect and destroy; in msec */
+ float m_Timer;
+} ; // tolua_export
\ No newline at end of file
diff --git a/src/Entities/FallingBlock.cpp b/src/Entities/FallingBlock.cpp
index 9fcd9ac80..a66c7e4ae 100644
--- a/src/Entities/FallingBlock.cpp
+++ b/src/Entities/FallingBlock.cpp
@@ -33,20 +33,16 @@ void cFallingBlock::SpawnOn(cClientHandle & a_ClientHandle)
void cFallingBlock::Tick(float a_Dt, cChunk & a_Chunk)
{
- float MilliDt = a_Dt * 0.001f;
- AddSpeedY(MilliDt * -9.8f);
- AddPosY(GetSpeedY() * MilliDt);
-
// GetWorld()->BroadcastTeleportEntity(*this); // Test position
- int BlockX = m_OriginalPosition.x;
+ int BlockX = POSX_TOINT;
int BlockY = (int)(GetPosY() - 0.5);
- int BlockZ = m_OriginalPosition.z;
+ int BlockZ = POSZ_TOINT;
if (BlockY < 0)
{
// Fallen out of this world, just continue falling until out of sight, then destroy:
- if (BlockY < 100)
+ if (BlockY < VOID_BOUNDARY)
{
Destroy(true);
}
@@ -86,6 +82,15 @@ void cFallingBlock::Tick(float a_Dt, cChunk & a_Chunk)
Destroy(true);
return;
}
+
+ float MilliDt = a_Dt * 0.001f;
+ AddSpeedY(MilliDt * -9.8f);
+ AddPosition(GetSpeed() * MilliDt);
+
+ if ((GetSpeedX() != 0) || (GetSpeedZ() != 0))
+ {
+ BroadcastMovementUpdate();
+ }
}
diff --git a/src/Entities/HangingEntity.cpp b/src/Entities/HangingEntity.cpp
new file mode 100644
index 000000000..41ac86268
--- /dev/null
+++ b/src/Entities/HangingEntity.cpp
@@ -0,0 +1,53 @@
+
+#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules
+
+#include "HangingEntity.h"
+#include "ClientHandle.h"
+#include "Player.h"
+
+
+
+
+
+cHangingEntity::cHangingEntity(eEntityType a_EntityType, eBlockFace a_BlockFace, double a_X, double a_Y, double a_Z)
+ : cEntity(a_EntityType, a_X, a_Y, a_Z, 0.8, 0.8)
+ , m_BlockFace(a_BlockFace)
+{
+ SetMaxHealth(1);
+ SetHealth(1);
+}
+
+
+
+
+
+void cHangingEntity::SpawnOn(cClientHandle & a_ClientHandle)
+{
+ int Dir = 0;
+
+ // The client uses different values for item frame directions and block faces. Our constants are for the block faces, so we convert them here to item frame faces
+ switch (m_BlockFace)
+ {
+ case BLOCK_FACE_ZP: break; // Initialised to zero
+ case BLOCK_FACE_ZM: Dir = 2; break;
+ case BLOCK_FACE_XM: Dir = 1; break;
+ case BLOCK_FACE_XP: Dir = 3; break;
+ default: ASSERT(!"Unhandled block face when trying to spawn item frame!"); return;
+ }
+
+ if ((Dir == 0) || (Dir == 2)) // Probably a client bug, but two directions are flipped and contrary to the norm, so we do -180
+ {
+ SetYaw((Dir * 90) - 180);
+ }
+ else
+ {
+ SetYaw(Dir * 90);
+ }
+
+ a_ClientHandle.SendSpawnObject(*this, 71, Dir, (Byte)GetYaw(), (Byte)GetPitch());
+ a_ClientHandle.SendEntityMetadata(*this);
+}
+
+
+
+
diff --git a/src/Entities/HangingEntity.h b/src/Entities/HangingEntity.h
new file mode 100644
index 000000000..6498e4b5b
--- /dev/null
+++ b/src/Entities/HangingEntity.h
@@ -0,0 +1,49 @@
+
+#pragma once
+
+#include "Entity.h"
+
+
+
+
+
+// tolua_begin
+class cHangingEntity :
+ public cEntity
+{
+ // tolua_end
+ typedef cEntity super;
+
+public:
+
+ CLASS_PROTODEF(cHangingEntity);
+
+ cHangingEntity(eEntityType a_EntityType, eBlockFace a_BlockFace, double a_X, double a_Y, double a_Z);
+
+ /** Returns the orientation from the hanging entity */
+ eBlockFace GetDirection() const { return m_BlockFace; } // tolua_export
+
+ /** Set the orientation from the hanging entity */
+ void SetDirection(eBlockFace a_BlockFace) { m_BlockFace = a_BlockFace; } // tolua_export
+
+ /** Returns the X coord. */
+ int GetTileX() const { return POSX_TOINT; } // tolua_export
+
+ /** Returns the Y coord. */
+ int GetTileY() const { return POSY_TOINT; } // tolua_export
+
+ /** Returns the Z coord. */
+ int GetTileZ() const { return POSZ_TOINT; } // tolua_export
+
+private:
+
+ virtual void SpawnOn(cClientHandle & a_ClientHandle) override;
+ virtual void Tick(float a_Dt, cChunk & a_Chunk) override {};
+
+ eBlockFace m_BlockFace;
+
+}; // tolua_export
+
+
+
+
diff --git a/src/Entities/ItemFrame.cpp b/src/Entities/ItemFrame.cpp
index 8cfa5e18d..9dd909880 100644
--- a/src/Entities/ItemFrame.cpp
+++ b/src/Entities/ItemFrame.cpp
@@ -10,43 +10,10 @@
cItemFrame::cItemFrame(eBlockFace a_BlockFace, double a_X, double a_Y, double a_Z)
- : cEntity(etItemFrame, a_X, a_Y, a_Z, 0.8, 0.8),
- m_BlockFace(a_BlockFace),
- m_Item(E_BLOCK_AIR),
- m_Rotation(0)
+ : cHangingEntity(etItemFrame, a_BlockFace, a_X, a_Y, a_Z)
+ , m_Item(E_BLOCK_AIR)
+ , m_Rotation(0)
{
- SetMaxHealth(1);
- SetHealth(1);
-}
-
-
-
-
-
-void cItemFrame::SpawnOn(cClientHandle & a_ClientHandle)
-{
- int Dir = 0;
-
- // The client uses different values for item frame directions and block faces. Our constants are for the block faces, so we convert them here to item frame faces
- switch (m_BlockFace)
- {
- case BLOCK_FACE_ZP: break; // Initialised to zero
- case BLOCK_FACE_ZM: Dir = 2; break;
- case BLOCK_FACE_XM: Dir = 1; break;
- case BLOCK_FACE_XP: Dir = 3; break;
- default: ASSERT(!"Unhandled block face when trying to spawn item frame!"); return;
- }
-
- if ((Dir == 0) || (Dir == 2)) // Probably a client bug, but two directions are flipped and contrary to the norm, so we do -180
- {
- SetYaw((Dir * 90) - 180);
- }
- else
- {
- SetYaw(Dir * 90);
- }
-
- a_ClientHandle.SendSpawnObject(*this, 71, Dir, (Byte)GetYaw(), (Byte)GetPitch());
}
diff --git a/src/Entities/ItemFrame.h b/src/Entities/ItemFrame.h
index 43915e3f9..6577e7d94 100644
--- a/src/Entities/ItemFrame.h
+++ b/src/Entities/ItemFrame.h
@@ -1,7 +1,7 @@
#pragma once
-#include "Entity.h"
+#include "HangingEntity.h"
@@ -9,10 +9,10 @@
// tolua_begin
class cItemFrame :
- public cEntity
+ public cHangingEntity
{
// tolua_end
- typedef cEntity super;
+ typedef cHangingEntity super;
public:
@@ -20,18 +20,24 @@ public:
cItemFrame(eBlockFace a_BlockFace, double a_X, double a_Y, double a_Z);
- const cItem & GetItem(void) { return m_Item; }
- Byte GetRotation(void) const { return m_Rotation; }
+ /** Returns the item in the frame */
+ const cItem & GetItem(void) { return m_Item; } // tolua_export
+
+ /** Set the item in the frame */
+ void SetItem(cItem & a_Item) { m_Item = a_Item; }; // tolua_export
+
+ /** Returns the rotation from the item in the frame */
+ Byte GetRotation(void) const { return m_Rotation; } // tolua_export
+
+ /** Set the rotation from the item in the frame */
+ void SetRotation(Byte a_Rotation) { m_Rotation = a_Rotation; } // tolua_export
private:
- virtual void SpawnOn(cClientHandle & a_ClientHandle) override;
virtual void OnRightClicked(cPlayer & a_Player) override;
- virtual void Tick(float a_Dt, cChunk & a_Chunk) override {};
virtual void KilledBy(cEntity * a_Killer) override;
virtual void GetDrops(cItems & a_Items, cEntity * a_Killer) override;
- eBlockFace m_BlockFace;
cItem m_Item;
Byte m_Rotation;
diff --git a/src/Entities/Pickup.cpp b/src/Entities/Pickup.cpp
index c5503c16a..7fc89b62b 100644
--- a/src/Entities/Pickup.cpp
+++ b/src/Entities/Pickup.cpp
@@ -82,7 +82,7 @@ cPickup::cPickup(double a_PosX, double a_PosY, double a_PosZ, const cItem & a_It
void cPickup::SpawnOn(cClientHandle & a_Client)
{
- a_Client.SendPickupSpawn(*this);
+ a_Client.SendPickupSpawn(*this);
}
diff --git a/src/Entities/Pickup.h b/src/Entities/Pickup.h
index c273567d1..74b917bce 100644
--- a/src/Entities/Pickup.h
+++ b/src/Entities/Pickup.h
@@ -26,31 +26,34 @@ public:
CLASS_PROTODEF(cPickup);
cPickup(double a_PosX, double a_PosY, double a_PosZ, const cItem & a_Item, bool IsPlayerCreated, float a_SpeedX = 0.f, float a_SpeedY = 0.f, float a_SpeedZ = 0.f);
-
+
cItem & GetItem(void) {return m_Item; } // tolua_export
const cItem & GetItem(void) const {return m_Item; }
virtual void SpawnOn(cClientHandle & a_ClientHandle) override;
-
+
bool CollectedBy(cPlayer * a_Dest); // tolua_export
virtual void Tick(float a_Dt, cChunk & a_Chunk) override;
-
- /// Returns the number of ticks that this entity has existed
- int GetAge(void) const { return (int)(m_Timer / 50); } // tolua_export
-
- /// Returns true if the pickup has already been collected
+
+ /** Returns the number of ticks that this entity has existed */
+ int GetAge(void) const { return (int)(m_Timer / 50); } // tolua_export
+
+ /** Set the number of ticks that this entity has existed */
+ void SetAge(int a_Age) { m_Timer = (float)(a_Age * 50); } // tolua_export
+
+ /** Returns true if the pickup has already been collected */
bool IsCollected(void) const { return m_bCollected; } // tolua_export
- /// Returns true if created by player (i.e. vomiting), used for determining picking-up delay time
+ /** Returns true if created by player (i.e. vomiting), used for determining picking-up delay time */
bool IsPlayerCreated(void) const { return m_bIsPlayerCreated; } // tolua_export
-
+
private:
Vector3d m_ResultingSpeed; //Can be used to modify the resulting speed for the current tick ;)
Vector3d m_WaterSpeed;
- /// The number of ticks that the entity has existed / timer between collect and destroy; in msec
+ /** The number of ticks that the entity has existed / timer between collect and destroy; in msec */
float m_Timer;
cItem m_Item;
diff --git a/src/Entities/Player.cpp b/src/Entities/Player.cpp
index 440d30595..646aad50f 100644
--- a/src/Entities/Player.cpp
+++ b/src/Entities/Player.cpp
@@ -43,8 +43,9 @@ cPlayer::cPlayer(cClientHandle* a_Client, const AString & a_PlayerName)
, m_GameMode(eGameMode_NotSet)
, m_IP("")
, m_ClientHandle(a_Client)
- , m_NormalMaxSpeed(0.1)
- , m_SprintingMaxSpeed(0.13)
+ , m_NormalMaxSpeed(1.0)
+ , m_SprintingMaxSpeed(1.3)
+ , m_FlyingMaxSpeed(1.0)
, m_IsCrouched(false)
, m_IsSprinting(false)
, m_IsFlying(false)
@@ -684,7 +685,21 @@ const cSlotNums & cPlayer::GetInventoryPaintSlots(void) const
double cPlayer::GetMaxSpeed(void) const
{
- return m_IsSprinting ? m_SprintingMaxSpeed : m_NormalMaxSpeed;
+ if (m_IsFlying)
+ {
+ return m_FlyingMaxSpeed;
+ }
+ else
+ {
+ if (m_IsSprinting)
+ {
+ return m_SprintingMaxSpeed;
+ }
+ else
+ {
+ return m_NormalMaxSpeed;
+ }
+ }
}
@@ -694,7 +709,7 @@ double cPlayer::GetMaxSpeed(void) const
void cPlayer::SetNormalMaxSpeed(double a_Speed)
{
m_NormalMaxSpeed = a_Speed;
- if (!m_IsSprinting)
+ if (!m_IsSprinting && !m_IsFlying)
{
m_ClientHandle->SendPlayerMaxSpeed();
}
@@ -707,7 +722,7 @@ void cPlayer::SetNormalMaxSpeed(double a_Speed)
void cPlayer::SetSprintingMaxSpeed(double a_Speed)
{
m_SprintingMaxSpeed = a_Speed;
- if (m_IsSprinting)
+ if (m_IsSprinting && !m_IsFlying)
{
m_ClientHandle->SendPlayerMaxSpeed();
}
@@ -717,6 +732,18 @@ void cPlayer::SetSprintingMaxSpeed(double a_Speed)
+void cPlayer::SetFlyingMaxSpeed(double a_Speed)
+{
+ m_FlyingMaxSpeed = a_Speed;
+
+ // Update the flying speed, always:
+ m_ClientHandle->SendPlayerAbilities();
+}
+
+
+
+
+
void cPlayer::SetCrouch(bool a_IsCrouched)
{
// Set the crouch status, broadcast to all visible players
@@ -1462,6 +1489,7 @@ bool cPlayer::MoveToWorld(const char * a_WorldName)
// Add player to all the necessary parts of the new world
SetWorld(World);
+ m_ClientHandle->StreamChunks();
World->AddEntity(this);
World->AddPlayer(this);
diff --git a/src/Entities/Player.h b/src/Entities/Player.h
index f9404dfaf..ea32dbfb9 100644
--- a/src/Entities/Player.h
+++ b/src/Entities/Player.h
@@ -47,19 +47,19 @@ public:
virtual void HandlePhysics(float a_Dt, cChunk &) override { UNUSED(a_Dt); };
- /// Returns the curently equipped weapon; empty item if none
+ /** Returns the curently equipped weapon; empty item if none */
virtual cItem GetEquippedWeapon(void) const override { return m_Inventory.GetEquippedItem(); }
- /// Returns the currently equipped helmet; empty item if none
+ /** Returns the currently equipped helmet; empty item if none */
virtual cItem GetEquippedHelmet(void) const override { return m_Inventory.GetEquippedHelmet(); }
- /// Returns the currently equipped chestplate; empty item if none
+ /** Returns the currently equipped chestplate; empty item if none */
virtual cItem GetEquippedChestplate(void) const override { return m_Inventory.GetEquippedChestplate(); }
- /// Returns the currently equipped leggings; empty item if none
+ /** Returns the currently equipped leggings; empty item if none */
virtual cItem GetEquippedLeggings(void) const override { return m_Inventory.GetEquippedLeggings(); }
- /// Returns the currently equipped boots; empty item if none
+ /** Returns the currently equipped boots; empty item if none */
virtual cItem GetEquippedBoots(void) const override { return m_Inventory.GetEquippedBoots(); }
@@ -77,36 +77,41 @@ public:
*/
short DeltaExperience(short a_Xp_delta);
- /// Gets the experience total - XpTotal for score on death
+ /** Gets the experience total - XpTotal for score on death */
inline short GetXpLifetimeTotal(void) { return m_LifetimeTotalXp; }
- /// Gets the currrent experience
+ /** Gets the currrent experience */
inline short GetCurrentXp(void) { return m_CurrentXp; }
- /// Gets the current level - XpLevel
+ /** Gets the current level - XpLevel */
short GetXpLevel(void);
- /// Gets the experience bar percentage - XpP
+ /** Gets the experience bar percentage - XpP */
float GetXpPercentage(void);
- /// Caculates the amount of XP needed for a given level, ref: http://minecraft.gamepedia.com/XP
+ /** Caculates the amount of XP needed for a given level
+ Ref: http://minecraft.gamepedia.com/XP
+ */
static short XpForLevel(short int a_Level);
- /// inverse of XpForLevel, ref: http://minecraft.gamepedia.com/XP values are as per this with pre-calculations
+ /** Inverse of XpForLevel
+ Ref: http://minecraft.gamepedia.com/XP
+ values are as per this with pre-calculations
+ */
static short CalcLevelFromXp(short int a_CurrentXp);
// tolua_end
- /// Starts charging the equipped bow
+ /** Starts charging the equipped bow */
void StartChargingBow(void);
- /// Finishes charging the current bow. Returns the number of ticks for which the bow has been charged
+ /** Finishes charging the current bow. Returns the number of ticks for which the bow has been charged */
int FinishChargingBow(void);
- /// Cancels the current bow charging
+ /** Cancels the current bow charging */
void CancelChargingBow(void);
- /// Returns true if the player is currently charging the bow
+ /** Returns true if the player is currently charging the bow */
bool IsChargingBow(void) const { return m_IsChargingBow; }
void SetTouchGround( bool a_bTouchGround );
@@ -124,16 +129,16 @@ public:
// tolua_begin
- /// Returns the position where projectiles thrown by this player should start, player eye position + adjustment
+ /** Returns the position where projectiles thrown by this player should start, player eye position + adjustment */
Vector3d GetThrowStartPos(void) const;
- /// Returns the initial speed vector of a throw, with a 3D length of a_SpeedCoeff.
+ /** Returns the initial speed vector of a throw, with a 3D length of a_SpeedCoeff. */
Vector3d GetThrowSpeed(double a_SpeedCoeff) const;
- /// Returns the current gamemode. Partly OBSOLETE, you should use IsGameModeXXX() functions wherever applicable
+ /** Returns the current gamemode. Partly OBSOLETE, you should use IsGameModeXXX() functions wherever applicable */
eGameMode GetGameMode(void) const { return m_GameMode; }
- /// Returns the current effective gamemode (inherited gamemode is resolved before returning)
+ /** Returns the current effective gamemode (inherited gamemode is resolved before returning) */
eGameMode GetEffectiveGameMode(void) const { return (m_GameMode == gmNotSet) ? m_World->GetGameMode() : m_GameMode; }
/** Sets the gamemode for the player.
@@ -142,24 +147,24 @@ public:
*/
void SetGameMode(eGameMode a_GameMode);
- /// Returns true if the player is in Creative mode, either explicitly, or by inheriting from current world
+ /** Returns true if the player is in Creative mode, either explicitly, or by inheriting from current world */
bool IsGameModeCreative(void) const;
- /// Returns true if the player is in Survival mode, either explicitly, or by inheriting from current world
+ /** Returns true if the player is in Survival mode, either explicitly, or by inheriting from current world */
bool IsGameModeSurvival(void) const;
- /// Returns true if the player is in Adventure mode, either explicitly, or by inheriting from current world
+ /** Returns true if the player is in Adventure mode, either explicitly, or by inheriting from current world */
bool IsGameModeAdventure(void) const;
AString GetIP(void) const { return m_IP; } // tolua_export
- /// Returns the associated team, NULL if none
+ /** Returns the associated team, NULL if none */
cTeam * GetTeam(void) { return m_Team; } // tolua_export
- /// Sets the player team, NULL if none
+ /** Sets the player team, NULL if none */
void SetTeam(cTeam * a_Team);
- /// Forces the player to query the scoreboard for his team
+ /** Forces the player to query the scoreboard for his team */
cTeam * UpdateTeam(void);
// tolua_end
@@ -169,24 +174,24 @@ public:
// Sets the current gamemode, doesn't check validity, doesn't send update packets to client
void LoginSetGameMode(eGameMode a_GameMode);
- /// Forces the player to move in the given direction.
+ /** Forces the player to move in the given direction. */
void ForceSetSpeed(Vector3d a_Direction); // tolua_export
- /// Tries to move to a new position, with attachment-related checks (y == -999)
+ /** Tries to move to a new position, with attachment-related checks (y == -999) */
void MoveTo(const Vector3d & a_NewPos); // tolua_export
cWindow * GetWindow(void) { return m_CurrentWindow; } // tolua_export
const cWindow * GetWindow(void) const { return m_CurrentWindow; }
- /// Opens the specified window; closes the current one first using CloseWindow()
+ /** Opens the specified window; closes the current one first using CloseWindow() */
void OpenWindow(cWindow * a_Window); // Exported in ManualBindings.cpp
// tolua_begin
- /// Closes the current window, resets current window to m_InventoryWindow. A plugin may refuse the closing if a_CanRefuse is true
+ /** Closes the current window, resets current window to m_InventoryWindow. A plugin may refuse the closing if a_CanRefuse is true */
void CloseWindow(bool a_CanRefuse = true);
- /// Closes the current window if it matches the specified ID, resets current window to m_InventoryWindow
+ /** Closes the current window if it matches the specified ID, resets current window to m_InventoryWindow */
void CloseWindowIfID(char a_WindowID, bool a_CanRefuse = true);
cClientHandle * GetClientHandle(void) const { return m_ClientHandle; }
@@ -208,10 +213,10 @@ public:
typedef std::list< cGroup* > GroupList;
typedef std::list< std::string > StringList;
- /// Adds a player to existing group or creates a new group when it doesn't exist
+ /** Adds a player to existing group or creates a new group when it doesn't exist */
void AddToGroup( const AString & a_GroupName ); // tolua_export
- /// Removes a player from the group, resolves permissions and group inheritance (case sensitive)
+ /** Removes a player from the group, resolves permissions and group inheritance (case sensitive) */
void RemoveFromGroup( const AString & a_GroupName ); // tolua_export
bool HasPermission( const AString & a_Permission ); // tolua_export
@@ -234,7 +239,7 @@ public:
/** tosses a pickup newly created from a_Item */
void TossPickup(const cItem & a_Item);
- /// Heals the player by the specified amount of HPs (positive only); sends health update
+ /** Heals the player by the specified amount of HPs (positive only); sends health update */
void Heal(int a_Health);
int GetFoodLevel (void) const { return m_FoodLevel; }
@@ -243,7 +248,7 @@ public:
double GetFoodExhaustionLevel (void) const { return m_FoodExhaustionLevel; }
int GetFoodPoisonedTicksRemaining(void) const { return m_FoodPoisonedTicksRemaining; }
- /// Returns true if the player is satiated, i. e. their foodlevel is at the max and they cannot eat anymore
+ /** Returns true if the player is satiated, i. e. their foodlevel is at the max and they cannot eat anymore */
bool IsSatiated(void) const { return (m_FoodLevel >= MAX_FOOD_LEVEL); }
void SetFoodLevel (int a_FoodLevel);
@@ -252,25 +257,28 @@ public:
void SetFoodExhaustionLevel (double a_FoodExhaustionLevel);
void SetFoodPoisonedTicksRemaining(int a_FoodPoisonedTicksRemaining);
- /// Adds to FoodLevel and FoodSaturationLevel, returns true if any food has been consumed, false if player "full"
+ /** Adds to FoodLevel and FoodSaturationLevel, returns true if any food has been consumed, false if player "full" */
bool Feed(int a_Food, double a_Saturation);
- /// Adds the specified exhaustion to m_FoodExhaustion. Expects only positive values.
+ /** Adds the specified exhaustion to m_FoodExhaustion. Expects only positive values. */
void AddFoodExhaustion(double a_Exhaustion)
{
m_FoodExhaustionLevel += a_Exhaustion;
}
- /// Starts the food poisoning for the specified amount of ticks; if already foodpoisoned, sets FoodPoisonedTicksRemaining to the larger of the two
+ /** Starts the food poisoning for the specified amount of ticks; if already foodpoisoned, sets FoodPoisonedTicksRemaining to the larger of the two */
void FoodPoison(int a_NumTicks);
- /// Returns true if the player is currently in the process of eating the currently equipped item
+ /** Returns true if the player is currently in the process of eating the currently equipped item */
bool IsEating(void) const { return (m_EatingFinishTick >= 0); }
- /// Returns true if the player is currently flying.
+ /** Returns true if the player is currently flying. */
bool IsFlying(void) const { return m_IsFlying; }
- /// returns true if the player has thrown out a floater.
+ /** Returns if a player is sleeping in a bed */
+ bool IsInBed(void) const { return m_bIsInBed; }
+
+ /** returns true if the player has thrown out a floater. */
bool IsFishing(void) const { return m_IsFishing; }
void SetIsFishing(bool a_IsFishing, int a_FloaterID = -1) { m_IsFishing = a_IsFishing; m_FloaterID = a_FloaterID; }
@@ -278,14 +286,17 @@ public:
int GetFloaterID(void) const { return m_FloaterID; }
// tolua_end
+
+ /** Sets a player's in-bed state; we can't be sure plugins will keep this value updated, so no exporting */
+ void SetIsInBed(bool a_Flag) { m_bIsInBed = a_Flag; }
- /// Starts eating the currently equipped item. Resets the eating timer and sends the proper animation packet
+ /** Starts eating the currently equipped item. Resets the eating timer and sends the proper animation packet */
void StartEating(void);
- /// Finishes eating the currently equipped item. Consumes the item, updates health and broadcasts the packets
+ /** Finishes eating the currently equipped item. Consumes the item, updates health and broadcasts the packets */
void FinishEating(void);
- /// Aborts the current eating operation
+ /** Aborts the current eating operation */
void AbortEating(void);
virtual void KilledBy(cEntity * a_Killer) override;
@@ -314,45 +325,51 @@ public:
cItem & GetDraggingItem(void) {return m_DraggingItem; }
// In UI windows, when inventory-painting:
- /// Clears the list of slots that are being inventory-painted. To be used by cWindow only
+ /** Clears the list of slots that are being inventory-painted. To be used by cWindow only */
void ClearInventoryPaintSlots(void);
- /// Adds a slot to the list for inventory painting. To be used by cWindow only
+ /** Adds a slot to the list for inventory painting. To be used by cWindow only */
void AddInventoryPaintSlot(int a_SlotNum);
- /// Returns the list of slots currently stored for inventory painting. To be used by cWindow only
+ /** Returns the list of slots currently stored for inventory painting. To be used by cWindow only */
const cSlotNums & GetInventoryPaintSlots(void) const;
// tolua_begin
- /// Returns the current maximum speed, as reported in the 1.6.1+ protocol (takes current sprinting state into account)
+ /** Returns the current relative maximum speed (takes current sprinting / flying state into account) */
double GetMaxSpeed(void) const;
- /// Gets the normal maximum speed, as reported in the 1.6.1+ protocol, in the protocol units
+ /** Gets the normal relative maximum speed */
double GetNormalMaxSpeed(void) const { return m_NormalMaxSpeed; }
- /// Gets the sprinting maximum speed, as reported in the 1.6.1+ protocol, in the protocol units
+ /** Gets the sprinting relative maximum speed */
double GetSprintingMaxSpeed(void) const { return m_SprintingMaxSpeed; }
- /// Sets the normal maximum speed, as reported in the 1.6.1+ protocol. Sends the update to player, if needed.
+ /** Gets the flying relative maximum speed */
+ double GetFlyingMaxSpeed(void) const { return m_FlyingMaxSpeed; }
+
+ /** Sets the normal relative maximum speed. Sends the update to player, if needed. */
void SetNormalMaxSpeed(double a_Speed);
- /// Sets the sprinting maximum speed, as reported in the 1.6.1+ protocol. Sends the update to player, if needed.
+ /** Sets the sprinting relative maximum speed. Sends the update to player, if needed. */
void SetSprintingMaxSpeed(double a_Speed);
- /// Sets the crouch status, broadcasts to all visible players
+ /** Sets the flying relative maximum speed. Sends the update to player, if needed. */
+ void SetFlyingMaxSpeed(double a_Speed);
+
+ /** Sets the crouch status, broadcasts to all visible players */
void SetCrouch(bool a_IsCrouched);
- /// Starts or stops sprinting, sends the max speed update to the client, if needed
+ /** Starts or stops sprinting, sends the max speed update to the client, if needed */
void SetSprint(bool a_IsSprinting);
- /// Flags the player as flying
+ /** Flags the player as flying */
void SetFlying(bool a_IsFlying);
- /// If true the player can fly even when he's not in creative.
+ /** If true the player can fly even when he's not in creative. */
void SetCanFly(bool a_CanFly);
- /// Returns wheter the player can fly or not.
+ /** Returns wheter the player can fly or not. */
virtual bool CanFly(void) const { return m_CanFly; }
// tolua_end
@@ -371,10 +388,10 @@ protected:
GroupList m_ResolvedGroups;
GroupList m_Groups;
- std::string m_PlayerName;
- std::string m_LoadedWorldName;
+ AString m_PlayerName;
+ AString m_LoadedWorldName;
- /// Xp Level stuff
+ /** Xp Level stuff */
enum
{
XP_TO_LEVEL15 = 255,
@@ -385,22 +402,22 @@ protected:
bool m_bVisible;
// Food-related variables:
- /// Represents the food bar, one point equals half a "drumstick"
+ /** Represents the food bar, one point equals half a "drumstick" */
int m_FoodLevel;
- /// "Overcharge" for the m_FoodLevel; is depleted before m_FoodLevel
+ /** "Overcharge" for the m_FoodLevel; is depleted before m_FoodLevel */
double m_FoodSaturationLevel;
- /// Count-up to the healing or damaging action, based on m_FoodLevel
+ /** Count-up to the healing or damaging action, based on m_FoodLevel */
int m_FoodTickTimer;
- /// A "buffer" which adds up hunger before it is substracted from m_FoodSaturationLevel or m_FoodLevel. Each action adds a little
+ /** A "buffer" which adds up hunger before it is substracted from m_FoodSaturationLevel or m_FoodLevel. Each action adds a little */
double m_FoodExhaustionLevel;
- /// Number of ticks remaining for the foodpoisoning effect; zero if not foodpoisoned
+ /** Number of ticks remaining for the foodpoisoning effect; zero if not foodpoisoned */
int m_FoodPoisonedTicksRemaining;
- /// Last position that has been recorded for food-related processing:
+ /** Last position that has been recorded for food-related processing: */
Vector3d m_LastFoodPos;
float m_LastJumpHeight;
@@ -416,7 +433,7 @@ protected:
eGameMode m_GameMode;
AString m_IP;
- /// The item being dragged by the cursor while in a UI window
+ /** The item being dragged by the cursor while in a UI window */
cItem m_DraggingItem;
long long m_LastPlayerListTime;
@@ -426,12 +443,21 @@ protected:
cSlotNums m_InventoryPaintSlots;
- /// Max speed, in ENTITY_PROPERTIES packet's units, when the player is walking. 0.1 by default
+ /** Max speed, relative to the game default.
+ 1 means regular speed, 2 means twice as fast, 0.5 means half-speed.
+ Default value is 1. */
double m_NormalMaxSpeed;
- /// Max speed, in ENTITY_PROPERTIES packet's units, when the player is sprinting. 0.13 by default
+ /** Max speed, relative to the game default max speed, when sprinting.
+ 1 means regular speed, 2 means twice as fast, 0.5 means half-speed.
+ Default value is 1.3. */
double m_SprintingMaxSpeed;
+ /** Max speed, relative to the game default flying max speed, when flying.
+ 1 means regular speed, 2 means twice as fast, 0.5 means half-speed.
+ Default value is 1. */
+ double m_FlyingMaxSpeed;
+
bool m_IsCrouched;
bool m_IsSprinting;
bool m_IsFlying;
@@ -441,10 +467,10 @@ protected:
bool m_CanFly; // If this is true the player can fly. Even if he is not in creative.
- /// The world tick in which eating will be finished. -1 if not eating
+ /** The world tick in which eating will be finished. -1 if not eating */
Int64 m_EatingFinishTick;
- /// Player Xp level
+ /** Player Xp level */
short int m_LifetimeTotalXp;
short int m_CurrentXp;
@@ -456,7 +482,7 @@ protected:
int m_FloaterID;
- cTeam* m_Team;
+ cTeam * m_Team;
@@ -465,20 +491,25 @@ protected:
virtual void Destroyed(void);
- /// Filters out damage for creative mode/friendly fire
+ /** Filters out damage for creative mode/friendly fire */
virtual void DoTakeDamage(TakeDamageInfo & TDI) override;
/** Stops players from burning in creative mode */
virtual void TickBurning(cChunk & a_Chunk) override;
- /// Called in each tick to handle food-related processing
+ /** Called in each tick to handle food-related processing */
void HandleFood(void);
- /// Called in each tick if the player is fishing to make sure the floater dissapears when the player doesn't have a fishing rod as equipped item.
+ /** Called in each tick if the player is fishing to make sure the floater dissapears when the player doesn't have a fishing rod as equipped item. */
void HandleFloater(void);
- /// Adds food exhaustion based on the difference between Pos and LastPos, sprinting status and swimming (in water block)
+ /** Adds food exhaustion based on the difference between Pos and LastPos, sprinting status and swimming (in water block) */
void ApplyFoodExhaustionFromMovement();
+
+ /** Flag representing whether the player is currently in a bed
+ Set by a right click on unoccupied bed, unset by a time fast forward or teleport */
+ bool m_bIsInBed;
+
} ; // tolua_export
diff --git a/src/Entities/ProjectileEntity.cpp b/src/Entities/ProjectileEntity.cpp
index f4ab825f2..a9735a53c 100644
--- a/src/Entities/ProjectileEntity.cpp
+++ b/src/Entities/ProjectileEntity.cpp
@@ -4,6 +4,7 @@
// Implements the cProjectileEntity class representing the common base class for projectiles, as well as individual projectile types
#include "Globals.h"
+#include "../Bindings/PluginManager.h"
#include "ProjectileEntity.h"
#include "../ClientHandle.h"
#include "Player.h"
@@ -66,6 +67,11 @@ protected:
eBlockFace Face;
if (bb.CalcLineIntersection(Line1, Line2, LineCoeff, Face))
{
+ if (cPluginManager::Get()->CallHookProjectileHitBlock(*m_Projectile))
+ {
+ return false;
+ }
+
Vector3d Intersection = Line1 + m_Projectile->GetSpeed() * LineCoeff;
m_Projectile->OnHitSolidBlock(Intersection, Face);
return true;
@@ -147,7 +153,11 @@ public:
}
// TODO: Some entities don't interact with the projectiles (pickups, falling blocks)
- // TODO: Allow plugins to interfere about which entities can be hit
+ if (cPluginManager::Get()->CallHookProjectileHitEntity(*m_Projectile, *a_Entity))
+ {
+ // A plugin disagreed.
+ return false;
+ }
if (LineCoeff < m_MinCoeff)
{
diff --git a/src/ForEachChunkProvider.h b/src/ForEachChunkProvider.h
index 6017173ee..7a6e8c5c6 100644
--- a/src/ForEachChunkProvider.h
+++ b/src/ForEachChunkProvider.h
@@ -24,6 +24,8 @@ class cBlockArea;
class cForEachChunkProvider
{
public:
+ virtual ~cForEachChunkProvider() {}
+
/** Calls the callback for each chunk in the specified range. */
virtual bool ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback) = 0;
diff --git a/src/Generating/BioGen.cpp b/src/Generating/BioGen.cpp
index 967deba6a..32a687201 100644
--- a/src/Generating/BioGen.cpp
+++ b/src/Generating/BioGen.cpp
@@ -371,8 +371,8 @@ void cBioGenDistortedVoronoi::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::B
Distort(BaseX + x * 4, BaseZ + z * 4, DistortX[4 * x][4 * z], DistortZ[4 * x][4 * z]);
}
- LinearUpscale2DArrayInPlace(&DistortX[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
- LinearUpscale2DArrayInPlace(&DistortZ[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
+ LinearUpscale2DArrayInPlace(&DistortX[0][0]);
+ LinearUpscale2DArrayInPlace(&DistortZ[0][0]);
for (int z = 0; z < cChunkDef::Width; z++)
{
@@ -477,8 +477,8 @@ void cBioGenMultiStepMap::DecideOceanLandMushroom(int a_ChunkX, int a_ChunkZ, cC
{
Distort(BaseX + x * 4, BaseZ + z * 4, DistortX[4 * x][4 * z], DistortZ[4 * x][4 * z], DistortSize);
}
- LinearUpscale2DArrayInPlace(&DistortX[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
- LinearUpscale2DArrayInPlace(&DistortZ[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
+ LinearUpscale2DArrayInPlace(&DistortX[0][0]);
+ LinearUpscale2DArrayInPlace(&DistortZ[0][0]);
// Prepare a 9x9 area of neighboring cell seeds
// (assuming that 7x7 cell area is larger than a chunk being generated)
@@ -651,8 +651,8 @@ void cBioGenMultiStepMap::BuildTemperatureHumidityMaps(int a_ChunkX, int a_Chunk
HumidityMap[x + 17 * z] = NoiseH;
} // for x
} // for z
- LinearUpscale2DArrayInPlace(TemperatureMap, 17, 17, 8, 8);
- LinearUpscale2DArrayInPlace(HumidityMap, 17, 17, 8, 8);
+ LinearUpscale2DArrayInPlace<17, 17, 8, 8>(TemperatureMap);
+ LinearUpscale2DArrayInPlace<17, 17, 8, 8>(HumidityMap);
// Re-map into integral values in [0 .. 255] range:
for (size_t idx = 0; idx < ARRAYCOUNT(a_TemperatureMap); idx++)
@@ -778,8 +778,8 @@ void cBioGenTwoLevel::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap
DistortZ[4 * x][4 * z] = BlockZ + (int)(64 * NoiseZ);
}
- LinearUpscale2DArrayInPlace(&DistortX[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
- LinearUpscale2DArrayInPlace(&DistortZ[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
+ LinearUpscale2DArrayInPlace(&DistortX[0][0]);
+ LinearUpscale2DArrayInPlace(&DistortZ[0][0]);
// Apply distortion to each block coord, then query the voronoi maps for biome group and biome index and choose biome based on that:
for (int z = 0; z < cChunkDef::Width; z++)
diff --git a/src/Generating/ChunkDesc.cpp b/src/Generating/ChunkDesc.cpp
index 308fbe423..7711723fc 100644
--- a/src/Generating/ChunkDesc.cpp
+++ b/src/Generating/ChunkDesc.cpp
@@ -343,9 +343,9 @@ void cChunkDesc::ReadBlockArea(cBlockArea & a_Dest, int a_MinRelX, int a_MaxRelX
int SizeY = a_MaxRelY - a_MinRelY;
int SizeZ = a_MaxRelZ - a_MinRelZ;
a_Dest.Clear();
- a_Dest.m_OriginX = m_ChunkX * cChunkDef::Width + a_MinRelX;
- a_Dest.m_OriginY = a_MinRelY;
- a_Dest.m_OriginZ = m_ChunkZ * cChunkDef::Width + a_MinRelZ;
+ a_Dest.m_Origin.x = m_ChunkX * cChunkDef::Width + a_MinRelX;
+ a_Dest.m_Origin.y = a_MinRelY;
+ a_Dest.m_Origin.z = m_ChunkZ * cChunkDef::Width + a_MinRelZ;
a_Dest.SetSize(SizeX, SizeY, SizeZ, cBlockArea::baTypes | cBlockArea::baMetas);
for (int y = 0; y < SizeY; y++)
diff --git a/src/Generating/CompoGen.cpp b/src/Generating/CompoGen.cpp
index 60356fe46..578bb2481 100644
--- a/src/Generating/CompoGen.cpp
+++ b/src/Generating/CompoGen.cpp
@@ -566,7 +566,7 @@ void cCompoGenNether::ComposeTerrain(cChunkDesc & a_ChunkDesc)
m_Noise2.IntNoise3DInt(BaseX + INTERPOL_X * x, 0, BaseZ + INTERPOL_Z * z) /
256;
} // for x, z - FloorLo[]
- LinearUpscale2DArrayInPlace(FloorLo, 17, 17, INTERPOL_X, INTERPOL_Z);
+ LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorLo);
// Interpolate segments:
for (int Segment = 0; Segment < MaxHeight; Segment += SEGMENT_HEIGHT)
@@ -579,7 +579,7 @@ void cCompoGenNether::ComposeTerrain(cChunkDesc & a_ChunkDesc)
m_Noise2.IntNoise3DInt(BaseX + INTERPOL_Z * x, Segment + SEGMENT_HEIGHT, BaseZ + INTERPOL_Z * z) /
256;
} // for x, z - FloorLo[]
- LinearUpscale2DArrayInPlace(FloorHi, 17, 17, INTERPOL_X, INTERPOL_Z);
+ LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorHi);
// Interpolate between FloorLo and FloorHi:
for (int z = 0; z < 16; z++) for (int x = 0; x < 16; x++)
diff --git a/src/Generating/ComposableGenerator.cpp b/src/Generating/ComposableGenerator.cpp
index 6c00b5905..2e886336f 100644
--- a/src/Generating/ComposableGenerator.cpp
+++ b/src/Generating/ComposableGenerator.cpp
@@ -21,6 +21,7 @@
#include "DistortedHeightmap.h"
#include "EndGen.h"
#include "MineShafts.h"
+#include "NetherFortGen.h"
#include "Noise3DGenerator.h"
#include "POCPieceGenerator.h"
#include "Ravines.h"
@@ -191,9 +192,11 @@ void cComposableGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ, cChunkDesc & a
m_HeightGen->GenHeightMap(a_ChunkX, a_ChunkZ, a_ChunkDesc.GetHeightMap());
}
+ bool ShouldUpdateHeightmap = false;
if (a_ChunkDesc.IsUsingDefaultComposition())
{
m_CompositionGen->ComposeTerrain(a_ChunkDesc);
+ ShouldUpdateHeightmap = true;
}
if (a_ChunkDesc.IsUsingDefaultFinish())
@@ -202,6 +205,12 @@ void cComposableGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ, cChunkDesc & a
{
(*itr)->GenFinish(a_ChunkDesc);
} // for itr - m_FinishGens[]
+ ShouldUpdateHeightmap = true;
+ }
+
+ if (ShouldUpdateHeightmap)
+ {
+ a_ChunkDesc.UpdateHeightmap();
}
}
@@ -349,7 +358,7 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile)
int ChanceCrossing = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceCrossing", 200);
int ChanceStaircase = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceStaircase", 200);
m_FinishGens.push_back(new cStructGenMineShafts(
- Seed, GridSize, MaxSystemSize,
+ Seed, GridSize, MaxSystemSize,
ChanceCorridor, ChanceCrossing, ChanceStaircase
));
}
@@ -361,6 +370,12 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile)
{
m_FinishGens.push_back(new cFinishGenNetherClumpFoliage(Seed));
}
+ else if (NoCaseCompare(*itr, "NetherForts") == 0)
+ {
+ int GridSize = a_IniFile.GetValueSetI("Generator", "NetherFortsGridSize", 512);
+ int MaxDepth = a_IniFile.GetValueSetI("Generator", "NetherFortsMaxDepth", 12);
+ m_FinishGens.push_back(new cNetherFortGen(Seed, GridSize, MaxDepth));
+ }
else if (NoCaseCompare(*itr, "OreNests") == 0)
{
m_FinishGens.push_back(new cStructGenOreNests(Seed));
diff --git a/src/Generating/HeiGen.cpp b/src/Generating/HeiGen.cpp
index 10710b4a1..3621421c2 100644
--- a/src/Generating/HeiGen.cpp
+++ b/src/Generating/HeiGen.cpp
@@ -428,7 +428,7 @@ void cHeiGenBiomal::GenHeightMap(int a_ChunkX, int a_ChunkZ, cChunkDef::HeightMa
Height[x + 17 * z] = GetHeightAt(x, z, a_ChunkX, a_ChunkZ, Biomes);
}
}
- LinearUpscale2DArrayInPlace(Height, 17, 17, STEPX, STEPZ);
+ LinearUpscale2DArrayInPlace<17, 17, STEPX, STEPZ>(Height);
// Copy into the heightmap
for (int z = 0; z < cChunkDef::Width; z++)
diff --git a/src/Generating/MineShafts.cpp b/src/Generating/MineShafts.cpp
index 28dc37567..231295c3f 100644
--- a/src/Generating/MineShafts.cpp
+++ b/src/Generating/MineShafts.cpp
@@ -1340,7 +1340,7 @@ void cStructGenMineShafts::GetMineShaftSystemsForChunk(
BaseX -= NEIGHBORHOOD_SIZE / 2;
BaseZ -= NEIGHBORHOOD_SIZE / 2;
- // Walk the cache, move each cave system that we want into a_Caves:
+ // Walk the cache, move each cave system that we want into a_Mineshafts:
int StartX = BaseX * m_GridSize;
int EndX = (BaseX + NEIGHBORHOOD_SIZE + 1) * m_GridSize;
int StartZ = BaseZ * m_GridSize;
diff --git a/src/Generating/NetherFortGen.cpp b/src/Generating/NetherFortGen.cpp
new file mode 100644
index 000000000..02779a8a3
--- /dev/null
+++ b/src/Generating/NetherFortGen.cpp
@@ -0,0 +1,275 @@
+
+// NetherFortGen.cpp
+
+// Implements the cNetherFortGen class representing the nether fortress generator
+
+#include "Globals.h"
+#include "NetherFortGen.h"
+#include "Prefabs/NetherFortPrefabs.h"
+
+
+
+
+
+static const int NEIGHBORHOOD_SIZE = 3;
+
+
+
+
+
+///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+// cNetherFortGen::cNetherFort:
+
+class cNetherFortGen::cNetherFort
+{
+public:
+ cNetherFortGen & m_ParentGen;
+ int m_BlockX, m_BlockZ;
+ int m_GridSize;
+ int m_Seed;
+ cPlacedPieces m_Pieces;
+
+
+ cNetherFort(cNetherFortGen & a_ParentGen, int a_BlockX, int a_BlockZ, int a_GridSize, int a_MaxDepth, int a_Seed) :
+ m_ParentGen(a_ParentGen),
+ m_BlockX(a_BlockX),
+ m_BlockZ(a_BlockZ),
+ m_GridSize(a_GridSize),
+ m_Seed(a_Seed)
+ {
+ // TODO: Proper Y-coord placement
+ int BlockY = 64;
+
+ // Generate pieces:
+ for (int i = 0; m_Pieces.size() < (size_t)(a_MaxDepth * a_MaxDepth / 8 + a_MaxDepth); i++)
+ {
+ cBFSPieceGenerator pg(m_ParentGen, a_Seed + i);
+ pg.PlacePieces(a_BlockX, BlockY, a_BlockZ, a_MaxDepth, m_Pieces);
+ }
+ }
+
+
+ ~cNetherFort()
+ {
+ cPieceGenerator::FreePieces(m_Pieces);
+ }
+
+
+ /** Carves the system into the chunk data */
+ void ProcessChunk(cChunkDesc & a_Chunk)
+ {
+ for (cPlacedPieces::const_iterator itr = m_Pieces.begin(), end = m_Pieces.end(); itr != end; ++itr)
+ {
+ const cPrefab & Prefab = (const cPrefab &)((*itr)->GetPiece());
+ Prefab.Draw(a_Chunk, *itr);
+ } // for itr - m_PlacedPieces[]
+ }
+};
+
+
+
+
+
+///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+// cNetherFortGen:
+
+cNetherFortGen::cNetherFortGen(int a_Seed, int a_GridSize, int a_MaxDepth) :
+ m_Seed(a_Seed),
+ m_Noise(a_Seed),
+ m_GridSize(a_GridSize),
+ m_MaxDepth(a_MaxDepth)
+{
+ // Initialize the prefabs:
+ for (size_t i = 0; i < g_NetherFortPrefabs1Count; i++)
+ {
+ cPrefab * Prefab = new cPrefab(g_NetherFortPrefabs1[i]);
+ m_AllPieces.push_back(Prefab);
+ if (Prefab->HasConnectorType(0))
+ {
+ m_OuterPieces.push_back(Prefab);
+ }
+ if (Prefab->HasConnectorType(1))
+ {
+ m_InnerPieces.push_back(Prefab);
+ }
+ }
+
+ // Initialize the starting piece prefabs:
+ for (size_t i = 0; i < g_NetherFortStartingPrefabs1Count; i++)
+ {
+ m_StartingPieces.push_back(new cPrefab(g_NetherFortStartingPrefabs1[i]));
+ }
+
+ // DEBUG: Try one round of placement:
+ cPlacedPieces Pieces;
+ cBFSPieceGenerator pg(*this, a_Seed);
+ pg.PlacePieces(0, 64, 0, a_MaxDepth, Pieces);
+}
+
+
+
+
+
+cNetherFortGen::~cNetherFortGen()
+{
+ ClearCache();
+ for (cPieces::iterator itr = m_AllPieces.begin(), end = m_AllPieces.end(); itr != end; ++itr)
+ {
+ delete *itr;
+ } // for itr - m_AllPieces[]
+ m_AllPieces.clear();
+}
+
+
+
+
+
+void cNetherFortGen::ClearCache(void)
+{
+ // TODO
+}
+
+
+
+
+
+void cNetherFortGen::GetFortsForChunk(int a_ChunkX, int a_ChunkZ, cNetherForts & a_Forts)
+{
+ int BaseX = a_ChunkX * cChunkDef::Width / m_GridSize;
+ int BaseZ = a_ChunkZ * cChunkDef::Width / m_GridSize;
+ if (BaseX < 0)
+ {
+ --BaseX;
+ }
+ if (BaseZ < 0)
+ {
+ --BaseZ;
+ }
+ BaseX -= NEIGHBORHOOD_SIZE / 2;
+ BaseZ -= NEIGHBORHOOD_SIZE / 2;
+
+ // Walk the cache, move each cave system that we want into a_Forts:
+ int StartX = BaseX * m_GridSize;
+ int EndX = (BaseX + NEIGHBORHOOD_SIZE + 1) * m_GridSize;
+ int StartZ = BaseZ * m_GridSize;
+ int EndZ = (BaseZ + NEIGHBORHOOD_SIZE + 1) * m_GridSize;
+ for (cNetherForts::iterator itr = m_Cache.begin(), end = m_Cache.end(); itr != end;)
+ {
+ if (
+ ((*itr)->m_BlockX >= StartX) && ((*itr)->m_BlockX < EndX) &&
+ ((*itr)->m_BlockZ >= StartZ) && ((*itr)->m_BlockZ < EndZ)
+ )
+ {
+ // want
+ a_Forts.push_back(*itr);
+ itr = m_Cache.erase(itr);
+ }
+ else
+ {
+ // don't want
+ ++itr;
+ }
+ } // for itr - m_Cache[]
+
+ // Create those forts that haven't been in the cache:
+ for (int x = 0; x < NEIGHBORHOOD_SIZE; x++)
+ {
+ int RealX = (BaseX + x) * m_GridSize;
+ for (int z = 0; z < NEIGHBORHOOD_SIZE; z++)
+ {
+ int RealZ = (BaseZ + z) * m_GridSize;
+ bool Found = false;
+ for (cNetherForts::const_iterator itr = a_Forts.begin(), end = a_Forts.end(); itr != end; ++itr)
+ {
+ if (((*itr)->m_BlockX == RealX) && ((*itr)->m_BlockZ == RealZ))
+ {
+ Found = true;
+ break;
+ }
+ } // for itr - a_Mineshafts
+ if (!Found)
+ {
+ a_Forts.push_back(new cNetherFort(*this, RealX, RealZ, m_GridSize, m_MaxDepth, m_Seed));
+ }
+ } // for z
+ } // for x
+
+ // Copy a_Forts into m_Cache to the beginning:
+ cNetherForts FortsCopy (a_Forts);
+ m_Cache.splice(m_Cache.begin(), FortsCopy, FortsCopy.begin(), FortsCopy.end());
+
+ // Trim the cache if it's too long:
+ if (m_Cache.size() > 100)
+ {
+ cNetherForts::iterator itr = m_Cache.begin();
+ std::advance(itr, 100);
+ for (cNetherForts::iterator end = m_Cache.end(); itr != end; ++itr)
+ {
+ delete *itr;
+ }
+ itr = m_Cache.begin();
+ std::advance(itr, 100);
+ m_Cache.erase(itr, m_Cache.end());
+ }
+}
+
+
+
+
+
+void cNetherFortGen::GenFinish(cChunkDesc & a_ChunkDesc)
+{
+ int ChunkX = a_ChunkDesc.GetChunkX();
+ int ChunkZ = a_ChunkDesc.GetChunkZ();
+ cNetherForts Forts;
+ GetFortsForChunk(ChunkX, ChunkZ, Forts);
+ for (cNetherForts::const_iterator itr = Forts.begin(); itr != Forts.end(); ++itr)
+ {
+ (*itr)->ProcessChunk(a_ChunkDesc);
+ } // for itr - Forts[]
+}
+
+
+
+
+
+cPieces cNetherFortGen::GetPiecesWithConnector(int a_ConnectorType)
+{
+ switch (a_ConnectorType)
+ {
+ case 0: return m_OuterPieces;
+ case 1: return m_InnerPieces;
+ default: return cPieces();
+ }
+}
+
+
+
+
+
+cPieces cNetherFortGen::GetStartingPieces(void)
+{
+ return m_StartingPieces;
+}
+
+
+
+
+
+void cNetherFortGen::PiecePlaced(const cPiece & a_Piece)
+{
+ UNUSED(a_Piece);
+}
+
+
+
+
+
+void cNetherFortGen::Reset(void)
+{
+ // Nothing needed
+}
+
+
+
+
diff --git a/src/Generating/NetherFortGen.h b/src/Generating/NetherFortGen.h
new file mode 100644
index 000000000..10ba01396
--- /dev/null
+++ b/src/Generating/NetherFortGen.h
@@ -0,0 +1,86 @@
+
+// NetherFortGen.h
+
+// Declares the cNetherFortGen class representing the nether fortress generator
+
+
+
+
+
+#pragma once
+
+#include "ComposableGenerator.h"
+#include "PieceGenerator.h"
+
+
+
+
+
+class cNetherFortGen :
+ public cFinishGen,
+ public cPiecePool
+{
+public:
+ cNetherFortGen(int a_Seed, int a_GridSize, int a_MaxDepth);
+
+ virtual ~cNetherFortGen();
+
+protected:
+ class cNetherFort; // fwd: NetherFortGen.cpp
+ typedef std::list cNetherForts;
+
+
+ /** The seed used for generating*/
+ int m_Seed;
+
+ /** The noise used for generating */
+ cNoise m_Noise;
+
+ /** Average spacing between the fortresses*/
+ int m_GridSize;
+
+ /** Maximum depth of the piece-generator tree */
+ int m_MaxDepth;
+
+ /** Cache of the most recently used systems. MoveToFront used. */
+ cNetherForts m_Cache;
+
+ /** All the pieces that are allowed for building.
+ This is the list that's used for memory allocation and deallocation for the pieces. */
+ cPieces m_AllPieces;
+
+ /** The pieces that are used as starting pieces.
+ This list is not shared and the pieces need deallocation. */
+ cPieces m_StartingPieces;
+
+ /** The pieces that have an "outer" connector.
+ The pieces are copies out of m_AllPieces and shouldn't be ever delete-d. */
+ cPieces m_OuterPieces;
+
+ /** The pieces that have an "inner" connector.
+ The pieces are copies out of m_AllPieces and shouldn't be ever delete-d. */
+ cPieces m_InnerPieces;
+
+
+ /** Clears everything from the cache.
+ Also invalidates the forst returned by GetFortsForChunk(). */
+ void ClearCache(void);
+
+ /** Returns all forts that *may* intersect the given chunk.
+ The returned forts live within m_Cache.They are valid until the next call
+ to this function (which may delete some of the pointers). */
+ void GetFortsForChunk(int a_ChunkX, int a_ChunkZ, cNetherForts & a_Forts);
+
+ // cFinishGen overrides:
+ virtual void GenFinish(cChunkDesc & a_ChunkDesc) override;
+
+ // cPiecePool overrides:
+ virtual cPieces GetPiecesWithConnector(int a_ConnectorType) override;
+ virtual cPieces GetStartingPieces(void) override;
+ virtual void PiecePlaced(const cPiece & a_Piece) override;
+ virtual void Reset(void) override;
+} ;
+
+
+
+
diff --git a/src/Generating/Noise3DGenerator.cpp b/src/Generating/Noise3DGenerator.cpp
index afa40c647..15a588d45 100644
--- a/src/Generating/Noise3DGenerator.cpp
+++ b/src/Generating/Noise3DGenerator.cpp
@@ -420,7 +420,7 @@ void cNoise3DComposable::GenerateNoiseArrayIfNeeded(int a_ChunkX, int a_ChunkZ)
}
}
// Linear-interpolate this XZ floor:
- LinearUpscale2DArrayInPlace(CurFloor, 17, 17, UPSCALE_X, UPSCALE_Z);
+ LinearUpscale2DArrayInPlace<17, 17, UPSCALE_X, UPSCALE_Z>(CurFloor);
}
// Finish the 3D linear interpolation by interpolating between each XZ-floors on the Y axis
diff --git a/src/Generating/Prefab.cpp b/src/Generating/Prefab.cpp
new file mode 100644
index 000000000..131b6acb2
--- /dev/null
+++ b/src/Generating/Prefab.cpp
@@ -0,0 +1,316 @@
+
+// Prefab.cpp
+
+/*
+Implements the cPrefab class, representing a cPiece descendant for the cPieceGenerator that
+uses a prefabricate in a cBlockArea for drawing itself.
+*/
+
+#include "Globals.h"
+#include "Prefab.h"
+#include "../WorldStorage/SchematicFileSerializer.h"
+#include "ChunkDesc.h"
+
+
+
+
+
+#ifdef SELF_TEST
+
+// Create one static prefab to test the parser:
+static const cPrefab::sDef g_TestPrefabDef =
+{
+ // Size:
+ 7, 6, 7, // SizeX = 7, SizeY = 6, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* 0 */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 2
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 3
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 4
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 5
+ "aabbbaa"
+ "a.....a"
+ "b.....b"
+ "b.....b"
+ "b.....b"
+ "a.....a"
+ "aabbbaa"
+
+ // Level 6
+ "aaaaaaa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "aaaaaaa",
+
+ // Connections:
+ "0: 0, 3, 2: 4\n"
+ "0: 2, 3, 0: 2\n",
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msImprint
+};
+
+static cPrefab g_TestPrefab(g_TestPrefabDef);
+#endif
+
+
+
+
+
+cPrefab::cPrefab(const cPrefab::sDef & a_Def) :
+ m_Size(a_Def.m_SizeX, a_Def.m_SizeY, a_Def.m_SizeZ),
+ m_HitBox(0, 0, 0, a_Def.m_SizeX - 1, a_Def.m_SizeY - 1, a_Def.m_SizeZ - 1),
+ m_AllowedRotations(a_Def.m_AllowedRotations),
+ m_MergeStrategy(a_Def.m_MergeStrategy)
+{
+ m_BlockArea[0].Create(m_Size);
+ CharMap cm;
+ ParseCharMap(cm, a_Def.m_CharMap);
+ ParseBlockImage(cm, a_Def.m_Image);
+ ParseConnectors(a_Def.m_Connectors);
+
+ // 1 CCW rotation:
+ if ((m_AllowedRotations & 0x01) != 0)
+ {
+ m_BlockArea[1].CopyFrom(m_BlockArea[0]);
+ m_BlockArea[1].RotateCCW();
+ }
+
+ // 2 rotations are the same as mirroring twice; mirroring is faster because it has no reallocations
+ if ((m_AllowedRotations & 0x02) != 0)
+ {
+ m_BlockArea[2].CopyFrom(m_BlockArea[0]);
+ m_BlockArea[2].MirrorXY();
+ m_BlockArea[2].MirrorYZ();
+ }
+
+ // 3 CCW rotations = 1 CW rotation:
+ if ((m_AllowedRotations & 0x04) != 0)
+ {
+ m_BlockArea[3].CopyFrom(m_BlockArea[0]);
+ m_BlockArea[3].RotateCW();
+ }
+}
+
+
+
+
+
+void cPrefab::Draw(cChunkDesc & a_Dest, const cPlacedPiece * a_Placement) const
+{
+ Vector3i Placement = a_Placement->GetCoords();
+ int ChunkStartX = a_Dest.GetChunkX() * cChunkDef::Width;
+ int ChunkStartZ = a_Dest.GetChunkZ() * cChunkDef::Width;
+ Placement.Move(-ChunkStartX, 0, -ChunkStartZ);
+ a_Dest.WriteBlockArea(m_BlockArea[a_Placement->GetNumCCWRotations()], Placement.x, Placement.y, Placement.z, m_MergeStrategy);
+
+}
+
+
+
+
+
+bool cPrefab::HasConnectorType(int a_ConnectorType) const
+{
+ for (cConnectors::const_iterator itr = m_Connectors.begin(), end = m_Connectors.end(); itr != end; ++itr)
+ {
+ if (itr->m_Type == a_ConnectorType)
+ {
+ return true;
+ }
+ } // for itr - m_Connectors[]
+ return false;
+}
+
+
+
+
+
+void cPrefab::ParseCharMap(CharMap & a_CharMapOut, const char * a_CharMapDef)
+{
+ ASSERT(a_CharMapDef != NULL);
+
+ // Initialize the charmap to all-invalid values:
+ for (size_t i = 0; i < ARRAYCOUNT(a_CharMapOut); i++)
+ {
+ a_CharMapOut[i].m_BlockType = 0;
+ a_CharMapOut[i].m_BlockMeta = 16; // Mark unassigned entries with a meta that is impossible otherwise
+ }
+
+ // Process the lines in the definition:
+ AStringVector Lines = StringSplitAndTrim(a_CharMapDef, "\n");
+ for (AStringVector::const_iterator itr = Lines.begin(), end = Lines.end(); itr != end; ++itr)
+ {
+ AStringVector CharDef = StringSplitAndTrim(*itr, ":");
+ size_t NumElements = CharDef.size();
+ if ((NumElements < 2) || CharDef[0].empty() || CharDef[1].empty())
+ {
+ LOGWARNING("Bad prefab CharMap definition line: \"%s\", skipping.", itr->c_str());
+ continue;
+ }
+ unsigned char Src = (unsigned char)CharDef[0][0];
+ ASSERT(a_CharMapOut[Src].m_BlockMeta == 16); // This letter has not been assigned yet?
+ a_CharMapOut[Src].m_BlockType = (BLOCKTYPE)atoi(CharDef[1].c_str());
+ NIBBLETYPE BlockMeta = 0;
+ if ((NumElements >= 3) && !CharDef[2].empty())
+ {
+ BlockMeta = (NIBBLETYPE)atoi(CharDef[2].c_str());
+ ASSERT((BlockMeta >= 0) && (BlockMeta <= 15));
+ }
+ a_CharMapOut[Src].m_BlockMeta = BlockMeta;
+ } // for itr - Lines[]
+}
+
+
+
+
+
+void cPrefab::ParseBlockImage(const CharMap & a_CharMap, const char * a_BlockImage)
+{
+ // Map each letter in the a_BlockImage (from the in-source definition) to real blocktype / blockmeta:
+ for (int y = 0; y < m_Size.y; y++)
+ {
+ for (int z = 0; z < m_Size.z; z++)
+ {
+ const unsigned char * BlockImage = (const unsigned char *)a_BlockImage + y * m_Size.x * m_Size.z + z * m_Size.x;
+ for (int x = 0; x < m_Size.x; x++)
+ {
+ const sBlockTypeDef & MappedValue = a_CharMap[BlockImage[x]];
+ ASSERT(MappedValue.m_BlockMeta != 16); // Using a letter not defined in the CharMap?
+ m_BlockArea[0].SetRelBlockTypeMeta(x, y, z, MappedValue.m_BlockType, MappedValue.m_BlockMeta);
+ }
+ }
+ }
+}
+
+
+
+
+
+void cPrefab::ParseConnectors(const char * a_ConnectorsDef)
+{
+ ASSERT(a_ConnectorsDef != NULL);
+
+ AStringVector Lines = StringSplitAndTrim(a_ConnectorsDef, "\n");
+ for (AStringVector::const_iterator itr = Lines.begin(), end = Lines.end(); itr != end; ++itr)
+ {
+ if (itr->empty())
+ {
+ continue;
+ }
+ // Split into components: "Type: X, Y, Z: Face":
+ AStringVector Defs = StringSplitAndTrim(*itr, ":");
+ if (Defs.size() != 3)
+ {
+ LOGWARNING("Bad prefab Connector definition line: \"%s\", skipping.", itr->c_str());
+ continue;
+ }
+ AStringVector Coords = StringSplitAndTrim(Defs[1], ",");
+ if (Coords.size() != 3)
+ {
+ LOGWARNING("Bad prefab Connector coords definition: \"%s\", skipping.", Defs[1].c_str());
+ continue;
+ }
+
+ // Check that the BlockFace is within range:
+ int BlockFace = atoi(Defs[2].c_str());
+ if ((BlockFace < 0) || (BlockFace >= 6))
+ {
+ LOGWARNING("Bad prefab Connector Blockface: \"%s\", skipping.", Defs[2].c_str());
+ continue;
+ }
+
+ // Add the connector:
+ m_Connectors.push_back(cPiece::cConnector(
+ atoi(Coords[0].c_str()), atoi(Coords[1].c_str()), atoi(Coords[2].c_str()), // Connector pos
+ atoi(Defs[0].c_str()), // Connector type
+ (eBlockFace)BlockFace
+ ));
+ } // for itr - Lines[]
+}
+
+
+
+
+
+cPiece::cConnectors cPrefab::GetConnectors(void) const
+{
+ return m_Connectors;
+}
+
+
+
+
+
+Vector3i cPrefab::GetSize(void) const
+{
+ return m_Size;
+}
+
+
+
+
+
+cCuboid cPrefab::GetHitBox(void) const
+{
+ return m_HitBox;
+}
+
+
+
+
+
+bool cPrefab::CanRotateCCW(int a_NumRotations) const
+{
+ // Either zero rotations
+ // Or the proper bit in m_AllowedRotations is set
+ return (a_NumRotations == 0) || ((m_AllowedRotations & (1 << ((a_NumRotations + 3) % 4))) != 0);
+}
+
+
+
+
diff --git a/src/Generating/Prefab.h b/src/Generating/Prefab.h
new file mode 100644
index 000000000..04c4f09da
--- /dev/null
+++ b/src/Generating/Prefab.h
@@ -0,0 +1,105 @@
+
+// Prefab.h
+
+/*
+Declares the cPrefab class, representing a cPiece descendant for the cPieceGenerator that
+uses a prefabricate in a cBlockArea for drawing itself.
+The class can be constructed from data that is stored directly in the executable, in a sPrefabDef structure
+declared in this file as well; the Gallery server exports areas in this format.
+*/
+
+
+
+
+
+#pragma once
+
+#include "PieceGenerator.h"
+#include "../BlockArea.h"
+
+
+
+
+
+// fwd:
+class cChunkDesc;
+
+
+
+
+
+class cPrefab :
+ public cPiece
+{
+public:
+ struct sDef
+ {
+ int m_SizeX;
+ int m_SizeY;
+ int m_SizeZ;
+ const char * m_CharMap;
+ const char * m_Image;
+ const char * m_Connectors;
+ int m_AllowedRotations;
+ cBlockArea::eMergeStrategy m_MergeStrategy;
+ };
+
+ cPrefab(const sDef & a_Def);
+
+ /** Draws the prefab into the specified chunk, according to the placement stored in the PlacedPiece. */
+ void Draw(cChunkDesc & a_Dest, const cPlacedPiece * a_Placement) const;
+
+ /** Returns true if the prefab has any connector of the specified type. */
+ bool HasConnectorType(int a_ConnectorType) const;
+
+protected:
+ /** Packs complete definition of a single block, for per-letter assignment. */
+ struct sBlockTypeDef
+ {
+ BLOCKTYPE m_BlockType;
+ NIBBLETYPE m_BlockMeta;
+ };
+
+ /** Maps letters in the sDef::m_Image onto a number, BlockType * 16 | BlockMeta */
+ typedef sBlockTypeDef CharMap[256];
+
+
+ /** The cBlockArea that contains the block definitions for the prefab.
+ The index identifies the number of CCW rotations applied (0 = no rotation, 1 = 1 CCW rotation, ...). */
+ cBlockArea m_BlockArea[4];
+
+ /** The size of the prefab */
+ Vector3i m_Size;
+
+ /** The hitbox of the prefab. In first version is the same as the m_BlockArea dimensions */
+ cCuboid m_HitBox;
+
+ /** The connectors through which the piece connects to other pieces */
+ cConnectors m_Connectors;
+
+ /** Bitmask, bit N set -> N rotations CCW supported */
+ int m_AllowedRotations;
+
+ /** The merge strategy to use when drawing the prefab into a block area */
+ cBlockArea::eMergeStrategy m_MergeStrategy;
+
+
+ // cPiece overrides:
+ virtual cConnectors GetConnectors(void) const override;
+ virtual Vector3i GetSize(void) const override;
+ virtual cCuboid GetHitBox(void) const override;
+ virtual bool CanRotateCCW(int a_NumRotations) const override;
+
+ /** Parses the CharMap in the definition into a CharMap binary data used for translating the definition into BlockArea. */
+ void ParseCharMap(CharMap & a_CharMapOut, const char * a_CharMapDef);
+
+ /** Parses the Image in the definition into m_BlockArea[0]'s block types and metas, using the specified CharMap. */
+ void ParseBlockImage(const CharMap & a_CharMap, const char * a_BlockImage);
+
+ /** Parses the connectors definition text into m_Connectors member. */
+ void ParseConnectors(const char * a_ConnectorsDef);
+};
+
+
+
+
diff --git a/src/Generating/Prefabs/CMakeLists.txt b/src/Generating/Prefabs/CMakeLists.txt
new file mode 100644
index 000000000..1e60447e7
--- /dev/null
+++ b/src/Generating/Prefabs/CMakeLists.txt
@@ -0,0 +1,13 @@
+
+cmake_minimum_required (VERSION 2.6)
+project (MCServer)
+
+include_directories ("${PROJECT_SOURCE_DIR}/../../")
+
+file(GLOB SOURCE
+ "*.cpp"
+)
+
+add_library(Generating_Prefabs ${SOURCE})
+
+target_link_libraries(Generating_Prefabs OSSupport iniFile Blocks)
diff --git a/src/Generating/Prefabs/NetherFortPrefabs.cpp b/src/Generating/Prefabs/NetherFortPrefabs.cpp
new file mode 100644
index 000000000..5e8685e32
--- /dev/null
+++ b/src/Generating/Prefabs/NetherFortPrefabs.cpp
@@ -0,0 +1,2758 @@
+
+// NetherFortPrefabs.cpp
+
+// Defines all the prefabs for nether forts
+
+#include "Globals.h"
+#include "NetherFortPrefabs.h"
+
+
+
+
+
+/*
+The nether fortress has two types of connectors, Outer and Inner. Outer is Type 0, Inner is Type 1.
+*/
+
+
+
+
+
+const cPrefab::sDef g_NetherFortPrefabs1[] =
+{
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BalconyCorridor:
+ // The data has been exported from gallery Nether, area index 37, ID 288
+ {
+ // Size:
+ 13, 7, 9, // SizeX = 13, SizeY = 7, SizeZ = 9
+
+ // Block definitions:
+ "a:112: 0\n" /* netherbrick */
+ "b: 19: 0\n" /* sponge */
+ "c:114: 4\n" /* netherbrickstairs */
+ "d:114: 7\n" /* netherbrickstairs */
+ "e:114: 5\n" /* netherbrickstairs */
+ "f: 44: 6\n" /* step */
+ "g:113: 0\n" /* netherbrickfence */
+ "h:114: 2\n" /* netherbrickstairs */
+ "i:114: 3\n" /* netherbrickstairs */
+ "j:114: 0\n" /* netherbrickstairs */
+ "k:114: 1\n" /* netherbrickstairs */
+ ".: 0: 0\n" /* air */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "bbbbaaaaabbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+
+ // Level 2
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaa.aaa.aaaa"
+ "bbcdaaaaadebb"
+ "bbbcdddddebbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+
+ // Level 3
+ "aaaaaaaaaaaaa"
+ "............."
+ "............."
+ "............."
+ "aaaa.fff.aaaa"
+ "bbaaaaaaaaabb"
+ "bbaaaaaaaaabb"
+ "bbaaaaaaaaabb"
+ "bbaaaaaaaaabb"
+
+ // Level 4
+ "agagagagagaga"
+ "............."
+ "............."
+ "............."
+ "agaa.....aaga"
+ "bbaaa...aaabb"
+ "bbg.......gbb"
+ "bbg.......gbb"
+ "bbgggggggggbb"
+
+ // Level 5
+ "agagagagagaga"
+ "............."
+ "............."
+ "............."
+ "agaa.....aaga"
+ "bbaaa...aaabb"
+ "bb.........bb"
+ "bb.........bb"
+ "bb.........bb"
+
+ // Level 6
+ "agagagagagaga"
+ "............."
+ "............."
+ "............."
+ "agaa.....aaga"
+ "bbaaa...aaabb"
+ "bb.........bb"
+ "bb.........bb"
+ "bb.........bb"
+
+ // Level 7
+ "hhhhhhhhhhhhh"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "iijaaaaaaaiii"
+ "bbjiiiiiiikbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb",
+
+ // Connections:
+ "1: 0, 2, 2: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 12, 2, 2: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BalconyCorridor
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BalconyTee2:
+ // The data has been exported from gallery Nether, area index 38, ID 289
+ {
+ // Size:
+ 13, 7, 11, // SizeX = 13, SizeY = 7, SizeZ = 11
+
+ // Block definitions:
+ "a: 19: 0\n" /* sponge */
+ "b:112: 0\n" /* netherbrick */
+ "c:114: 4\n" /* netherbrickstairs */
+ "d:114: 7\n" /* netherbrickstairs */
+ "e:114: 5\n" /* netherbrickstairs */
+ "f: 44: 6\n" /* step */
+ "g:113: 0\n" /* netherbrickfence */
+ "h:114: 0\n" /* netherbrickstairs */
+ "i:114: 1\n" /* netherbrickstairs */
+ "j:114: 2\n" /* netherbrickstairs */
+ "k:114: 3\n" /* netherbrickstairs */
+ ".: 0: 0\n" /* air */,
+
+ // Block data:
+ // Level 1
+ "aaaabbbbbaaaa"
+ "aaaabbbbbaaaa"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "aaaabbbbbaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "aaaabbbbbaaaa"
+ "aaaabbbbbaaaa"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbb.bbb.bbbb"
+ "aacdbbbbbdeaa"
+ "aaacdddddeaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 3
+ "aaaab...baaaa"
+ "aaaab...baaaa"
+ "bbbbb...bbbbb"
+ "............."
+ "............."
+ "............."
+ "bbbb.fff.bbbb"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+
+ // Level 4
+ "aaaab...baaaa"
+ "aaaag...gaaaa"
+ "bgbgb...bgbgb"
+ "............."
+ "............."
+ "............."
+ "bgbb.....bbgb"
+ "aabbb...bbbaa"
+ "aag.......gaa"
+ "aag.......gaa"
+ "aagggggggggaa"
+
+ // Level 5
+ "aaaab...baaaa"
+ "aaaag...gaaaa"
+ "bgbgb...bgbgb"
+ "............."
+ "............."
+ "............."
+ "bgbb.....bbgb"
+ "aabbb...bbbaa"
+ "aa.........aa"
+ "aa.........aa"
+ "aa.........aa"
+
+ // Level 6
+ "aaaab...baaaa"
+ "aaaag...gaaaa"
+ "bgbgb...bgbgb"
+ "............."
+ "............."
+ "............."
+ "bgbb.....bbgb"
+ "aabbb...bbbaa"
+ "aa.........aa"
+ "aa.........aa"
+ "aa.........aa"
+
+ // Level 7
+ "aaaahbbbiaaaa"
+ "aaaahbbbiaaaa"
+ "jjjjjbbbjjjjj"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "kkhbbbbbbbkkk"
+ "aahkkkkkkkiaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa",
+
+ // Connections:
+ "1: 0, 2, 4: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 12, 2, 4: 5\n" /* Type 1, BLOCK_FACE_XP */
+ "1: 6, 2, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BalconyTee2
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BlazePlatform
+ // The data has been exported from gallery Nether, area index 26, ID 276
+ {
+ // Size:
+ 10, 7, 7, // SizeX = 10, SizeY = 7, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b: 52: 0\n" /* mobspawner */
+ "c:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ ".........."
+ "aaaaaaaaaa"
+ "aaaaaaaaaa"
+ "aaaaaaaaaa"
+ "aaaaaaaaaa"
+ "aaaaaaaaaa"
+ ".........."
+
+ // Level 2
+ ".........."
+ "aaaaaaaaaa"
+ "..aaaaaaaa"
+ "..aaaaaaaa"
+ "..aaaaaaaa"
+ "aaaaaaaaaa"
+ ".........."
+
+ // Level 3
+ "....aaaaaa"
+ "aaaaaaaaaa"
+ "...aaaaaaa"
+ "...aaaaaaa"
+ "...aaaaaaa"
+ "aaaaaaaaaa"
+ "....aaaaaa"
+
+ // Level 4
+ "....aaaaaa"
+ "..aaa....a"
+ ".........a"
+ "......b..a"
+ ".........a"
+ "..aaa....a"
+ "....aaaaaa"
+
+ // Level 5
+ "....cccccc"
+ "...cc....c"
+ ".........c"
+ ".........c"
+ ".........c"
+ "...cc....c"
+ "....cccccc"
+
+ // Level 6
+ ".........."
+ ".........c"
+ ".........c"
+ ".........c"
+ ".........c"
+ ".........c"
+ ".........."
+
+ // Level 7
+ ".........."
+ ".........."
+ ".........c"
+ ".........c"
+ ".........c"
+ ".........."
+ "..........",
+
+ // Connections:
+ "0: 0, 1, 3: 4\n" /* Type 0, BLOCK_FACE_XM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BlazePlatform
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BlazePlatformOverhang:
+ // The data has been exported from gallery Nether, area index 20, ID 162
+ {
+ // Size:
+ 14, 9, 7, // SizeX = 14, SizeY = 9, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 5\n" /* netherbrickstairs */
+ "c: 44:14\n" /* step */
+ "d:114: 6\n" /* netherbrickstairs */
+ "e:114: 7\n" /* netherbrickstairs */
+ "f:114: 0\n" /* netherbrickstairs */
+ "g:114: 4\n" /* netherbrickstairs */
+ "h:113: 0\n" /* netherbrickfence */
+ "i: 52: 0\n" /* mobspawner */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "aammmmmmmmmmmm"
+ "aammmmmmmmmmmm"
+ "aammmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 2
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "aabcmmmmmmmmmm"
+ "aabcmmmmmmmmmm"
+ "aabcmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 3
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "aaaaabmmmmmmmm"
+ "aaaaabmmmmmmmm"
+ "aaaaabmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 4
+ "mmmmmmmmmmmmmm"
+ "dddddddmmmmmmm"
+ "aaaaaabmmmmmmm"
+ "aaaaaabmmmmmmm"
+ "aaaaaabmmmmmmm"
+ "eeeeeeemmmmmmm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 5
+ "mmmmmmmmmmmmmm"
+ "aaaaaaadmmmmmm"
+ "aaaaaaabmmmmmm"
+ "aaaaaaabmmmmmm"
+ "aaaaaaabmmmmmm"
+ "aaaaaaaemmmmmm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 6
+ "mmmmmmmmmmmmmm"
+ "aaaaaaaabddddm"
+ "......faaaaabm"
+ "......faaaaabm"
+ "......faaaaabm"
+ "aaaaaaaaabeebm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 7
+ "mmmmmmmmgdddbm"
+ "......aaaaaaad"
+ ".......faaaaab"
+ ".......faaaaab"
+ ".......faaaaab"
+ "......aaaaaaae"
+ "mmmmmmmmgeeebm"
+
+ // Level 8
+ "mmmmmmmmaaaaam"
+ "......haa...aa"
+ ".............a"
+ "..........i..a"
+ ".............a"
+ "......haa...aa"
+ "mmmmmmmmaaaaam"
+
+ // Level 9
+ "mmmmmmmmhhhhhm"
+ "......hhh...hh"
+ ".............h"
+ ".............h"
+ ".............h"
+ "......hhh...hh"
+ "mmmmmmmmhhhhhm",
+
+ // Connections:
+ "0: 0, 5, 3: 4\n" /* Type 0, BLOCK_FACE_XM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BlazePlatformOverhang
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BridgeCrossing:
+ // The data has been exported from gallery Nether, area index 17, ID 159
+ {
+ // Size:
+ 15, 8, 15, // SizeX = 15, SizeY = 8, SizeZ = 15
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 7\n" /* netherbrickstairs */
+ "c:114: 5\n" /* netherbrickstairs */
+ "d:114: 4\n" /* netherbrickstairs */
+ "e:114: 6\n" /* netherbrickstairs */
+ "f: 44:14\n" /* step */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 2
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmbbbmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "aacmmmmmmmmmdaa"
+ "aacmmmmmmmmmdaa"
+ "aacmmmmmmmmmdaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmeeemmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 3
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmbbbmmmmmm"
+ "mmmmmmfffmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "aaacfmmmmmfdaaa"
+ "aaacfmmmmmfdaaa"
+ "aaacfmmmmmfdaaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmfffmmmmmm"
+ "mmmmmmeeemmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 4
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "eeeeeeaaaeeeeee"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "bbbbbdaaacbbbbb"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+
+ // Level 5
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+
+ // Level 6
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "aaaaaa...aaaaaa"
+ "..............."
+ "..............."
+ "..............."
+ "aaaaaa...aaaaaa"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+
+ // Level 7
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+
+ // Level 8
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm",
+
+ // Connections:
+ "0: 0, 5, 7: 4\n" /* Type 0, BLOCK_FACE_XM */
+ "0: 7, 5, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "0: 14, 5, 7: 5\n" /* Type 0, BLOCK_FACE_XP */
+ "0: 7, 5, 14: 3\n" /* Type 0, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BridgeCrossing
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BridgeCrumble1:
+ // The data has been exported from gallery Nether, area index 19, ID 161
+ {
+ // Size:
+ 9, 6, 5, // SizeX = 9, SizeY = 6, SizeZ = 5
+
+ // Block definitions:
+ ".: 19: 0\n" /* sponge */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 5\n" /* netherbrickstairs */
+ "c: 44:14\n" /* step */
+ "d:114: 6\n" /* netherbrickstairs */
+ "e:114: 7\n" /* netherbrickstairs */,
+
+ // Block data:
+ // Level 1
+ "........."
+ "aa......."
+ "aa......."
+ "aa......."
+ "........."
+
+ // Level 2
+ "........."
+ "aab......"
+ "aab......"
+ "aab......"
+ "........."
+
+ // Level 3
+ "........."
+ "aaabc...."
+ "aaabc...."
+ "aaabc...."
+ "........."
+
+ // Level 4
+ "ddddddd.."
+ "aaaaaaaa."
+ "aaaaaaaaa"
+ "aaaaaaa.."
+ "eeeee...."
+
+ // Level 5
+ "aaaaaaaaa"
+ "aaaaa...."
+ "aaaaaa..."
+ "aaaaaa..."
+ "aaaaaaaa."
+
+ // Level 6
+ "aaaaaa..."
+ "........."
+ "........."
+ "........."
+ "aaaaaaa..",
+
+ // Connections:
+ "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BridgeCrumble1
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BridgeCrumble2
+ // The data has been exported from gallery Nether, area index 18, ID 160
+ {
+ // Size:
+ 13, 6, 5, // SizeX = 13, SizeY = 6, SizeZ = 5
+
+ // Block definitions:
+ ".: 19: 0\n" /* sponge */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 5\n" /* netherbrickstairs */
+ "c: 44:14\n" /* step */
+ "d:114: 6\n" /* netherbrickstairs */
+ "e:114: 7\n" /* netherbrickstairs */,
+
+ // Block data:
+ // Level 1
+ "............."
+ "aa..........."
+ "aa..........."
+ "aa..........."
+ "............."
+
+ // Level 2
+ "............."
+ "aab.........."
+ "aab.........."
+ "aab.........."
+ "............."
+
+ // Level 3
+ "............."
+ "aaabc........"
+ "aaabc........"
+ "aaabc........"
+ "............."
+
+ // Level 4
+ "ddddddddd...."
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaa...."
+ "aaaaaaaaaaaa."
+ "eeeeeeeee...."
+
+ // Level 5
+ "aaaaaaaaaaaa."
+ "aaaaaaaaaa..."
+ "aaaaaaaaaaa.."
+ "aaaaaaaaa...."
+ "aaaaaaaaaaaaa"
+
+ // Level 6
+ "aaaaaaaaa...."
+ "............."
+ "............."
+ "............."
+ "aaaaaaaaaa...",
+
+ // Connections:
+ "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BridgeCrumble2
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BridgeSegment:
+ // The data has been exported from gallery Nether, area index 16, ID 158
+ {
+ // Size:
+ 15, 8, 5, // SizeX = 15, SizeY = 8, SizeZ = 5
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 5\n" /* netherbrickstairs */
+ "c:114: 4\n" /* netherbrickstairs */
+ "d: 44:14\n" /* step */
+ "e:114: 6\n" /* netherbrickstairs */
+ "f:114: 7\n" /* netherbrickstairs */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmmmmmmmmmmmm"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "mmmmmmmmmmmmmmm"
+
+ // Level 2
+ "mmmmmmmmmmmmmmm"
+ "aabmmmmmmmmmcaa"
+ "aabmmmmmmmmmcaa"
+ "aabmmmmmmmmmcaa"
+ "mmmmmmmmmmmmmmm"
+
+ // Level 3
+ "mmmmmmmmmmmmmmm"
+ "aaabdmmmmmdcaaa"
+ "aaabdmmmmmdcaaa"
+ "aaabdmmmmmdcaaa"
+ "mmmmmmmmmmmmmmm"
+
+ // Level 4
+ "eeeeeeeeeeeeeee"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "fffffffffffffff"
+
+ // Level 5
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+
+ // Level 6
+ "aaaaaaaaaaaaaaa"
+ "..............."
+ "..............."
+ "..............."
+ "aaaaaaaaaaaaaaa"
+
+ // Level 7
+ "mmmmmmmmmmmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmmmmmmmmmmm"
+
+ // Level 8
+ "mmmmmmmmmmmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmmmmmmmmmmm",
+
+ // Connections:
+ "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */
+ "0: 14, 5, 2: 5\n" /* Type 0, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BridgeSegment
+
+
+ // BridgeTee:
+ // The data has been exported from gallery Nether, area index 39, ID 290
+ {
+ // Size:
+ 15, 8, 10, // SizeX = 15, SizeY = 8, SizeZ = 10
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 5\n" /* netherbrickstairs */
+ "c:114: 4\n" /* netherbrickstairs */
+ "d:114: 6\n" /* netherbrickstairs */
+ "e: 44:14\n" /* step */
+ "f:114: 7\n" /* netherbrickstairs */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmmmmmmmmmmmm"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 2
+ "mmmmmmmmmmmmmmm"
+ "aabmmmmmmmmmcaa"
+ "aabmmmmmmmmmcaa"
+ "aabmmmmmmmmmcaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmdddmmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 3
+ "mmmmmmmmmmmmmmm"
+ "aaabemmmmmecaaa"
+ "aaabemmmmmecaaa"
+ "aaabemmmmmecaaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmeeemmmmmm"
+ "mmmmmmdddmmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 4
+ "ddddddddddddddd"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "fffffcaaabfffff"
+ "mmmmmcaaabmmmmm"
+ "mmmmmcaaabmmmmm"
+ "mmmmmcaaabmmmmm"
+ "mmmmmcaaabmmmmm"
+ "mmmmmcaaabmmmmm"
+
+ // Level 5
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+
+ // Level 6
+ "aaaaaaaaaaaaaaa"
+ "..............."
+ "..............."
+ "..............."
+ "aaaaaa...aaaaaa"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+
+ // Level 7
+ "mmmmmmmmmmmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+
+ // Level 8
+ "mmmmmmmmmmmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm",
+
+ // Connections:
+ "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */
+ "0: 14, 5, 2: 5\n" /* Type 0, BLOCK_FACE_XP */
+ "0: 7, 5, 9: 3\n" /* Type 0, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BridgeTee
+
+
+ // Corridor11:
+ // The data has been exported from gallery Nether, area index 36, ID 287
+ {
+ // Size:
+ 11, 6, 5, // SizeX = 11, SizeY = 6, SizeZ = 5
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c:114: 2\n" /* netherbrickstairs */
+ "d:114: 3\n" /* netherbrickstairs */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaaaaa"
+ "..........."
+ "..........."
+ "..........."
+ "aaaaaaaaaaa"
+
+ // Level 3
+ "abababababa"
+ "..........."
+ "..........."
+ "..........."
+ "abababababa"
+
+ // Level 4
+ "abababababa"
+ "..........."
+ "..........."
+ "..........."
+ "abababababa"
+
+ // Level 5
+ "abababababa"
+ "..........."
+ "..........."
+ "..........."
+ "abababababa"
+
+ // Level 6
+ "ccccccccccc"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "ddddddddddd",
+
+ // Connections:
+ "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // Corridor11
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // Corridor13:
+ // The data has been exported from gallery Nether, area index 35, ID 286
+ {
+ // Size:
+ 13, 6, 5, // SizeX = 13, SizeY = 6, SizeZ = 5
+
+ // Block definitions:
+ "a:112: 0\n" /* netherbrick */
+ ".: 0: 0\n" /* air */
+ "c:113: 0\n" /* netherbrickfence */
+ "d:114: 2\n" /* netherbrickstairs */
+ "e:114: 3\n" /* netherbrickstairs */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaaaaaaa"
+ "............."
+ "............."
+ "............."
+ "aaaaaaaaaaaaa"
+
+ // Level 3
+ "acacacacacaca"
+ "............."
+ "............."
+ "............."
+ "acacacacacaca"
+
+ // Level 4
+ "acacacacacaca"
+ "............."
+ "............."
+ "............."
+ "acacacacacaca"
+
+ // Level 5
+ "acacacacacaca"
+ "............."
+ "............."
+ "............."
+ "acacacacacaca"
+
+ // Level 6
+ "ddddddddddddd"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "eeeeeeeeeeeee",
+
+ // Connections:
+ "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 12, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // Corridor13
+
+
+ // CorridorCorner5:
+ // The data has been exported from gallery Nether, area index 10, ID 40
+ {
+ // Size:
+ 11, 6, 11, // SizeX = 11, SizeY = 6, SizeZ = 11
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c:114: 2\n" /* netherbrickstairs */
+ "d:114: 0\n" /* netherbrickstairs */
+ "e:114: 3\n" /* netherbrickstairs */
+ "f:114: 1\n" /* netherbrickstairs */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+
+ // Level 2
+ "aaaaaaaaaaa"
+ "a.........."
+ "a.........."
+ "a.........."
+ "a...aaaaaaa"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+
+ // Level 3
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 4
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 5
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 6
+ "ccccccccccc"
+ "daaaaaaaaaa"
+ "daaaaaaaaaa"
+ "daaaaaaaaaa"
+ "daaaeeeeeee"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm",
+
+ // Connections:
+ "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */
+ "1: 2, 1, 10: 3\n" /* Type 1, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // CorridorCorner5
+
+
+ // CorridorCorner5:
+ // The data has been exported from gallery Nether, area index 10, ID 40
+ {
+ // Size:
+ 11, 6, 11, // SizeX = 11, SizeY = 6, SizeZ = 11
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c:114: 2\n" /* netherbrickstairs */
+ "d:114: 0\n" /* netherbrickstairs */
+ "e:114: 3\n" /* netherbrickstairs */
+ "f:114: 1\n" /* netherbrickstairs */
+ "g: 54: 5\n" /* chest */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+
+ // Level 2
+ "aaaaaaaaaaa"
+ "ag........."
+ "a.........."
+ "a.........."
+ "a...aaaaaaa"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+
+ // Level 3
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 4
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 5
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 6
+ "ccccccccccc"
+ "daaaaaaaaaa"
+ "daaaaaaaaaa"
+ "daaaaaaaaaa"
+ "daaaeeeeeee"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm",
+
+ // Connections:
+ "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */
+ "1: 2, 1, 10: 3\n" /* Type 1, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // CorridorCorner5Chest
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // CorridorStairs:
+ // The data has been exported from gallery Nether, area index 12, ID 42
+ {
+ // Size:
+ 9, 13, 5, // SizeX = 9, SizeY = 13, SizeZ = 5
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 0\n" /* netherbrickstairs */
+ "c:113: 0\n" /* netherbrickfence */
+ "d:114: 2\n" /* netherbrickstairs */
+ "e:114: 3\n" /* netherbrickstairs */
+ "f: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaa"
+ "aaaaaaaaa"
+ "aaaaaaaaa"
+ "aaaaaaaaa"
+ "aaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaaa"
+ ".baaaaaaa"
+ ".baaaaaaa"
+ ".baaaaaaa"
+ "aaaaaaaaa"
+
+ // Level 3
+ "acaaaaaaa"
+ "..baaaaaa"
+ "..baaaaaa"
+ "..baaaaaa"
+ "acaaaaaaa"
+
+ // Level 4
+ "acaaaaaaa"
+ "...baaaaa"
+ "...baaaaa"
+ "...baaaaa"
+ "acaaaaaaa"
+
+ // Level 5
+ "acacaaaaa"
+ "....baaaa"
+ "....baaaa"
+ "....baaaa"
+ "acacaaaaa"
+
+ // Level 6
+ "aaacaaaaa"
+ ".....baaa"
+ ".....baaa"
+ ".....baaa"
+ "aaacaaaaa"
+
+ // Level 7
+ "daacacaaa"
+ "a.....baa"
+ "a.....baa"
+ "a.....baa"
+ "eaacacaaa"
+
+ // Level 8
+ "fdaaacaaa"
+ "fa.....ba"
+ "fa.....ba"
+ "fa.....ba"
+ "feaaacaaa"
+
+ // Level 9
+ "ffdaacaca"
+ "ffa......"
+ "ffa......"
+ "ffa......"
+ "ffeaacaca"
+
+ // Level 10
+ "fffdaaaca"
+ "fffa....."
+ "fffa....."
+ "fffa....."
+ "fffeaaaca"
+
+ // Level 11
+ "ffffdaaca"
+ "ffffa...."
+ "ffffa...."
+ "ffffa...."
+ "ffffeaaca"
+
+ // Level 12
+ "fffffdaaa"
+ "fffffa..."
+ "fffffa..."
+ "fffffa..."
+ "fffffeaaa"
+
+ // Level 13
+ "ffffffddd"
+ "ffffffaaa"
+ "ffffffaaa"
+ "ffffffaaa"
+ "ffffffeee",
+
+ // Connections:
+ "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 8, 8, 2: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // CorridorStairs
+
+
+ // LavaStaircase:
+ // The data has been exported from gallery Nether, area index 28, ID 278
+ {
+ // Size:
+ 15, 11, 15, // SizeX = 15, SizeY = 11, SizeZ = 15
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c: 11: 0\n" /* lava */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaa...aaaa"
+ "aaaaa.........a"
+ "aaaaa.........a"
+ "aaaaab........a"
+ "accca...aaaa..a"
+ "accca...acca..a"
+ "acccaaaaacca..a"
+ "acccccccccca..a"
+ "acccaaaaacca..a"
+ "accca...acca..a"
+ "accca...aaaa..a"
+ "aaaaab........a"
+ "aaaaa.........a"
+ "aaaaa.........a"
+ "aaaaaaaa...aaaa"
+
+ // Level 3
+ "aaaaaaaa...aaaa"
+ "aaaa..........a"
+ "aaaa..........a"
+ "aaaabb........a"
+ "aaaa..........a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "aaaa..........a"
+ "aaaabb........a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "aaaaaaaa...aaaa"
+
+ // Level 4
+ "aaaaaaaa...aaaa"
+ "a.............a"
+ "a.............a"
+ "a..bb.........a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "a..bb.........a"
+ "a.............a"
+ "a.............a"
+ "aaaaaaaa...aaaa"
+
+ // Level 5
+ "aaaaaaaabbbaaaa"
+ "a.............a"
+ "a.............a"
+ "a..b..........a"
+ "a..b..........a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "a.............a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "a..b..........a"
+ "a..b..........a"
+ "a.............a"
+ "a.............a"
+ "aaaaaaaabbbaaaa"
+
+ // Level 6
+ "aaaaaaaaaaaaaaa"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a..b..........a"
+ "a..b..........a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "a..b..........a"
+ "a..b..........a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "aaaaaaaaaaaaaaa"
+
+ // Level 7
+ "aaaaaaaaaaaaaaa"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a..b..........a"
+ "...b..........a"
+ "...b..........a"
+ "...b..........a"
+ "a..b..........a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "aaaaaaaaaaaaaaa"
+
+ // Level 8
+ "aababababababaa"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "..............b"
+ "..............a"
+ "..............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "aababababababaa"
+
+ // Level 9
+ "aababababababaa"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "..............b"
+ "..............a"
+ "..............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "aababababababaa"
+
+ // Level 10
+ "aababababababaa"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "..............b"
+ "..............a"
+ "..............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "aababababababaa"
+
+ // Level 11
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa",
+
+ // Connections:
+ "1: 0, 6, 7: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "0: 9, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "0: 9, 1, 14: 3\n" /* Type 0, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // LavaStaircase
+
+
+ // LavaStaircaseBig:
+ // The data has been exported from gallery Nether, area index 31, ID 282
+ {
+ // Size:
+ 12, 15, 15, // SizeX = 12, SizeY = 15, SizeZ = 15
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b: 10: 0\n" /* lava */
+ "c:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "abbbbbaaaaaa"
+ "abbbbbbaaaaa"
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbbaaaaa"
+ "abbbbb.aaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+
+ // Level 3
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "abbbbbaaaaaa"
+ "abbbbbba...a"
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbba...a"
+ "abbbbb.aaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+
+ // Level 4
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "abbbbbaa...a"
+ "abbbbbba...a"
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbba...a"
+ "abbbbbaa...a"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+
+ // Level 5
+ "aaaaaaaaaaaa"
+ "aaaaa......a"
+ "aaaaa......a"
+ "aaaaacc....a"
+ "a.....cc...a"
+ "a......c...a"
+ "a......c...."
+ "a......c...."
+ "a......c...."
+ "a......c...a"
+ "a.....cc...a"
+ "aaaaacc....a"
+ "aaaaa......a"
+ "aaaaa......a"
+ "aaaaaaaaaaaa"
+
+ // Level 6
+ "aaaaaaaaaaaa"
+ "aaaa.......a"
+ "aaaa.......a"
+ "aaaacc.....a"
+ "aaaa.......a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaa.......a"
+ "aaaacc.....a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "aaaaaaaaaaaa"
+
+ // Level 7
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..cc......a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "a..cc......a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 8
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..c.......a"
+ "a..c.......a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "a..........a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "a..c.......a"
+ "a..c.......a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 9
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..c.......a"
+ "a..c.......a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "a..c.......a"
+ "a..c.......a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 10
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..c.......a"
+ "...c.......a"
+ "...c.......a"
+ "...c.......a"
+ "a..c.......a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 11
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "...........a"
+ "...........a"
+ "...........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 12
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "...........a"
+ "...........a"
+ "...........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 13
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "...........a"
+ "...........a"
+ "...........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 14
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+
+ // Level 15
+ "aaaaaaaaaaaa"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "aaaaaaaaaaaa",
+
+ // Connections:
+ "1: 0, 9, 7: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 11, 1, 7: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // LavaStaircaseBig
+
+
+ // MidStaircase:
+ // The data has been exported from gallery Nether, area index 23, ID 165
+ {
+ // Size:
+ 13, 8, 13, // SizeX = 13, SizeY = 8, SizeZ = 13
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b: 88: 0\n" /* soulsand */
+ "c:115: 7\n" /* netherwartblock */
+ "d:114: 3\n" /* netherbrickstairs */
+ "e:114: 0\n" /* netherbrickstairs */
+ "f:114: 1\n" /* netherbrickstairs */
+ "g:114: 2\n" /* netherbrickstairs */
+ "h: 10: 0\n" /* lava */
+ "i:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaabbbbbaaaa"
+ "aaaabbbbbaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaabbbbbaaaa"
+ "aaaabbbbbaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaacccccaaaa"
+ "addecccccfdda"
+ "...eaaaaad..."
+ "...eaaaaa...."
+ "...eaaaaag..."
+ "agggcccccfgga"
+ "aaaacccccaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 3
+ "aaaaaaaaaaaaa"
+ "aha.......aha"
+ "aaa.......aaa"
+ "a...........a"
+ "a...........a"
+ "....eaaaa...."
+ "....eaaaa...."
+ "....eaaaa...."
+ "a...........a"
+ "a...........a"
+ "aaa.......aaa"
+ "aha.......aha"
+ "aaaaaaaaaaaaa"
+
+ // Level 4
+ "aaaiiaaaiiaaa"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ ".....eaaa...."
+ ".....eaaa...."
+ ".....eaaa...."
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "aaaiiaaaiiaaa"
+
+ // Level 5
+ "aaaiiaaaiiaaa"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "......eaa...."
+ "......eaa...."
+ "......eaa...."
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "aaaiiaaaiiaaa"
+
+ // Level 6
+ "aaaaaaaaaaaaa"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a......ea...a"
+ "a......ea...a"
+ "a......ea...a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "aaaaaaaaaaaaa"
+
+ // Level 7
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaa....eaaaa"
+ "aaaa....eaaaa"
+ "aaaa....eaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 8
+ "iaiaiaiaiaiai"
+ "a...........a"
+ "i...........i"
+ "a...........a"
+ "i...........i"
+ "a............"
+ "i............"
+ "a............"
+ "i...........i"
+ "a...........a"
+ "i...........i"
+ "a...........a"
+ "iaiaiaiaiaiai",
+
+ // Connections:
+ "1: 0, 1, 6: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 12, 1, 6: 5\n" /* Type 1, BLOCK_FACE_XP */
+ "1: 12, 7, 6: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // MidStaircase
+
+
+ // StairsToOpen1:
+ // The data has been exported from gallery Nether, area index 27, ID 277
+ {
+ // Size:
+ 7, 10, 7, // SizeX = 7, SizeY = 10, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 2
+ "aa...aa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 3
+ "aa...aa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a.aaaaa"
+ "aabaaba"
+
+ // Level 4
+ "aa...aa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a..aaaa"
+ "aabaaba"
+
+ // Level 5
+ "aabbbaa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a...aaa"
+ "aabaaba"
+
+ // Level 6
+ "aaaaaaa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a....aa"
+ "aaaaaaa"
+
+ // Level 7
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "a.....a"
+ "aaaaaaa"
+
+ // Level 8
+ "aaaaaaa"
+ "a.....a"
+ "a......"
+ "a......"
+ "a......"
+ "a.....a"
+ "aaaaaaa"
+
+ // Level 9
+ "mmmmmmm"
+ "m.....m"
+ "m......"
+ "m......"
+ "m......"
+ "m.....m"
+ "mmmmmmm"
+
+ // Level 10
+ "mmmmmmm"
+ "m.....m"
+ "m......"
+ "m......"
+ "m......"
+ "m.....m"
+ "mmmmmmm",
+
+ // Connections:
+ "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "0: 6, 7, 3: 5\n" /* Type 0, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // StairsToOpen1
+
+
+ // StairsToOpen2:
+ // The data has been exported from gallery Nether, area index 8, ID 35
+ {
+ // Size:
+ 7, 10, 7, // SizeX = 7, SizeY = 10, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 2
+ "aa...aa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 3
+ "aa...aa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a.aaaaa"
+ "aabaaba"
+
+ // Level 4
+ "aa...aa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a..aaaa"
+ "aabaaba"
+
+ // Level 5
+ "aabbbaa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a...aaa"
+ "aabaaba"
+
+ // Level 6
+ "aaaaaaa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a....aa"
+ "aaaaaaa"
+
+ // Level 7
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "a.....a"
+ "aaaaaaa"
+
+ // Level 8
+ "aaaaaaa"
+ "a.....a"
+ "......a"
+ "......a"
+ "......a"
+ "a.....a"
+ "aaaaaaa"
+
+ // Level 9
+ "mmmmmmm"
+ "m.....m"
+ "......m"
+ "......m"
+ "......m"
+ "m.....m"
+ "mmmmmmm"
+
+ // Level 10
+ "mmmmmmm"
+ "m.....m"
+ "......m"
+ "......m"
+ "......m"
+ "m.....m"
+ "mmmmmmm",
+
+ // Connections:
+ "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "0: 0, 7, 3: 4\n" /* Type 0, BLOCK_FACE_XM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // StairsToOpen2
+
+
+ // Tee2x4:
+ // The data has been exported from gallery Nether, area index 40, ID 291
+ {
+ // Size:
+ 13, 6, 7, // SizeX = 13, SizeY = 6, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c:114: 0\n" /* netherbrickstairs */
+ "d:114: 1\n" /* netherbrickstairs */
+ "e:114: 2\n" /* netherbrickstairs */
+ "f:114: 3\n" /* netherbrickstairs */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmaaaaammmm"
+ "mmmmaaaaammmm"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "mmmma...ammmm"
+ "mmmma...ammmm"
+ "aaaaa...aaaaa"
+ "............."
+ "............."
+ "............."
+ "aaaaaaaaaaaaa"
+
+ // Level 3
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 4
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 5
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 6
+ "mmmmcaaadmmmm"
+ "mmmmcaaadmmmm"
+ "eeeecaaadeeee"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "fffffffffffff",
+
+ // Connections:
+ "1: 0, 1, 4: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 6, 1, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */
+ "1: 12, 1, 4: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // Tee2x4
+
+
+ // Tee4x4:
+ // The data has been exported from gallery Nether, area index 41, ID 292
+ {
+ // Size:
+ 13, 6, 9, // SizeX = 13, SizeY = 6, SizeZ = 9
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c:114: 0\n" /* netherbrickstairs */
+ "d:114: 1\n" /* netherbrickstairs */
+ "e:114: 2\n" /* netherbrickstairs */
+ "f:114: 3\n" /* netherbrickstairs */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmaaaaammmm"
+ "mmmmaaaaammmm"
+ "mmmmaaaaammmm"
+ "mmmmaaaaammmm"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "mmmma...ammmm"
+ "mmmma...ammmm"
+ "mmmma...ammmm"
+ "mmmma...ammmm"
+ "aaaaa...aaaaa"
+ "............."
+ "............."
+ "............."
+ "aaaaaaaaaaaaa"
+
+ // Level 3
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 4
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 5
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 6
+ "mmmmcaaadmmmm"
+ "mmmmcaaadmmmm"
+ "mmmmcaaadmmmm"
+ "mmmmcaaadmmmm"
+ "eeeecaaadeeee"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "fffffffffffff",
+
+ // Connections:
+ "1: 0, 1, 6: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 12, 1, 6: 5\n" /* Type 1, BLOCK_FACE_XP */
+ "1: 6, 1, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // Tee4x4
+
+ // Turret:
+ // The data has been exported from gallery Nether, area index 7, ID 34
+ {
+ // Size:
+ 7, 6, 7, // SizeX = 7, SizeY = 6, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 2
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 3
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 4
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 5
+ "aabbbaa"
+ "a.....a"
+ "b.....b"
+ "b.....b"
+ "b.....b"
+ "a.....a"
+ "aabbbaa"
+
+ // Level 6
+ "aaaaaaa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "aaaaaaa",
+
+ // Connections:
+ "0: 0, 1, 3: 4\n" /* Type 0, BLOCK_FACE_XM */
+ "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "0: 6, 1, 3: 5\n" /* Type 0, BLOCK_FACE_XP */
+ "0: 3, 1, 6: 3\n" /* Type 0, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // Turret
+
+} ; // g_NetherFortPrefabs1
+
+
+
+
+
+const cPrefab::sDef g_NetherFortStartingPrefabs1[] =
+{
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // CentralRoom:
+ // The data has been exported from gallery Nether, area index 22, ID 164
+ {
+ // Size:
+ 13, 9, 13, // SizeX = 13, SizeY = 9, SizeZ = 13
+
+ // Block definitions:
+ "a:112: 0\n" /* netherbrick */
+ "b: 0: 0\n" /* air */
+ "c: 10: 0\n" /* lava */
+ "d:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "aaaaabbbaaaaa"
+ "aaaaabbbaaaaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbaaabbbaa"
+ "aabbbacabbbaa"
+ "aabbbaaabbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aaaaabbbaaaaa"
+ "aaaaabbbaaaaa"
+
+ // Level 3
+ "aaaaabbbaaaaa"
+ "aaadabbbadaaa"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "aaadabbbadaaa"
+ "aaaaabbbaaaaa"
+
+ // Level 4
+ "aaaaabbbaaaaa"
+ "aaadabbbadaaa"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "aaadabbbadaaa"
+ "aaaaabbbaaaaa"
+
+ // Level 5
+ "adadadddadada"
+ "daaaabbbaaaad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "daaaabbbaaaad"
+ "adadabbbadada"
+
+ // Level 6
+ "adadaaaaadada"
+ "daaaaaaaaaaad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "daaaaaaaaaaad"
+ "adadaaaaadada"
+
+ // Level 7
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 8
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 9
+ "dadadadadadad"
+ "abbbbbbbbbbba"
+ "dbbbbbbbbbbbd"
+ "abbbbbbbbbbba"
+ "dbbbbbbbbbbbd"
+ "abbbbbbbbbbba"
+ "dbbbbbbbbbbbd"
+ "abbbbbbbbbbba"
+ "dbbbbbbbbbbbd"
+ "abbbbbbbbbbba"
+ "dbbbbbbbbbbbd"
+ "abbbbbbbbbbba"
+ "dadadadadadad",
+
+ // Connections:
+ "0: 6, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "1: 6, 1, 12: 3\n" /* Type 1, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ },
+} ; // g_NetherFortStartingPrefabs1
+
+const size_t g_NetherFortPrefabs1Count = ARRAYCOUNT(g_NetherFortPrefabs1);
+const size_t g_NetherFortStartingPrefabs1Count = ARRAYCOUNT(g_NetherFortStartingPrefabs1);
+
+
+
+
diff --git a/src/Generating/Prefabs/NetherFortPrefabs.h b/src/Generating/Prefabs/NetherFortPrefabs.h
new file mode 100644
index 000000000..37a91689d
--- /dev/null
+++ b/src/Generating/Prefabs/NetherFortPrefabs.h
@@ -0,0 +1,15 @@
+
+// NetherFortPrefabs.h
+
+// Declares the data used for nether fortress prefabs
+
+#include "../Prefab.h"
+
+
+
+
+
+extern const cPrefab::sDef g_NetherFortPrefabs1[];
+extern const cPrefab::sDef g_NetherFortStartingPrefabs1[];
+extern const size_t g_NetherFortPrefabs1Count;
+extern const size_t g_NetherFortStartingPrefabs1Count;
diff --git a/src/Generating/StructGen.cpp b/src/Generating/StructGen.cpp
index 3cc8a09c3..db9d5578c 100644
--- a/src/Generating/StructGen.cpp
+++ b/src/Generating/StructGen.cpp
@@ -578,7 +578,7 @@ void cStructGenDirectOverhangs::GenFinish(cChunkDesc & a_ChunkDesc)
m_Noise2.IntNoise3DInt(BaseX + INTERPOL_X * x, BaseY, BaseZ + INTERPOL_Z * z) /
256;
} // for x, z - FloorLo[]
- LinearUpscale2DArrayInPlace(FloorLo, 17, 17, INTERPOL_X, INTERPOL_Z);
+ LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorLo);
// Interpolate segments:
for (int Segment = BaseY; Segment < MaxHeight; Segment += SEGMENT_HEIGHT)
@@ -591,7 +591,7 @@ void cStructGenDirectOverhangs::GenFinish(cChunkDesc & a_ChunkDesc)
m_Noise2.IntNoise3DInt(BaseX + INTERPOL_Z * x, Segment + SEGMENT_HEIGHT, BaseZ + INTERPOL_Z * z) /
256;
} // for x, z - FloorLo[]
- LinearUpscale2DArrayInPlace(FloorHi, 17, 17, INTERPOL_X, INTERPOL_Z);
+ LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorHi);
// Interpolate between FloorLo and FloorHi:
for (int z = 0; z < 16; z++) for (int x = 0; x < 16; x++)
diff --git a/src/Globals.h b/src/Globals.h
index 3e62832b7..a1cee5c2f 100644
--- a/src/Globals.h
+++ b/src/Globals.h
@@ -264,11 +264,17 @@ template class SizeChecker;
#define assert_test(x) ( !!(x) || (assert(!#x), exit(1), 0))
#endif
-/// A generic interface used mainly in ForEach() functions
+
+
+
+
+/** A generic interface used mainly in ForEach() functions */
template class cItemCallback
{
public:
- /// Called for each item in the internal list; return true to stop the loop, or false to continue enumerating
+ virtual ~cItemCallback() {}
+
+ /** Called for each item in the internal list; return true to stop the loop, or false to continue enumerating */
virtual bool Item(Type * a_Type) = 0;
} ;
diff --git a/src/HTTPServer/HTTPServer.h b/src/HTTPServer/HTTPServer.h
index 24baf8c95..383abb4b6 100644
--- a/src/HTTPServer/HTTPServer.h
+++ b/src/HTTPServer/HTTPServer.h
@@ -37,6 +37,8 @@ public:
class cCallbacks
{
public:
+ virtual ~cCallbacks() {}
+
/** Called when a new request arrives over a connection and its headers have been parsed.
The request body needn't have arrived yet.
*/
@@ -50,7 +52,7 @@ public:
} ;
cHTTPServer(void);
- ~cHTTPServer();
+ virtual ~cHTTPServer();
/// Initializes the server on the specified ports
bool Initialize(const AString & a_PortsIPv4, const AString & a_PortsIPv6);
diff --git a/src/Inventory.h b/src/Inventory.h
index fd2089a13..1ad7c4776 100644
--- a/src/Inventory.h
+++ b/src/Inventory.h
@@ -52,6 +52,8 @@ public:
cInventory(cPlayer & a_Owner);
+ virtual ~cInventory() {}
+
// tolua_begin
/// Removes all items from the entire inventory
diff --git a/src/Item.h b/src/Item.h
index 4bdfb12dd..910ecb382 100644
--- a/src/Item.h
+++ b/src/Item.h
@@ -209,7 +209,7 @@ public:
void Add (const cItem & a_Item) {push_back(a_Item); }
void Delete(int a_Idx);
void Clear (void) {clear(); }
- int Size (void) {return size(); }
+ size_t Size (void) {return size(); }
void Set (int a_Idx, short a_ItemType, char a_ItemCount, short a_ItemDamage);
void Add (short a_ItemType, char a_ItemCount, short a_ItemDamage)
diff --git a/src/ItemGrid.h b/src/ItemGrid.h
index b344e3daf..c34d5e9e2 100644
--- a/src/ItemGrid.h
+++ b/src/ItemGrid.h
@@ -20,11 +20,13 @@ class cItemGrid
public:
// tolua_end
- /// This class is used as a callback for when a slot changes
+ /** This class is used as a callback for when a slot changes */
class cListener
{
public:
- /// Called whenever a slot changes
+ virtual ~cListener() {}
+
+ /** Called whenever a slot changes */
virtual void OnSlotChanged(cItemGrid * a_ItemGrid, int a_SlotNum) = 0;
} ;
typedef std::vector cListeners;
@@ -38,12 +40,12 @@ public:
int GetHeight (void) const { return m_Height; }
int GetNumSlots(void) const { return m_NumSlots; }
- /// Converts XY coords into slot number; returns -1 on invalid coords
+ /** Converts XY coords into slot number; returns -1 on invalid coords */
int GetSlotNum(int a_X, int a_Y) const;
// tolua_end
- /// Converts slot number into XY coords; sets coords to -1 on invalid slot number. Exported in ManualBindings.cpp
+ /** Converts slot number into XY coords; sets coords to -1 on invalid slot number. Exported in ManualBindings.cpp */
void GetSlotCoords(int a_SlotNum, int & a_X, int & a_Y) const;
// tolua_begin
@@ -62,16 +64,16 @@ public:
void EmptySlot(int a_X, int a_Y);
void EmptySlot(int a_SlotNum);
- /// Returns true if the specified slot is empty or the slot doesn't exist
+ /** Returns true if the specified slot is empty or the slot doesn't exist */
bool IsSlotEmpty(int a_SlotNum) const;
- /// Returns true if the specified slot is empty or the slot doesn't exist
+ /** Returns true if the specified slot is empty or the slot doesn't exist */
bool IsSlotEmpty(int a_X, int a_Y) const;
- /// Sets all items as empty
+ /** Sets all items as empty */
void Clear(void);
- /// Returns number of items out of a_ItemStack that can fit in the storage
+ /** Returns number of items out of a_ItemStack that can fit in the storage */
int HowManyCanFit(const cItem & a_ItemStack, bool a_AllowNewStacks = true);
/** Adds as many items out of a_ItemStack as can fit.
@@ -117,37 +119,37 @@ public:
*/
cItem RemoveOneItem(int a_X, int a_Y);
- /// Returns the number of items of type a_Item that are stored
+ /** Returns the number of items of type a_Item that are stored */
int HowManyItems(const cItem & a_Item);
- /// Returns true if there are at least as many items of type a_ItemStack as in a_ItemStack
+ /** Returns true if there are at least as many items of type a_ItemStack as in a_ItemStack */
bool HasItems(const cItem & a_ItemStack);
- /// Returns the index of the first empty slot; -1 if all full
+ /** Returns the index of the first empty slot; -1 if all full */
int GetFirstEmptySlot(void) const;
- /// Returns the index of the first non-empty slot; -1 if all empty
+ /** Returns the index of the first non-empty slot; -1 if all empty */
int GetFirstUsedSlot(void) const;
- /// Returns the index of the last empty slot; -1 if all full
+ /** Returns the index of the last empty slot; -1 if all full */
int GetLastEmptySlot(void) const;
- /// Returns the index of the last used slot; -1 if all empty
+ /** Returns the index of the last used slot; -1 if all empty */
int GetLastUsedSlot(void) const;
- /// Returns the index of the first empty slot following a_StartFrom (a_StartFrom is not checked)
+ /** Returns the index of the first empty slot following a_StartFrom (a_StartFrom is not checked) */
int GetNextEmptySlot(int a_StartFrom) const;
- /// Returns the index of the first used slot following a_StartFrom (a_StartFrom is not checked)
+ /** Returns the index of the first used slot following a_StartFrom (a_StartFrom is not checked) */
int GetNextUsedSlot(int a_StartFrom) const;
- /// Copies the contents into a cItems object; preserves the original a_Items contents
+ /** Copies the contents into a cItems object; preserves the original a_Items contents */
void CopyToItems(cItems & a_Items) const;
- /// Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact)
+ /** Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) */
bool DamageItem(int a_SlotNum, short a_Amount);
- /// Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact)
+ /** Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) */
bool DamageItem(int a_X, int a_Y, short a_Amount);
// tolua_end
@@ -159,10 +161,10 @@ public:
*/
void GenerateRandomLootWithBooks(const cLootProbab * a_LootProbabs, size_t a_CountLootProbabs, int a_NumSlots, int a_Seed);
- /// Adds a callback that gets called whenever a slot changes. Must not be called from within the listener callback!
+ /** Adds a callback that gets called whenever a slot changes. Must not be called from within the listener callback! */
void AddListener(cListener & a_Listener);
- /// Removes a slot-change-callback. Must not be called from within the listener callback!
+ /** Removes a slot-change-callback. Must not be called from within the listener callback! */
void RemoveListener(cListener & a_Listener);
// tolua_begin
@@ -177,7 +179,7 @@ protected:
cCriticalSection m_CSListeners; ///< CS that guards the m_Listeners against multi-thread access
bool m_IsInTriggerListeners; ///< Set to true while TriggerListeners is running, to detect attempts to manipulate listener list while triggerring
- /// Calls all m_Listeners for the specified slot number
+ /** Calls all m_Listeners for the specified slot number */
void TriggerListeners(int a_SlotNum);
/** Adds up to a_Num items out of a_ItemStack, as many as can fit, in specified slot
diff --git a/src/Items/ItemBucket.h b/src/Items/ItemBucket.h
index 72cb8fa0a..68c89dd85 100644
--- a/src/Items/ItemBucket.h
+++ b/src/Items/ItemBucket.h
@@ -172,12 +172,12 @@ public:
virtual bool OnNextBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, char a_EntryFace) override
{
- if (a_BlockMeta != 0) // Even if it was a water block it would not be a source.
- {
- return false;
- }
if (IsBlockWater(a_BlockType) || IsBlockLava(a_BlockType))
{
+ if (a_BlockMeta != 0) // GetBlockFromTrace is called for scooping up fluids; the hit block should be a source
+ {
+ return false;
+ }
m_HasHitFluid = true;
m_Pos.Set(a_BlockX, a_BlockY, a_BlockZ);
return true;
diff --git a/src/Items/ItemCake.h b/src/Items/ItemCake.h
new file mode 100644
index 000000000..48e23ed59
--- /dev/null
+++ b/src/Items/ItemCake.h
@@ -0,0 +1,41 @@
+
+#pragma once
+
+#include "ItemHandler.h"
+
+
+
+
+
+class cItemCakeHandler :
+ public cItemHandler
+{
+public:
+ cItemCakeHandler(int a_ItemType) :
+ cItemHandler(a_ItemType)
+ {
+ }
+
+
+ virtual bool IsPlaceable(void) override
+ {
+ return true;
+ }
+
+
+ virtual bool GetPlacementBlockTypeMeta(
+ cWorld * a_World, cPlayer * a_Player,
+ int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace,
+ int a_CursorX, int a_CursorY, int a_CursorZ,
+ BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta
+ ) override
+ {
+ a_BlockType = E_BLOCK_CAKE;
+ a_BlockMeta = 0;
+ return true;
+ }
+} ;
+
+
+
+
diff --git a/src/Items/ItemHandler.cpp b/src/Items/ItemHandler.cpp
index 1d357fcf1..337b3a83c 100644
--- a/src/Items/ItemHandler.cpp
+++ b/src/Items/ItemHandler.cpp
@@ -13,6 +13,7 @@
#include "ItemBow.h"
#include "ItemBrewingStand.h"
#include "ItemBucket.h"
+#include "ItemCake.h"
#include "ItemCauldron.h"
#include "ItemCloth.h"
#include "ItemComparator.h"
@@ -26,6 +27,7 @@
#include "ItemHoe.h"
#include "ItemLeaves.h"
#include "ItemLighter.h"
+#include "ItemLilypad.h"
#include "ItemMap.h"
#include "ItemMinecart.h"
#include "ItemNetherWart.h"
@@ -94,6 +96,7 @@ cItemHandler *cItemHandler::CreateItemHandler(int a_ItemType)
// Single item per handler, alphabetically sorted:
case E_BLOCK_LEAVES: return new cItemLeavesHandler(a_ItemType);
+ case E_BLOCK_NEW_LEAVES: return new cItemLeavesHandler(a_ItemType);
case E_BLOCK_SAPLING: return new cItemSaplingHandler(a_ItemType);
case E_BLOCK_WOOL: return new cItemClothHandler(a_ItemType);
case E_ITEM_BED: return new cItemBedHandler(a_ItemType);
@@ -101,16 +104,19 @@ cItemHandler *cItemHandler::CreateItemHandler(int a_ItemType)
case E_ITEM_BOTTLE_O_ENCHANTING: return new cItemBottleOEnchantingHandler();
case E_ITEM_BOW: return new cItemBowHandler;
case E_ITEM_BREWING_STAND: return new cItemBrewingStandHandler(a_ItemType);
+ case E_ITEM_CAKE: return new cItemCakeHandler(a_ItemType);
case E_ITEM_CAULDRON: return new cItemCauldronHandler(a_ItemType);
case E_ITEM_COMPARATOR: return new cItemComparatorHandler(a_ItemType);
case E_ITEM_DYE: return new cItemDyeHandler(a_ItemType);
case E_ITEM_EGG: return new cItemEggHandler();
case E_ITEM_EMPTY_MAP: return new cItemEmptyMapHandler();
case E_ITEM_ENDER_PEARL: return new cItemEnderPearlHandler();
+ case E_ITEM_FIRE_CHARGE: return new cItemLighterHandler(a_ItemType);
case E_ITEM_FIREWORK_ROCKET: return new cItemFireworkHandler();
case E_ITEM_FISHING_ROD: return new cItemFishingRodHandler(a_ItemType);
case E_ITEM_FLINT_AND_STEEL: return new cItemLighterHandler(a_ItemType);
case E_ITEM_FLOWER_POT: return new cItemFlowerPotHandler(a_ItemType);
+ case E_BLOCK_LILY_PAD: return new cItemLilypadHandler(a_ItemType);
case E_ITEM_MAP: return new cItemMapHandler();
case E_ITEM_ITEM_FRAME: return new cItemItemFrameHandler(a_ItemType);
case E_ITEM_NETHER_WART: return new cItemNetherWartHandler(a_ItemType);
@@ -337,6 +343,7 @@ char cItemHandler::GetMaxStackSize(void)
case E_ITEM_BREWING_STAND: return 64;
case E_ITEM_BUCKET: return 16;
case E_ITEM_CARROT: return 64;
+ case E_ITEM_CAKE: return 1;
case E_ITEM_CAULDRON: return 64;
case E_ITEM_CLAY: return 64;
case E_ITEM_CLAY_BRICK: return 64;
diff --git a/src/Items/ItemItemFrame.h b/src/Items/ItemItemFrame.h
index 74e987445..27e7dba35 100644
--- a/src/Items/ItemItemFrame.h
+++ b/src/Items/ItemItemFrame.h
@@ -34,7 +34,11 @@ public:
if (Block == E_BLOCK_AIR)
{
cItemFrame * ItemFrame = new cItemFrame(a_Dir, a_BlockX, a_BlockY, a_BlockZ);
- ItemFrame->Initialize(a_World);
+ if (!ItemFrame->Initialize(a_World))
+ {
+ delete ItemFrame;
+ return false;
+ }
if (!a_Player->IsGameModeCreative())
{
diff --git a/src/Items/ItemLighter.h b/src/Items/ItemLighter.h
index 18873e911..32f49cab6 100644
--- a/src/Items/ItemLighter.h
+++ b/src/Items/ItemLighter.h
@@ -26,7 +26,26 @@ public:
return false;
}
- a_Player->UseEquippedItem();
+ if (!a_Player->IsGameModeCreative())
+ {
+ switch (m_ItemType)
+ {
+ case E_ITEM_FLINT_AND_STEEL:
+ {
+ a_Player->UseEquippedItem();
+ break;
+ }
+ case E_ITEM_FIRE_CHARGE:
+ {
+ a_Player->GetInventory().RemoveOneEquippedItem();
+ break;
+ }
+ default:
+ {
+ ASSERT(!"Unknown Lighter Item!");
+ }
+ }
+ }
switch (a_World->GetBlock(a_BlockX, a_BlockY, a_BlockZ))
{
@@ -34,8 +53,8 @@ public:
{
// Activate the TNT:
a_World->BroadcastSoundEffect("game.tnt.primed", a_BlockX * 8, a_BlockY * 8, a_BlockZ * 8, 1.0f, 1.0f);
- a_World->SpawnPrimedTNT(a_BlockX + 0.5, a_BlockY + 0.5, a_BlockZ + 0.5); // 80 ticks to boom
a_World->SetBlock(a_BlockX,a_BlockY,a_BlockZ, E_BLOCK_AIR, 0);
+ a_World->SpawnPrimedTNT(a_BlockX + 0.5, a_BlockY + 0.5, a_BlockZ + 0.5); // 80 ticks to boom
break;
}
default:
@@ -49,6 +68,7 @@ public:
if (a_World->GetBlock(a_BlockX, a_BlockY, a_BlockZ) == E_BLOCK_AIR)
{
a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_FIRE, 0);
+ a_World->BroadcastSoundEffect("fire.ignite", a_BlockX * 8, a_BlockY * 8, a_BlockZ * 8, 1.0F, 1.04F);
break;
}
}
diff --git a/src/Items/ItemLilypad.h b/src/Items/ItemLilypad.h
new file mode 100644
index 000000000..5a29abe94
--- /dev/null
+++ b/src/Items/ItemLilypad.h
@@ -0,0 +1,109 @@
+#pragma once
+
+#include "ItemHandler.h"
+#include "../Entities/Player.h"
+#include "Vector3.h"
+#include "../LineBlockTracer.h"
+#include "BlockInfo.h"
+
+
+
+
+
+class cItemLilypadHandler :
+ public cItemHandler
+{
+ typedef cItemHandler super;
+
+public:
+ cItemLilypadHandler(BLOCKTYPE a_BlockType)
+ : cItemHandler(a_BlockType)
+ {
+
+ }
+
+ virtual bool IsPlaceable(void) override
+ {
+ return false; // Set as not placeable so OnItemUse is called
+ }
+
+ virtual bool OnItemUse(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override
+ {
+ if (a_BlockFace > BLOCK_FACE_NONE)
+ {
+ // Clicked on the side of a submerged block; vanilla allows placement, so should we
+ AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace);
+ a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_LILY_PAD, 0);
+ if (!a_Player->IsGameModeCreative())
+ {
+ a_Player->GetInventory().RemoveOneEquippedItem();
+ }
+ return true;
+ }
+
+ class cCallbacks :
+ public cBlockTracer::cCallbacks
+ {
+ public:
+ cCallbacks(cWorld * a_World) :
+ m_HasHitFluid(false),
+ m_World(a_World)
+ {
+ }
+
+ virtual bool OnNextBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, char a_EntryFace) override
+ {
+ if (IsBlockWater(a_BlockType))
+ {
+ if ((a_BlockMeta != 0) || (a_EntryFace == BLOCK_FACE_NONE)) // The hit block should be a source. The FACE_NONE check is clicking whilst submerged
+ {
+ return false;
+ }
+ a_EntryFace = BLOCK_FACE_YP; // Always place pad at top of water block
+ AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, (eBlockFace)a_EntryFace);
+ BLOCKTYPE Block = m_World->GetBlock(a_BlockX, a_BlockY, a_BlockZ);
+ if (
+ !IsBlockWater(Block) &&
+ cBlockInfo::FullyOccupiesVoxel(Block)
+ )
+ {
+ // Can't place lilypad on air/in another block!
+ return true;
+ }
+ m_HasHitFluid = true;
+ m_Pos.Set(a_BlockX, a_BlockY, a_BlockZ);
+ return true;
+ }
+ return false;
+ }
+
+ Vector3i m_Pos;
+ bool m_HasHitFluid;
+ cWorld * m_World;
+
+ };
+
+ cCallbacks Callbacks(a_World);
+ cLineBlockTracer Tracer(*a_Player->GetWorld(), Callbacks);
+ Vector3d Start(a_Player->GetEyePosition() + a_Player->GetLookVector());
+ Vector3d End(a_Player->GetEyePosition() + a_Player->GetLookVector() * 5);
+
+ Tracer.Trace(Start.x, Start.y, Start.z, End.x, End.y, End.z);
+
+ if (Callbacks.m_HasHitFluid)
+ {
+ a_World->SetBlock(Callbacks.m_Pos.x, Callbacks.m_Pos.y, Callbacks.m_Pos.z, E_BLOCK_LILY_PAD, 0);
+ if (!a_Player->IsGameModeCreative())
+ {
+ a_Player->GetInventory().RemoveOneEquippedItem();
+ }
+ return true;
+ }
+
+ return false;
+ }
+};
+
+
+
+
diff --git a/src/Items/ItemMinecart.h b/src/Items/ItemMinecart.h
index bcaa5635a..25500aeb9 100644
--- a/src/Items/ItemMinecart.h
+++ b/src/Items/ItemMinecart.h
@@ -1,4 +1,3 @@
-
// ItemMinecart.h
// Declares the various minecart ItemHandlers
@@ -72,6 +71,11 @@ public:
}
} // switch (m_ItemType)
Minecart->Initialize(a_World);
+
+ if (!a_Player->IsGameModeCreative())
+ {
+ a_Player->GetInventory().RemoveOneEquippedItem();
+ }
return true;
}
diff --git a/src/Items/ItemShears.h b/src/Items/ItemShears.h
index b8f75f5ba..39d2776fa 100644
--- a/src/Items/ItemShears.h
+++ b/src/Items/ItemShears.h
@@ -28,10 +28,10 @@ public:
virtual bool OnDiggingBlock(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_Dir) override
{
BLOCKTYPE Block = a_World->GetBlock(a_BlockX, a_BlockY, a_BlockZ);
- if (Block == E_BLOCK_LEAVES)
+ if ((Block == E_BLOCK_LEAVES) || (Block == E_BLOCK_NEW_LEAVES))
{
cItems Drops;
- Drops.push_back(cItem(E_BLOCK_LEAVES, 1, a_World->GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) & 0x03));
+ Drops.push_back(cItem(Block, 1, a_World->GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) & 0x03));
a_World->SpawnItemPickups(Drops, a_BlockX, a_BlockY, a_BlockZ);
a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
@@ -49,6 +49,7 @@ public:
case E_BLOCK_COBWEB:
case E_BLOCK_VINES:
case E_BLOCK_LEAVES:
+ case E_BLOCK_NEW_LEAVES:
{
return true;
}
diff --git a/src/LightingThread.h b/src/LightingThread.h
index 198f27248..3209ad9b2 100644
--- a/src/LightingThread.h
+++ b/src/LightingThread.h
@@ -160,14 +160,14 @@ protected:
inline void PropagateLight(
NIBBLETYPE * a_Light,
- int a_SrcIdx, int a_DstIdx,
+ unsigned int a_SrcIdx, unsigned int a_DstIdx,
int & a_NumSeedsOut, unsigned char * a_IsSeedOut, unsigned int * a_SeedIdxOut
)
{
ASSERT(a_SrcIdx >= 0);
- ASSERT(a_SrcIdx < (int)ARRAYCOUNT(m_SkyLight));
+ ASSERT(a_SrcIdx < ARRAYCOUNT(m_SkyLight));
ASSERT(a_DstIdx >= 0);
- ASSERT(a_DstIdx < (int)ARRAYCOUNT(m_BlockTypes));
+ ASSERT(a_DstIdx < ARRAYCOUNT(m_BlockTypes));
if (a_Light[a_SrcIdx] <= a_Light[a_DstIdx] + cBlockInfo::GetSpreadLightFalloff(m_BlockTypes[a_DstIdx]))
{
diff --git a/src/LinearUpscale.h b/src/LinearUpscale.h
index b337b3219..0b04408cf 100644
--- a/src/LinearUpscale.h
+++ b/src/LinearUpscale.h
@@ -18,7 +18,7 @@ Therefore, there is no cpp file.
InPlace upscaling works on a single array and assumes that the values to work on have already
been interspersed into the array to the cell boundaries.
-Specifically, a_Array[x * a_AnchorStepX + y * a_AnchorStepY] contains the anchor value.
+Specifically, a_Array[x * AnchorStepX + y * AnchorStepY] contains the anchor value.
Regular upscaling takes two arrays and "moves" the input from src to dst; src is expected packed.
*/
@@ -29,46 +29,48 @@ Regular upscaling takes two arrays and "moves" the input from src to dst; src is
/**
Linearly interpolates values in the array between the equidistant anchor points (upscales).
Works in-place (input is already present at the correct output coords)
+Uses templates to make it possible for the compiler to further optimizer the loops
*/
-template void LinearUpscale2DArrayInPlace(
- TYPE * a_Array,
- int a_SizeX, int a_SizeY, // Dimensions of the array
- int a_AnchorStepX, int a_AnchorStepY // Distances between the anchor points in each direction
-)
+template<
+ int SizeX, int SizeY, // Dimensions of the array
+ int AnchorStepX, int AnchorStepY,
+ typename TYPE
+>
+void LinearUpscale2DArrayInPlace(TYPE * a_Array)
{
// First interpolate columns where the anchor points are:
- int LastYCell = a_SizeY - a_AnchorStepY;
- for (int y = 0; y < LastYCell; y += a_AnchorStepY)
+ int LastYCell = SizeY - AnchorStepY;
+ for (int y = 0; y < LastYCell; y += AnchorStepY)
{
- int Idx = a_SizeX * y;
- for (int x = 0; x < a_SizeX; x += a_AnchorStepX)
+ int Idx = SizeX * y;
+ for (int x = 0; x < SizeX; x += AnchorStepX)
{
TYPE StartValue = a_Array[Idx];
- TYPE EndValue = a_Array[Idx + a_SizeX * a_AnchorStepY];
+ TYPE EndValue = a_Array[Idx + SizeX * AnchorStepY];
TYPE Diff = EndValue - StartValue;
- for (int CellY = 1; CellY < a_AnchorStepY; CellY++)
+ for (int CellY = 1; CellY < AnchorStepY; CellY++)
{
- a_Array[Idx + a_SizeX * CellY] = StartValue + Diff * CellY / a_AnchorStepY;
+ a_Array[Idx + SizeX * CellY] = StartValue + Diff * CellY / AnchorStepY;
} // for CellY
- Idx += a_AnchorStepX;
+ Idx += AnchorStepX;
} // for x
} // for y
// Now interpolate in rows, each row has values in the anchor columns
- int LastXCell = a_SizeX - a_AnchorStepX;
- for (int y = 0; y < a_SizeY; y++)
+ int LastXCell = SizeX - AnchorStepX;
+ for (int y = 0; y < SizeY; y++)
{
- int Idx = a_SizeX * y;
- for (int x = 0; x < LastXCell; x += a_AnchorStepX)
+ int Idx = SizeX * y;
+ for (int x = 0; x < LastXCell; x += AnchorStepX)
{
TYPE StartValue = a_Array[Idx];
- TYPE EndValue = a_Array[Idx + a_AnchorStepX];
+ TYPE EndValue = a_Array[Idx + AnchorStepX];
TYPE Diff = EndValue - StartValue;
- for (int CellX = 1; CellX < a_AnchorStepX; CellX++)
+ for (int CellX = 1; CellX < AnchorStepX; CellX++)
{
- a_Array[Idx + CellX] = StartValue + CellX * Diff / a_AnchorStepX;
+ a_Array[Idx + CellX] = StartValue + CellX * Diff / AnchorStepX;
} // for CellY
- Idx += a_AnchorStepX;
+ Idx += AnchorStepX;
}
}
}
diff --git a/src/MCLogger.cpp b/src/MCLogger.cpp
index 4f3e5dc0f..80fa7b173 100644
--- a/src/MCLogger.cpp
+++ b/src/MCLogger.cpp
@@ -93,25 +93,30 @@ void cMCLogger::InitLog(const AString & a_FileName)
-void cMCLogger::LogSimple(const char* a_Text, int a_LogType /* = 0 */ )
+void cMCLogger::LogSimple(const char * a_Text, eLogLevel a_LogLevel)
{
- switch( a_LogType )
+ switch (a_LogLevel)
{
- case 0:
+ case llRegular:
+ {
LOG("%s", a_Text);
break;
- case 1:
+ }
+ case llInfo:
+ {
LOGINFO("%s", a_Text);
break;
- case 2:
+ }
+ case llWarning:
+ {
LOGWARN("%s", a_Text);
break;
- case 3:
+ }
+ case llError:
+ {
LOGERROR("%s", a_Text);
break;
- default:
- LOG("(#%d#: %s", a_LogType, a_Text);
- break;
+ }
}
}
diff --git a/src/MCLogger.h b/src/MCLogger.h
index 996e60329..c0150c124 100644
--- a/src/MCLogger.h
+++ b/src/MCLogger.h
@@ -10,25 +10,36 @@ class cLog;
-class cMCLogger // tolua_export
-{ // tolua_export
-public: // tolua_export
- /// Creates a logger with the default filename, "logs/LOG_.log"
+// tolua_begin
+class cMCLogger
+{
+public:
+ enum eLogLevel
+ {
+ llRegular,
+ llInfo,
+ llWarning,
+ llError,
+ };
+ // tolua_end
+
+ /** Creates a logger with the default filename, "logs/LOG_.log" */
cMCLogger(void);
- /// Creates a logger with the specified filename inside "logs" folder
+ /** Creates a logger with the specified filename inside "logs" folder */
cMCLogger(const AString & a_FileName); // tolua_export
~cMCLogger(); // tolua_export
- void Log(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
- void Info(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
- void Warn(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
- void Error(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+ void Log (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+ void Info (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+ void Warn (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+ void Error(const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
- void LogSimple(const char* a_Text, int a_LogType = 0 ); // tolua_export
+ /** Logs the simple text message at the specified log level. */
+ void LogSimple(const char * a_Text, eLogLevel a_LogLevel = llRegular); // tolua_export
- static cMCLogger* GetInstance();
+ static cMCLogger * GetInstance();
private:
enum eColorScheme
{
diff --git a/src/Map.cpp b/src/Map.cpp
index 2d8f57168..79370b097 100644
--- a/src/Map.cpp
+++ b/src/Map.cpp
@@ -243,7 +243,7 @@ bool cMap::UpdatePixel(unsigned int a_X, unsigned int a_Z)
{
for (unsigned int Z = m_RelZ; Z < m_RelZ + PixelWidth; ++Z)
{
- unsigned int WaterDepth = 0;
+ // unsigned int WaterDepth = 0;
BLOCKTYPE TargetBlock = E_BLOCK_AIR;
NIBBLETYPE TargetMeta = 0;
@@ -261,12 +261,14 @@ bool cMap::UpdatePixel(unsigned int a_X, unsigned int a_Z)
continue;
}
// TODO 2014-02-22 xdot: Check if block is liquid
+ /*
else if (false)
{
--Height;
++WaterDepth;
continue;
}
+ */
break;
}
diff --git a/src/MobSpawner.cpp b/src/MobSpawner.cpp
index 7704f6cf3..a0d0f5c54 100644
--- a/src/MobSpawner.cpp
+++ b/src/MobSpawner.cpp
@@ -169,7 +169,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R
(TargetBlock == E_BLOCK_AIR) &&
(BlockAbove == E_BLOCK_AIR) &&
(
- (BlockBelow == E_BLOCK_GRASS) || (BlockBelow == E_BLOCK_LEAVES)
+ (BlockBelow == E_BLOCK_GRASS) || (BlockBelow == E_BLOCK_LEAVES) || (BlockBelow == E_BLOCK_NEW_LEAVES)
) &&
(a_RelY >= 62) &&
(m_Random.NextInt(3, a_Biome) != 0)
diff --git a/src/Mobs/Monster.cpp b/src/Mobs/Monster.cpp
index 6e3c91d58..d3e0f1c26 100644
--- a/src/Mobs/Monster.cpp
+++ b/src/Mobs/Monster.cpp
@@ -82,11 +82,11 @@ cMonster::cMonster(const AString & a_ConfigName, eType a_MobType, const AString
, m_AttackRange(2)
, m_AttackInterval(0)
, m_SightDistance(25)
- , m_DropChanceWeapon(0.085)
- , m_DropChanceHelmet(0.085)
- , m_DropChanceChestplate(0.085)
- , m_DropChanceLeggings(0.085)
- , m_DropChanceBoots(0.085)
+ , m_DropChanceWeapon(0.085f)
+ , m_DropChanceHelmet(0.085f)
+ , m_DropChanceChestplate(0.085f)
+ , m_DropChanceLeggings(0.085f)
+ , m_DropChanceBoots(0.085f)
, m_CanPickUpLoot(true)
, m_BurnsInDaylight(false)
{
@@ -758,6 +758,7 @@ cMonster::eFamily cMonster::FamilyFromType(eType a_Type)
case mtSquid: return mfWater;
case mtVillager: return mfPassive;
case mtWitch: return mfHostile;
+ case mtWither: return mfHostile;
case mtWolf: return mfHostile;
case mtZombie: return mfHostile;
case mtZombiePigman: return mfHostile;
diff --git a/src/Mobs/Villager.h b/src/Mobs/Villager.h
index b99ae876f..5bba4d4ba 100644
--- a/src/Mobs/Villager.h
+++ b/src/Mobs/Villager.h
@@ -29,7 +29,7 @@ public:
CLASS_PROTODEF(cVillager);
- // Override functions
+ // cEntity overrides
virtual void DoTakeDamage(TakeDamageInfo & a_TDI) override;
virtual void Tick (float a_Dt, cChunk & a_Chunk) override;
diff --git a/src/Mobs/Wither.cpp b/src/Mobs/Wither.cpp
index c46e0beab..8f5d28b68 100644
--- a/src/Mobs/Wither.cpp
+++ b/src/Mobs/Wither.cpp
@@ -2,14 +2,90 @@
#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules
#include "Wither.h"
+#include "../World.h"
cWither::cWither(void) :
- super("Wither", mtWither, "mob.wither.hurt", "mob.wither.death", 0.9, 4.0)
+ super("Wither", mtWither, "mob.wither.hurt", "mob.wither.death", 0.9, 4.0),
+ m_InvulnerableTicks(220)
{
+ SetMaxHealth(300);
+}
+
+
+
+
+
+bool cWither::IsArmored(void) const
+{
+ return GetHealth() <= (GetMaxHealth() / 2);
+}
+
+
+
+
+
+bool cWither::Initialize(cWorld * a_World)
+{
+ // Set health before BroadcastSpawnEntity()
+ SetHealth(GetMaxHealth() / 3);
+
+ return super::Initialize(a_World);
+}
+
+
+
+
+
+void cWither::DoTakeDamage(TakeDamageInfo & a_TDI)
+{
+ if (a_TDI.DamageType == dtDrowning)
+ {
+ return;
+ }
+
+ if (m_InvulnerableTicks > 0)
+ {
+ return;
+ }
+
+ if (IsArmored() && (a_TDI.DamageType == dtRangedAttack))
+ {
+ return;
+ }
+
+ super::DoTakeDamage(a_TDI);
+}
+
+
+
+
+
+void cWither::Tick(float a_Dt, cChunk & a_Chunk)
+{
+ super::Tick(a_Dt, a_Chunk);
+
+ if (m_InvulnerableTicks > 0)
+ {
+ unsigned int NewTicks = m_InvulnerableTicks - 1;
+
+ if (NewTicks == 0)
+ {
+ m_World->DoExplosionAt(7.0, GetPosX(), GetPosY(), GetPosZ(), false, esWitherBirth, this);
+ }
+
+ m_InvulnerableTicks = NewTicks;
+
+ if ((NewTicks % 10) == 0)
+ {
+ Heal(10);
+ }
+ }
+
+ m_World->BroadcastEntityMetadata(*this);
}
diff --git a/src/Mobs/Wither.h b/src/Mobs/Wither.h
index 56effc6bb..bc78bfaad 100644
--- a/src/Mobs/Wither.h
+++ b/src/Mobs/Wither.h
@@ -16,8 +16,25 @@ public:
cWither(void);
CLASS_PROTODEF(cWither);
+
+ unsigned int GetNumInvulnerableTicks(void) const { return m_InvulnerableTicks; }
+
+ void SetNumInvulnerableTicks(unsigned int a_Ticks) { m_InvulnerableTicks = a_Ticks; }
+
+ /** Returns whether the wither is invulnerable to arrows. */
+ bool IsArmored(void) const;
+ // cEntity overrides
+ virtual bool Initialize(cWorld * a_World) override;
virtual void GetDrops(cItems & a_Drops, cEntity * a_Killer = NULL) override;
+ virtual void DoTakeDamage(TakeDamageInfo & a_TDI) override;
+ virtual void Tick(float a_Dt, cChunk & a_Chunk) override;
+
+private:
+
+ /** The number of ticks of invulnerability left after being initially created. Zero once invulnerability has expired. */
+ unsigned int m_InvulnerableTicks;
+
} ;
diff --git a/src/OSSupport/File.cpp b/src/OSSupport/File.cpp
index 17070030f..7f0f0ad2f 100644
--- a/src/OSSupport/File.cpp
+++ b/src/OSSupport/File.cpp
@@ -152,7 +152,7 @@ int cFile::Read (void * iBuffer, int iNumBytes)
return -1;
}
- return fread(iBuffer, 1, iNumBytes, m_File); // fread() returns the portion of Count parameter actually read, so we need to send iNumBytes as Count
+ return (int)fread(iBuffer, 1, (size_t)iNumBytes, m_File); // fread() returns the portion of Count parameter actually read, so we need to send iNumBytes as Count
}
@@ -168,7 +168,7 @@ int cFile::Write(const void * iBuffer, int iNumBytes)
return -1;
}
- int res = fwrite(iBuffer, 1, iNumBytes, m_File); // fwrite() returns the portion of Count parameter actually written, so we need to send iNumBytes as Count
+ int res = (int)fwrite(iBuffer, 1, (size_t)iNumBytes, m_File); // fwrite() returns the portion of Count parameter actually written, so we need to send iNumBytes as Count
return res;
}
@@ -189,7 +189,7 @@ int cFile::Seek (int iPosition)
{
return -1;
}
- return ftell(m_File);
+ return (int)ftell(m_File);
}
@@ -206,7 +206,7 @@ int cFile::Tell (void) const
return -1;
}
- return ftell(m_File);
+ return (int)ftell(m_File);
}
@@ -222,7 +222,7 @@ int cFile::GetSize(void) const
return -1;
}
- int CurPos = ftell(m_File);
+ int CurPos = Tell();
if (CurPos < 0)
{
return -1;
@@ -231,8 +231,8 @@ int cFile::GetSize(void) const
{
return -1;
}
- int res = ftell(m_File);
- if (fseek(m_File, CurPos, SEEK_SET) != 0)
+ int res = Tell();
+ if (fseek(m_File, (long)CurPos, SEEK_SET) != 0)
{
return -1;
}
@@ -255,7 +255,7 @@ int cFile::ReadRestOfFile(AString & a_Contents)
int DataSize = GetSize() - Tell();
// HACK: This depends on the internal knowledge that AString's data() function returns the internal buffer directly
- a_Contents.assign(DataSize, '\0');
+ a_Contents.assign((size_t)DataSize, '\0');
return Read((void *)a_Contents.data(), DataSize);
}
@@ -350,7 +350,7 @@ int cFile::GetSize(const AString & a_FileName)
struct stat st;
if (stat(a_FileName.c_str(), &st) == 0)
{
- return st.st_size;
+ return (int)st.st_size;
}
return -1;
}
@@ -456,7 +456,7 @@ int cFile::Printf(const char * a_Fmt, ...)
va_start(args, a_Fmt);
AppendVPrintf(buf, a_Fmt, args);
va_end(args);
- return Write(buf.c_str(), buf.length());
+ return Write(buf.c_str(), (int)buf.length());
}
diff --git a/src/OSSupport/GZipFile.cpp b/src/OSSupport/GZipFile.cpp
index cbf6be6c4..7a8433f4f 100644
--- a/src/OSSupport/GZipFile.cpp
+++ b/src/OSSupport/GZipFile.cpp
@@ -73,12 +73,15 @@ int cGZipFile::ReadRestOfFile(AString & a_Contents)
// Since the gzip format doesn't really support getting the uncompressed length, we need to read incrementally. Yuck!
int NumBytesRead = 0;
+ int TotalBytes = 0;
char Buffer[64 KiB];
while ((NumBytesRead = gzread(m_File, Buffer, sizeof(Buffer))) > 0)
{
- a_Contents.append(Buffer, NumBytesRead);
+ TotalBytes += NumBytesRead;
+ a_Contents.append(Buffer, (size_t)NumBytesRead);
}
- return NumBytesRead;
+ // NumBytesRead is < 0 on error
+ return (NumBytesRead >= 0) ? TotalBytes : NumBytesRead;
}
@@ -99,7 +102,7 @@ bool cGZipFile::Write(const char * a_Contents, int a_Size)
return false;
}
- return (gzwrite(m_File, a_Contents, a_Size) != 0);
+ return (gzwrite(m_File, a_Contents, (unsigned int)a_Size) != 0);
}
diff --git a/src/OSSupport/ListenThread.h b/src/OSSupport/ListenThread.h
index 4e337d814..b2d806c82 100644
--- a/src/OSSupport/ListenThread.h
+++ b/src/OSSupport/ListenThread.h
@@ -29,43 +29,45 @@ class cListenThread :
typedef cIsThread super;
public:
- /// Used as the callback for connection events
+ /** Used as the callback for connection events */
class cCallback
{
public:
- /// This callback is called whenever a socket connection is accepted
+ virtual ~cCallback() {}
+
+ /** This callback is called whenever a socket connection is accepted */
virtual void OnConnectionAccepted(cSocket & a_Socket) = 0;
} ;
cListenThread(cCallback & a_Callback, cSocket::eFamily a_Family, const AString & a_ServiceName = "");
~cListenThread();
- /// Creates all the sockets, returns trus if successful, false if not.
+ /** Creates all the sockets, returns trus if successful, false if not. */
bool Initialize(const AString & a_PortsString);
bool Start(void);
void Stop(void);
- /// Call before Initialize() to set the "reuse" flag on the sockets
+ /** Call before Initialize() to set the "reuse" flag on the sockets */
void SetReuseAddr(bool a_Reuse = true);
protected:
typedef std::vector cSockets;
- /// The callback which to notify of incoming connections
+ /** The callback which to notify of incoming connections */
cCallback & m_Callback;
- /// Socket address family to use
+ /** Socket address family to use */
cSocket::eFamily m_Family;
- /// Sockets that are being monitored
+ /** Sockets that are being monitored */
cSockets m_Sockets;
- /// If set to true, the SO_REUSEADDR socket option is set to true
+ /** If set to true, the SO_REUSEADDR socket option is set to true */
bool m_ShouldReuseAddr;
- /// Name of the service that's listening on the ports; for logging purposes only
+ /** Name of the service that's listening on the ports; for logging purposes only */
AString m_ServiceName;
diff --git a/src/Protocol/Protocol125.cpp b/src/Protocol/Protocol125.cpp
index 69f4934d8..fe6280218 100644
--- a/src/Protocol/Protocol125.cpp
+++ b/src/Protocol/Protocol125.cpp
@@ -239,32 +239,11 @@ void cProtocol125::SendChat(const AString & a_Message)
void cProtocol125::SendChat(const cCompositeChat & a_Message)
{
// This version doesn't support composite messages, just extract each part's text and use it:
- AString Msg;
- const cCompositeChat::cParts & Parts = a_Message.GetParts();
- for (cCompositeChat::cParts::const_iterator itr = Parts.begin(), end = Parts.end(); itr != end; ++itr)
- {
- switch ((*itr)->m_PartType)
- {
- case cCompositeChat::ptText:
- case cCompositeChat::ptClientTranslated:
- case cCompositeChat::ptRunCommand:
- case cCompositeChat::ptSuggestCommand:
- {
- Msg.append((*itr)->m_Text);
- break;
- }
- case cCompositeChat::ptUrl:
- {
- Msg.append(((cCompositeChat::cUrlPart *)(*itr))->m_Url);
- break;
- }
- } // switch (PartType)
- } // for itr - Parts[]
// Send the message:
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_CHAT);
- WriteString(Msg);
+ WriteString(a_Message.ExtractText());
Flush();
}
@@ -1972,6 +1951,14 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob)
WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0); // Aggravated? Doesn't seem to do anything
break;
}
+ case cMonster::mtWither:
+ {
+ WriteByte(0x54); // Int at index 20
+ WriteInt(((const cWither &)a_Mob).GetNumInvulnerableTicks());
+ WriteByte(0x66); // Float at index 6
+ WriteFloat((float)(a_Mob.GetHealth()));
+ break;
+ }
case cMonster::mtSlime:
case cMonster::mtMagmaCube:
{
diff --git a/src/Protocol/Protocol16x.cpp b/src/Protocol/Protocol16x.cpp
index f6ec0a199..ecb24254f 100644
--- a/src/Protocol/Protocol16x.cpp
+++ b/src/Protocol/Protocol16x.cpp
@@ -135,7 +135,7 @@ void cProtocol161::SendPlayerMaxSpeed(void)
WriteInt(m_Client->GetPlayer()->GetUniqueID());
WriteInt(1);
WriteString("generic.movementSpeed");
- WriteDouble(m_Client->GetPlayer()->GetMaxSpeed());
+ WriteDouble(0.1 * m_Client->GetPlayer()->GetMaxSpeed());
Flush();
}
@@ -267,7 +267,7 @@ void cProtocol162::SendPlayerMaxSpeed(void)
WriteInt(m_Client->GetPlayer()->GetUniqueID());
WriteInt(1);
WriteString("generic.movementSpeed");
- WriteDouble(m_Client->GetPlayer()->GetMaxSpeed());
+ WriteDouble(0.1 * m_Client->GetPlayer()->GetMaxSpeed());
WriteShort(0);
Flush();
}
diff --git a/src/Protocol/Protocol17x.cpp b/src/Protocol/Protocol17x.cpp
index 6fc344eaf..c678fc9a0 100644
--- a/src/Protocol/Protocol17x.cpp
+++ b/src/Protocol/Protocol17x.cpp
@@ -687,9 +687,8 @@ void cProtocol172::SendPlayerAbilities(void)
Flags |= 0x04;
}
Pkt.WriteByte(Flags);
- // TODO: Pkt.WriteFloat(m_Client->GetPlayer()->GetMaxFlyingSpeed());
- Pkt.WriteFloat(0.05f);
- Pkt.WriteFloat((float)m_Client->GetPlayer()->GetMaxSpeed());
+ Pkt.WriteFloat((float)(0.05 * m_Client->GetPlayer()->GetFlyingMaxSpeed()));
+ Pkt.WriteFloat((float)(0.1 * m_Client->GetPlayer()->GetMaxSpeed()));
}
@@ -743,13 +742,14 @@ void cProtocol172::SendPlayerMaxSpeed(void)
Pkt.WriteInt(m_Client->GetPlayer()->GetUniqueID());
Pkt.WriteInt(1); // Count
Pkt.WriteString("generic.movementSpeed");
- Pkt.WriteDouble(0.1);
+ // The default game speed is 0.1, multiply that value by the relative speed:
+ Pkt.WriteDouble(0.1 * m_Client->GetPlayer()->GetNormalMaxSpeed());
if (m_Client->GetPlayer()->IsSprinting())
{
Pkt.WriteShort(1); // Modifier count
Pkt.WriteInt64(0x662a6b8dda3e4c1c);
Pkt.WriteInt64(0x881396ea6097278d); // UUID of the modifier
- Pkt.WriteDouble(0.3);
+ Pkt.WriteDouble(m_Client->GetPlayer()->GetSprintingMaxSpeed() - m_Client->GetPlayer()->GetNormalMaxSpeed());
Pkt.WriteByte(2);
}
else
@@ -2535,6 +2535,7 @@ void cProtocol172::cPacketizer::WriteEntityMetadata(const cEntity & a_Entity)
WriteByte(Frame.GetRotation());
break;
}
+ default: break;
}
}
@@ -2659,6 +2660,15 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob)
WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0);
break;
}
+
+ case cMonster::mtWither:
+ {
+ WriteByte(0x54); // Int at index 20
+ WriteInt(((const cWither &)a_Mob).GetNumInvulnerableTicks());
+ WriteByte(0x66); // Float at index 6
+ WriteFloat((float)(a_Mob.GetHealth()));
+ break;
+ }
case cMonster::mtSlime:
{
diff --git a/src/RCONServer.h b/src/RCONServer.h
index 0e89800a2..88aac4b5f 100644
--- a/src/RCONServer.h
+++ b/src/RCONServer.h
@@ -29,7 +29,7 @@ class cRCONServer :
{
public:
cRCONServer(cServer & a_Server);
- ~cRCONServer();
+ virtual ~cRCONServer();
void Initialize(cIniFile & a_IniFile);
diff --git a/src/Root.cpp b/src/Root.cpp
index 3555afb45..ba4398b35 100644
--- a/src/Root.cpp
+++ b/src/Root.cpp
@@ -304,6 +304,7 @@ void cRoot::LoadWorlds(cIniFile & IniFile)
{
if (IniFile.GetKeyComment("Worlds", 0) != " World=secondworld")
{
+ IniFile.DeleteKeyComment("Worlds", 0);
IniFile.AddKeyComment("Worlds", " World=secondworld");
}
}
diff --git a/src/Scoreboard.cpp b/src/Scoreboard.cpp
index 8088e624b..4c89ce265 100644
--- a/src/Scoreboard.cpp
+++ b/src/Scoreboard.cpp
@@ -30,9 +30,13 @@ AString cObjective::TypeToString(eType a_Type)
case otStatBlockMine: return "stat.mineBlock";
case otStatEntityKill: return "stat.killEntity";
case otStatEntityKilledBy: return "stat.entityKilledBy";
-
+
+ // clang optimisises this line away then warns that it has done so.
+ #if !defined(__clang__)
default: return "";
+ #endif
}
+
}
diff --git a/src/Simulator/FireSimulator.cpp b/src/Simulator/FireSimulator.cpp
index 26712e6e6..470dfc791 100644
--- a/src/Simulator/FireSimulator.cpp
+++ b/src/Simulator/FireSimulator.cpp
@@ -6,6 +6,8 @@
#include "../BlockID.h"
#include "../Defines.h"
#include "../Chunk.h"
+#include "Root.h"
+#include "../Bindings/PluginManager.h"
@@ -315,9 +317,15 @@ void cFireSimulator::TrySpreadFire(cChunk * a_Chunk, int a_RelX, int a_RelY, int
*/
if (CanStartFireInBlock(a_Chunk, x, y, z))
{
- FLOG("FS: Starting new fire at {%d, %d, %d}.",
- x + a_Chunk->GetPosX() * cChunkDef::Width, y, z + a_Chunk->GetPosZ() * cChunkDef::Width
- );
+ int a_PosX = x + a_Chunk->GetPosX() * cChunkDef::Width;
+ int a_PosZ = z + a_Chunk->GetPosZ() * cChunkDef::Width;
+
+ if (cRoot::Get()->GetPluginManager()->CallHookBlockSpread(&m_World, a_PosX, y, a_PosZ, ssFireSpread))
+ {
+ return;
+ }
+
+ FLOG("FS: Starting new fire at {%d, %d, %d}.", a_PosX, y, a_PosZ);
a_Chunk->UnboundedRelSetBlock(x, y, z, E_BLOCK_FIRE, 0);
}
} // for y
diff --git a/src/Simulator/FluidSimulator.cpp b/src/Simulator/FluidSimulator.cpp
index 61c93ed73..7779573d7 100644
--- a/src/Simulator/FluidSimulator.cpp
+++ b/src/Simulator/FluidSimulator.cpp
@@ -36,6 +36,7 @@ bool cFluidSimulator::CanWashAway(BLOCKTYPE a_BlockType)
case E_BLOCK_COBWEB:
case E_BLOCK_CROPS:
case E_BLOCK_DEAD_BUSH:
+ case E_BLOCK_LILY_PAD:
case E_BLOCK_RAIL:
case E_BLOCK_REDSTONE_TORCH_OFF:
case E_BLOCK_REDSTONE_TORCH_ON:
diff --git a/src/Simulator/IncrementalRedstoneSimulator.cpp b/src/Simulator/IncrementalRedstoneSimulator.cpp
index ca2ef4b1a..92659fab7 100644
--- a/src/Simulator/IncrementalRedstoneSimulator.cpp
+++ b/src/Simulator/IncrementalRedstoneSimulator.cpp
@@ -838,8 +838,8 @@ void cIncrementalRedstoneSimulator::HandleTNT(int a_BlockX, int a_BlockY, int a_
if (AreCoordsPowered(a_BlockX, a_BlockY, a_BlockZ))
{
m_World.BroadcastSoundEffect("game.tnt.primed", a_BlockX * 8, a_BlockY * 8, a_BlockZ * 8, 0.5f, 0.6f);
- m_World.SpawnPrimedTNT(a_BlockX + 0.5, a_BlockY + 0.5, a_BlockZ + 0.5); // 80 ticks to boom
m_World.SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+ m_World.SpawnPrimedTNT(a_BlockX + 0.5, a_BlockY + 0.5, a_BlockZ + 0.5); // 80 ticks to boom
}
}
@@ -1062,7 +1062,7 @@ void cIncrementalRedstoneSimulator::HandlePressurePlate(int a_BlockX, int a_Bloc
{
Vector3f EntityPos = a_Entity->GetPosition();
Vector3f BlockPos(m_X + 0.5f, (float)m_Y, m_Z + 0.5f);
- float Distance = (EntityPos - BlockPos).Length();
+ double Distance = (EntityPos - BlockPos).Length();
if (Distance <= 0.7)
{
diff --git a/src/StringCompression.cpp b/src/StringCompression.cpp
index 5b9a3bb0a..2a85649a1 100644
--- a/src/StringCompression.cpp
+++ b/src/StringCompression.cpp
@@ -53,7 +53,7 @@ int UncompressString(const char * a_Data, int a_Length, AString & a_Uncompressed
-int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed)
+int CompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Compressed)
{
// Compress a_Data into a_Compressed using GZIP; return Z_XXX error constants same as zlib's compress2()
@@ -83,6 +83,7 @@ int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed
{
// Some data has been compressed. Consume the buffer and continue compressing
a_Compressed.append(Buffer, sizeof(Buffer) - strm.avail_out);
+ strm.next_out = (Bytef *)Buffer;
strm.avail_out = sizeof(Buffer);
if (strm.avail_in == 0)
{
@@ -116,7 +117,7 @@ int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed
-extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_Uncompressed)
+extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Uncompressed)
{
// Uncompresses a_Data into a_Uncompressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib
@@ -139,13 +140,14 @@ extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_U
for (;;)
{
- res = inflate(&strm, Z_FINISH);
+ res = inflate(&strm, Z_NO_FLUSH);
switch (res)
{
case Z_OK:
{
// Some data has been uncompressed. Consume the buffer and continue uncompressing
a_Uncompressed.append(Buffer, sizeof(Buffer) - strm.avail_out);
+ strm.next_out = (Bytef *)Buffer;
strm.avail_out = sizeof(Buffer);
if (strm.avail_in == 0)
{
diff --git a/src/StringCompression.h b/src/StringCompression.h
index 3f4e12d2d..c3a9eca91 100644
--- a/src/StringCompression.h
+++ b/src/StringCompression.h
@@ -16,10 +16,10 @@ extern int CompressString(const char * a_Data, int a_Length, AString & a_Compres
extern int UncompressString(const char * a_Data, int a_Length, AString & a_Uncompressed, int a_UncompressedSize);
/// Compresses a_Data into a_Compressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib
-extern int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed);
+extern int CompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Compressed);
/// Uncompresses a_Data into a_Uncompressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib
-extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_Uncompressed);
+extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Uncompressed);
diff --git a/src/StringUtils.cpp b/src/StringUtils.cpp
index 3f9275798..ad622d707 100644
--- a/src/StringUtils.cpp
+++ b/src/StringUtils.cpp
@@ -454,7 +454,6 @@ AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a
if (!isLegalUTF8(source, extraBytesToRead + 1))
{
return a_UTF16;
- break;
}
// The cases all fall through. See "Note A" below.
diff --git a/src/StringUtils.h b/src/StringUtils.h
index 4feff7553..da395e5b5 100644
--- a/src/StringUtils.h
+++ b/src/StringUtils.h
@@ -79,10 +79,10 @@ extern AString URLDecode(const AString & a_String); // Cannot export to Lua aut
extern AString ReplaceAllCharOccurrences(const AString & a_String, char a_From, char a_To); // Needn't export to Lua, since Lua doesn't have chars anyway
/// Decodes a Base64-encoded string into the raw data
-extern AString Base64Decode(const AString & a_Base64String);
+extern AString Base64Decode(const AString & a_Base64String); // Exported manually due to embedded NULs and extra parameter
/// Encodes a string into Base64
-extern AString Base64Encode(const AString & a_Input);
+extern AString Base64Encode(const AString & a_Input); // Exported manually due to embedded NULs and extra parameter
/// Reads two bytes from the specified memory location and interprets them as BigEndian short
extern short GetBEShort(const char * a_Mem);
diff --git a/src/UI/WindowOwner.h b/src/UI/WindowOwner.h
index d41abf66d..e3c73edc4 100644
--- a/src/UI/WindowOwner.h
+++ b/src/UI/WindowOwner.h
@@ -33,6 +33,10 @@ public:
{
}
+ virtual ~cWindowOwner()
+ {
+ }
+
void CloseWindow(void)
{
m_Window = NULL;
diff --git a/src/Vector3.h b/src/Vector3.h
index ba4abe3eb..a00e14508 100644
--- a/src/Vector3.h
+++ b/src/Vector3.h
@@ -121,6 +121,13 @@ public:
z += a_Z;
}
+ inline void Move(const Vector3 & a_Diff)
+ {
+ x += a_Diff.x;
+ y += a_Diff.y;
+ z += a_Diff.z;
+ }
+
// tolua_end
inline void operator += (const Vector3 & a_Rhs)
diff --git a/src/World.cpp b/src/World.cpp
index 012ba915b..e39a605bb 100644
--- a/src/World.cpp
+++ b/src/World.cpp
@@ -60,9 +60,6 @@
-/// Up to this many m_SpreadQueue elements are handled each world tick
-const int MAX_LIGHTING_SPREAD_PER_TICK = 10;
-
const int TIME_SUNSET = 12000;
const int TIME_NIGHT_START = 13187;
const int TIME_NIGHT_END = 22812;
@@ -250,8 +247,6 @@ cWorld::cWorld(const AString & a_WorldName) :
m_SkyDarkness(0),
m_Weather(eWeather_Sunny),
m_WeatherInterval(24000), // Guaranteed 1 day of sunshine at server start :)
- m_bCommandBlocksEnabled(false),
- m_bUseChatPrefixes(true),
m_Scoreboard(this),
m_MapManager(this),
m_GeneratorCallbacks(*this),
@@ -562,29 +557,33 @@ void cWorld::Start(void)
m_SpawnZ = IniFile.GetValueF("SpawnPosition", "Z", m_SpawnZ);
}
- m_StorageSchema = IniFile.GetValueSet ("Storage", "Schema", m_StorageSchema);
- m_StorageCompressionFactor = IniFile.GetValueSetI("Storage", "CompressionFactor", m_StorageCompressionFactor);
- m_MaxCactusHeight = IniFile.GetValueSetI("Plants", "MaxCactusHeight", 3);
- m_MaxSugarcaneHeight = IniFile.GetValueSetI("Plants", "MaxSugarcaneHeight", 3);
- m_IsCactusBonemealable = IniFile.GetValueSetB("Plants", "IsCactusBonemealable", false);
- m_IsCarrotsBonemealable = IniFile.GetValueSetB("Plants", "IsCarrotsBonemealable", true);
- m_IsCropsBonemealable = IniFile.GetValueSetB("Plants", "IsCropsBonemealable", true);
- m_IsGrassBonemealable = IniFile.GetValueSetB("Plants", "IsGrassBonemealable", true);
- m_IsMelonStemBonemealable = IniFile.GetValueSetB("Plants", "IsMelonStemBonemealable", true);
- m_IsMelonBonemealable = IniFile.GetValueSetB("Plants", "IsMelonBonemealable", false);
- m_IsPotatoesBonemealable = IniFile.GetValueSetB("Plants", "IsPotatoesBonemealable", true);
- m_IsPumpkinStemBonemealable = IniFile.GetValueSetB("Plants", "IsPumpkinStemBonemealable", true);
- m_IsPumpkinBonemealable = IniFile.GetValueSetB("Plants", "IsPumpkinBonemealable", false);
- m_IsSaplingBonemealable = IniFile.GetValueSetB("Plants", "IsSaplingBonemealable", true);
- m_IsSugarcaneBonemealable = IniFile.GetValueSetB("Plants", "IsSugarcaneBonemealable", false);
- m_IsDeepSnowEnabled = IniFile.GetValueSetB("Physics", "DeepSnow", true);
- m_ShouldLavaSpawnFire = IniFile.GetValueSetB("Physics", "ShouldLavaSpawnFire", true);
- m_bCommandBlocksEnabled = IniFile.GetValueSetB("Mechanics", "CommandBlocksEnabled", false);
- m_bEnabledPVP = IniFile.GetValueSetB("Mechanics", "PVPEnabled", true);
- m_bUseChatPrefixes = IniFile.GetValueSetB("Mechanics", "UseChatPrefixes", true);
- m_VillagersShouldHarvestCrops = IniFile.GetValueSetB("Monsters", "VillagersShouldHarvestCrops", true);
-
- m_GameMode = (eGameMode)IniFile.GetValueSetI("General", "Gamemode", m_GameMode);
+ m_StorageSchema = IniFile.GetValueSet ("Storage", "Schema", m_StorageSchema);
+ m_StorageCompressionFactor = IniFile.GetValueSetI("Storage", "CompressionFactor", m_StorageCompressionFactor);
+ m_MaxCactusHeight = IniFile.GetValueSetI("Plants", "MaxCactusHeight", 3);
+ m_MaxSugarcaneHeight = IniFile.GetValueSetI("Plants", "MaxSugarcaneHeight", 3);
+ m_IsCactusBonemealable = IniFile.GetValueSetB("Plants", "IsCactusBonemealable", false);
+ m_IsCarrotsBonemealable = IniFile.GetValueSetB("Plants", "IsCarrotsBonemealable", true);
+ m_IsCropsBonemealable = IniFile.GetValueSetB("Plants", "IsCropsBonemealable", true);
+ m_IsGrassBonemealable = IniFile.GetValueSetB("Plants", "IsGrassBonemealable", true);
+ m_IsMelonStemBonemealable = IniFile.GetValueSetB("Plants", "IsMelonStemBonemealable", true);
+ m_IsMelonBonemealable = IniFile.GetValueSetB("Plants", "IsMelonBonemealable", false);
+ m_IsPotatoesBonemealable = IniFile.GetValueSetB("Plants", "IsPotatoesBonemealable", true);
+ m_IsPumpkinStemBonemealable = IniFile.GetValueSetB("Plants", "IsPumpkinStemBonemealable", true);
+ m_IsPumpkinBonemealable = IniFile.GetValueSetB("Plants", "IsPumpkinBonemealable", false);
+ m_IsSaplingBonemealable = IniFile.GetValueSetB("Plants", "IsSaplingBonemealable", true);
+ m_IsSugarcaneBonemealable = IniFile.GetValueSetB("Plants", "IsSugarcaneBonemealable", false);
+ m_IsDeepSnowEnabled = IniFile.GetValueSetB("Physics", "DeepSnow", true);
+ m_ShouldLavaSpawnFire = IniFile.GetValueSetB("Physics", "ShouldLavaSpawnFire", true);
+ int TNTShrapnelLevel = IniFile.GetValueSetI("Physics", "TNTShrapnelLevel", (int)slNone);
+ m_bCommandBlocksEnabled = IniFile.GetValueSetB("Mechanics", "CommandBlocksEnabled", false);
+ m_bEnabledPVP = IniFile.GetValueSetB("Mechanics", "PVPEnabled", true);
+ m_bUseChatPrefixes = IniFile.GetValueSetB("Mechanics", "UseChatPrefixes", true);
+ m_VillagersShouldHarvestCrops = IniFile.GetValueSetB("Monsters", "VillagersShouldHarvestCrops", true);
+ int GameMode = IniFile.GetValueSetI("General", "Gamemode", (int)m_GameMode);
+
+ // Adjust the enum-backed variables into their respective bounds:
+ m_GameMode = (eGameMode) Clamp(GameMode, (int)gmSurvival, (int)gmAdventure);
+ m_TNTShrapnelLevel = (eShrapnelLevel)Clamp(TNTShrapnelLevel, (int)slNone, (int)slAll);
// Load allowed mobs:
const char * DefaultMonsters = "";
@@ -1727,10 +1726,13 @@ int cWorld::SpawnMinecart(double a_X, double a_Y, double a_Z, int a_MinecartType
void cWorld::SpawnPrimedTNT(double a_X, double a_Y, double a_Z, int a_FuseTicks, double a_InitialVelocityCoeff)
{
- UNUSED(a_InitialVelocityCoeff);
cTNTEntity * TNT = new cTNTEntity(a_X, a_Y, a_Z, a_FuseTicks);
TNT->Initialize(this);
- // TODO: Add a bit of speed in horiz and vert axes, based on the a_InitialVelocityCoeff
+ TNT->SetSpeed(
+ a_InitialVelocityCoeff * (GetTickRandomNumber(2) - 1), /** -1, 0, 1 */
+ a_InitialVelocityCoeff * 2,
+ a_InitialVelocityCoeff * (GetTickRandomNumber(2) - 1)
+ );
}
diff --git a/src/World.h b/src/World.h
index a772710ab..b3ee94a27 100644
--- a/src/World.h
+++ b/src/World.h
@@ -125,15 +125,16 @@ public:
// tolua_begin
int GetTicksUntilWeatherChange(void) const { return m_WeatherInterval; }
- virtual Int64 GetWorldAge(void) const { return m_WorldAge; }
- virtual Int64 GetTimeOfDay(void) const { return m_TimeOfDay; }
+
+ virtual Int64 GetWorldAge (void) const { return m_WorldAge; } // override, cannot specify due to tolua
+ virtual Int64 GetTimeOfDay(void) const { return m_TimeOfDay; } // override, cannot specify due to tolua
void SetTicksUntilWeatherChange(int a_WeatherInterval)
{
m_WeatherInterval = a_WeatherInterval;
}
- void SetTimeOfDay(Int64 a_TimeOfDay)
+ virtual void SetTimeOfDay(Int64 a_TimeOfDay) // override, cannot specify due to tolua
{
m_TimeOfDay = a_TimeOfDay;
m_TimeOfDaySecs = (double)a_TimeOfDay / 20.0;
@@ -191,35 +192,35 @@ public:
void BroadcastChat (const cCompositeChat & a_Message, const cClientHandle * a_Exclude = NULL);
// tolua_end
- void BroadcastChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer, const cClientHandle * a_Exclude = NULL);
- void BroadcastCollectPickup (const cPickup & a_Pickup, const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL);
- void BroadcastDestroyEntity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
- void BroadcastEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration, const cClientHandle * a_Exclude = NULL);
- void BroadcastEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item, const cClientHandle * a_Exclude = NULL);
- void BroadcastEntityHeadLook (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
- void BroadcastEntityLook (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
- void BroadcastEntityMetadata (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
- void BroadcastEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL);
- void BroadcastEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL);
- void BroadcastEntityStatus (const cEntity & a_Entity, char a_Status, const cClientHandle * a_Exclude = NULL);
- void BroadcastEntityVelocity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
- void BroadcastEntityAnimation (const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL);
- void BroadcastParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude = NULL); // tolua_export
- void BroadcastPlayerListItem (const cPlayer & a_Player, bool a_IsOnline, const cClientHandle * a_Exclude = NULL);
- void BroadcastRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL);
- void BroadcastScoreboardObjective(const AString & a_Name, const AString & a_DisplayName, Byte a_Mode);
- void BroadcastScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode);
- void BroadcastDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display);
- void BroadcastSoundEffect (const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL); // tolua_export a_Src coords are Block * 8
- void BroadcastSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL); // tolua_export
- void BroadcastSpawnEntity (cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
- void BroadcastTeleportEntity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
- void BroadcastThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL);
- void BroadcastTimeUpdate (const cClientHandle * a_Exclude = NULL);
- virtual void BroadcastUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ );
- void BroadcastWeather (eWeather a_Weather, const cClientHandle * a_Exclude = NULL);
+ void BroadcastChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer, const cClientHandle * a_Exclude = NULL);
+ void BroadcastCollectPickup (const cPickup & a_Pickup, const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL);
+ void BroadcastDestroyEntity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+ void BroadcastEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration, const cClientHandle * a_Exclude = NULL);
+ void BroadcastEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item, const cClientHandle * a_Exclude = NULL);
+ void BroadcastEntityHeadLook (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+ void BroadcastEntityLook (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+ void BroadcastEntityMetadata (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+ void BroadcastEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL);
+ void BroadcastEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL);
+ void BroadcastEntityStatus (const cEntity & a_Entity, char a_Status, const cClientHandle * a_Exclude = NULL);
+ void BroadcastEntityVelocity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+ virtual void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL) override;
+ void BroadcastParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude = NULL); // tolua_export
+ void BroadcastPlayerListItem (const cPlayer & a_Player, bool a_IsOnline, const cClientHandle * a_Exclude = NULL);
+ void BroadcastRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL);
+ void BroadcastScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode);
+ void BroadcastScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode);
+ void BroadcastDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display);
+ void BroadcastSoundEffect (const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL); // tolua_export a_Src coords are Block * 8
+ void BroadcastSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL); // tolua_export
+ void BroadcastSpawnEntity (cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+ void BroadcastTeleportEntity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+ void BroadcastThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL);
+ void BroadcastTimeUpdate (const cClientHandle * a_Exclude = NULL);
+ virtual void BroadcastUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) override;
+ void BroadcastWeather (eWeather a_Weather, const cClientHandle * a_Exclude = NULL);
- virtual cBroadcastInterface & GetBroadcastManager()
+ virtual cBroadcastInterface & GetBroadcastManager(void) override
{
return *this;
}
@@ -273,7 +274,7 @@ public:
void RemovePlayer( cPlayer* a_Player );
/** Calls the callback for each player in the list; returns true if all players processed, false if the callback aborted by returning true */
- bool ForEachPlayer(cPlayerListCallback & a_Callback); // >> EXPORTED IN MANUALBINDINGS <<
+ virtual bool ForEachPlayer(cPlayerListCallback & a_Callback) override; // >> EXPORTED IN MANUALBINDINGS <<
/** Calls the callback for the player of the given name; returns true if the player was found and the callback called, false if player not found. Callback return ignored */
bool DoWithPlayer(const AString & a_PlayerName, cPlayerListCallback & a_Callback); // >> EXPORTED IN MANUALBINDINGS <<
@@ -365,7 +366,7 @@ public:
bool IsChunkLighted(int a_ChunkX, int a_ChunkZ);
/** Calls the callback for each chunk in the coords specified (all cords are inclusive). Returns true if all chunks have been processed successfully */
- virtual bool ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback);
+ virtual bool ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback) override;
// tolua_begin
@@ -456,7 +457,7 @@ public:
// tolua_begin
bool DigBlock (int a_X, int a_Y, int a_Z);
- virtual void SendBlockTo(int a_X, int a_Y, int a_Z, cPlayer * a_Player);
+ virtual void SendBlockTo(int a_X, int a_Y, int a_Z, cPlayer * a_Player); // override, cannot specify due to tolua
double GetSpawnX(void) const { return m_SpawnX; }
double GetSpawnY(void) const { return m_SpawnY; }
@@ -496,18 +497,18 @@ public:
/** Does an explosion with the specified strength at the specified coordinate
a_SourceData exact type depends on the a_Source:
- | esOther | void * |
- | esPrimedTNT | cTNTEntity * |
- | esMonster | cMonster * |
- | esBed | cVector3i * |
- | esEnderCrystal | Vector3i * |
- | esGhastFireball | cGhastFireball * |
- | esWitherSkullBlack | TBD |
- | esWitherSkullBlue | TBD |
- | esWitherBirth | TBD |
- | esPlugin | void * |
+ | esOther | void * |
+ | esPrimedTNT | cTNTEntity * |
+ | esMonster | cMonster * |
+ | esBed | cVector3i * |
+ | esEnderCrystal | Vector3i * |
+ | esGhastFireball | cGhastFireball * |
+ | esWitherSkullBlack | TBD |
+ | esWitherSkullBlue | TBD |
+ | esWitherBirth | cMonster * |
+ | esPlugin | void * |
*/
- virtual void DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_BlockY, double a_BlockZ, bool a_CanCauseFire, eExplosionSource a_Source, void * a_SourceData); // tolua_export
+ virtual void DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_BlockY, double a_BlockZ, bool a_CanCauseFire, eExplosionSource a_Source, void * a_SourceData); // tolua_export // override, cannot specify due to tolua
/** Calls the callback for the block entity at the specified coords; returns false if there's no block entity at those coords, true if found */
bool DoWithBlockEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBlockEntityCallback & a_Callback); // Exported in ManualBindings.cpp
@@ -604,6 +605,9 @@ public:
bool AreCommandBlocksEnabled(void) const { return m_bCommandBlocksEnabled; }
void SetCommandBlocksEnabled(bool a_Flag) { m_bCommandBlocksEnabled = a_Flag; }
+ eShrapnelLevel GetTNTShrapnelLevel(void) const { return m_TNTShrapnelLevel; }
+ void SetTNTShrapnelLevel(eShrapnelLevel a_Flag) { m_TNTShrapnelLevel = a_Flag; }
+
bool ShouldUseChatPrefixes(void) const { return m_bUseChatPrefixes; }
void SetShouldUseChatPrefixes(bool a_Flag) { m_bUseChatPrefixes = a_Flag; }
@@ -642,9 +646,9 @@ public:
// Various queues length queries (cannot be const, they lock their CS):
inline int GetGeneratorQueueLength (void) { return m_Generator.GetQueueLength(); } // tolua_export
- inline int GetLightingQueueLength (void) { return m_Lighting.GetQueueLength(); } // tolua_export
- inline int GetStorageLoadQueueLength(void) { return m_Storage.GetLoadQueueLength(); } // tolua_export
- inline int GetStorageSaveQueueLength(void) { return m_Storage.GetSaveQueueLength(); } // tolua_export
+ inline size_t GetLightingQueueLength (void) { return m_Lighting.GetQueueLength(); } // tolua_export
+ inline size_t GetStorageLoadQueueLength(void) { return m_Storage.GetLoadQueueLength(); } // tolua_export
+ inline size_t GetStorageSaveQueueLength(void) { return m_Storage.GetSaveQueueLength(); } // tolua_export
void InitializeSpawn(void);
@@ -703,7 +707,7 @@ public:
bool IsBlockDirectlyWatered(int a_BlockX, int a_BlockY, int a_BlockZ); // tolua_export
/** Spawns a mob of the specified type. Returns the mob's EntityID if recognized and spawned, <0 otherwise */
- virtual int SpawnMob(double a_PosX, double a_PosY, double a_PosZ, cMonster::eType a_MonsterType); // tolua_export
+ virtual int SpawnMob(double a_PosX, double a_PosY, double a_PosZ, cMonster::eType a_MonsterType); // tolua_export // override, cannot specify due to tolua
int SpawnMobFinalize(cMonster* a_Monster);
/** Creates a projectile of the specified type. Returns the projectile's EntityID if successful, <0 otherwise */
@@ -861,6 +865,11 @@ private:
/** Whether prefixes such as [INFO] are prepended to SendMessageXXX() / BroadcastChatXXX() functions */
bool m_bUseChatPrefixes;
+
+ /** The level of DoExplosionAt() projecting random affected blocks as FallingBlock entities
+ See the eShrapnelLevel enumeration for details
+ */
+ eShrapnelLevel m_TNTShrapnelLevel;
cChunkGenerator m_Generator;
diff --git a/src/WorldStorage/FireworksSerializer.cpp b/src/WorldStorage/FireworksSerializer.cpp
index 3c97ae0a2..744fc731f 100644
--- a/src/WorldStorage/FireworksSerializer.cpp
+++ b/src/WorldStorage/FireworksSerializer.cpp
@@ -20,8 +20,14 @@ void cFireworkItem::WriteToNBTCompound(const cFireworkItem & a_FireworkItem, cFa
a_Writer.AddByte("Flicker", a_FireworkItem.m_HasFlicker);
a_Writer.AddByte("Trail", a_FireworkItem.m_HasTrail);
a_Writer.AddByte("Type", a_FireworkItem.m_Type);
- a_Writer.AddIntArray("Colors", &(a_FireworkItem.m_Colours[0]), a_FireworkItem.m_Colours.size());
- a_Writer.AddIntArray("FadeColors", &(a_FireworkItem.m_FadeColours[0]), a_FireworkItem.m_FadeColours.size());
+ if (!a_FireworkItem.m_Colours.empty())
+ {
+ a_Writer.AddIntArray("Colors", &(a_FireworkItem.m_Colours[0]), a_FireworkItem.m_Colours.size());
+ }
+ if (!a_FireworkItem.m_FadeColours.empty())
+ {
+ a_Writer.AddIntArray("FadeColors", &(a_FireworkItem.m_FadeColours[0]), a_FireworkItem.m_FadeColours.size());
+ }
a_Writer.EndCompound();
a_Writer.EndList();
a_Writer.EndCompound();
diff --git a/src/WorldStorage/MapSerializer.cpp b/src/WorldStorage/MapSerializer.cpp
index a4a0aab57..df72d1cc9 100644
--- a/src/WorldStorage/MapSerializer.cpp
+++ b/src/WorldStorage/MapSerializer.cpp
@@ -141,7 +141,11 @@ bool cMapSerializer::LoadMapFromNBT(const cParsedNBT & a_NBT)
{
eDimension Dimension = (eDimension) a_NBT.GetByte(CurrLine);
- ASSERT(Dimension == m_Map->m_World->GetDimension());
+ if (Dimension != m_Map->m_World->GetDimension())
+ {
+ // TODO 2014-03-20 xdot: We should store nether maps in nether worlds, e.t.c.
+ return false;
+ }
}
CurrLine = a_NBT.FindChildByName(Data, "width");
diff --git a/src/WorldStorage/NBTChunkSerializer.cpp b/src/WorldStorage/NBTChunkSerializer.cpp
index 4cf3c62d7..415693ae2 100644
--- a/src/WorldStorage/NBTChunkSerializer.cpp
+++ b/src/WorldStorage/NBTChunkSerializer.cpp
@@ -23,12 +23,16 @@
#include "../BlockEntities/FlowerPotEntity.h"
#include "../Entities/Entity.h"
+#include "../Entities/EnderCrystal.h"
#include "../Entities/FallingBlock.h"
#include "../Entities/Boat.h"
#include "../Entities/Minecart.h"
#include "../Entities/Pickup.h"
#include "../Entities/ProjectileEntity.h"
#include "../Entities/TNTEntity.h"
+#include "../Entities/ExpOrb.h"
+#include "../Entities/HangingEntity.h"
+#include "../Entities/ItemFrame.h"
#include "../Mobs/Monster.h"
#include "../Mobs/Bat.h"
@@ -40,6 +44,7 @@
#include "../Mobs/Slime.h"
#include "../Mobs/Skeleton.h"
#include "../Mobs/Villager.h"
+#include "../Mobs/Wither.h"
#include "../Mobs/Wolf.h"
#include "../Mobs/Zombie.h"
@@ -332,6 +337,17 @@ void cNBTChunkSerializer::AddBoatEntity(cBoat * a_Boat)
+void cNBTChunkSerializer::AddEnderCrystalEntity(cEnderCrystal * a_EnderCrystal)
+{
+ m_Writer.BeginCompound("");
+ AddBasicEntity(a_EnderCrystal, "EnderCrystal");
+ m_Writer.EndCompound();
+}
+
+
+
+
+
void cNBTChunkSerializer::AddFallingBlockEntity(cFallingBlock * a_FallingBlock)
{
m_Writer.BeginCompound("");
@@ -419,7 +435,7 @@ void cNBTChunkSerializer::AddMonsterEntity(cMonster * a_Monster)
case cMonster::mtSquid: EntityClass = "Squid"; break;
case cMonster::mtVillager: EntityClass = "Villager"; break;
case cMonster::mtWitch: EntityClass = "Witch"; break;
- case cMonster::mtWither: EntityClass = "Wither"; break;
+ case cMonster::mtWither: EntityClass = "WitherBoss"; break;
case cMonster::mtWolf: EntityClass = "Wolf"; break;
case cMonster::mtZombie: EntityClass = "Zombie"; break;
case cMonster::mtZombiePigman: EntityClass = "PigZombie"; break;
@@ -498,6 +514,11 @@ void cNBTChunkSerializer::AddMonsterEntity(cMonster * a_Monster)
m_Writer.AddInt("Profession", ((const cVillager *)a_Monster)->GetVilType());
break;
}
+ case cMonster::mtWither:
+ {
+ m_Writer.AddInt("Invul", ((const cWither *)a_Monster)->GetNumInvulnerableTicks());
+ break;
+ }
case cMonster::mtWolf:
{
m_Writer.AddString("Owner", ((const cWolf *)a_Monster)->GetOwner());
@@ -526,8 +547,8 @@ void cNBTChunkSerializer::AddPickupEntity(cPickup * a_Pickup)
m_Writer.BeginCompound("");
AddBasicEntity(a_Pickup, "Item");
AddItem(a_Pickup->GetItem(), -1, "Item");
- m_Writer.AddShort("Health", a_Pickup->GetHealth());
- m_Writer.AddShort("Age", a_Pickup->GetAge());
+ m_Writer.AddShort("Health", (Int16)(unsigned char)a_Pickup->GetHealth());
+ m_Writer.AddShort("Age", (Int16)a_Pickup->GetAge());
m_Writer.EndCompound();
}
@@ -592,6 +613,25 @@ void cNBTChunkSerializer::AddProjectileEntity(cProjectileEntity * a_Projectile)
+void cNBTChunkSerializer::AddHangingEntity(cHangingEntity * a_Hanging)
+{
+ m_Writer.AddByte("Direction", (unsigned char)a_Hanging->GetDirection());
+ m_Writer.AddInt("TileX", a_Hanging->GetTileX());
+ m_Writer.AddInt("TileY", a_Hanging->GetTileY());
+ m_Writer.AddInt("TileZ", a_Hanging->GetTileZ());
+ switch (a_Hanging->GetDirection())
+ {
+ case 0: m_Writer.AddByte("Dir", (unsigned char)2); break;
+ case 1: m_Writer.AddByte("Dir", (unsigned char)1); break;
+ case 2: m_Writer.AddByte("Dir", (unsigned char)0); break;
+ case 3: m_Writer.AddByte("Dir", (unsigned char)3); break;
+ }
+}
+
+
+
+
+
void cNBTChunkSerializer::AddTNTEntity(cTNTEntity * a_TNT)
{
m_Writer.BeginCompound("");
@@ -604,6 +644,35 @@ void cNBTChunkSerializer::AddTNTEntity(cTNTEntity * a_TNT)
+void cNBTChunkSerializer::AddExpOrbEntity(cExpOrb * a_ExpOrb)
+{
+ m_Writer.BeginCompound("");
+ AddBasicEntity(a_ExpOrb, "XPOrb");
+ m_Writer.AddShort("Health", (Int16)(unsigned char)a_ExpOrb->GetHealth());
+ m_Writer.AddShort("Age", (Int16)a_ExpOrb->GetAge());
+ m_Writer.AddShort("Value", (Int16)a_ExpOrb->GetReward());
+ m_Writer.EndCompound();
+}
+
+
+
+
+
+void cNBTChunkSerializer::AddItemFrameEntity(cItemFrame * a_ItemFrame)
+{
+ m_Writer.BeginCompound("");
+ AddBasicEntity(a_ItemFrame, "ItemFrame");
+ AddHangingEntity(a_ItemFrame);
+ AddItem(a_ItemFrame->GetItem(), -1, "Item");
+ m_Writer.AddByte("ItemRotation", (unsigned char)a_ItemFrame->GetRotation());
+ m_Writer.AddFloat("ItemDropChance", 1.0F);
+ m_Writer.EndCompound();
+}
+
+
+
+
+
void cNBTChunkSerializer::AddMinecartChestContents(cMinecartWithChest * a_Minecart)
{
m_Writer.BeginList("Items", TAG_Compound);
@@ -678,14 +747,15 @@ void cNBTChunkSerializer::Entity(cEntity * a_Entity)
switch (a_Entity->GetEntityType())
{
case cEntity::etBoat: AddBoatEntity ((cBoat *) a_Entity); break;
+ case cEntity::etEnderCrystal: AddEnderCrystalEntity((cEnderCrystal *) a_Entity); break;
case cEntity::etFallingBlock: AddFallingBlockEntity((cFallingBlock *) a_Entity); break;
case cEntity::etMinecart: AddMinecartEntity ((cMinecart *) a_Entity); break;
case cEntity::etMonster: AddMonsterEntity ((cMonster *) a_Entity); break;
case cEntity::etPickup: AddPickupEntity ((cPickup *) a_Entity); break;
case cEntity::etProjectile: AddProjectileEntity ((cProjectileEntity *)a_Entity); break;
case cEntity::etTNT: AddTNTEntity ((cTNTEntity *) a_Entity); break;
- case cEntity::etExpOrb: /* TODO */ break;
- case cEntity::etItemFrame: /* TODO */ break;
+ case cEntity::etExpOrb: AddExpOrbEntity ((cExpOrb *) a_Entity); break;
+ case cEntity::etItemFrame: AddItemFrameEntity ((cItemFrame *) a_Entity); break;
case cEntity::etPainting: /* TODO */ break;
case cEntity::etPlayer: return; // Players aren't saved into the world
default:
diff --git a/src/WorldStorage/NBTChunkSerializer.h b/src/WorldStorage/NBTChunkSerializer.h
index 3b486d2bc..51d104970 100644
--- a/src/WorldStorage/NBTChunkSerializer.h
+++ b/src/WorldStorage/NBTChunkSerializer.h
@@ -24,6 +24,7 @@ class cChestEntity;
class cCommandBlockEntity;
class cDispenserEntity;
class cDropperEntity;
+class cEnderCrystal;
class cFurnaceEntity;
class cHopperEntity;
class cJukeboxEntity;
@@ -42,6 +43,9 @@ class cPickup;
class cItemGrid;
class cProjectileEntity;
class cTNTEntity;
+class cExpOrb;
+class cHangingEntity;
+class cItemFrame;
@@ -103,12 +107,16 @@ protected:
// Entities:
void AddBasicEntity (cEntity * a_Entity, const AString & a_ClassName);
void AddBoatEntity (cBoat * a_Boat);
+ void AddEnderCrystalEntity(cEnderCrystal * a_EnderCrystal);
void AddFallingBlockEntity(cFallingBlock * a_FallingBlock);
void AddMinecartEntity (cMinecart * a_Minecart);
void AddMonsterEntity (cMonster * a_Monster);
void AddPickupEntity (cPickup * a_Pickup);
void AddProjectileEntity (cProjectileEntity * a_Projectile);
+ void AddHangingEntity (cHangingEntity * a_Hanging);
void AddTNTEntity (cTNTEntity * a_TNT);
+ void AddExpOrbEntity (cExpOrb * a_ExpOrb);
+ void AddItemFrameEntity (cItemFrame * a_ItemFrame);
void AddMinecartChestContents(cMinecartWithChest * a_Minecart);
diff --git a/src/WorldStorage/SchematicFileSerializer.cpp b/src/WorldStorage/SchematicFileSerializer.cpp
index ef67fdb13..9d594a084 100644
--- a/src/WorldStorage/SchematicFileSerializer.cpp
+++ b/src/WorldStorage/SchematicFileSerializer.cpp
@@ -14,6 +14,39 @@
+#ifdef SELF_TEST
+
+static class cSchematicStringSelfTest
+{
+public:
+ cSchematicStringSelfTest(void)
+ {
+ cBlockArea ba;
+ ba.Create(21, 256, 21);
+ ba.RelLine(0, 0, 0, 9, 8, 7, cBlockArea::baTypes | cBlockArea::baMetas, E_BLOCK_WOODEN_STAIRS, 1);
+ AString Schematic;
+ if (!cSchematicFileSerializer::SaveToSchematicString(ba, Schematic))
+ {
+ assert_test(!"Schematic failed to save!");
+ }
+ cBlockArea ba2;
+ if (!cSchematicFileSerializer::LoadFromSchematicString(ba2, Schematic))
+ {
+ assert_test(!"Schematic failed to load!");
+ }
+ }
+} g_SelfTest;
+
+#endif
+
+
+
+
+
+
+///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+// cSchematicFileSerializer:
+
bool cSchematicFileSerializer::LoadFromSchematicFile(cBlockArea & a_BlockArea, const AString & a_FileName)
{
// Un-GZip the contents:
@@ -197,7 +230,7 @@ bool cSchematicFileSerializer::LoadFromSchematicNBT(cBlockArea & a_BlockArea, cP
}
// Copy the block types and metas:
- int NumBytes = a_BlockArea.m_SizeX * a_BlockArea.m_SizeY * a_BlockArea.m_SizeZ;
+ int NumBytes = a_BlockArea.GetBlockCount();
if (a_NBT.GetDataLength(TBlockTypes) < NumBytes)
{
LOG("BlockTypes truncated in the schematic file (exp %d, got %d bytes). Loading partial.",
@@ -209,7 +242,7 @@ bool cSchematicFileSerializer::LoadFromSchematicNBT(cBlockArea & a_BlockArea, cP
if (AreMetasPresent)
{
- int NumBytes = a_BlockArea.m_SizeX * a_BlockArea.m_SizeY * a_BlockArea.m_SizeZ;
+ int NumBytes = a_BlockArea.GetBlockCount();
if (a_NBT.GetDataLength(TBlockMetas) < NumBytes)
{
LOG("BlockMetas truncated in the schematic file (exp %d, got %d bytes). Loading partial.",
@@ -230,9 +263,9 @@ bool cSchematicFileSerializer::LoadFromSchematicNBT(cBlockArea & a_BlockArea, cP
AString cSchematicFileSerializer::SaveToSchematicNBT(const cBlockArea & a_BlockArea)
{
cFastNBTWriter Writer("Schematic");
- Writer.AddShort("Width", a_BlockArea.m_SizeX);
- Writer.AddShort("Height", a_BlockArea.m_SizeY);
- Writer.AddShort("Length", a_BlockArea.m_SizeZ);
+ Writer.AddShort("Width", a_BlockArea.m_Size.x);
+ Writer.AddShort("Height", a_BlockArea.m_Size.y);
+ Writer.AddShort("Length", a_BlockArea.m_Size.z);
Writer.AddString("Materials", "Alpha");
if (a_BlockArea.HasBlockTypes())
{
diff --git a/src/WorldStorage/WSSAnvil.cpp b/src/WorldStorage/WSSAnvil.cpp
index 070738164..48934d074 100644
--- a/src/WorldStorage/WSSAnvil.cpp
+++ b/src/WorldStorage/WSSAnvil.cpp
@@ -32,11 +32,15 @@
#include "../Mobs/IncludeAllMonsters.h"
#include "../Entities/Boat.h"
+#include "../Entities/EnderCrystal.h"
#include "../Entities/FallingBlock.h"
#include "../Entities/Minecart.h"
#include "../Entities/Pickup.h"
#include "../Entities/ProjectileEntity.h"
#include "../Entities/TNTEntity.h"
+#include "../Entities/ExpOrb.h"
+#include "../Entities/HangingEntity.h"
+#include "../Entities/ItemFrame.h"
@@ -366,6 +370,7 @@ bool cWSSAnvil::LoadChunkFromNBT(const cChunkCoords & a_Chunk, const cParsedNBT
{
case E_BLOCK_AIR:
case E_BLOCK_LEAVES:
+ case E_BLOCK_NEW_LEAVES:
{
// nothing needed
break;
@@ -1053,6 +1058,10 @@ void cWSSAnvil::LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a
{
LoadBoatFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
}
+ else if (strncmp(a_IDTag, "EnderCrystal", a_IDTagLength) == 0)
+ {
+ LoadEnderCrystalFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
+ }
else if (strncmp(a_IDTag, "FallingBlock", a_IDTagLength) == 0)
{
LoadFallingBlockFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
@@ -1098,6 +1107,18 @@ void cWSSAnvil::LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a
{
LoadPickupFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
}
+ else if (strncmp(a_IDTag, "PrimedTnt", a_IDTagLength) == 0)
+ {
+ LoadTNTFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
+ }
+ else if (strncmp(a_IDTag, "XPOrb", a_IDTagLength) == 0)
+ {
+ LoadExpOrbFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
+ }
+ else if (strncmp(a_IDTag, "ItemFrame", a_IDTagLength) == 0)
+ {
+ LoadItemFrameFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
+ }
else if (strncmp(a_IDTag, "Arrow", a_IDTagLength) == 0)
{
LoadArrowFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
@@ -1222,7 +1243,7 @@ void cWSSAnvil::LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a
{
LoadWitchFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
}
- else if (strncmp(a_IDTag, "Wither", a_IDTagLength) == 0)
+ else if (strncmp(a_IDTag, "WitherBoss", a_IDTagLength) == 0)
{
LoadWitherFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
}
@@ -1238,10 +1259,6 @@ void cWSSAnvil::LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a
{
LoadPigZombieFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
}
- else if (strncmp(a_IDTag, "PrimedTnt", a_IDTagLength) == 0)
- {
- LoadTNTFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
- }
// TODO: other entities
}
@@ -1263,6 +1280,20 @@ void cWSSAnvil::LoadBoatFromNBT(cEntityList & a_Entities, const cParsedNBT & a_N
+void cWSSAnvil::LoadEnderCrystalFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
+{
+ std::auto_ptr EnderCrystal(new cEnderCrystal(0, 0, 0));
+ if (!LoadEntityBaseFromNBT(*EnderCrystal.get(), a_NBT, a_TagIdx))
+ {
+ return;
+ }
+ a_Entities.push_back(EnderCrystal.release());
+}
+
+
+
+
+
void cWSSAnvil::LoadFallingBlockFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
{
int TypeIdx = a_NBT.FindChildByName(a_TagIdx, "TileID");
@@ -1384,6 +1415,7 @@ void cWSSAnvil::LoadMinecartHFromNBT(cEntityList & a_Entities, const cParsedNBT
void cWSSAnvil::LoadPickupFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
{
+ // Load item:
int ItemTag = a_NBT.FindChildByName(a_TagIdx, "Item");
if ((ItemTag < 0) || (a_NBT.GetType(ItemTag) != TAG_Compound))
{
@@ -1394,11 +1426,27 @@ void cWSSAnvil::LoadPickupFromNBT(cEntityList & a_Entities, const cParsedNBT & a
{
return;
}
+
std::auto_ptr Pickup(new cPickup(0, 0, 0, Item, false)); // Pickup delay doesn't matter, just say false
if (!LoadEntityBaseFromNBT(*Pickup.get(), a_NBT, a_TagIdx))
{
return;
}
+
+ // Load health:
+ int Health = a_NBT.FindChildByName(a_TagIdx, "Health");
+ if (Health > 0)
+ {
+ Pickup->SetHealth((int) (a_NBT.GetShort(Health) & 0xFF));
+ }
+
+ // Load age:
+ int Age = a_NBT.FindChildByName(a_TagIdx, "Age");
+ if (Age > 0)
+ {
+ Pickup->SetAge(a_NBT.GetShort(Age));
+ }
+
a_Entities.push_back(Pickup.release());
}
@@ -1406,6 +1454,148 @@ void cWSSAnvil::LoadPickupFromNBT(cEntityList & a_Entities, const cParsedNBT & a
+void cWSSAnvil::LoadTNTFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
+{
+ std::auto_ptr TNT(new cTNTEntity(0.0, 0.0, 0.0, 0));
+ if (!LoadEntityBaseFromNBT(*TNT.get(), a_NBT, a_TagIdx))
+ {
+ return;
+ }
+
+ // Load Fuse Ticks:
+ int FuseTicks = a_NBT.FindChildByName(a_TagIdx, "Fuse");
+ if (FuseTicks > 0)
+ {
+ TNT->SetFuseTicks((int) a_NBT.GetByte(FuseTicks));
+ }
+
+ a_Entities.push_back(TNT.release());
+}
+
+
+
+
+
+void cWSSAnvil::LoadExpOrbFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
+{
+ std::auto_ptr ExpOrb(new cExpOrb(0.0, 0.0, 0.0, 0));
+ if (!LoadEntityBaseFromNBT(*ExpOrb.get(), a_NBT, a_TagIdx))
+ {
+ return;
+ }
+
+ // Load Health:
+ int Health = a_NBT.FindChildByName(a_TagIdx, "Health");
+ if (Health > 0)
+ {
+ ExpOrb->SetHealth((int) (a_NBT.GetShort(Health) & 0xFF));
+ }
+
+ // Load Age:
+ int Age = a_NBT.FindChildByName(a_TagIdx, "Age");
+ if (Age > 0)
+ {
+ ExpOrb->SetAge(a_NBT.GetShort(Age));
+ }
+
+ // Load Reward (Value):
+ int Reward = a_NBT.FindChildByName(a_TagIdx, "Value");
+ if (Reward > 0)
+ {
+ ExpOrb->SetReward(a_NBT.GetShort(Reward));
+ }
+
+ a_Entities.push_back(ExpOrb.release());
+}
+
+
+
+
+
+void cWSSAnvil::LoadHangingFromNBT(cHangingEntity & a_Hanging, const cParsedNBT & a_NBT, int a_TagIdx)
+{
+ int Direction = a_NBT.FindChildByName(a_TagIdx, "Direction");
+ if (Direction > 0)
+ {
+ Direction = (int)a_NBT.GetByte(Direction);
+ if ((Direction < 0) || (Direction > 5))
+ {
+ a_Hanging.SetDirection(BLOCK_FACE_NORTH);
+ }
+ else
+ {
+ a_Hanging.SetDirection(static_cast(Direction));
+ }
+ }
+ else
+ {
+ Direction = a_NBT.FindChildByName(a_TagIdx, "Dir");
+ if (Direction > 0)
+ {
+ switch ((int)a_NBT.GetByte(Direction))
+ {
+ case 0: a_Hanging.SetDirection(BLOCK_FACE_NORTH); break;
+ case 1: a_Hanging.SetDirection(BLOCK_FACE_TOP); break;
+ case 2: a_Hanging.SetDirection(BLOCK_FACE_BOTTOM); break;
+ case 3: a_Hanging.SetDirection(BLOCK_FACE_SOUTH); break;
+ }
+ }
+ }
+
+ int TileX = a_NBT.FindChildByName(a_TagIdx, "TileX");
+ int TileY = a_NBT.FindChildByName(a_TagIdx, "TileY");
+ int TileZ = a_NBT.FindChildByName(a_TagIdx, "TileZ");
+ if ((TileX > 0) && (TileY > 0) && (TileZ > 0))
+ {
+ a_Hanging.SetPosition(
+ (double)a_NBT.GetInt(TileX),
+ (double)a_NBT.GetInt(TileY),
+ (double)a_NBT.GetInt(TileZ)
+ );
+ }
+}
+
+
+
+
+
+void cWSSAnvil::LoadItemFrameFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
+{
+ // Load item:
+ int ItemTag = a_NBT.FindChildByName(a_TagIdx, "Item");
+ if ((ItemTag < 0) || (a_NBT.GetType(ItemTag) != TAG_Compound))
+ {
+ return;
+ }
+ cItem Item;
+ if (!LoadItemFromNBT(Item, a_NBT, ItemTag))
+ {
+ return;
+ }
+
+ std::auto_ptr ItemFrame(new cItemFrame(BLOCK_FACE_NONE, 0.0, 0.0, 0.0));
+ if (!LoadEntityBaseFromNBT(*ItemFrame.get(), a_NBT, a_TagIdx))
+ {
+ return;
+ }
+ ItemFrame->SetItem(Item);
+
+ LoadHangingFromNBT(*ItemFrame.get(), a_NBT, a_TagIdx);
+
+ // Load Rotation:
+ int Rotation = a_NBT.FindChildByName(a_TagIdx, "ItemRotation");
+ if (Rotation > 0)
+ {
+ ItemFrame->SetRotation((Byte)a_NBT.GetByte(Rotation));
+ }
+
+ a_Entities.push_back(ItemFrame.release());
+}
+
+
+
+
+
void cWSSAnvil::LoadArrowFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
{
std::auto_ptr Arrow(new cArrowEntity(NULL, 0, 0, 0, Vector3d(0, 0, 0)));
@@ -2079,6 +2269,12 @@ void cWSSAnvil::LoadWitherFromNBT(cEntityList & a_Entities, const cParsedNBT & a
return;
}
+ int CurrLine = a_NBT.FindChildByName(a_TagIdx, "Invul");
+ if (CurrLine > 0)
+ {
+ Monster->SetNumInvulnerableTicks(a_NBT.GetInt(CurrLine));
+ }
+
a_Entities.push_back(Monster.release());
}
@@ -2178,28 +2374,6 @@ void cWSSAnvil::LoadPigZombieFromNBT(cEntityList & a_Entities, const cParsedNBT
-void cWSSAnvil::LoadTNTFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
-{
- std::auto_ptr TNT(new cTNTEntity(0.0, 0.0, 0.0, 0));
- if (!LoadEntityBaseFromNBT(*TNT.get(), a_NBT, a_TagIdx))
- {
- return;
- }
-
- // Load Fuse Ticks:
- int FuseTicks = a_NBT.FindChildByName(a_TagIdx, "Fuse");
- if (FuseTicks > 0)
- {
- TNT->SetFuseTicks((int) a_NBT.GetByte(FuseTicks));
- }
-
- a_Entities.push_back(TNT.release());
-}
-
-
-
-
-
bool cWSSAnvil::LoadEntityBaseFromNBT(cEntity & a_Entity, const cParsedNBT & a_NBT, int a_TagIdx)
{
double Pos[3];
diff --git a/src/WorldStorage/WSSAnvil.h b/src/WorldStorage/WSSAnvil.h
index fe93d16c3..1773ee882 100644
--- a/src/WorldStorage/WSSAnvil.h
+++ b/src/WorldStorage/WSSAnvil.h
@@ -20,6 +20,7 @@
class cItemGrid;
class cProjectileEntity;
+class cHangingEntity;
@@ -147,8 +148,13 @@ protected:
void LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_EntityTagIdx, const char * a_IDTag, int a_IDTagLength);
void LoadBoatFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
+ void LoadEnderCrystalFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
void LoadFallingBlockFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
void LoadPickupFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
+ void LoadTNTFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
+ void LoadExpOrbFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
+ void LoadHangingFromNBT (cHangingEntity & a_Hanging,const cParsedNBT & a_NBT, int a_TagIdx);
+ void LoadItemFrameFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
void LoadMinecartRFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
void LoadMinecartCFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
@@ -192,7 +198,6 @@ protected:
void LoadWolfFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
void LoadZombieFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
void LoadPigZombieFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
- void LoadTNTFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
/// Loads entity common data from the NBT compound; returns true if successful
bool LoadEntityBaseFromNBT(cEntity & a_Entity, const cParsedNBT & a_NBT, int a_TagIdx);
diff --git a/src/main.cpp b/src/main.cpp
index 2ae8a413b..68eea7f4d 100644
--- a/src/main.cpp
+++ b/src/main.cpp
@@ -72,7 +72,6 @@ void NonCtrlHandler(int a_Signal)
LOGERROR(" D: | MCServer has encountered an error and needs to close");
LOGERROR("Details | SIGABRT: Server self-terminated due to an internal fault");
exit(EXIT_FAILURE);
- break;
}
case SIGINT:
case SIGTERM:
About ZeroBrane Studio